\r\n */\r\nfunction mergeDeep(...sources) {\r\n const target = {};\r\n if (!sources.length) {\r\n return target;\r\n }\r\n while (sources.length > 0) {\r\n const source = sources.shift();\r\n if (isObject(source)) {\r\n for (const key in source) {\r\n if (isObject(source[key])) {\r\n target[key] = mergeDeep(target[key], source[key]);\r\n }\r\n else {\r\n Object.assign(target, { [key]: source[key] });\r\n }\r\n }\r\n }\r\n }\r\n return target;\r\n}\r\nfunction animate(start, duration, callback) {\r\n let endTime;\r\n requestAnimationFrame(timestamp => (endTime = timestamp + duration));\r\n const calculate = () => {\r\n requestAnimationFrame(timestamp => {\r\n const runtime = timestamp - endTime;\r\n const progress = Math.min(runtime / duration, 1) + start;\r\n if (runtime < duration) {\r\n if (callback(+(100 * progress).toFixed(2), progress)) {\r\n calculate();\r\n }\r\n }\r\n });\r\n };\r\n}\n\n/**\r\n * Defines toast style depending on method name\r\n * @param target any\r\n * @param propertyKey SnotifyType\r\n * @param descriptor PropertyDescriptor\r\n * @returns value: ((...args: any[]) => any)\r\n */\r\nfunction SetToastType(target, propertyKey, descriptor) {\r\n return {\r\n value(...args) {\r\n args[0].config = Object.assign(Object.assign({}, args[0].config), { type: propertyKey });\r\n return descriptor.value.apply(this, args);\r\n }\r\n };\r\n}\n\n// @TODO remove method in observable way\r\n/**\r\n * Toast main model\r\n */\r\nclass SnotifyToast {\r\n constructor(id, title, body, config) {\r\n this.id = id;\r\n this.title = title;\r\n this.body = body;\r\n this.config = config;\r\n /**\r\n * Emits SnotifyEvent\r\n */\r\n this.eventEmitter = new Subject();\r\n /**\r\n * Holds all subscribers because we need to unsubscribe from all before toast get destroyed\r\n */\r\n this.eventsHolder = [];\r\n if (this.config.type === SnotifyStyle.prompt) {\r\n this.value = '';\r\n }\r\n this.on('hidden', () => {\r\n this.eventsHolder.forEach((subscription) => {\r\n subscription.unsubscribe();\r\n });\r\n });\r\n }\r\n /**\r\n * Subscribe to toast events\r\n * @returns this\r\n * @param event SnotifyEvent\r\n * @param action (toast: this) => void\r\n */\r\n on(event, action) {\r\n this.eventsHolder.push(this.eventEmitter.subscribe((e) => {\r\n if (e === event) {\r\n action(this);\r\n }\r\n }));\r\n return this;\r\n }\r\n /**\r\n * Tests if a toast equals this toast.\r\n * @returns boolean true then equals else false.\r\n * @param toast SnotifyToast\r\n */\r\n equals(toast) {\r\n return this.body === toast.body && this.title === toast.title && this.config.type === toast.config.type;\r\n }\r\n}\n\n/**\r\n * SnotifyService - create, remove, config toasts\r\n */\r\nlet SnotifyService = \r\n// tslint:disable:unified-signatures\r\nclass SnotifyService {\r\n constructor(config) {\r\n this.config = config;\r\n this.emitter = new Subject();\r\n this.toastChanged = new Subject();\r\n this.toastDeleted = new Subject();\r\n this.notifications = [];\r\n }\r\n /**\r\n * emit changes in notifications array\r\n */\r\n emit() {\r\n this.emitter.next(this.notifications.slice());\r\n }\r\n /**\r\n * returns SnotifyToast object\r\n * @param id Number\r\n * @return SnotifyToast|undefined\r\n */\r\n get(id) {\r\n return this.notifications.find(toast => toast.id === id);\r\n }\r\n /**\r\n * add SnotifyToast to notifications array\r\n * @param toast SnotifyToast\r\n */\r\n add(toast) {\r\n if (this.config.global.filterDuplicates && this.containsToast(toast)) {\r\n return;\r\n }\r\n if (this.config.global.newOnTop) {\r\n this.notifications.unshift(toast);\r\n }\r\n else {\r\n this.notifications.push(toast);\r\n }\r\n this.emit();\r\n }\r\n /**\r\n * checks if the toast is in the collection.\r\n * @param inToast SnotifyToast\r\n * @returns boolean\r\n */\r\n containsToast(inToast) {\r\n return this.notifications.some(toast => toast.equals(inToast));\r\n }\r\n /**\r\n * If ID passed, emits toast animation remove, if ID & REMOVE passed, removes toast from notifications array\r\n * @param id number\r\n * @param remove boolean\r\n */\r\n remove(id, remove) {\r\n if (!id) {\r\n return this.clear();\r\n }\r\n else if (remove) {\r\n this.notifications = this.notifications.filter(toast => toast.id !== id);\r\n return this.emit();\r\n }\r\n this.toastDeleted.next(id);\r\n }\r\n /**\r\n * Clear notifications array\r\n */\r\n clear() {\r\n this.notifications = [];\r\n this.emit();\r\n }\r\n /**\r\n * Creates toast and add it to array, returns toast id\r\n * @param snotify Snotify\r\n * @return number\r\n */\r\n create(snotify) {\r\n const config = mergeDeep(this.config.toast, this.config.type[snotify.config.type], snotify.config);\r\n const toast = new SnotifyToast(uuid(), snotify.title, snotify.body, config);\r\n this.add(toast);\r\n return toast;\r\n }\r\n setDefaults(defaults) {\r\n return (this.config = mergeDeep(this.config, defaults));\r\n }\r\n /**\r\n * Transform toast arguments into Snotify object\r\n */\r\n simple(args) {\r\n return this.create(args);\r\n }\r\n /**\r\n * Transform toast arguments into Snotify object\r\n */\r\n success(args) {\r\n return this.create(args);\r\n }\r\n /**\r\n * Transform toast arguments into Snotify object\r\n */\r\n error(args) {\r\n return this.create(args);\r\n }\r\n /**\r\n * Transform toast arguments into Snotify object\r\n */\r\n info(args) {\r\n return this.create(args);\r\n }\r\n /**\r\n * Transform toast arguments into Snotify object\r\n */\r\n warning(args) {\r\n return this.create(args);\r\n }\r\n /**\r\n * Transform toast arguments into Snotify object\r\n */\r\n confirm(args) {\r\n return this.create(args);\r\n }\r\n /**\r\n * Transform toast arguments into Snotify object\r\n */\r\n prompt(args) {\r\n return this.create(args);\r\n }\r\n /**\r\n * Transform toast arguments into Snotify object\r\n */\r\n async(args) {\r\n let async;\r\n if (args.action instanceof Promise) {\r\n async = from(args.action);\r\n }\r\n else {\r\n async = args.action;\r\n }\r\n const toast = this.create(args);\r\n toast.on('mounted', () => {\r\n const subscription = async.subscribe((next) => {\r\n this.mergeToast(toast, next);\r\n }, (error) => {\r\n this.mergeToast(toast, error, SnotifyStyle.error);\r\n subscription.unsubscribe();\r\n }, () => {\r\n this.mergeToast(toast, {}, SnotifyStyle.success);\r\n subscription.unsubscribe();\r\n });\r\n });\r\n return toast;\r\n }\r\n mergeToast(toast, next, type) {\r\n if (next.body) {\r\n toast.body = next.body;\r\n }\r\n if (next.title) {\r\n toast.title = next.title;\r\n }\r\n if (type) {\r\n toast.config = mergeDeep(toast.config, this.config.global, this.config.toast[type], { type }, next.config);\r\n }\r\n else {\r\n toast.config = mergeDeep(toast.config, next.config);\r\n }\r\n if (next.html) {\r\n toast.config.html = next.html;\r\n }\r\n this.emit();\r\n this.toastChanged.next(toast);\r\n }\r\n /**\r\n * Creates empty toast with html string inside\r\n * @param html string | SafeHtml\r\n * @param config SnotifyToastConfig\r\n * @returns number\r\n */\r\n html(html, config) {\r\n return this.create({\r\n title: null,\r\n body: null,\r\n config: Object.assign(Object.assign({}, config), { html })\r\n });\r\n }\r\n};\nSnotifyService.ɵfac = function SnotifyService_Factory(t) { return new (t || SnotifyService)(ɵngcc0.ɵɵinject('SnotifyToastConfig')); };\nSnotifyService.ɵprov = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjectable({ token: SnotifyService, factory: function (t) { return SnotifyService.ɵfac(t); } });\r\nSnotifyService.ctorParameters = () => [\r\n { type: undefined, decorators: [{ type: Inject, args: ['SnotifyToastConfig',] }] }\r\n];\r\n__decorate([\r\n TransformArgument\r\n /**\r\n * Determines current toast type and collects default configuration\r\n */\r\n ,\r\n SetToastType\r\n], SnotifyService.prototype, \"simple\", null);\r\n__decorate([\r\n TransformArgument\r\n /**\r\n * Determines current toast type and collects default configuration\r\n */\r\n ,\r\n SetToastType\r\n], SnotifyService.prototype, \"success\", null);\r\n__decorate([\r\n TransformArgument\r\n /**\r\n * Determines current toast type and collects default configuration\r\n */\r\n ,\r\n SetToastType\r\n], SnotifyService.prototype, \"error\", null);\r\n__decorate([\r\n TransformArgument\r\n /**\r\n * Determines current toast type and collects default configuration\r\n */\r\n ,\r\n SetToastType\r\n], SnotifyService.prototype, \"info\", null);\r\n__decorate([\r\n TransformArgument\r\n /**\r\n * Determines current toast type and collects default configuration\r\n */\r\n ,\r\n SetToastType\r\n], SnotifyService.prototype, \"warning\", null);\r\n__decorate([\r\n TransformArgument\r\n /**\r\n * Determines current toast type and collects default configuration\r\n */\r\n ,\r\n SetToastType\r\n], SnotifyService.prototype, \"confirm\", null);\r\n__decorate([\r\n TransformArgument\r\n /**\r\n * Determines current toast type and collects default configuration\r\n */\r\n ,\r\n SetToastType\r\n], SnotifyService.prototype, \"prompt\", null);\r\n__decorate([\r\n TransformArgument\r\n /**\r\n * Determines current toast type and collects default configuration\r\n */\r\n ,\r\n SetToastType\r\n], SnotifyService.prototype, \"async\", null);\r\nSnotifyService = __decorate([ __param(0, Inject('SnotifyToastConfig'))\r\n], SnotifyService);\n\nlet ButtonsComponent = \r\n/**\r\n * Buttons component\r\n */\r\nclass ButtonsComponent {\r\n constructor(service) {\r\n this.service = service;\r\n }\r\n /**\r\n * remove toast\r\n */\r\n remove() {\r\n this.service.remove(this.toast.id);\r\n }\r\n};\nButtonsComponent.ɵfac = function ButtonsComponent_Factory(t) { return new (t || ButtonsComponent)(ɵngcc0.ɵɵdirectiveInject(SnotifyService)); };\nButtonsComponent.ɵcmp = /*@__PURE__*/ ɵngcc0.ɵɵdefineComponent({ type: ButtonsComponent, selectors: [[\"ng-snotify-button\"]], inputs: { toast: \"toast\" }, decls: 2, vars: 1, consts: [[1, \"snotifyToast__buttons\"], [\"type\", \"button\", 3, \"ngClass\", \"click\", 4, \"ngFor\", \"ngForOf\"], [\"type\", \"button\", 3, \"ngClass\", \"click\"]], template: function ButtonsComponent_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵelementStart(0, \"div\", 0);\n ɵngcc0.ɵɵtemplate(1, ButtonsComponent_button_1_Template, 2, 4, \"button\", 1);\n ɵngcc0.ɵɵelementEnd();\n } if (rf & 2) {\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵproperty(\"ngForOf\", ctx.toast.config.buttons);\n } }, dependencies: [ɵngcc1.NgClass, ɵngcc1.NgForOf], encapsulation: 2, changeDetection: 0 });\r\nButtonsComponent.ctorParameters = () => [\r\n { type: SnotifyService }\r\n];\r\n__decorate([\r\n Input()\r\n], ButtonsComponent.prototype, \"toast\", void 0);\n\nlet PromptComponent = \r\n/**\r\n * Prompt component. Part of PROMPT type\r\n */\r\nclass PromptComponent {\r\n constructor() {\r\n /**\r\n * Is PROMPT focused\r\n */\r\n this.isPromptFocused = false;\r\n }\r\n};\nPromptComponent.ɵfac = function PromptComponent_Factory(t) { return new (t || PromptComponent)(); };\nPromptComponent.ɵcmp = /*@__PURE__*/ ɵngcc0.ɵɵdefineComponent({ type: PromptComponent, selectors: [[\"ng-snotify-prompt\"]], inputs: { toast: \"toast\" }, decls: 6, vars: 8, consts: [[1, \"snotifyToast__input\", 3, \"ngClass\"], [\"autofocus\", \"\", \"type\", \"text\", 1, \"snotifyToast__input__field\", 3, \"id\", \"input\", \"focus\", \"blur\"], [1, \"snotifyToast__input__label\", 3, \"for\"], [1, \"snotifyToast__input__labelContent\"]], template: function PromptComponent_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵelementStart(0, \"span\", 0)(1, \"input\", 1);\n ɵngcc0.ɵɵlistener(\"input\", function PromptComponent_Template_input_input_1_listener($event) { ctx.toast.value = $event.target.value; return ctx.toast.eventEmitter.next(\"input\"); })(\"focus\", function PromptComponent_Template_input_focus_1_listener() { return ctx.isPromptFocused = true; })(\"blur\", function PromptComponent_Template_input_blur_1_listener() { return ctx.isPromptFocused = !!ctx.toast.value.length; });\n ɵngcc0.ɵɵelementEnd();\n ɵngcc0.ɵɵelementStart(2, \"label\", 2)(3, \"span\", 3);\n ɵngcc0.ɵɵtext(4);\n ɵngcc0.ɵɵpipe(5, \"truncate\");\n ɵngcc0.ɵɵelementEnd()()();\n } if (rf & 2) {\n ɵngcc0.ɵɵproperty(\"ngClass\", ɵngcc0.ɵɵpureFunction1(6, _c1, ctx.isPromptFocused));\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵproperty(\"id\", ctx.toast.id);\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵproperty(\"for\", ctx.toast.id);\n ɵngcc0.ɵɵadvance(2);\n ɵngcc0.ɵɵtextInterpolate(ɵngcc0.ɵɵpipeBind1(5, 4, ctx.toast.config.placeholder));\n } }, dependencies: function () { return [ɵngcc1.NgClass, TruncatePipe]; }, encapsulation: 2, changeDetection: 0 });\r\n__decorate([\r\n Input()\r\n], PromptComponent.prototype, \"toast\", void 0);\n\n/**\r\n * Toast position\r\n */\r\nvar SnotifyPosition;\r\n(function (SnotifyPosition) {\r\n SnotifyPosition[\"leftTop\"] = \"leftTop\";\r\n SnotifyPosition[\"leftCenter\"] = \"leftCenter\";\r\n SnotifyPosition[\"leftBottom\"] = \"leftBottom\";\r\n SnotifyPosition[\"rightTop\"] = \"rightTop\";\r\n SnotifyPosition[\"rightCenter\"] = \"rightCenter\";\r\n SnotifyPosition[\"rightBottom\"] = \"rightBottom\";\r\n SnotifyPosition[\"centerTop\"] = \"centerTop\";\r\n SnotifyPosition[\"centerCenter\"] = \"centerCenter\";\r\n SnotifyPosition[\"centerBottom\"] = \"centerBottom\";\r\n})(SnotifyPosition || (SnotifyPosition = {}));\n\nlet SnotifyComponent = class SnotifyComponent {\r\n constructor(service) {\r\n this.service = service;\r\n /**\r\n * Backdrop Opacity\r\n */\r\n this.backdrop = -1;\r\n }\r\n /**\r\n * Init base options. Subscribe to options, lifecycle change\r\n */\r\n ngOnInit() {\r\n this.emitter = this.service.emitter.subscribe((toasts) => {\r\n if (this.service.config.global.newOnTop) {\r\n this.dockSizeA = -this.service.config.global.maxOnScreen;\r\n this.dockSizeB = undefined;\r\n this.blockSizeA = -this.service.config.global.maxAtPosition;\r\n this.blockSizeB = undefined;\r\n this.withBackdrop = toasts.filter(toast => toast.config.backdrop >= 0);\r\n }\r\n else {\r\n this.dockSizeA = 0;\r\n this.dockSizeB = this.service.config.global.maxOnScreen;\r\n this.blockSizeA = 0;\r\n this.blockSizeB = this.service.config.global.maxAtPosition;\r\n this.withBackdrop = toasts.filter(toast => toast.config.backdrop >= 0).reverse();\r\n }\r\n this.notifications = this.splitToasts(toasts.slice(this.dockSizeA, this.dockSizeB));\r\n this.stateChanged('mounted');\r\n });\r\n }\r\n // TODO: fix backdrop if more than one toast called in a row\r\n /**\r\n * Changes the backdrop opacity\r\n * @param event SnotifyEvent\r\n */\r\n stateChanged(event) {\r\n if (!this.withBackdrop.length) {\r\n if (this.backdrop >= 0) {\r\n this.backdrop = -1;\r\n }\r\n return;\r\n }\r\n switch (event) {\r\n case 'mounted':\r\n if (this.backdrop < 0) {\r\n this.backdrop = 0;\r\n }\r\n break;\r\n case 'beforeShow':\r\n this.backdrop = this.withBackdrop[this.withBackdrop.length - 1].config.backdrop;\r\n break;\r\n case 'beforeHide':\r\n if (this.withBackdrop.length === 1) {\r\n this.backdrop = 0;\r\n }\r\n break;\r\n case 'hidden':\r\n if (this.withBackdrop.length === 1) {\r\n this.backdrop = -1;\r\n }\r\n break;\r\n }\r\n }\r\n /**\r\n * Split toasts toasts into different objects\r\n * @param toasts SnotifyToast[]\r\n * @returns SnotifyNotifications\r\n */\r\n splitToasts(toasts) {\r\n const result = {};\r\n for (const property in SnotifyPosition) {\r\n if (SnotifyPosition.hasOwnProperty(property)) {\r\n result[SnotifyPosition[property]] = [];\r\n }\r\n }\r\n toasts.forEach((toast) => {\r\n result[toast.config.position].push(toast);\r\n });\r\n return result;\r\n }\r\n /**\r\n * Unsubscribe subscriptions\r\n */\r\n ngOnDestroy() {\r\n this.emitter.unsubscribe();\r\n }\r\n};\nSnotifyComponent.ɵfac = function SnotifyComponent_Factory(t) { return new (t || SnotifyComponent)(ɵngcc0.ɵɵdirectiveInject(SnotifyService)); };\nSnotifyComponent.ɵcmp = /*@__PURE__*/ ɵngcc0.ɵɵdefineComponent({ type: SnotifyComponent, selectors: [[\"ng-snotify\"]], decls: 3, vars: 4, consts: [[\"class\", \"snotify-backdrop\", 3, \"opacity\", 4, \"ngIf\"], [3, \"class\", 4, \"ngFor\", \"ngForOf\"], [1, \"snotify-backdrop\"], [3, \"toast\", \"stateChanged\", 4, \"ngFor\", \"ngForOf\"], [3, \"toast\", \"stateChanged\"]], template: function SnotifyComponent_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵtemplate(0, SnotifyComponent_div_0_Template, 1, 2, \"div\", 0);\n ɵngcc0.ɵɵtemplate(1, SnotifyComponent_div_1_Template, 3, 8, \"div\", 1);\n ɵngcc0.ɵɵpipe(2, \"keys\");\n } if (rf & 2) {\n ɵngcc0.ɵɵproperty(\"ngIf\", ctx.backdrop >= 0);\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵproperty(\"ngForOf\", ɵngcc0.ɵɵpipeBind1(2, 2, ctx.notifications));\n } }, dependencies: function () { return [ɵngcc1.NgForOf, ɵngcc1.NgIf, ToastComponent, ɵngcc1.SlicePipe, KeysPipe]; }, encapsulation: 2 });\r\nSnotifyComponent.ctorParameters = () => [\r\n { type: SnotifyService }\r\n];\n\nlet ToastComponent = class ToastComponent {\r\n constructor(service) {\r\n this.service = service;\r\n this.stateChanged = new EventEmitter();\r\n /**\r\n * Toast state\r\n */\r\n this.state = {\r\n paused: false,\r\n progress: 0,\r\n animation: '',\r\n isDestroying: false,\r\n promptType: SnotifyStyle.prompt\r\n };\r\n }\r\n // Lifecycles\r\n /**\r\n * Init base options. Subscribe to toast changed, toast deleted\r\n */\r\n ngOnInit() {\r\n this.toastChangedSubscription = this.service.toastChanged.subscribe((toast) => {\r\n if (this.toast.id === toast.id) {\r\n this.initToast();\r\n }\r\n });\r\n this.toastDeletedSubscription = this.service.toastDeleted.subscribe(id => {\r\n if (this.toast.id === id) {\r\n this.onRemove();\r\n }\r\n });\r\n if (!this.toast.config.timeout) {\r\n this.toast.config.showProgressBar = false;\r\n }\r\n this.toast.eventEmitter.next('mounted');\r\n this.state.animation = 'snotifyToast--in';\r\n }\r\n ngAfterContentInit() {\r\n setTimeout(() => {\r\n this.stateChanged.emit('beforeShow');\r\n this.toast.eventEmitter.next('beforeShow');\r\n this.state.animation = this.toast.config.animation.enter;\r\n }, this.service.config.toast.animation.time / 5); // time to show toast push animation (snotifyToast--in)\r\n }\r\n /**\r\n * Unsubscribe subscriptions\r\n */\r\n ngOnDestroy() {\r\n cancelAnimationFrame(this.animationFrame);\r\n this.toast.eventEmitter.next('destroyed');\r\n this.toastChangedSubscription.unsubscribe();\r\n this.toastDeletedSubscription.unsubscribe();\r\n }\r\n /*\r\n Event hooks\r\n */\r\n /**\r\n * Trigger OnClick lifecycle\r\n */\r\n onClick() {\r\n this.toast.eventEmitter.next('click');\r\n if (this.toast.config.closeOnClick) {\r\n this.service.remove(this.toast.id);\r\n }\r\n }\r\n /**\r\n * Trigger beforeDestroy lifecycle. Removes toast\r\n */\r\n onRemove() {\r\n this.state.isDestroying = true;\r\n this.toast.eventEmitter.next('beforeHide');\r\n this.stateChanged.emit('beforeHide');\r\n this.state.animation = this.toast.config.animation.exit;\r\n setTimeout(() => {\r\n this.stateChanged.emit('hidden');\r\n this.state.animation = 'snotifyToast--out';\r\n this.toast.eventEmitter.next('hidden');\r\n setTimeout(() => this.service.remove(this.toast.id, true), this.toast.config.animation.time / 2);\r\n }, this.toast.config.animation.time / 2);\r\n }\r\n /**\r\n * Trigger onHoverEnter lifecycle\r\n */\r\n onMouseEnter() {\r\n this.toast.eventEmitter.next('mouseenter');\r\n if (this.toast.config.pauseOnHover) {\r\n this.state.paused = true;\r\n }\r\n }\r\n /**\r\n * Trigger onHoverLeave lifecycle\r\n */\r\n onMouseLeave() {\r\n if (this.toast.config.pauseOnHover && this.toast.config.timeout) {\r\n this.state.paused = false;\r\n this.startTimeout(this.toast.config.timeout * this.state.progress);\r\n }\r\n this.toast.eventEmitter.next('mouseleave');\r\n }\r\n /**\r\n * Remove toast completely after animation\r\n */\r\n onExitTransitionEnd() {\r\n if (this.state.isDestroying) {\r\n return;\r\n }\r\n this.initToast();\r\n this.toast.eventEmitter.next('shown');\r\n }\r\n /*\r\n Common\r\n */\r\n /**\r\n * Initialize base toast config\r\n *\r\n */\r\n initToast() {\r\n if (this.toast.config.timeout > 0) {\r\n this.startTimeout(0);\r\n }\r\n }\r\n /**\r\n * Start progress bar\r\n * @param startTime number\r\n */\r\n startTimeout(startTime = 0) {\r\n const start = performance.now();\r\n const calculate = () => {\r\n this.animationFrame = requestAnimationFrame(timestamp => {\r\n const runtime = timestamp + startTime - start;\r\n const progress = Math.min(runtime / this.toast.config.timeout, 1);\r\n if (this.state.paused) {\r\n cancelAnimationFrame(this.animationFrame);\r\n }\r\n else if (runtime < this.toast.config.timeout) {\r\n this.state.progress = progress;\r\n calculate();\r\n }\r\n else {\r\n this.state.progress = 1;\r\n cancelAnimationFrame(this.animationFrame);\r\n this.service.remove(this.toast.id);\r\n }\r\n });\r\n };\r\n calculate();\r\n }\r\n};\nToastComponent.ɵfac = function ToastComponent_Factory(t) { return new (t || ToastComponent)(ɵngcc0.ɵɵdirectiveInject(SnotifyService)); };\nToastComponent.ɵcmp = /*@__PURE__*/ ɵngcc0.ɵɵdefineComponent({ type: ToastComponent, selectors: [[\"ng-snotify-toast\"]], inputs: { toast: \"toast\" }, outputs: { stateChanged: \"stateChanged\" }, decls: 6, vars: 18, consts: [[3, \"ngClass\", \"ngStyle\", \"animationend\", \"click\", \"mouseenter\", \"mouseleave\"], [\"class\", \"snotifyToast__progressBar\", 4, \"ngIf\"], [\"class\", \"snotifyToast__inner\", 4, \"ngIf\", \"ngIfElse\"], [\"toastHTML\", \"\"], [3, \"toast\", 4, \"ngIf\"], [1, \"snotifyToast__progressBar\"], [1, \"snotifyToast__progressBar__percentage\", 3, \"ngStyle\"], [1, \"snotifyToast__inner\"], [\"class\", \"snotifyToast__title\", 4, \"ngIf\"], [\"class\", \"snotifyToast__body\", 4, \"ngIf\"], [3, \"ngClass\", 4, \"ngIf\", \"ngIfElse\"], [\"elseBlock\", \"\"], [1, \"snotifyToast__title\"], [1, \"snotifyToast__body\"], [3, \"toast\"], [3, \"ngClass\"], [1, \"snotify-icon\", 3, \"src\"], [1, \"snotifyToast__inner\", 3, \"innerHTML\"]], template: function ToastComponent_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵelementStart(0, \"div\", 0);\n ɵngcc0.ɵɵlistener(\"animationend\", function ToastComponent_Template_div_animationend_0_listener() { return ctx.onExitTransitionEnd(); })(\"click\", function ToastComponent_Template_div_click_0_listener() { return ctx.onClick(); })(\"mouseenter\", function ToastComponent_Template_div_mouseenter_0_listener() { return ctx.onMouseEnter(); })(\"mouseleave\", function ToastComponent_Template_div_mouseleave_0_listener() { return ctx.onMouseLeave(); });\n ɵngcc0.ɵɵtemplate(1, ToastComponent_div_1_Template, 2, 3, \"div\", 1);\n ɵngcc0.ɵɵtemplate(2, ToastComponent_div_2_Template, 7, 5, \"div\", 2);\n ɵngcc0.ɵɵtemplate(3, ToastComponent_ng_template_3_Template, 1, 1, \"ng-template\", null, 3, ɵngcc0.ɵɵtemplateRefExtractor);\n ɵngcc0.ɵɵtemplate(5, ToastComponent_ng_snotify_button_5_Template, 1, 1, \"ng-snotify-button\", 4);\n ɵngcc0.ɵɵelementEnd();\n } if (rf & 2) {\n const _r2 = ɵngcc0.ɵɵreference(4);\n ɵngcc0.ɵɵproperty(\"ngClass\", ɵngcc0.ɵɵpureFunction3(9, _c4, \"snotify-\" + ctx.toast.config.type, ctx.state.animation, ctx.toast.valid === undefined ? \"\" : ctx.toast.valid ? \"snotifyToast--valid\" : \"snotifyToast--invalid\"))(\"ngStyle\", ɵngcc0.ɵɵpureFunction4(13, _c5, ctx.toast.config.animation.time + \"ms\", ctx.toast.config.animation.time + \"ms\", ctx.toast.config.animation.time + \"ms\", ctx.toast.config.animation.time + \"ms\"));\n ɵngcc0.ɵɵattribute(\"role\", ctx.toast.config.type === ctx.state.promptType ? \"dialog\" : \"alert\")(\"aria-labelledby\", \"snotify_\" + ctx.toast.id)(\"aria-modal\", ctx.toast.config.type === ctx.state.promptType);\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵproperty(\"ngIf\", ctx.toast.config.showProgressBar);\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵproperty(\"ngIf\", !ctx.toast.config.html)(\"ngIfElse\", _r2);\n ɵngcc0.ɵɵadvance(3);\n ɵngcc0.ɵɵproperty(\"ngIf\", ctx.toast.config.buttons);\n } }, dependencies: function () { return [ɵngcc1.NgClass, ɵngcc1.NgIf, ɵngcc1.NgStyle, ButtonsComponent, PromptComponent, TruncatePipe]; }, encapsulation: 2 });\r\nToastComponent.ctorParameters = () => [\r\n { type: SnotifyService }\r\n];\r\n__decorate([\r\n Input()\r\n], ToastComponent.prototype, \"toast\", void 0);\r\n__decorate([\r\n Output()\r\n], ToastComponent.prototype, \"stateChanged\", void 0);\n\nlet KeysPipe = \r\n/**\r\n * Extract object keys pipe\r\n */\r\nclass KeysPipe {\r\n transform(value, args = null) {\r\n if (!value) {\r\n return value;\r\n }\r\n return Object.keys(value);\r\n }\r\n};\nKeysPipe.ɵfac = function KeysPipe_Factory(t) { return new (t || KeysPipe)(); };\nKeysPipe.ɵpipe = /*@__PURE__*/ ɵngcc0.ɵɵdefinePipe({ name: \"keys\", type: KeysPipe, pure: false });\n\nlet TruncatePipe = \r\n/**\r\n * Truncate toast text pipe\r\n */\r\nclass TruncatePipe {\r\n transform(value, ...args) {\r\n let limit = 40;\r\n let trail = '...';\r\n if (args.length > 0) {\r\n limit = args.length > 0 ? parseInt(args[0], 10) : limit;\r\n trail = args.length > 1 ? args[1] : trail;\r\n }\r\n return value.length > limit ? value.substring(0, limit) + trail : value;\r\n }\r\n};\nTruncatePipe.ɵfac = function TruncatePipe_Factory(t) { return new (t || TruncatePipe)(); };\nTruncatePipe.ɵpipe = /*@__PURE__*/ ɵngcc0.ɵɵdefinePipe({ name: \"truncate\", type: TruncatePipe, pure: true });\n\nvar SnotifyModule_1;\r\nlet SnotifyModule = SnotifyModule_1 = class SnotifyModule {\r\n static forRoot() {\r\n return {\r\n ngModule: SnotifyModule_1,\r\n providers: [SnotifyService]\r\n };\r\n }\r\n};\nSnotifyModule.ɵfac = function SnotifyModule_Factory(t) { return new (t || SnotifyModule)(); };\nSnotifyModule.ɵmod = /*@__PURE__*/ ɵngcc0.ɵɵdefineNgModule({ type: SnotifyModule });\nSnotifyModule.ɵinj = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjector({ imports: [CommonModule] });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(SnotifyService, [{\n type: Injectable\n }], function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: ['SnotifyToastConfig']\n }] }]; }, null); })();\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(ButtonsComponent, [{\n type: Component,\n args: [{\n selector: 'ng-snotify-button',\n template: \"\\r\\n \\r\\n {{ button.text }}\\r\\n \\r\\n
\\r\\n\",\n changeDetection: ChangeDetectionStrategy.OnPush,\n encapsulation: ViewEncapsulation.None\n }]\n }], function () { return [{ type: SnotifyService }]; }, { toast: [{\n type: Input\n }] }); })();\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(PromptComponent, [{\n type: Component,\n args: [{\n selector: 'ng-snotify-prompt',\n template: \"\\r\\n \\r\\n \\r\\n {{ toast.config.placeholder | truncate }} \\r\\n \\r\\n \\r\\n\",\n changeDetection: ChangeDetectionStrategy.OnPush,\n encapsulation: ViewEncapsulation.None\n }]\n }], function () { return []; }, { toast: [{\n type: Input\n }] }); })();\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(SnotifyComponent, [{\n type: Component,\n args: [{\n selector: 'ng-snotify',\n template: \"= 0\\\" [style.opacity]=\\\"backdrop\\\">
\\r\\n\\r\\n \\r\\n \\r\\n
\\r\\n\",\n encapsulation: ViewEncapsulation.None\n }]\n }], function () { return [{ type: SnotifyService }]; }, null); })();\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(ToastComponent, [{\n type: Component,\n args: [{\n selector: 'ng-snotify-toast',\n template: \"\\r\\n
\\r\\n \\r\\n
\\r\\n
\\r\\n
\\r\\n {{ toast.title | truncate: toast.config.titleMaxLength }}\\r\\n
\\r\\n
{{ toast.body | truncate: toast.config.bodyMaxLength }}
\\r\\n
\\r\\n
\\r\\n
\\r\\n \\r\\n \\r\\n
\\r\\n
\\r\\n
\\r\\n \\r\\n
\\r\\n
\\r\\n\",\n encapsulation: ViewEncapsulation.None\n }]\n }], function () { return [{ type: SnotifyService }]; }, { stateChanged: [{\n type: Output\n }], toast: [{\n type: Input\n }] }); })();\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(KeysPipe, [{\n type: Pipe,\n args: [{\n name: 'keys',\n pure: false\n }]\n }], null, null); })();\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(TruncatePipe, [{\n type: Pipe,\n args: [{\n name: 'truncate'\n }]\n }], null, null); })();\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(SnotifyModule, [{\n type: NgModule,\n args: [{\n imports: [CommonModule],\n declarations: [SnotifyComponent, ToastComponent, TruncatePipe, ButtonsComponent, PromptComponent, KeysPipe],\n exports: [SnotifyComponent, TruncatePipe, KeysPipe]\n }]\n }], null, null); })();\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(SnotifyModule, { declarations: function () { return [SnotifyComponent, ToastComponent, TruncatePipe, ButtonsComponent, PromptComponent, KeysPipe]; }, imports: function () { return [CommonModule]; }, exports: function () { return [SnotifyComponent, TruncatePipe, KeysPipe]; } }); })();\n\n/**\r\n * Snotify default configuration object\r\n */\r\nconst ToastDefaults = {\r\n global: {\r\n newOnTop: true,\r\n maxOnScreen: 8,\r\n maxAtPosition: 8,\r\n filterDuplicates: false\r\n },\r\n toast: {\r\n type: SnotifyStyle.simple,\r\n showProgressBar: true,\r\n timeout: 2000,\r\n closeOnClick: true,\r\n pauseOnHover: true,\r\n bodyMaxLength: 150,\r\n titleMaxLength: 16,\r\n backdrop: -1,\r\n icon: null,\r\n iconClass: null,\r\n html: null,\r\n position: SnotifyPosition.rightBottom,\r\n animation: { enter: 'fadeIn', exit: 'fadeOut', time: 400 }\r\n },\r\n type: {\r\n [SnotifyStyle.prompt]: {\r\n timeout: 0,\r\n closeOnClick: false,\r\n buttons: [\r\n { text: 'Ok', action: null, bold: true },\r\n { text: 'Cancel', action: null, bold: false }\r\n ],\r\n placeholder: 'Enter answer here...',\r\n type: SnotifyStyle.prompt\r\n },\r\n [SnotifyStyle.confirm]: {\r\n timeout: 0,\r\n closeOnClick: false,\r\n buttons: [\r\n { text: 'Ok', action: null, bold: true },\r\n { text: 'Cancel', action: null, bold: false }\r\n ],\r\n type: SnotifyStyle.confirm\r\n },\r\n [SnotifyStyle.simple]: {\r\n type: SnotifyStyle.simple\r\n },\r\n [SnotifyStyle.success]: {\r\n type: SnotifyStyle.success\r\n },\r\n [SnotifyStyle.error]: {\r\n type: SnotifyStyle.error\r\n },\r\n [SnotifyStyle.warning]: {\r\n type: SnotifyStyle.warning\r\n },\r\n [SnotifyStyle.info]: {\r\n type: SnotifyStyle.info\r\n },\r\n [SnotifyStyle.async]: {\r\n pauseOnHover: false,\r\n closeOnClick: false,\r\n timeout: 0,\r\n showProgressBar: false,\r\n type: SnotifyStyle.async\r\n }\r\n }\r\n};\n\n/*\r\n * Public API Surface of ng-snotify\r\n */\n\n/**\r\n * Generated bundle index. Do not edit.\r\n */\n\nexport { ButtonsComponent, KeysPipe, PromptComponent, SnotifyComponent, SnotifyModule, SnotifyPosition, SnotifyService, SnotifyStyle, SnotifyToast, ToastComponent, ToastDefaults, TruncatePipe, SnotifyComponent as ɵa, SnotifyService as ɵb, TransformArgument as ɵd, SetToastType as ɵe, ToastComponent as ɵf, TruncatePipe as ɵg, ButtonsComponent as ɵh, PromptComponent as ɵi, KeysPipe as ɵj };\n\n","import * as dragulaExpt from 'dragula';\nimport dragulaExpt__default, { } from 'dragula';\nimport { Injectable, Optional, Directive, Input, Output, ElementRef, EventEmitter, NgModule } from '@angular/core';\nimport { Subject, Subscription } from 'rxjs';\nimport { filter, map } from 'rxjs/operators';\n\n/**\n * @fileoverview added by tsickle\n * @suppress {checkTypes} checked by tsc\n */\nimport * as ɵngcc0 from '@angular/core';\nclass Group {\n /**\n * @param {?} name\n * @param {?} drake\n * @param {?} options\n */\n constructor(name, drake, options) {\n this.name = name;\n this.drake = drake;\n this.options = options;\n this.initEvents = false;\n }\n}\n\n/**\n * @fileoverview added by tsickle\n * @suppress {checkTypes} checked by tsc\n */\n/** @enum {string} */\nconst EventTypes = {\n Cancel: \"cancel\",\n Cloned: \"cloned\",\n Drag: \"drag\",\n DragEnd: \"dragend\",\n Drop: \"drop\",\n Out: \"out\",\n Over: \"over\",\n Remove: \"remove\",\n Shadow: \"shadow\",\n DropModel: \"dropModel\",\n RemoveModel: \"removeModel\",\n};\n/** @type {?} */\nconst AllEvents = Object.keys(EventTypes).map(k => /** @type {?} */ (EventTypes[/** @type {?} */ (k)]));\n\n/**\n * @fileoverview added by tsickle\n * @suppress {checkTypes} checked by tsc\n */\n/** @type {?} */\nconst dragula = dragulaExpt__default || dragulaExpt;\nclass DrakeFactory {\n /**\n * @param {?=} build\n */\n constructor(build = dragula) {\n this.build = build;\n }\n}\n\n/**\n * @fileoverview added by tsickle\n * @suppress {checkTypes} checked by tsc\n */\n/** @type {?} */\nconst filterEvent = (eventType, filterDragType, projector) => (input) => {\n return input.pipe(filter(({ event, name }) => {\n return event === eventType\n && (filterDragType === undefined || name === filterDragType);\n }), map(({ name, args }) => projector(name, args)));\n};\n/** @type {?} */\nconst elContainerSourceProjector = (name, [el, container, source]) => ({ name, el, container, source });\nclass DragulaService {\n /**\n * @param {?=} drakeFactory\n */\n constructor(drakeFactory = null) {\n this.drakeFactory = drakeFactory;\n this.dispatch$ = new Subject();\n this.drag = (groupName) => this.dispatch$.pipe(filterEvent(EventTypes.Drag, groupName, (name, [el, source]) => ({ name, el, source })));\n this.dragend = (groupName) => this.dispatch$.pipe(filterEvent(EventTypes.DragEnd, groupName, (name, [el]) => ({ name, el })));\n this.drop = (groupName) => this.dispatch$.pipe(filterEvent(EventTypes.Drop, groupName, (name, [el, target, source, sibling]) => {\n return { name, el, target, source, sibling };\n }));\n this.elContainerSource = (eventType) => (groupName) => this.dispatch$.pipe(filterEvent(eventType, groupName, elContainerSourceProjector));\n this.cancel = this.elContainerSource(EventTypes.Cancel);\n this.remove = this.elContainerSource(EventTypes.Remove);\n this.shadow = this.elContainerSource(EventTypes.Shadow);\n this.over = this.elContainerSource(EventTypes.Over);\n this.out = this.elContainerSource(EventTypes.Out);\n this.cloned = (groupName) => this.dispatch$.pipe(filterEvent(EventTypes.Cloned, groupName, (name, [clone, original, cloneType]) => {\n return { name, clone, original, cloneType };\n }));\n this.dropModel = (groupName) => this.dispatch$.pipe(filterEvent(EventTypes.DropModel, groupName, (name, [el, target, source, sibling, item, sourceModel, targetModel, sourceIndex, targetIndex]) => {\n return { name, el, target, source, sibling, item, sourceModel, targetModel, sourceIndex, targetIndex };\n }));\n this.removeModel = (groupName) => this.dispatch$.pipe(filterEvent(EventTypes.RemoveModel, groupName, (name, [el, container, source, item, sourceModel, sourceIndex]) => {\n return { name, el, container, source, item, sourceModel, sourceIndex };\n }));\n this.groups = {};\n if (this.drakeFactory === null) {\n this.drakeFactory = new DrakeFactory();\n }\n }\n /**\n * Public mainly for testing purposes. Prefer `createGroup()`.\n * @param {?} group\n * @return {?}\n */\n add(group) {\n /** @type {?} */\n let existingGroup = this.find(group.name);\n if (existingGroup) {\n throw new Error('Group named: \"' + group.name + '\" already exists.');\n }\n this.groups[group.name] = group;\n this.handleModels(group);\n this.setupEvents(group);\n return group;\n }\n /**\n * @param {?} name\n * @return {?}\n */\n find(name) {\n return this.groups[name];\n }\n /**\n * @param {?} name\n * @return {?}\n */\n destroy(name) {\n /** @type {?} */\n let group = this.find(name);\n if (!group) {\n return;\n }\n group.drake && group.drake.destroy();\n delete this.groups[name];\n }\n /**\n * Creates a group with the specified name and options.\n *\n * Note: formerly known as `setOptions`\n * @template T\n * @param {?} name\n * @param {?} options\n * @return {?}\n */\n createGroup(name, options) {\n return this.add(new Group(name, this.drakeFactory.build([], options), options));\n }\n /**\n * @param {?} __0\n * @return {?}\n */\n handleModels({ name, drake, options }) {\n /** @type {?} */\n let dragElm;\n /** @type {?} */\n let dragIndex;\n /** @type {?} */\n let dropIndex;\n drake.on('remove', (el, container, source) => {\n if (!drake.models) {\n return;\n }\n /** @type {?} */\n let sourceModel = drake.models[drake.containers.indexOf(source)];\n sourceModel = sourceModel.slice(0);\n /** @type {?} */\n const item = sourceModel.splice(dragIndex, 1)[0];\n // console.log('REMOVE');\n // console.log(sourceModel);\n this.dispatch$.next({\n event: EventTypes.RemoveModel,\n name,\n args: [el, container, source, item, sourceModel, dragIndex]\n });\n });\n drake.on('drag', (el, source) => {\n if (!drake.models) {\n return;\n }\n dragElm = el;\n dragIndex = this.domIndexOf(el, source);\n });\n drake.on('drop', (dropElm, target, source, sibling) => {\n if (!drake.models || !target) {\n return;\n }\n dropIndex = this.domIndexOf(dropElm, target);\n /** @type {?} */\n let sourceModel = drake.models[drake.containers.indexOf(source)];\n /** @type {?} */\n let targetModel = drake.models[drake.containers.indexOf(target)];\n /** @type {?} */\n let item;\n if (target === source) {\n sourceModel = sourceModel.slice(0);\n item = sourceModel.splice(dragIndex, 1)[0];\n sourceModel.splice(dropIndex, 0, item);\n // this was true before we cloned and updated sourceModel,\n // but targetModel still has the old value\n targetModel = sourceModel;\n }\n else {\n /** @type {?} */\n let isCopying = dragElm !== dropElm;\n item = sourceModel[dragIndex];\n if (isCopying) {\n if (!options.copyItem) {\n throw new Error(\"If you have enabled `copy` on a group, you must provide a `copyItem` function.\");\n }\n item = options.copyItem(item);\n }\n if (!isCopying) {\n sourceModel = sourceModel.slice(0);\n sourceModel.splice(dragIndex, 1);\n }\n targetModel = targetModel.slice(0);\n targetModel.splice(dropIndex, 0, item);\n if (isCopying) {\n try {\n target.removeChild(dropElm);\n }\n catch (e) { }\n }\n }\n this.dispatch$.next({\n event: EventTypes.DropModel,\n name,\n args: [dropElm, target, source, sibling, item, sourceModel, targetModel, dragIndex, dropIndex]\n });\n });\n }\n /**\n * @param {?} group\n * @return {?}\n */\n setupEvents(group) {\n if (group.initEvents) {\n return;\n }\n group.initEvents = true;\n /** @type {?} */\n const name = group.name;\n /** @type {?} */\n let emitter = (event) => {\n group.drake.on(event, (...args) => {\n this.dispatch$.next({ event, name, args });\n });\n };\n AllEvents.forEach(emitter);\n }\n /**\n * @param {?} child\n * @param {?} parent\n * @return {?}\n */\n domIndexOf(child, parent) {\n return Array.prototype.indexOf.call(parent.children, child);\n }\n}\nDragulaService.ɵfac = function DragulaService_Factory(t) { return new (t || DragulaService)(ɵngcc0.ɵɵinject(DrakeFactory, 8)); };\nDragulaService.ɵprov = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjectable({ token: DragulaService, factory: DragulaService.ɵfac });\n/** @nocollapse */\nDragulaService.ctorParameters = () => [\n { type: DrakeFactory, decorators: [{ type: Optional }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(DragulaService, [{\n type: Injectable\n }], function () { return [{ type: DrakeFactory, decorators: [{\n type: Optional\n }] }]; }, null); })();\n\n/**\n * @fileoverview added by tsickle\n * @suppress {checkTypes} checked by tsc\n */\nclass DragulaDirective {\n /**\n * @param {?} el\n * @param {?} dragulaService\n */\n constructor(el, dragulaService) {\n this.el = el;\n this.dragulaService = dragulaService;\n this.dragulaModelChange = new EventEmitter();\n }\n /**\n * @return {?}\n */\n get container() {\n return this.el && this.el.nativeElement;\n }\n /**\n * @param {?} changes\n * @return {?}\n */\n ngOnChanges(changes) {\n if (changes && changes.dragula) {\n const { previousValue: prev, currentValue: current, firstChange } = changes.dragula;\n /** @type {?} */\n let hadPreviousValue = !!prev;\n /** @type {?} */\n let hasNewValue = !!current;\n // something -> null => teardown only\n // something -> something => teardown, then setup\n // null -> something => setup only\n //\n // null -> null (precluded by fact of change being present)\n if (hadPreviousValue) {\n this.teardown(prev);\n }\n if (hasNewValue) {\n this.setup();\n }\n }\n else if (changes && changes.dragulaModel) {\n const { previousValue: prev, currentValue: current, firstChange } = changes.dragulaModel;\n const { drake } = this.group;\n if (this.dragula && drake) {\n drake.models = drake.models || [];\n /** @type {?} */\n let prevIndex = drake.models.indexOf(prev);\n if (prevIndex !== -1) {\n // delete the previous\n drake.models.splice(prevIndex, 1);\n // maybe insert a new one at the same spot\n if (!!current) {\n drake.models.splice(prevIndex, 0, current);\n }\n }\n else if (!!current) {\n // no previous one to remove; just push this one.\n drake.models.push(current);\n }\n }\n }\n }\n /**\n * @return {?}\n */\n setup() {\n /** @type {?} */\n let checkModel = (group) => {\n if (this.dragulaModel) {\n if (group.drake.models) {\n group.drake.models.push(this.dragulaModel);\n }\n else {\n group.drake.models = [this.dragulaModel];\n }\n }\n };\n /** @type {?} */\n let group = this.dragulaService.find(this.dragula);\n if (!group) {\n /** @type {?} */\n let options = {};\n group = this.dragulaService.createGroup(this.dragula, options);\n }\n // ensure model and container element are pushed\n checkModel(group);\n group.drake.containers.push(this.container);\n this.subscribe(this.dragula);\n this.group = group;\n }\n /**\n * @param {?} name\n * @return {?}\n */\n subscribe(name) {\n this.subs = new Subscription();\n this.subs.add(this.dragulaService\n .dropModel(name)\n .subscribe(({ source, target, sourceModel, targetModel }) => {\n if (source === this.el.nativeElement) {\n this.dragulaModelChange.emit(sourceModel);\n }\n else if (target === this.el.nativeElement) {\n this.dragulaModelChange.emit(targetModel);\n }\n }));\n this.subs.add(this.dragulaService\n .removeModel(name)\n .subscribe(({ source, sourceModel }) => {\n if (source === this.el.nativeElement) {\n this.dragulaModelChange.emit(sourceModel);\n }\n }));\n }\n /**\n * @param {?} groupName\n * @return {?}\n */\n teardown(groupName) {\n if (this.subs) {\n this.subs.unsubscribe();\n }\n /** @type {?} */\n const group = this.dragulaService.find(groupName);\n if (group) {\n /** @type {?} */\n const itemToRemove = group.drake.containers.indexOf(this.el.nativeElement);\n if (itemToRemove !== -1) {\n group.drake.containers.splice(itemToRemove, 1);\n }\n if (this.dragulaModel && group.drake && group.drake.models) {\n /** @type {?} */\n let modelIndex = group.drake.models.indexOf(this.dragulaModel);\n if (modelIndex !== -1) {\n group.drake.models.splice(modelIndex, 1);\n }\n }\n }\n }\n /**\n * @return {?}\n */\n ngOnDestroy() {\n this.teardown(this.dragula);\n }\n}\nDragulaDirective.ɵfac = function DragulaDirective_Factory(t) { return new (t || DragulaDirective)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef), ɵngcc0.ɵɵdirectiveInject(DragulaService)); };\nDragulaDirective.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: DragulaDirective, selectors: [[\"\", \"dragula\", \"\"]], inputs: { dragula: \"dragula\", dragulaModel: \"dragulaModel\" }, outputs: { dragulaModelChange: \"dragulaModelChange\" }, features: [ɵngcc0.ɵɵNgOnChangesFeature] });\n/** @nocollapse */\nDragulaDirective.ctorParameters = () => [\n { type: ElementRef },\n { type: DragulaService }\n];\nDragulaDirective.propDecorators = {\n dragula: [{ type: Input }],\n dragulaModel: [{ type: Input }],\n dragulaModelChange: [{ type: Output }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(DragulaDirective, [{\n type: Directive,\n args: [{ selector: '[dragula]' }]\n }], function () { return [{ type: ɵngcc0.ElementRef }, { type: DragulaService }]; }, { dragulaModelChange: [{\n type: Output\n }], dragula: [{\n type: Input\n }], dragulaModel: [{\n type: Input\n }] }); })();\n\n/**\n * @fileoverview added by tsickle\n * @suppress {checkTypes} checked by tsc\n */\nclass DragulaModule {\n /**\n * @return {?}\n */\n static forRoot() {\n return {\n ngModule: DragulaModule,\n providers: [DragulaService]\n };\n }\n}\nDragulaModule.ɵfac = function DragulaModule_Factory(t) { return new (t || DragulaModule)(); };\nDragulaModule.ɵmod = /*@__PURE__*/ ɵngcc0.ɵɵdefineNgModule({ type: DragulaModule });\nDragulaModule.ɵinj = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjector({});\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(DragulaModule, [{\n type: NgModule,\n args: [{\n exports: [DragulaDirective],\n declarations: [DragulaDirective]\n }]\n }], null, null); })();\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(DragulaModule, { declarations: [DragulaDirective], exports: [DragulaDirective] }); })();\n\n/**\n * @fileoverview added by tsickle\n * @suppress {checkTypes} checked by tsc\n */\n/** @type {?} */\nconst MockDrakeFactory = new DrakeFactory((containers, options) => {\n return new MockDrake(containers, options);\n});\n/**\n * You can use MockDrake to simulate Drake events.\n *\n * The three methods that actually do anything are `on(event, listener)`,\n * `destroy()`, and a new method, `emit()`. Use `emit()` to manually emit Drake\n * events, and if you injected MockDrake properly with MockDrakeFactory or\n * mocked the DragulaService.find() method, then you can make ng2-dragula think\n * drags and drops are happening.\n *\n * Caveats:\n *\n * 1. YOU MUST MAKE THE DOM CHANGES YOURSELF.\n * 2. REPEAT: YOU MUST MAKE THE DOM CHANGES YOURSELF.\n * That means `source.removeChild(el)`, and `target.insertBefore(el)`.\n * 3. None of the other methods do anything.\n * That's ok, because ng2-dragula doesn't use them.\n */\nclass MockDrake {\n /**\n * @param {?=} containers A list of container elements.\n * @param {?=} options These will NOT be used. At all.\n * @param {?=} models Nonstandard, but useful for testing using `new MockDrake()` directly.\n * Note, default value is undefined, like a real Drake. Don't change that.\n */\n constructor(containers = [], options = {}, models) {\n this.containers = containers;\n this.options = options;\n this.models = models;\n /* Doesn't represent anything meaningful. */\n this.dragging = false;\n this.emitter$ = new Subject();\n this.subs = new Subscription();\n }\n /**\n * @param {?} item\n * @return {?}\n */\n start(item) {\n this.dragging = true;\n }\n /**\n * @return {?}\n */\n end() {\n this.dragging = false;\n }\n /**\n * @param {?=} revert\n * @return {?}\n */\n cancel(revert) {\n this.dragging = false;\n }\n /**\n * @return {?}\n */\n remove() {\n this.dragging = false;\n }\n /**\n * @param {?} event\n * @param {?} callback\n * @return {?}\n */\n on(event, callback) {\n this.subs.add(this.emitter$\n .pipe(filter(({ eventType }) => eventType === event))\n .subscribe(({ args }) => {\n callback(...args);\n }));\n }\n /**\n * @return {?}\n */\n destroy() {\n this.subs.unsubscribe();\n }\n /**\n * This is the most useful method. You can use it to manually fire events that would normally\n * be fired by a real drake.\n *\n * You're likely most interested in firing `drag`, `remove` and `drop`, the three events\n * DragulaService uses to implement [dragulaModel].\n *\n * See https://github.com/bevacqua/dragula#drakeon-events for what you should emit (and in what order).\n *\n * (Note also, firing dropModel and removeModel won't work. You would have to mock DragulaService for that.)\n * @param {?} eventType\n * @param {...?} args\n * @return {?}\n */\n emit(eventType, ...args) {\n this.emitter$.next({ eventType, args });\n }\n}\n\n/**\n * @fileoverview added by tsickle\n * @suppress {checkTypes} checked by tsc\n */\n\n/**\n * @fileoverview added by tsickle\n * @suppress {checkTypes} checked by tsc\n */\n\nexport { DragulaDirective, DragulaService, DragulaModule, dragula, DrakeFactory, Group, EventTypes, MockDrake, MockDrakeFactory };\n\n","import { __decorate, __param } from 'tslib';\nimport { InjectionToken, EventEmitter, NgZone, Renderer2, ElementRef, KeyValueDiffers, Inject, PLATFORM_ID, Optional, Input, Output, Directive, ViewChild, Component, ViewEncapsulation, NgModule } from '@angular/core';\nimport { isPlatformBrowser, CommonModule } from '@angular/common';\nimport Dropzone from 'dropzone';\n\nimport * as ɵngcc0 from '@angular/core';\nimport * as ɵngcc1 from '@angular/common';\n\nfunction DropzoneComponent_div_3_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵelement(0, \"div\", 4);\n} if (rf & 2) {\n const ctx_r0 = ɵngcc0.ɵɵnextContext();\n ɵngcc0.ɵɵstyleProp(\"background-image\", ctx_r0.getPlaceholder());\n} }\nconst _c0 = [\"*\"];\nconst DROPZONE_CONFIG = new InjectionToken('DROPZONE_CONFIG');\nconst DropzoneEvents = [\n 'error',\n 'success',\n 'sending',\n 'canceled',\n 'complete',\n 'processing',\n 'drop',\n 'dragStart',\n 'dragEnd',\n 'dragEnter',\n 'dragOver',\n 'dragLeave',\n 'thumbnail',\n 'addedFile',\n 'removedFile',\n 'uploadProgress',\n 'maxFilesReached',\n 'maxFilesExceeded',\n 'successMultiple',\n 'sendingMultiple',\n 'canceledMultiple',\n 'completeMultiple',\n 'processingMultiple',\n 'reset',\n 'queueComplete',\n 'totalUploadProgress'\n];\nclass DropzoneConfig {\n constructor(config = {}) {\n this.assign(config);\n }\n assign(config = {}, target) {\n target = target || this;\n for (const key in config) {\n if (config[key] != null && !(Array.isArray(config[key])) &&\n typeof config[key] === 'object' && !(config[key] instanceof HTMLElement)) {\n target[key] = {};\n this.assign(config[key], target[key]);\n }\n else {\n target[key] = config[key];\n }\n }\n }\n}\n\nlet DropzoneDirective = class DropzoneDirective {\n constructor(zone, renderer, elementRef, differs, platformId, defaults) {\n this.zone = zone;\n this.renderer = renderer;\n this.elementRef = elementRef;\n this.differs = differs;\n this.platformId = platformId;\n this.defaults = defaults;\n this.configDiff = null;\n this.disabled = false;\n this.DZ_INIT = new EventEmitter();\n this.DZ_ERROR = new EventEmitter();\n this.DZ_SUCCESS = new EventEmitter();\n this.DZ_SENDING = new EventEmitter();\n this.DZ_CANCELED = new EventEmitter();\n this.DZ_COMPLETE = new EventEmitter();\n this.DZ_PROCESSING = new EventEmitter();\n this.DZ_DROP = new EventEmitter();\n this.DZ_DRAGSTART = new EventEmitter();\n this.DZ_DRAGEND = new EventEmitter();\n this.DZ_DRAGENTER = new EventEmitter();\n this.DZ_DRAGOVER = new EventEmitter();\n this.DZ_DRAGLEAVE = new EventEmitter();\n this.DZ_THUMBNAIL = new EventEmitter();\n this.DZ_ADDEDFILE = new EventEmitter();\n this.DZ_REMOVEDFILE = new EventEmitter();\n this.DZ_UPLOADPROGRESS = new EventEmitter();\n this.DZ_MAXFILESREACHED = new EventEmitter();\n this.DZ_MAXFILESEXCEEDED = new EventEmitter();\n this.DZ_SUCCESSMULTIPLE = new EventEmitter();\n this.DZ_SENDINGMULTIPLE = new EventEmitter();\n this.DZ_CANCELEDMULTIPLE = new EventEmitter();\n this.DZ_COMPLETEMULTIPLE = new EventEmitter();\n this.DZ_PROCESSINGMULTIPLE = new EventEmitter();\n this.DZ_RESET = new EventEmitter();\n this.DZ_QUEUECOMPLETE = new EventEmitter();\n this.DZ_TOTALUPLOADPROGRESS = new EventEmitter();\n const dz = Dropzone;\n dz.autoDiscover = false;\n }\n ngOnInit() {\n if (!isPlatformBrowser(this.platformId)) {\n return;\n }\n const params = new DropzoneConfig(this.defaults);\n params.assign(this.config); // Custom configuration\n this.renderer.addClass(this.elementRef.nativeElement, (params.maxFiles === 1) ? 'dz-single' : 'dz-multiple');\n this.renderer.removeClass(this.elementRef.nativeElement, (params.maxFiles === 1) ? 'dz-multiple' : 'dz-single');\n this.zone.runOutsideAngular(() => {\n this.instance = new Dropzone(this.elementRef.nativeElement, params);\n });\n if (this.disabled) {\n this.instance.disable();\n }\n if (this.DZ_INIT.observers.length) {\n this.zone.run(() => {\n this.DZ_INIT.emit(this.instance);\n });\n }\n // Add auto reset handling for events\n this.instance.on('success', () => {\n if (params.autoReset != null) {\n setTimeout(() => this.reset(), params.autoReset);\n }\n });\n this.instance.on('error', () => {\n if (params.errorReset != null) {\n setTimeout(() => this.reset(), params.errorReset);\n }\n });\n this.instance.on('canceled', () => {\n if (params.cancelReset != null) {\n setTimeout(() => this.reset(), params.cancelReset);\n }\n });\n // Add native Dropzone event handling\n DropzoneEvents.forEach((eventName) => {\n this.instance.on(eventName.toLowerCase(), (...args) => {\n args = (args.length === 1) ? args[0] : args;\n const output = `DZ_${eventName.toUpperCase()}`;\n const emitter = this[output];\n if (emitter.observers.length > 0) {\n this.zone.run(() => {\n emitter.emit(args);\n });\n }\n });\n });\n if (!this.configDiff) {\n this.configDiff = this.differs.find(this.config || {}).create();\n this.configDiff.diff(this.config || {});\n }\n }\n ngOnDestroy() {\n if (this.instance) {\n this.zone.runOutsideAngular(() => {\n this.instance.destroy();\n });\n this.instance = null;\n }\n }\n ngDoCheck() {\n if (!this.disabled && this.configDiff) {\n const changes = this.configDiff.diff(this.config || {});\n if (changes && this.instance) {\n this.ngOnDestroy();\n this.ngOnInit();\n }\n }\n }\n ngOnChanges(changes) {\n if (this.instance && changes['disabled']) {\n if (changes['disabled'].currentValue !== changes['disabled'].previousValue) {\n if (changes['disabled'].currentValue === false) {\n this.zone.runOutsideAngular(() => {\n this.instance.enable();\n });\n }\n else if (changes['disabled'].currentValue === true) {\n this.zone.runOutsideAngular(() => {\n this.instance.disable();\n });\n }\n }\n }\n }\n dropzone() {\n return this.instance;\n }\n reset(cancel) {\n if (this.instance) {\n this.zone.runOutsideAngular(() => {\n this.instance.removeAllFiles(cancel);\n });\n }\n }\n};\nDropzoneDirective.ɵfac = function DropzoneDirective_Factory(t) { return new (t || DropzoneDirective)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.NgZone), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.Renderer2), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.KeyValueDiffers), ɵngcc0.ɵɵdirectiveInject(PLATFORM_ID), ɵngcc0.ɵɵdirectiveInject(DROPZONE_CONFIG, 8)); };\nDropzoneDirective.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: DropzoneDirective, selectors: [[\"\", \"dropzone\", \"\"]], inputs: { disabled: \"disabled\", config: [\"dropzone\", \"config\"] }, outputs: { DZ_INIT: \"init\", DZ_ERROR: \"error\", DZ_SUCCESS: \"success\", DZ_SENDING: \"sending\", DZ_CANCELED: \"canceled\", DZ_COMPLETE: \"complete\", DZ_PROCESSING: \"processing\", DZ_DROP: \"drop\", DZ_DRAGSTART: \"dragStart\", DZ_DRAGEND: \"dragEnd\", DZ_DRAGENTER: \"dragEnter\", DZ_DRAGOVER: \"dragOver\", DZ_DRAGLEAVE: \"dragLeave\", DZ_THUMBNAIL: \"thumbnail\", DZ_ADDEDFILE: \"addedFile\", DZ_REMOVEDFILE: \"removedFile\", DZ_UPLOADPROGRESS: \"uploadProgress\", DZ_MAXFILESREACHED: \"maxFilesReached\", DZ_MAXFILESEXCEEDED: \"maxFilesExceeded\", DZ_SUCCESSMULTIPLE: \"successMultiple\", DZ_SENDINGMULTIPLE: \"sendingMultiple\", DZ_CANCELEDMULTIPLE: \"canceledMultiple\", DZ_COMPLETEMULTIPLE: \"completeMultiple\", DZ_PROCESSINGMULTIPLE: \"processingMultiple\", DZ_RESET: \"reset\", DZ_QUEUECOMPLETE: \"queueComplete\", DZ_TOTALUPLOADPROGRESS: \"totalUploadProgress\" }, exportAs: [\"ngxDropzone\"], features: [ɵngcc0.ɵɵNgOnChangesFeature] });\nDropzoneDirective.ctorParameters = () => [\n { type: NgZone },\n { type: Renderer2 },\n { type: ElementRef },\n { type: KeyValueDiffers },\n { type: Object, decorators: [{ type: Inject, args: [PLATFORM_ID,] }] },\n { type: undefined, decorators: [{ type: Optional }, { type: Inject, args: [DROPZONE_CONFIG,] }] }\n];\n__decorate([\n Input()\n], DropzoneDirective.prototype, \"disabled\", void 0);\n__decorate([\n Input('dropzone')\n], DropzoneDirective.prototype, \"config\", void 0);\n__decorate([\n Output('init')\n], DropzoneDirective.prototype, \"DZ_INIT\", void 0);\n__decorate([\n Output('error')\n], DropzoneDirective.prototype, \"DZ_ERROR\", void 0);\n__decorate([\n Output('success')\n], DropzoneDirective.prototype, \"DZ_SUCCESS\", void 0);\n__decorate([\n Output('sending')\n], DropzoneDirective.prototype, \"DZ_SENDING\", void 0);\n__decorate([\n Output('canceled')\n], DropzoneDirective.prototype, \"DZ_CANCELED\", void 0);\n__decorate([\n Output('complete')\n], DropzoneDirective.prototype, \"DZ_COMPLETE\", void 0);\n__decorate([\n Output('processing')\n], DropzoneDirective.prototype, \"DZ_PROCESSING\", void 0);\n__decorate([\n Output('drop')\n], DropzoneDirective.prototype, \"DZ_DROP\", void 0);\n__decorate([\n Output('dragStart')\n], DropzoneDirective.prototype, \"DZ_DRAGSTART\", void 0);\n__decorate([\n Output('dragEnd')\n], DropzoneDirective.prototype, \"DZ_DRAGEND\", void 0);\n__decorate([\n Output('dragEnter')\n], DropzoneDirective.prototype, \"DZ_DRAGENTER\", void 0);\n__decorate([\n Output('dragOver')\n], DropzoneDirective.prototype, \"DZ_DRAGOVER\", void 0);\n__decorate([\n Output('dragLeave')\n], DropzoneDirective.prototype, \"DZ_DRAGLEAVE\", void 0);\n__decorate([\n Output('thumbnail')\n], DropzoneDirective.prototype, \"DZ_THUMBNAIL\", void 0);\n__decorate([\n Output('addedFile')\n], DropzoneDirective.prototype, \"DZ_ADDEDFILE\", void 0);\n__decorate([\n Output('removedFile')\n], DropzoneDirective.prototype, \"DZ_REMOVEDFILE\", void 0);\n__decorate([\n Output('uploadProgress')\n], DropzoneDirective.prototype, \"DZ_UPLOADPROGRESS\", void 0);\n__decorate([\n Output('maxFilesReached')\n], DropzoneDirective.prototype, \"DZ_MAXFILESREACHED\", void 0);\n__decorate([\n Output('maxFilesExceeded')\n], DropzoneDirective.prototype, \"DZ_MAXFILESEXCEEDED\", void 0);\n__decorate([\n Output('successMultiple')\n], DropzoneDirective.prototype, \"DZ_SUCCESSMULTIPLE\", void 0);\n__decorate([\n Output('sendingMultiple')\n], DropzoneDirective.prototype, \"DZ_SENDINGMULTIPLE\", void 0);\n__decorate([\n Output('canceledMultiple')\n], DropzoneDirective.prototype, \"DZ_CANCELEDMULTIPLE\", void 0);\n__decorate([\n Output('completeMultiple')\n], DropzoneDirective.prototype, \"DZ_COMPLETEMULTIPLE\", void 0);\n__decorate([\n Output('processingMultiple')\n], DropzoneDirective.prototype, \"DZ_PROCESSINGMULTIPLE\", void 0);\n__decorate([\n Output('reset')\n], DropzoneDirective.prototype, \"DZ_RESET\", void 0);\n__decorate([\n Output('queueComplete')\n], DropzoneDirective.prototype, \"DZ_QUEUECOMPLETE\", void 0);\n__decorate([\n Output('totalUploadProgress')\n], DropzoneDirective.prototype, \"DZ_TOTALUPLOADPROGRESS\", void 0);\nDropzoneDirective = __decorate([ __param(4, Inject(PLATFORM_ID)),\n __param(5, Optional()), __param(5, Inject(DROPZONE_CONFIG))\n], DropzoneDirective);\n\nlet DropzoneComponent = class DropzoneComponent {\n constructor(platformId) {\n this.platformId = platformId;\n this.disabled = false;\n this.message = 'Click or drag files to upload';\n this.placeholder = '';\n this.useDropzoneClass = true;\n this.DZ_INIT = new EventEmitter();\n this.DZ_ERROR = new EventEmitter();\n this.DZ_SUCCESS = new EventEmitter();\n this.DZ_SENDING = new EventEmitter();\n this.DZ_CANCELED = new EventEmitter();\n this.DZ_COMPLETE = new EventEmitter();\n this.DZ_PROCESSING = new EventEmitter();\n this.DZ_DROP = new EventEmitter();\n this.DZ_DRAGSTART = new EventEmitter();\n this.DZ_DRAGEND = new EventEmitter();\n this.DZ_DRAGENTER = new EventEmitter();\n this.DZ_DRAGOVER = new EventEmitter();\n this.DZ_DRAGLEAVE = new EventEmitter();\n this.DZ_THUMBNAIL = new EventEmitter();\n this.DZ_ADDEDFILE = new EventEmitter();\n this.DZ_REMOVEDFILE = new EventEmitter();\n this.DZ_UPLOADPROGRESS = new EventEmitter();\n this.DZ_MAXFILESREACHED = new EventEmitter();\n this.DZ_MAXFILESEXCEEDED = new EventEmitter();\n this.DZ_SUCCESSMULTIPLE = new EventEmitter();\n this.DZ_SENDINGMULTIPLE = new EventEmitter();\n this.DZ_CANCELEDMULTIPLE = new EventEmitter();\n this.DZ_COMPLETEMULTIPLE = new EventEmitter();\n this.DZ_PROCESSINGMULTIPLE = new EventEmitter();\n this.DZ_RESET = new EventEmitter();\n this.DZ_QUEUECOMPLETE = new EventEmitter();\n this.DZ_TOTALUPLOADPROGRESS = new EventEmitter();\n }\n ngOnInit() {\n if (!isPlatformBrowser(this.platformId)) {\n return;\n }\n window.setTimeout(() => {\n DropzoneEvents.forEach((eventName) => {\n if (this.directiveRef) {\n const output = `DZ_${eventName.toUpperCase()}`;\n const directiveOutput = output;\n const componentOutput = output;\n this.directiveRef[directiveOutput] = this[componentOutput];\n }\n });\n }, 0);\n }\n getPlaceholder() {\n return 'url(' + encodeURI(this.placeholder) + ')';\n }\n};\nDropzoneComponent.ɵfac = function DropzoneComponent_Factory(t) { return new (t || DropzoneComponent)(ɵngcc0.ɵɵdirectiveInject(PLATFORM_ID)); };\nDropzoneComponent.ɵcmp = /*@__PURE__*/ ɵngcc0.ɵɵdefineComponent({ type: DropzoneComponent, selectors: [[\"dropzone\"]], viewQuery: function DropzoneComponent_Query(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵviewQuery(DropzoneDirective, 7);\n } if (rf & 2) {\n let _t;\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx.directiveRef = _t.first);\n } }, inputs: { disabled: \"disabled\", message: \"message\", placeholder: \"placeholder\", useDropzoneClass: \"useDropzoneClass\", config: \"config\" }, outputs: { DZ_INIT: \"init\", DZ_ERROR: \"error\", DZ_SUCCESS: \"success\", DZ_SENDING: \"sending\", DZ_CANCELED: \"canceled\", DZ_COMPLETE: \"complete\", DZ_PROCESSING: \"processing\", DZ_DROP: \"drop\", DZ_DRAGSTART: \"dragStart\", DZ_DRAGEND: \"dragEnd\", DZ_DRAGENTER: \"dragEnter\", DZ_DRAGOVER: \"dragOver\", DZ_DRAGLEAVE: \"dragLeave\", DZ_THUMBNAIL: \"thumbnail\", DZ_ADDEDFILE: \"addedFile\", DZ_REMOVEDFILE: \"removedFile\", DZ_UPLOADPROGRESS: \"uploadProgress\", DZ_MAXFILESREACHED: \"maxFilesReached\", DZ_MAXFILESEXCEEDED: \"maxFilesExceeded\", DZ_SUCCESSMULTIPLE: \"successMultiple\", DZ_SENDINGMULTIPLE: \"sendingMultiple\", DZ_CANCELEDMULTIPLE: \"canceledMultiple\", DZ_COMPLETEMULTIPLE: \"completeMultiple\", DZ_PROCESSINGMULTIPLE: \"processingMultiple\", DZ_RESET: \"reset\", DZ_QUEUECOMPLETE: \"queueComplete\", DZ_TOTALUPLOADPROGRESS: \"totalUploadProgress\" }, exportAs: [\"ngxDropzone\"], ngContentSelectors: _c0, decls: 5, vars: 10, consts: [[1, \"dz-wrapper\", 3, \"dropzone\", \"disabled\", \"init\"], [1, \"dz-message\"], [1, \"dz-text\", 3, \"innerHTML\"], [\"class\", \"dz-image\", 3, \"background-image\", 4, \"ngIf\"], [1, \"dz-image\"]], template: function DropzoneComponent_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵprojectionDef();\n ɵngcc0.ɵɵelementStart(0, \"div\", 0);\n ɵngcc0.ɵɵlistener(\"init\", function DropzoneComponent_Template_div_init_0_listener($event) { return ctx.DZ_INIT.emit($event); });\n ɵngcc0.ɵɵelementStart(1, \"div\", 1);\n ɵngcc0.ɵɵelement(2, \"div\", 2);\n ɵngcc0.ɵɵtemplate(3, DropzoneComponent_div_3_Template, 1, 2, \"div\", 3);\n ɵngcc0.ɵɵelementEnd();\n ɵngcc0.ɵɵprojection(4);\n ɵngcc0.ɵɵelementEnd();\n } if (rf & 2) {\n ɵngcc0.ɵɵclassProp(\"dropzone\", ctx.useDropzoneClass);\n ɵngcc0.ɵɵproperty(\"dropzone\", ctx.config)(\"disabled\", ctx.disabled);\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵclassProp(\"disabled\", ctx.disabled)(\"dz-placeholder\", ctx.placeholder);\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵproperty(\"innerHTML\", (ctx.config == null ? null : ctx.config.dictDefaultMessage) || ctx.message, ɵngcc0.ɵɵsanitizeHtml);\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵproperty(\"ngIf\", ctx.placeholder);\n } }, dependencies: [ɵngcc1.NgIf, DropzoneDirective], styles: [\"dropzone{display:block;width:100%;height:auto}dropzone[fxflex]{display:-webkit-box;display:flex;flex-direction:inherit;min-width:0;min-height:0;-webkit-box-direction:inherit;-webkit-box-orient:inherit}dropzone[fxflex]>.dropzone.dz-wrapper{flex:1 1 auto;min-width:0;min-height:0;-webkit-box-flex:1}dropzone[fxlayout]{align-items:inherit;align-content:inherit;justify-content:inherit;-webkit-box-align:inherit;-webkit-box-pack:inherit}dropzone[fxlayout]>.dropzone.dz-wrapper.dz-single{display:-webkit-box;display:flex;flex-direction:column;align-items:center;align-content:center;justify-content:center;-webkit-box-align:center;-webkit-box-direction:column;-webkit-box-orient:column;-webkit-box-pack:center}dropzone[fxlayout]>.dropzone.dz-wrapper.dz-multiple{display:-webkit-box;display:flex;flex-flow:row wrap;-webkit-box-align:start;align-items:flex-start;align-content:flex-start;-webkit-box-pack:justify;justify-content:space-between;-webkit-box-align:flex-start;-webkit-box-direction:row;-webkit-box-orient:row;-webkit-box-pack:flex-start}dropzone>.dropzone.dz-wrapper{position:relative;overflow:auto;width:100%;min-height:0;max-height:100%;padding:0;border:none;color:#666;background:0 0}dropzone>.dropzone.dz-wrapper .dz-message{position:relative;display:inline-block;overflow:auto;width:calc(100% - 16px);min-width:calc(100% - 16px);min-height:40px;max-width:calc(100% - 16px);max-height:100%;margin:8px;border:2px dashed #aaa;background-color:#eee}dropzone>.dropzone.dz-wrapper .dz-message .dz-text{position:absolute;top:50%;width:100%;padding:8px 16px;text-align:center;-webkit-transform:translateY(-50%);transform:translateY(-50%)}dropzone>.dropzone.dz-wrapper .dz-message .dz-image{width:100%;height:100%;background-size:contain;background-repeat:no-repeat;background-position:50% 50%}dropzone>.dropzone.dz-wrapper .dz-message.disabled{cursor:not-allowed}dropzone>.dropzone.dz-wrapper .dz-message.disabled .dz-text{opacity:.5}dropzone>.dropzone.dz-wrapper .dz-message.dz-placeholder{border-color:rgba(#aaa,0)}dropzone>.dropzone.dz-wrapper .dz-message.dz-placeholder .dz-text{position:absolute;z-index:1;top:0;right:10%;left:10%;opacity:0;font-weight:700;background-color:rgba(#fff,.5);-webkit-transform:translateY(-50%);transform:translateY(-50%);-webkit-transition:opacity 250ms ease-in-out,border-color 250ms ease-in-out,-webkit-filter 250ms ease-in-out;transition:filter 250ms ease-in-out,opacity 250ms ease-in-out,border-color 250ms ease-in-out,-webkit-filter 250ms ease-in-out}dropzone>.dropzone.dz-wrapper .dz-message.dz-placeholder:hover:not(.disabled){border-color:#aaa}dropzone>.dropzone.dz-wrapper .dz-message.dz-placeholder:hover:not(.disabled) .dz-text{opacity:1}dropzone>.dropzone.dz-wrapper .dz-message.dz-placeholder:hover:not(.disabled) .dz-image{-webkit-filter:blur(8px);filter:blur(8px)}dropzone>.dropzone.dz-wrapper .dz-preview{margin:8px}dropzone>.dropzone.dz-wrapper .dz-preview .dz-details{padding:24px}dropzone>.dropzone.dz-wrapper .dz-preview .dz-progress{width:80%;margin-left:-40%;border:1px solid #aaa;border-radius:4px}dropzone>.dropzone.dz-wrapper .dz-preview .dz-progress .dz-upload{background-color:#666}dropzone>.dropzone.dz-wrapper .dz-preview .dz-filename span{display:block;overflow:hidden;width:100%;max-width:100%;text-overflow:ellipsis}dropzone>.dropzone.dz-wrapper .dz-preview .dz-filename span:hover{overflow:visible;white-space:normal;word-wrap:break-word}dropzone>.dropzone.dz-wrapper.dz-single .dz-message{width:100%;height:100%}dropzone>.dropzone.dz-wrapper.dz-single.dz-started .dz-message{display:none}dropzone>.dropzone.dz-wrapper.dz-single .dz-preview{width:calc(100% - 16px);height:100%}dropzone>.dropzone.dz-wrapper.dz-single .dz-preview .dz-image{width:100%;height:100%;border-radius:0}dropzone>.dropzone.dz-wrapper.dz-single .dz-preview .dz-image img{display:block;width:100%;height:auto;margin:0}dropzone>.dropzone.dz-wrapper.dz-single .dz-error-message{top:50%;left:50%;-webkit-transform:translateX(-50%) translateY(100%);transform:translateX(-50%) translateY(100%)}dropzone>.dropzone.dz-wrapper.dz-multiple.dz-started .dz-message{display:inline-block}\", \"@-webkit-keyframes passing-through{0%{opacity:0;-webkit-transform:translateY(40px);transform:translateY(40px)}30%,70%{opacity:1;-webkit-transform:translateY(0);transform:translateY(0)}100%{opacity:0;-webkit-transform:translateY(-40px);transform:translateY(-40px)}}@keyframes passing-through{0%{opacity:0;-webkit-transform:translateY(40px);transform:translateY(40px)}30%,70%{opacity:1;-webkit-transform:translateY(0);transform:translateY(0)}100%{opacity:0;-webkit-transform:translateY(-40px);transform:translateY(-40px)}}@-webkit-keyframes slide-in{0%{opacity:0;-webkit-transform:translateY(40px);transform:translateY(40px)}30%{opacity:1;-webkit-transform:translateY(0);transform:translateY(0)}}@keyframes slide-in{0%{opacity:0;-webkit-transform:translateY(40px);transform:translateY(40px)}30%{opacity:1;-webkit-transform:translateY(0);transform:translateY(0)}}@-webkit-keyframes pulse{0%,20%{-webkit-transform:scale(1);transform:scale(1)}10%{-webkit-transform:scale(1.1);transform:scale(1.1)}}@keyframes pulse{0%,20%{-webkit-transform:scale(1);transform:scale(1)}10%{-webkit-transform:scale(1.1);transform:scale(1.1)}}.dropzone,.dropzone *{box-sizing:border-box}.dropzone{min-height:150px;border:2px solid rgba(0,0,0,.3);background:#fff;padding:20px}.dropzone.dz-clickable{cursor:pointer}.dropzone.dz-clickable *{cursor:default}.dropzone.dz-clickable .dz-message,.dropzone.dz-clickable .dz-message *{cursor:pointer}.dropzone.dz-started .dz-message{display:none}.dropzone.dz-drag-hover{border-style:solid}.dropzone.dz-drag-hover .dz-message{opacity:.5}.dropzone .dz-message{text-align:center;margin:2em 0}.dropzone .dz-preview{position:relative;display:inline-block;vertical-align:top;margin:16px;min-height:100px}.dropzone .dz-preview:hover{z-index:1000}.dropzone .dz-preview.dz-file-preview .dz-image{border-radius:20px;background:#999;background:-webkit-gradient(linear,left top,left bottom,from(#eee),to(#ddd));background:linear-gradient(to bottom,#eee,#ddd)}.dropzone .dz-preview.dz-file-preview .dz-details{opacity:1}.dropzone .dz-preview.dz-image-preview{background:#fff}.dropzone .dz-preview.dz-image-preview .dz-details{-webkit-transition:opacity .2s linear;transition:opacity .2s linear}.dropzone .dz-preview .dz-remove{font-size:14px;text-align:center;display:block;cursor:pointer;border:none}.dropzone .dz-preview .dz-remove:hover{text-decoration:underline}.dropzone .dz-preview:hover .dz-details{opacity:1}.dropzone .dz-preview .dz-details{z-index:20;position:absolute;top:0;left:0;opacity:0;font-size:13px;min-width:100%;max-width:100%;padding:2em 1em;text-align:center;color:rgba(0,0,0,.9);line-height:150%}.dropzone .dz-preview .dz-details .dz-size{margin-bottom:1em;font-size:16px}.dropzone .dz-preview .dz-details .dz-filename{white-space:nowrap}.dropzone .dz-preview .dz-details .dz-filename:hover span{border:1px solid rgba(200,200,200,.8);background-color:rgba(255,255,255,.8)}.dropzone .dz-preview .dz-details .dz-filename:not(:hover){overflow:hidden;text-overflow:ellipsis}.dropzone .dz-preview .dz-details .dz-filename:not(:hover) span{border:1px solid transparent}.dropzone .dz-preview .dz-details .dz-filename span,.dropzone .dz-preview .dz-details .dz-size span{background-color:rgba(255,255,255,.4);padding:0 .4em;border-radius:3px}.dropzone .dz-preview:hover .dz-image img{-webkit-transform:scale(1.05,1.05);transform:scale(1.05,1.05);-webkit-filter:blur(8px);filter:blur(8px)}.dropzone .dz-preview .dz-image{border-radius:20px;overflow:hidden;width:120px;height:120px;position:relative;display:block;z-index:10}.dropzone .dz-preview .dz-image img{display:block}.dropzone .dz-preview.dz-success .dz-success-mark{-webkit-animation:3s cubic-bezier(.77,0,.175,1) passing-through;animation:3s cubic-bezier(.77,0,.175,1) passing-through}.dropzone .dz-preview.dz-error .dz-error-mark{opacity:1;-webkit-animation:3s cubic-bezier(.77,0,.175,1) slide-in;animation:3s cubic-bezier(.77,0,.175,1) slide-in}.dropzone .dz-preview .dz-error-mark,.dropzone .dz-preview .dz-success-mark{pointer-events:none;opacity:0;z-index:500;position:absolute;display:block;top:50%;left:50%;margin-left:-27px;margin-top:-27px}.dropzone .dz-preview .dz-error-mark svg,.dropzone .dz-preview .dz-success-mark svg{display:block;width:54px;height:54px}.dropzone .dz-preview.dz-processing .dz-progress{opacity:1;-webkit-transition:.2s linear;transition:.2s linear}.dropzone .dz-preview.dz-complete .dz-progress{opacity:0;-webkit-transition:opacity .4s ease-in;transition:opacity .4s ease-in}.dropzone .dz-preview:not(.dz-processing) .dz-progress{-webkit-animation:6s infinite pulse;animation:6s infinite pulse}.dropzone .dz-preview .dz-progress{opacity:1;z-index:1000;pointer-events:none;position:absolute;height:16px;left:50%;top:50%;margin-top:-8px;width:80px;margin-left:-40px;background:rgba(255,255,255,.9);-webkit-transform:scale(1);border-radius:8px;overflow:hidden}.dropzone .dz-preview .dz-progress .dz-upload{background:#333;background:-webkit-gradient(linear,left top,left bottom,from(#666),to(#444));background:linear-gradient(to bottom,#666,#444);position:absolute;top:0;left:0;bottom:0;width:0;-webkit-transition:width .3s ease-in-out;transition:width .3s ease-in-out}.dropzone .dz-preview.dz-error .dz-error-message{display:block}.dropzone .dz-preview.dz-error:hover .dz-error-message{opacity:1;pointer-events:auto}.dropzone .dz-preview .dz-error-message{pointer-events:none;z-index:1000;position:absolute;display:none;opacity:0;-webkit-transition:opacity .3s;transition:opacity .3s;border-radius:8px;font-size:13px;top:130px;left:-10px;width:140px;background:#be2626;background:-webkit-gradient(linear,left top,left bottom,from(#be2626),to(#a92222));background:linear-gradient(to bottom,#be2626,#a92222);padding:.5em 1.2em;color:#fff}.dropzone .dz-preview .dz-error-message:after{content:'';position:absolute;top:-6px;left:64px;width:0;height:0;border-left:6px solid transparent;border-right:6px solid transparent;border-bottom:6px solid #be2626}\"], encapsulation: 2 });\nDropzoneComponent.ctorParameters = () => [\n { type: Object, decorators: [{ type: Inject, args: [PLATFORM_ID,] }] }\n];\n__decorate([\n Input()\n], DropzoneComponent.prototype, \"disabled\", void 0);\n__decorate([\n Input()\n], DropzoneComponent.prototype, \"config\", void 0);\n__decorate([\n Input()\n], DropzoneComponent.prototype, \"message\", void 0);\n__decorate([\n Input()\n], DropzoneComponent.prototype, \"placeholder\", void 0);\n__decorate([\n Input()\n], DropzoneComponent.prototype, \"useDropzoneClass\", void 0);\n__decorate([\n Output('init')\n], DropzoneComponent.prototype, \"DZ_INIT\", void 0);\n__decorate([\n Output('error')\n], DropzoneComponent.prototype, \"DZ_ERROR\", void 0);\n__decorate([\n Output('success')\n], DropzoneComponent.prototype, \"DZ_SUCCESS\", void 0);\n__decorate([\n Output('sending')\n], DropzoneComponent.prototype, \"DZ_SENDING\", void 0);\n__decorate([\n Output('canceled')\n], DropzoneComponent.prototype, \"DZ_CANCELED\", void 0);\n__decorate([\n Output('complete')\n], DropzoneComponent.prototype, \"DZ_COMPLETE\", void 0);\n__decorate([\n Output('processing')\n], DropzoneComponent.prototype, \"DZ_PROCESSING\", void 0);\n__decorate([\n Output('drop')\n], DropzoneComponent.prototype, \"DZ_DROP\", void 0);\n__decorate([\n Output('dragStart')\n], DropzoneComponent.prototype, \"DZ_DRAGSTART\", void 0);\n__decorate([\n Output('dragEnd')\n], DropzoneComponent.prototype, \"DZ_DRAGEND\", void 0);\n__decorate([\n Output('dragEnter')\n], DropzoneComponent.prototype, \"DZ_DRAGENTER\", void 0);\n__decorate([\n Output('dragOver')\n], DropzoneComponent.prototype, \"DZ_DRAGOVER\", void 0);\n__decorate([\n Output('dragLeave')\n], DropzoneComponent.prototype, \"DZ_DRAGLEAVE\", void 0);\n__decorate([\n Output('thumbnail')\n], DropzoneComponent.prototype, \"DZ_THUMBNAIL\", void 0);\n__decorate([\n Output('addedFile')\n], DropzoneComponent.prototype, \"DZ_ADDEDFILE\", void 0);\n__decorate([\n Output('removedFile')\n], DropzoneComponent.prototype, \"DZ_REMOVEDFILE\", void 0);\n__decorate([\n Output('uploadProgress')\n], DropzoneComponent.prototype, \"DZ_UPLOADPROGRESS\", void 0);\n__decorate([\n Output('maxFilesReached')\n], DropzoneComponent.prototype, \"DZ_MAXFILESREACHED\", void 0);\n__decorate([\n Output('maxFilesExceeded')\n], DropzoneComponent.prototype, \"DZ_MAXFILESEXCEEDED\", void 0);\n__decorate([\n Output('successMultiple')\n], DropzoneComponent.prototype, \"DZ_SUCCESSMULTIPLE\", void 0);\n__decorate([\n Output('sendingMultiple')\n], DropzoneComponent.prototype, \"DZ_SENDINGMULTIPLE\", void 0);\n__decorate([\n Output('canceledMultiple')\n], DropzoneComponent.prototype, \"DZ_CANCELEDMULTIPLE\", void 0);\n__decorate([\n Output('completeMultiple')\n], DropzoneComponent.prototype, \"DZ_COMPLETEMULTIPLE\", void 0);\n__decorate([\n Output('processingMultiple')\n], DropzoneComponent.prototype, \"DZ_PROCESSINGMULTIPLE\", void 0);\n__decorate([\n Output('reset')\n], DropzoneComponent.prototype, \"DZ_RESET\", void 0);\n__decorate([\n Output('queueComplete')\n], DropzoneComponent.prototype, \"DZ_QUEUECOMPLETE\", void 0);\n__decorate([\n Output('totalUploadProgress')\n], DropzoneComponent.prototype, \"DZ_TOTALUPLOADPROGRESS\", void 0);\n__decorate([\n ViewChild(DropzoneDirective, { static: true })\n], DropzoneComponent.prototype, \"directiveRef\", void 0);\nDropzoneComponent = __decorate([ __param(0, Inject(PLATFORM_ID))\n], DropzoneComponent);\n\nlet DropzoneModule = class DropzoneModule {\n};\nDropzoneModule.ɵfac = function DropzoneModule_Factory(t) { return new (t || DropzoneModule)(); };\nDropzoneModule.ɵmod = /*@__PURE__*/ ɵngcc0.ɵɵdefineNgModule({ type: DropzoneModule });\nDropzoneModule.ɵinj = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjector({ imports: [CommonModule, CommonModule] });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(DropzoneDirective, [{\n type: Directive,\n args: [{\n selector: '[dropzone]',\n exportAs: 'ngxDropzone'\n }]\n }], function () { return [{ type: ɵngcc0.NgZone }, { type: ɵngcc0.Renderer2 }, { type: ɵngcc0.ElementRef }, { type: ɵngcc0.KeyValueDiffers }, { type: Object, decorators: [{\n type: Inject,\n args: [PLATFORM_ID]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [DROPZONE_CONFIG]\n }] }]; }, { disabled: [{\n type: Input\n }], DZ_INIT: [{\n type: Output,\n args: ['init']\n }], DZ_ERROR: [{\n type: Output,\n args: ['error']\n }], DZ_SUCCESS: [{\n type: Output,\n args: ['success']\n }], DZ_SENDING: [{\n type: Output,\n args: ['sending']\n }], DZ_CANCELED: [{\n type: Output,\n args: ['canceled']\n }], DZ_COMPLETE: [{\n type: Output,\n args: ['complete']\n }], DZ_PROCESSING: [{\n type: Output,\n args: ['processing']\n }], DZ_DROP: [{\n type: Output,\n args: ['drop']\n }], DZ_DRAGSTART: [{\n type: Output,\n args: ['dragStart']\n }], DZ_DRAGEND: [{\n type: Output,\n args: ['dragEnd']\n }], DZ_DRAGENTER: [{\n type: Output,\n args: ['dragEnter']\n }], DZ_DRAGOVER: [{\n type: Output,\n args: ['dragOver']\n }], DZ_DRAGLEAVE: [{\n type: Output,\n args: ['dragLeave']\n }], DZ_THUMBNAIL: [{\n type: Output,\n args: ['thumbnail']\n }], DZ_ADDEDFILE: [{\n type: Output,\n args: ['addedFile']\n }], DZ_REMOVEDFILE: [{\n type: Output,\n args: ['removedFile']\n }], DZ_UPLOADPROGRESS: [{\n type: Output,\n args: ['uploadProgress']\n }], DZ_MAXFILESREACHED: [{\n type: Output,\n args: ['maxFilesReached']\n }], DZ_MAXFILESEXCEEDED: [{\n type: Output,\n args: ['maxFilesExceeded']\n }], DZ_SUCCESSMULTIPLE: [{\n type: Output,\n args: ['successMultiple']\n }], DZ_SENDINGMULTIPLE: [{\n type: Output,\n args: ['sendingMultiple']\n }], DZ_CANCELEDMULTIPLE: [{\n type: Output,\n args: ['canceledMultiple']\n }], DZ_COMPLETEMULTIPLE: [{\n type: Output,\n args: ['completeMultiple']\n }], DZ_PROCESSINGMULTIPLE: [{\n type: Output,\n args: ['processingMultiple']\n }], DZ_RESET: [{\n type: Output,\n args: ['reset']\n }], DZ_QUEUECOMPLETE: [{\n type: Output,\n args: ['queueComplete']\n }], DZ_TOTALUPLOADPROGRESS: [{\n type: Output,\n args: ['totalUploadProgress']\n }], config: [{\n type: Input,\n args: ['dropzone']\n }] }); })();\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(DropzoneComponent, [{\n type: Component,\n args: [{ selector: 'dropzone', exportAs: 'ngxDropzone', template: \"\\n\", encapsulation: ViewEncapsulation.None, styles: [\"dropzone{display:block;width:100%;height:auto}dropzone[fxflex]{display:-webkit-box;display:flex;flex-direction:inherit;min-width:0;min-height:0;-webkit-box-direction:inherit;-webkit-box-orient:inherit}dropzone[fxflex]>.dropzone.dz-wrapper{flex:1 1 auto;min-width:0;min-height:0;-webkit-box-flex:1}dropzone[fxlayout]{align-items:inherit;align-content:inherit;justify-content:inherit;-webkit-box-align:inherit;-webkit-box-pack:inherit}dropzone[fxlayout]>.dropzone.dz-wrapper.dz-single{display:-webkit-box;display:flex;flex-direction:column;align-items:center;align-content:center;justify-content:center;-webkit-box-align:center;-webkit-box-direction:column;-webkit-box-orient:column;-webkit-box-pack:center}dropzone[fxlayout]>.dropzone.dz-wrapper.dz-multiple{display:-webkit-box;display:flex;flex-flow:row wrap;-webkit-box-align:start;align-items:flex-start;align-content:flex-start;-webkit-box-pack:justify;justify-content:space-between;-webkit-box-align:flex-start;-webkit-box-direction:row;-webkit-box-orient:row;-webkit-box-pack:flex-start}dropzone>.dropzone.dz-wrapper{position:relative;overflow:auto;width:100%;min-height:0;max-height:100%;padding:0;border:none;color:#666;background:0 0}dropzone>.dropzone.dz-wrapper .dz-message{position:relative;display:inline-block;overflow:auto;width:calc(100% - 16px);min-width:calc(100% - 16px);min-height:40px;max-width:calc(100% - 16px);max-height:100%;margin:8px;border:2px dashed #aaa;background-color:#eee}dropzone>.dropzone.dz-wrapper .dz-message .dz-text{position:absolute;top:50%;width:100%;padding:8px 16px;text-align:center;-webkit-transform:translateY(-50%);transform:translateY(-50%)}dropzone>.dropzone.dz-wrapper .dz-message .dz-image{width:100%;height:100%;background-size:contain;background-repeat:no-repeat;background-position:50% 50%}dropzone>.dropzone.dz-wrapper .dz-message.disabled{cursor:not-allowed}dropzone>.dropzone.dz-wrapper .dz-message.disabled .dz-text{opacity:.5}dropzone>.dropzone.dz-wrapper .dz-message.dz-placeholder{border-color:rgba(#aaa,0)}dropzone>.dropzone.dz-wrapper .dz-message.dz-placeholder .dz-text{position:absolute;z-index:1;top:0;right:10%;left:10%;opacity:0;font-weight:700;background-color:rgba(#fff,.5);-webkit-transform:translateY(-50%);transform:translateY(-50%);-webkit-transition:opacity 250ms ease-in-out,border-color 250ms ease-in-out,-webkit-filter 250ms ease-in-out;transition:filter 250ms ease-in-out,opacity 250ms ease-in-out,border-color 250ms ease-in-out,-webkit-filter 250ms ease-in-out}dropzone>.dropzone.dz-wrapper .dz-message.dz-placeholder:hover:not(.disabled){border-color:#aaa}dropzone>.dropzone.dz-wrapper .dz-message.dz-placeholder:hover:not(.disabled) .dz-text{opacity:1}dropzone>.dropzone.dz-wrapper .dz-message.dz-placeholder:hover:not(.disabled) .dz-image{-webkit-filter:blur(8px);filter:blur(8px)}dropzone>.dropzone.dz-wrapper .dz-preview{margin:8px}dropzone>.dropzone.dz-wrapper .dz-preview .dz-details{padding:24px}dropzone>.dropzone.dz-wrapper .dz-preview .dz-progress{width:80%;margin-left:-40%;border:1px solid #aaa;border-radius:4px}dropzone>.dropzone.dz-wrapper .dz-preview .dz-progress .dz-upload{background-color:#666}dropzone>.dropzone.dz-wrapper .dz-preview .dz-filename span{display:block;overflow:hidden;width:100%;max-width:100%;text-overflow:ellipsis}dropzone>.dropzone.dz-wrapper .dz-preview .dz-filename span:hover{overflow:visible;white-space:normal;word-wrap:break-word}dropzone>.dropzone.dz-wrapper.dz-single .dz-message{width:100%;height:100%}dropzone>.dropzone.dz-wrapper.dz-single.dz-started .dz-message{display:none}dropzone>.dropzone.dz-wrapper.dz-single .dz-preview{width:calc(100% - 16px);height:100%}dropzone>.dropzone.dz-wrapper.dz-single .dz-preview .dz-image{width:100%;height:100%;border-radius:0}dropzone>.dropzone.dz-wrapper.dz-single .dz-preview .dz-image img{display:block;width:100%;height:auto;margin:0}dropzone>.dropzone.dz-wrapper.dz-single .dz-error-message{top:50%;left:50%;-webkit-transform:translateX(-50%) translateY(100%);transform:translateX(-50%) translateY(100%)}dropzone>.dropzone.dz-wrapper.dz-multiple.dz-started .dz-message{display:inline-block}\", \"@-webkit-keyframes passing-through{0%{opacity:0;-webkit-transform:translateY(40px);transform:translateY(40px)}30%,70%{opacity:1;-webkit-transform:translateY(0);transform:translateY(0)}100%{opacity:0;-webkit-transform:translateY(-40px);transform:translateY(-40px)}}@keyframes passing-through{0%{opacity:0;-webkit-transform:translateY(40px);transform:translateY(40px)}30%,70%{opacity:1;-webkit-transform:translateY(0);transform:translateY(0)}100%{opacity:0;-webkit-transform:translateY(-40px);transform:translateY(-40px)}}@-webkit-keyframes slide-in{0%{opacity:0;-webkit-transform:translateY(40px);transform:translateY(40px)}30%{opacity:1;-webkit-transform:translateY(0);transform:translateY(0)}}@keyframes slide-in{0%{opacity:0;-webkit-transform:translateY(40px);transform:translateY(40px)}30%{opacity:1;-webkit-transform:translateY(0);transform:translateY(0)}}@-webkit-keyframes pulse{0%,20%{-webkit-transform:scale(1);transform:scale(1)}10%{-webkit-transform:scale(1.1);transform:scale(1.1)}}@keyframes pulse{0%,20%{-webkit-transform:scale(1);transform:scale(1)}10%{-webkit-transform:scale(1.1);transform:scale(1.1)}}.dropzone,.dropzone *{box-sizing:border-box}.dropzone{min-height:150px;border:2px solid rgba(0,0,0,.3);background:#fff;padding:20px}.dropzone.dz-clickable{cursor:pointer}.dropzone.dz-clickable *{cursor:default}.dropzone.dz-clickable .dz-message,.dropzone.dz-clickable .dz-message *{cursor:pointer}.dropzone.dz-started .dz-message{display:none}.dropzone.dz-drag-hover{border-style:solid}.dropzone.dz-drag-hover .dz-message{opacity:.5}.dropzone .dz-message{text-align:center;margin:2em 0}.dropzone .dz-preview{position:relative;display:inline-block;vertical-align:top;margin:16px;min-height:100px}.dropzone .dz-preview:hover{z-index:1000}.dropzone .dz-preview.dz-file-preview .dz-image{border-radius:20px;background:#999;background:-webkit-gradient(linear,left top,left bottom,from(#eee),to(#ddd));background:linear-gradient(to bottom,#eee,#ddd)}.dropzone .dz-preview.dz-file-preview .dz-details{opacity:1}.dropzone .dz-preview.dz-image-preview{background:#fff}.dropzone .dz-preview.dz-image-preview .dz-details{-webkit-transition:opacity .2s linear;transition:opacity .2s linear}.dropzone .dz-preview .dz-remove{font-size:14px;text-align:center;display:block;cursor:pointer;border:none}.dropzone .dz-preview .dz-remove:hover{text-decoration:underline}.dropzone .dz-preview:hover .dz-details{opacity:1}.dropzone .dz-preview .dz-details{z-index:20;position:absolute;top:0;left:0;opacity:0;font-size:13px;min-width:100%;max-width:100%;padding:2em 1em;text-align:center;color:rgba(0,0,0,.9);line-height:150%}.dropzone .dz-preview .dz-details .dz-size{margin-bottom:1em;font-size:16px}.dropzone .dz-preview .dz-details .dz-filename{white-space:nowrap}.dropzone .dz-preview .dz-details .dz-filename:hover span{border:1px solid rgba(200,200,200,.8);background-color:rgba(255,255,255,.8)}.dropzone .dz-preview .dz-details .dz-filename:not(:hover){overflow:hidden;text-overflow:ellipsis}.dropzone .dz-preview .dz-details .dz-filename:not(:hover) span{border:1px solid transparent}.dropzone .dz-preview .dz-details .dz-filename span,.dropzone .dz-preview .dz-details .dz-size span{background-color:rgba(255,255,255,.4);padding:0 .4em;border-radius:3px}.dropzone .dz-preview:hover .dz-image img{-webkit-transform:scale(1.05,1.05);transform:scale(1.05,1.05);-webkit-filter:blur(8px);filter:blur(8px)}.dropzone .dz-preview .dz-image{border-radius:20px;overflow:hidden;width:120px;height:120px;position:relative;display:block;z-index:10}.dropzone .dz-preview .dz-image img{display:block}.dropzone .dz-preview.dz-success .dz-success-mark{-webkit-animation:3s cubic-bezier(.77,0,.175,1) passing-through;animation:3s cubic-bezier(.77,0,.175,1) passing-through}.dropzone .dz-preview.dz-error .dz-error-mark{opacity:1;-webkit-animation:3s cubic-bezier(.77,0,.175,1) slide-in;animation:3s cubic-bezier(.77,0,.175,1) slide-in}.dropzone .dz-preview .dz-error-mark,.dropzone .dz-preview .dz-success-mark{pointer-events:none;opacity:0;z-index:500;position:absolute;display:block;top:50%;left:50%;margin-left:-27px;margin-top:-27px}.dropzone .dz-preview .dz-error-mark svg,.dropzone .dz-preview .dz-success-mark svg{display:block;width:54px;height:54px}.dropzone .dz-preview.dz-processing .dz-progress{opacity:1;-webkit-transition:.2s linear;transition:.2s linear}.dropzone .dz-preview.dz-complete .dz-progress{opacity:0;-webkit-transition:opacity .4s ease-in;transition:opacity .4s ease-in}.dropzone .dz-preview:not(.dz-processing) .dz-progress{-webkit-animation:6s infinite pulse;animation:6s infinite pulse}.dropzone .dz-preview .dz-progress{opacity:1;z-index:1000;pointer-events:none;position:absolute;height:16px;left:50%;top:50%;margin-top:-8px;width:80px;margin-left:-40px;background:rgba(255,255,255,.9);-webkit-transform:scale(1);border-radius:8px;overflow:hidden}.dropzone .dz-preview .dz-progress .dz-upload{background:#333;background:-webkit-gradient(linear,left top,left bottom,from(#666),to(#444));background:linear-gradient(to bottom,#666,#444);position:absolute;top:0;left:0;bottom:0;width:0;-webkit-transition:width .3s ease-in-out;transition:width .3s ease-in-out}.dropzone .dz-preview.dz-error .dz-error-message{display:block}.dropzone .dz-preview.dz-error:hover .dz-error-message{opacity:1;pointer-events:auto}.dropzone .dz-preview .dz-error-message{pointer-events:none;z-index:1000;position:absolute;display:none;opacity:0;-webkit-transition:opacity .3s;transition:opacity .3s;border-radius:8px;font-size:13px;top:130px;left:-10px;width:140px;background:#be2626;background:-webkit-gradient(linear,left top,left bottom,from(#be2626),to(#a92222));background:linear-gradient(to bottom,#be2626,#a92222);padding:.5em 1.2em;color:#fff}.dropzone .dz-preview .dz-error-message:after{content:'';position:absolute;top:-6px;left:64px;width:0;height:0;border-left:6px solid transparent;border-right:6px solid transparent;border-bottom:6px solid #be2626}\"] }]\n }], function () { return [{ type: Object, decorators: [{\n type: Inject,\n args: [PLATFORM_ID]\n }] }]; }, { disabled: [{\n type: Input\n }], message: [{\n type: Input\n }], placeholder: [{\n type: Input\n }], useDropzoneClass: [{\n type: Input\n }], DZ_INIT: [{\n type: Output,\n args: ['init']\n }], DZ_ERROR: [{\n type: Output,\n args: ['error']\n }], DZ_SUCCESS: [{\n type: Output,\n args: ['success']\n }], DZ_SENDING: [{\n type: Output,\n args: ['sending']\n }], DZ_CANCELED: [{\n type: Output,\n args: ['canceled']\n }], DZ_COMPLETE: [{\n type: Output,\n args: ['complete']\n }], DZ_PROCESSING: [{\n type: Output,\n args: ['processing']\n }], DZ_DROP: [{\n type: Output,\n args: ['drop']\n }], DZ_DRAGSTART: [{\n type: Output,\n args: ['dragStart']\n }], DZ_DRAGEND: [{\n type: Output,\n args: ['dragEnd']\n }], DZ_DRAGENTER: [{\n type: Output,\n args: ['dragEnter']\n }], DZ_DRAGOVER: [{\n type: Output,\n args: ['dragOver']\n }], DZ_DRAGLEAVE: [{\n type: Output,\n args: ['dragLeave']\n }], DZ_THUMBNAIL: [{\n type: Output,\n args: ['thumbnail']\n }], DZ_ADDEDFILE: [{\n type: Output,\n args: ['addedFile']\n }], DZ_REMOVEDFILE: [{\n type: Output,\n args: ['removedFile']\n }], DZ_UPLOADPROGRESS: [{\n type: Output,\n args: ['uploadProgress']\n }], DZ_MAXFILESREACHED: [{\n type: Output,\n args: ['maxFilesReached']\n }], DZ_MAXFILESEXCEEDED: [{\n type: Output,\n args: ['maxFilesExceeded']\n }], DZ_SUCCESSMULTIPLE: [{\n type: Output,\n args: ['successMultiple']\n }], DZ_SENDINGMULTIPLE: [{\n type: Output,\n args: ['sendingMultiple']\n }], DZ_CANCELEDMULTIPLE: [{\n type: Output,\n args: ['canceledMultiple']\n }], DZ_COMPLETEMULTIPLE: [{\n type: Output,\n args: ['completeMultiple']\n }], DZ_PROCESSINGMULTIPLE: [{\n type: Output,\n args: ['processingMultiple']\n }], DZ_RESET: [{\n type: Output,\n args: ['reset']\n }], DZ_QUEUECOMPLETE: [{\n type: Output,\n args: ['queueComplete']\n }], DZ_TOTALUPLOADPROGRESS: [{\n type: Output,\n args: ['totalUploadProgress']\n }], config: [{\n type: Input\n }], directiveRef: [{\n type: ViewChild,\n args: [DropzoneDirective, { static: true }]\n }] }); })();\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(DropzoneModule, [{\n type: NgModule,\n args: [{\n imports: [CommonModule],\n declarations: [DropzoneComponent, DropzoneDirective],\n exports: [CommonModule, DropzoneComponent, DropzoneDirective]\n }]\n }], null, null); })();\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(DropzoneModule, { declarations: function () { return [DropzoneComponent, DropzoneDirective]; }, imports: function () { return [CommonModule]; }, exports: function () { return [CommonModule, DropzoneComponent, DropzoneDirective]; } }); })();\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { DROPZONE_CONFIG, DropzoneComponent, DropzoneConfig, DropzoneDirective, DropzoneModule };\n\n","import { __decorate, __param } from 'tslib';\nimport { ElementRef, Directive, NgModule, InjectionToken, Inject, ɵɵdefineInjectable, ɵɵinject, Injectable, ComponentFactoryResolver, ApplicationRef, SecurityContext, Injector, NgZone, INJECTOR, HostBinding, HostListener, Component } from '@angular/core';\nimport { trigger, state, style, transition, animate } from '@angular/animations';\nimport { Subject } from 'rxjs';\nimport { DomSanitizer } from '@angular/platform-browser';\nimport { DOCUMENT, CommonModule } from '@angular/common';\n\nimport * as ɵngcc0 from '@angular/core';\nimport * as ɵngcc1 from '@angular/platform-browser';\nimport * as ɵngcc2 from '@angular/common';\n\nconst _c0 = [\"toast-component\", \"\"];\nfunction Toast_button_0_Template(rf, ctx) { if (rf & 1) {\n const _r6 = ɵngcc0.ɵɵgetCurrentView();\n ɵngcc0.ɵɵelementStart(0, \"button\", 5);\n ɵngcc0.ɵɵlistener(\"click\", function Toast_button_0_Template_button_click_0_listener() { ɵngcc0.ɵɵrestoreView(_r6); const ctx_r5 = ɵngcc0.ɵɵnextContext(); return ɵngcc0.ɵɵresetView(ctx_r5.remove()); });\n ɵngcc0.ɵɵelementStart(1, \"span\", 6);\n ɵngcc0.ɵɵtext(2, \"\\u00D7\");\n ɵngcc0.ɵɵelementEnd()();\n} }\nfunction Toast_div_1_ng_container_2_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵelementContainerStart(0);\n ɵngcc0.ɵɵtext(1);\n ɵngcc0.ɵɵelementContainerEnd();\n} if (rf & 2) {\n const ctx_r7 = ɵngcc0.ɵɵnextContext(2);\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵtextInterpolate1(\"[\", ctx_r7.duplicatesCount + 1, \"]\");\n} }\nfunction Toast_div_1_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵelementStart(0, \"div\");\n ɵngcc0.ɵɵtext(1);\n ɵngcc0.ɵɵtemplate(2, Toast_div_1_ng_container_2_Template, 2, 1, \"ng-container\", 4);\n ɵngcc0.ɵɵelementEnd();\n} if (rf & 2) {\n const ctx_r1 = ɵngcc0.ɵɵnextContext();\n ɵngcc0.ɵɵclassMap(ctx_r1.options.titleClass);\n ɵngcc0.ɵɵattribute(\"aria-label\", ctx_r1.title);\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵtextInterpolate1(\" \", ctx_r1.title, \" \");\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵproperty(\"ngIf\", ctx_r1.duplicatesCount);\n} }\nfunction Toast_div_2_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵelement(0, \"div\", 7);\n} if (rf & 2) {\n const ctx_r2 = ɵngcc0.ɵɵnextContext();\n ɵngcc0.ɵɵclassMap(ctx_r2.options.messageClass);\n ɵngcc0.ɵɵproperty(\"innerHTML\", ctx_r2.message, ɵngcc0.ɵɵsanitizeHtml);\n} }\nfunction Toast_div_3_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵelementStart(0, \"div\", 8);\n ɵngcc0.ɵɵtext(1);\n ɵngcc0.ɵɵelementEnd();\n} if (rf & 2) {\n const ctx_r3 = ɵngcc0.ɵɵnextContext();\n ɵngcc0.ɵɵclassMap(ctx_r3.options.messageClass);\n ɵngcc0.ɵɵattribute(\"aria-label\", ctx_r3.message);\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵtextInterpolate1(\" \", ctx_r3.message, \" \");\n} }\nfunction Toast_div_4_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵelementStart(0, \"div\");\n ɵngcc0.ɵɵelement(1, \"div\", 9);\n ɵngcc0.ɵɵelementEnd();\n} if (rf & 2) {\n const ctx_r4 = ɵngcc0.ɵɵnextContext();\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵstyleProp(\"width\", ctx_r4.width + \"%\");\n} }\nfunction ToastNoAnimation_button_0_Template(rf, ctx) { if (rf & 1) {\n const _r6 = ɵngcc0.ɵɵgetCurrentView();\n ɵngcc0.ɵɵelementStart(0, \"button\", 5);\n ɵngcc0.ɵɵlistener(\"click\", function ToastNoAnimation_button_0_Template_button_click_0_listener() { ɵngcc0.ɵɵrestoreView(_r6); const ctx_r5 = ɵngcc0.ɵɵnextContext(); return ɵngcc0.ɵɵresetView(ctx_r5.remove()); });\n ɵngcc0.ɵɵelementStart(1, \"span\", 6);\n ɵngcc0.ɵɵtext(2, \"\\u00D7\");\n ɵngcc0.ɵɵelementEnd()();\n} }\nfunction ToastNoAnimation_div_1_ng_container_2_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵelementContainerStart(0);\n ɵngcc0.ɵɵtext(1);\n ɵngcc0.ɵɵelementContainerEnd();\n} if (rf & 2) {\n const ctx_r7 = ɵngcc0.ɵɵnextContext(2);\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵtextInterpolate1(\"[\", ctx_r7.duplicatesCount + 1, \"]\");\n} }\nfunction ToastNoAnimation_div_1_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵelementStart(0, \"div\");\n ɵngcc0.ɵɵtext(1);\n ɵngcc0.ɵɵtemplate(2, ToastNoAnimation_div_1_ng_container_2_Template, 2, 1, \"ng-container\", 4);\n ɵngcc0.ɵɵelementEnd();\n} if (rf & 2) {\n const ctx_r1 = ɵngcc0.ɵɵnextContext();\n ɵngcc0.ɵɵclassMap(ctx_r1.options.titleClass);\n ɵngcc0.ɵɵattribute(\"aria-label\", ctx_r1.title);\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵtextInterpolate1(\" \", ctx_r1.title, \" \");\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵproperty(\"ngIf\", ctx_r1.duplicatesCount);\n} }\nfunction ToastNoAnimation_div_2_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵelement(0, \"div\", 7);\n} if (rf & 2) {\n const ctx_r2 = ɵngcc0.ɵɵnextContext();\n ɵngcc0.ɵɵclassMap(ctx_r2.options.messageClass);\n ɵngcc0.ɵɵproperty(\"innerHTML\", ctx_r2.message, ɵngcc0.ɵɵsanitizeHtml);\n} }\nfunction ToastNoAnimation_div_3_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵelementStart(0, \"div\", 8);\n ɵngcc0.ɵɵtext(1);\n ɵngcc0.ɵɵelementEnd();\n} if (rf & 2) {\n const ctx_r3 = ɵngcc0.ɵɵnextContext();\n ɵngcc0.ɵɵclassMap(ctx_r3.options.messageClass);\n ɵngcc0.ɵɵattribute(\"aria-label\", ctx_r3.message);\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵtextInterpolate1(\" \", ctx_r3.message, \" \");\n} }\nfunction ToastNoAnimation_div_4_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵelementStart(0, \"div\");\n ɵngcc0.ɵɵelement(1, \"div\", 9);\n ɵngcc0.ɵɵelementEnd();\n} if (rf & 2) {\n const ctx_r4 = ɵngcc0.ɵɵnextContext();\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵstyleProp(\"width\", ctx_r4.width + \"%\");\n} }\nlet ToastContainerDirective = class ToastContainerDirective {\n constructor(el) {\n this.el = el;\n }\n getContainerElement() {\n return this.el.nativeElement;\n }\n};\nToastContainerDirective.ɵfac = function ToastContainerDirective_Factory(t) { return new (t || ToastContainerDirective)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef)); };\nToastContainerDirective.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: ToastContainerDirective, selectors: [[\"\", \"toastContainer\", \"\"]], exportAs: [\"toastContainer\"] });\nToastContainerDirective.ctorParameters = () => [\n { type: ElementRef }\n];\nlet ToastContainerModule = class ToastContainerModule {\n};\nToastContainerModule.ɵfac = function ToastContainerModule_Factory(t) { return new (t || ToastContainerModule)(); };\nToastContainerModule.ɵmod = /*@__PURE__*/ ɵngcc0.ɵɵdefineNgModule({ type: ToastContainerModule });\nToastContainerModule.ɵinj = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjector({});\n\n/**\n * Everything a toast needs to launch\n */\nclass ToastPackage {\n constructor(toastId, config, message, title, toastType, toastRef) {\n this.toastId = toastId;\n this.config = config;\n this.message = message;\n this.title = title;\n this.toastType = toastType;\n this.toastRef = toastRef;\n this._onTap = new Subject();\n this._onAction = new Subject();\n this.toastRef.afterClosed().subscribe(() => {\n this._onAction.complete();\n this._onTap.complete();\n });\n }\n /** Fired on click */\n triggerTap() {\n this._onTap.next();\n if (this.config.tapToDismiss) {\n this._onTap.complete();\n }\n }\n onTap() {\n return this._onTap.asObservable();\n }\n /** available for use in custom toast */\n triggerAction(action) {\n this._onAction.next(action);\n }\n onAction() {\n return this._onAction.asObservable();\n }\n}\nconst DefaultNoComponentGlobalConfig = {\n maxOpened: 0,\n autoDismiss: false,\n newestOnTop: true,\n preventDuplicates: false,\n countDuplicates: false,\n resetTimeoutOnDuplicate: false,\n iconClasses: {\n error: 'toast-error',\n info: 'toast-info',\n success: 'toast-success',\n warning: 'toast-warning',\n },\n // Individual\n closeButton: false,\n disableTimeOut: false,\n timeOut: 5000,\n extendedTimeOut: 1000,\n enableHtml: false,\n progressBar: false,\n toastClass: 'ngx-toastr',\n positionClass: 'toast-top-right',\n titleClass: 'toast-title',\n messageClass: 'toast-message',\n easing: 'ease-in',\n easeTime: 300,\n tapToDismiss: true,\n onActivateTick: false,\n progressAnimation: 'decreasing',\n};\nconst TOAST_CONFIG = new InjectionToken('ToastConfig');\n\n/**\n * A `ComponentPortal` is a portal that instantiates some Component upon attachment.\n */\nclass ComponentPortal {\n constructor(component, injector) {\n this.component = component;\n this.injector = injector;\n }\n /** Attach this portal to a host. */\n attach(host, newestOnTop) {\n this._attachedHost = host;\n return host.attach(this, newestOnTop);\n }\n /** Detach this portal from its host */\n detach() {\n const host = this._attachedHost;\n if (host) {\n this._attachedHost = undefined;\n return host.detach();\n }\n }\n /** Whether this portal is attached to a host. */\n get isAttached() {\n return this._attachedHost != null;\n }\n /**\n * Sets the PortalHost reference without performing `attach()`. This is used directly by\n * the PortalHost when it is performing an `attach()` or `detach()`.\n */\n setAttachedHost(host) {\n this._attachedHost = host;\n }\n}\n/**\n * Partial implementation of PortalHost that only deals with attaching a\n * ComponentPortal\n */\nclass BasePortalHost {\n attach(portal, newestOnTop) {\n this._attachedPortal = portal;\n return this.attachComponentPortal(portal, newestOnTop);\n }\n detach() {\n if (this._attachedPortal) {\n this._attachedPortal.setAttachedHost();\n }\n this._attachedPortal = undefined;\n if (this._disposeFn) {\n this._disposeFn();\n this._disposeFn = undefined;\n }\n }\n setDisposeFn(fn) {\n this._disposeFn = fn;\n }\n}\n\n/**\n * A PortalHost for attaching portals to an arbitrary DOM element outside of the Angular\n * application context.\n *\n * This is the only part of the portal core that directly touches the DOM.\n */\nclass DomPortalHost extends BasePortalHost {\n constructor(_hostDomElement, _componentFactoryResolver, _appRef) {\n super();\n this._hostDomElement = _hostDomElement;\n this._componentFactoryResolver = _componentFactoryResolver;\n this._appRef = _appRef;\n }\n /**\n * Attach the given ComponentPortal to DOM element using the ComponentFactoryResolver.\n * @param portal Portal to be attached\n */\n attachComponentPortal(portal, newestOnTop) {\n const componentFactory = this._componentFactoryResolver.resolveComponentFactory(portal.component);\n let componentRef;\n // If the portal specifies a ViewContainerRef, we will use that as the attachment point\n // for the component (in terms of Angular's component tree, not rendering).\n // When the ViewContainerRef is missing, we use the factory to create the component directly\n // and then manually attach the ChangeDetector for that component to the application (which\n // happens automatically when using a ViewContainer).\n componentRef = componentFactory.create(portal.injector);\n // When creating a component outside of a ViewContainer, we need to manually register\n // its ChangeDetector with the application. This API is unfortunately not yet published\n // in Angular core. The change detector must also be deregistered when the component\n // is destroyed to prevent memory leaks.\n this._appRef.attachView(componentRef.hostView);\n this.setDisposeFn(() => {\n this._appRef.detachView(componentRef.hostView);\n componentRef.destroy();\n });\n // At this point the component has been instantiated, so we move it to the location in the DOM\n // where we want it to be rendered.\n if (newestOnTop) {\n this._hostDomElement.insertBefore(this._getComponentRootNode(componentRef), this._hostDomElement.firstChild);\n }\n else {\n this._hostDomElement.appendChild(this._getComponentRootNode(componentRef));\n }\n return componentRef;\n }\n /** Gets the root HTMLElement for an instantiated component. */\n _getComponentRootNode(componentRef) {\n return componentRef.hostView.rootNodes[0];\n }\n}\n\n/** Container inside which all toasts will render. */\nlet OverlayContainer = class OverlayContainer {\n constructor(_document) {\n this._document = _document;\n }\n ngOnDestroy() {\n if (this._containerElement && this._containerElement.parentNode) {\n this._containerElement.parentNode.removeChild(this._containerElement);\n }\n }\n /**\n * This method returns the overlay container element. It will lazily\n * create the element the first time it is called to facilitate using\n * the container in non-browser environments.\n * @returns the container element\n */\n getContainerElement() {\n if (!this._containerElement) {\n this._createContainer();\n }\n return this._containerElement;\n }\n /**\n * Create the overlay container element, which is simply a div\n * with the 'cdk-overlay-container' class on the document body.\n */\n _createContainer() {\n const container = this._document.createElement('div');\n container.classList.add('overlay-container');\n this._document.body.appendChild(container);\n this._containerElement = container;\n }\n};\nOverlayContainer.ɵfac = function OverlayContainer_Factory(t) { return new (t || OverlayContainer)(ɵngcc0.ɵɵinject(DOCUMENT)); };\nOverlayContainer.ctorParameters = () => [\n { type: undefined, decorators: [{ type: Inject, args: [DOCUMENT,] }] }\n];\nOverlayContainer.ɵprov = ɵɵdefineInjectable({ factory: function OverlayContainer_Factory() { return new OverlayContainer(ɵɵinject(DOCUMENT)); }, token: OverlayContainer, providedIn: \"root\" });\nOverlayContainer = __decorate([ __param(0, Inject(DOCUMENT))\n], OverlayContainer);\n\n/**\n * Reference to an overlay that has been created with the Overlay service.\n * Used to manipulate or dispose of said overlay.\n */\nclass OverlayRef {\n constructor(_portalHost) {\n this._portalHost = _portalHost;\n }\n attach(portal, newestOnTop = true) {\n return this._portalHost.attach(portal, newestOnTop);\n }\n /**\n * Detaches an overlay from a portal.\n * @returns Resolves when the overlay has been detached.\n */\n detach() {\n return this._portalHost.detach();\n }\n}\n\n/**\n * Service to create Overlays. Overlays are dynamically added pieces of floating UI, meant to be\n * used as a low-level building building block for other components. Dialogs, tooltips, menus,\n * selects, etc. can all be built using overlays. The service should primarily be used by authors\n * of re-usable components rather than developers building end-user applications.\n *\n * An overlay *is* a PortalHost, so any kind of Portal can be loaded into one.\n */\nlet Overlay = class Overlay {\n constructor(_overlayContainer, _componentFactoryResolver, _appRef, _document) {\n this._overlayContainer = _overlayContainer;\n this._componentFactoryResolver = _componentFactoryResolver;\n this._appRef = _appRef;\n this._document = _document;\n // Namespace panes by overlay container\n this._paneElements = new Map();\n }\n /**\n * Creates an overlay.\n * @returns A reference to the created overlay.\n */\n create(positionClass, overlayContainer) {\n // get existing pane if possible\n return this._createOverlayRef(this.getPaneElement(positionClass, overlayContainer));\n }\n getPaneElement(positionClass = '', overlayContainer) {\n if (!this._paneElements.get(overlayContainer)) {\n this._paneElements.set(overlayContainer, {});\n }\n if (!this._paneElements.get(overlayContainer)[positionClass]) {\n this._paneElements.get(overlayContainer)[positionClass] = this._createPaneElement(positionClass, overlayContainer);\n }\n return this._paneElements.get(overlayContainer)[positionClass];\n }\n /**\n * Creates the DOM element for an overlay and appends it to the overlay container.\n * @returns Newly-created pane element\n */\n _createPaneElement(positionClass, overlayContainer) {\n const pane = this._document.createElement('div');\n pane.id = 'toast-container';\n pane.classList.add(positionClass);\n pane.classList.add('toast-container');\n if (!overlayContainer) {\n this._overlayContainer.getContainerElement().appendChild(pane);\n }\n else {\n overlayContainer.getContainerElement().appendChild(pane);\n }\n return pane;\n }\n /**\n * Create a DomPortalHost into which the overlay content can be loaded.\n * @param pane The DOM element to turn into a portal host.\n * @returns A portal host for the given DOM element.\n */\n _createPortalHost(pane) {\n return new DomPortalHost(pane, this._componentFactoryResolver, this._appRef);\n }\n /**\n * Creates an OverlayRef for an overlay in the given DOM element.\n * @param pane DOM element for the overlay\n */\n _createOverlayRef(pane) {\n return new OverlayRef(this._createPortalHost(pane));\n }\n};\nOverlay.ɵfac = function Overlay_Factory(t) { return new (t || Overlay)(ɵngcc0.ɵɵinject(OverlayContainer), ɵngcc0.ɵɵinject(ɵngcc0.ComponentFactoryResolver), ɵngcc0.ɵɵinject(ɵngcc0.ApplicationRef), ɵngcc0.ɵɵinject(DOCUMENT)); };\nOverlay.ctorParameters = () => [\n { type: OverlayContainer },\n { type: ComponentFactoryResolver },\n { type: ApplicationRef },\n { type: undefined, decorators: [{ type: Inject, args: [DOCUMENT,] }] }\n];\nOverlay.ɵprov = ɵɵdefineInjectable({ factory: function Overlay_Factory() { return new Overlay(ɵɵinject(OverlayContainer), ɵɵinject(ComponentFactoryResolver), ɵɵinject(ApplicationRef), ɵɵinject(DOCUMENT)); }, token: Overlay, providedIn: \"root\" });\nOverlay = __decorate([ __param(3, Inject(DOCUMENT))\n], Overlay);\n\n/**\n * Reference to a toast opened via the Toastr service.\n */\nclass ToastRef {\n constructor(_overlayRef) {\n this._overlayRef = _overlayRef;\n /** Count of duplicates of this toast */\n this.duplicatesCount = 0;\n /** Subject for notifying the user that the toast has finished closing. */\n this._afterClosed = new Subject();\n /** triggered when toast is activated */\n this._activate = new Subject();\n /** notifies the toast that it should close before the timeout */\n this._manualClose = new Subject();\n /** notifies the toast that it should reset the timeouts */\n this._resetTimeout = new Subject();\n /** notifies the toast that it should count a duplicate toast */\n this._countDuplicate = new Subject();\n }\n manualClose() {\n this._manualClose.next();\n this._manualClose.complete();\n }\n manualClosed() {\n return this._manualClose.asObservable();\n }\n timeoutReset() {\n return this._resetTimeout.asObservable();\n }\n countDuplicate() {\n return this._countDuplicate.asObservable();\n }\n /**\n * Close the toast.\n */\n close() {\n this._overlayRef.detach();\n this._afterClosed.next();\n this._manualClose.next();\n this._afterClosed.complete();\n this._manualClose.complete();\n this._activate.complete();\n this._resetTimeout.complete();\n this._countDuplicate.complete();\n }\n /** Gets an observable that is notified when the toast is finished closing. */\n afterClosed() {\n return this._afterClosed.asObservable();\n }\n isInactive() {\n return this._activate.isStopped;\n }\n activate() {\n this._activate.next();\n this._activate.complete();\n }\n /** Gets an observable that is notified when the toast has started opening. */\n afterActivate() {\n return this._activate.asObservable();\n }\n /** Reset the toast timouts and count duplicates */\n onDuplicate(resetTimeout, countDuplicate) {\n if (resetTimeout) {\n this._resetTimeout.next();\n }\n if (countDuplicate) {\n this._countDuplicate.next(++this.duplicatesCount);\n }\n }\n}\n/** Custom injector type specifically for instantiating components with a toast. */\nclass ToastInjector {\n constructor(_toastPackage, _parentInjector) {\n this._toastPackage = _toastPackage;\n this._parentInjector = _parentInjector;\n }\n get(token, notFoundValue, flags) {\n if (token === ToastPackage) {\n return this._toastPackage;\n }\n return this._parentInjector.get(token, notFoundValue, flags);\n }\n}\n\nlet ToastrService = class ToastrService {\n constructor(token, overlay, _injector, sanitizer, ngZone) {\n this.overlay = overlay;\n this._injector = _injector;\n this.sanitizer = sanitizer;\n this.ngZone = ngZone;\n this.currentlyActive = 0;\n this.toasts = [];\n this.index = 0;\n this.toastrConfig = Object.assign(Object.assign({}, token.default), token.config);\n if (token.config.iconClasses) {\n this.toastrConfig.iconClasses = Object.assign(Object.assign({}, token.default.iconClasses), token.config.iconClasses);\n }\n }\n /** show toast */\n show(message, title, override = {}, type = '') {\n return this._preBuildNotification(type, message, title, this.applyConfig(override));\n }\n /** show successful toast */\n success(message, title, override = {}) {\n const type = this.toastrConfig.iconClasses.success || '';\n return this._preBuildNotification(type, message, title, this.applyConfig(override));\n }\n /** show error toast */\n error(message, title, override = {}) {\n const type = this.toastrConfig.iconClasses.error || '';\n return this._preBuildNotification(type, message, title, this.applyConfig(override));\n }\n /** show info toast */\n info(message, title, override = {}) {\n const type = this.toastrConfig.iconClasses.info || '';\n return this._preBuildNotification(type, message, title, this.applyConfig(override));\n }\n /** show warning toast */\n warning(message, title, override = {}) {\n const type = this.toastrConfig.iconClasses.warning || '';\n return this._preBuildNotification(type, message, title, this.applyConfig(override));\n }\n /**\n * Remove all or a single toast by id\n */\n clear(toastId) {\n // Call every toastRef manualClose function\n for (const toast of this.toasts) {\n if (toastId !== undefined) {\n if (toast.toastId === toastId) {\n toast.toastRef.manualClose();\n return;\n }\n }\n else {\n toast.toastRef.manualClose();\n }\n }\n }\n /**\n * Remove and destroy a single toast by id\n */\n remove(toastId) {\n const found = this._findToast(toastId);\n if (!found) {\n return false;\n }\n found.activeToast.toastRef.close();\n this.toasts.splice(found.index, 1);\n this.currentlyActive = this.currentlyActive - 1;\n if (!this.toastrConfig.maxOpened || !this.toasts.length) {\n return false;\n }\n if (this.currentlyActive < this.toastrConfig.maxOpened &&\n this.toasts[this.currentlyActive]) {\n const p = this.toasts[this.currentlyActive].toastRef;\n if (!p.isInactive()) {\n this.currentlyActive = this.currentlyActive + 1;\n p.activate();\n }\n }\n return true;\n }\n /**\n * Determines if toast message is already shown\n */\n findDuplicate(message, resetOnDuplicate, countDuplicates) {\n for (const toast of this.toasts) {\n if (toast.message === message) {\n toast.toastRef.onDuplicate(resetOnDuplicate, countDuplicates);\n return toast;\n }\n }\n return null;\n }\n /** create a clone of global config and apply individual settings */\n applyConfig(override = {}) {\n return Object.assign(Object.assign({}, this.toastrConfig), override);\n }\n /**\n * Find toast object by id\n */\n _findToast(toastId) {\n for (let i = 0; i < this.toasts.length; i++) {\n if (this.toasts[i].toastId === toastId) {\n return { index: i, activeToast: this.toasts[i] };\n }\n }\n return null;\n }\n /**\n * Determines the need to run inside angular's zone then builds the toast\n */\n _preBuildNotification(toastType, message, title, config) {\n if (config.onActivateTick) {\n return this.ngZone.run(() => this._buildNotification(toastType, message, title, config));\n }\n return this._buildNotification(toastType, message, title, config);\n }\n /**\n * Creates and attaches toast data to component\n * returns the active toast, or in case preventDuplicates is enabled the original/non-duplicate active toast.\n */\n _buildNotification(toastType, message, title, config) {\n if (!config.toastComponent) {\n throw new Error('toastComponent required');\n }\n // max opened and auto dismiss = true\n // if timeout = 0 resetting it would result in setting this.hideTime = Date.now(). Hence, we only want to reset timeout if there is\n // a timeout at all\n const duplicate = this.findDuplicate(message, this.toastrConfig.resetTimeoutOnDuplicate && config.timeOut > 0, this.toastrConfig.countDuplicates);\n if (message && this.toastrConfig.preventDuplicates && duplicate !== null) {\n return duplicate;\n }\n this.previousToastMessage = message;\n let keepInactive = false;\n if (this.toastrConfig.maxOpened &&\n this.currentlyActive >= this.toastrConfig.maxOpened) {\n keepInactive = true;\n if (this.toastrConfig.autoDismiss) {\n this.clear(this.toasts[0].toastId);\n }\n }\n const overlayRef = this.overlay.create(config.positionClass, this.overlayContainer);\n this.index = this.index + 1;\n let sanitizedMessage = message;\n if (message && config.enableHtml) {\n sanitizedMessage = this.sanitizer.sanitize(SecurityContext.HTML, message);\n }\n const toastRef = new ToastRef(overlayRef);\n const toastPackage = new ToastPackage(this.index, config, sanitizedMessage, title, toastType, toastRef);\n const toastInjector = new ToastInjector(toastPackage, this._injector);\n const component = new ComponentPortal(config.toastComponent, toastInjector);\n const portal = overlayRef.attach(component, this.toastrConfig.newestOnTop);\n toastRef.componentInstance = portal.instance;\n const ins = {\n toastId: this.index,\n message: message || '',\n toastRef,\n onShown: toastRef.afterActivate(),\n onHidden: toastRef.afterClosed(),\n onTap: toastPackage.onTap(),\n onAction: toastPackage.onAction(),\n portal\n };\n if (!keepInactive) {\n this.currentlyActive = this.currentlyActive + 1;\n setTimeout(() => {\n ins.toastRef.activate();\n });\n }\n this.toasts.push(ins);\n return ins;\n }\n};\nToastrService.ɵfac = function ToastrService_Factory(t) { return new (t || ToastrService)(ɵngcc0.ɵɵinject(TOAST_CONFIG), ɵngcc0.ɵɵinject(Overlay), ɵngcc0.ɵɵinject(ɵngcc0.Injector), ɵngcc0.ɵɵinject(ɵngcc1.DomSanitizer), ɵngcc0.ɵɵinject(ɵngcc0.NgZone)); };\nToastrService.ctorParameters = () => [\n { type: undefined, decorators: [{ type: Inject, args: [TOAST_CONFIG,] }] },\n { type: Overlay },\n { type: Injector },\n { type: DomSanitizer },\n { type: NgZone }\n];\nToastrService.ɵprov = ɵɵdefineInjectable({ factory: function ToastrService_Factory() { return new ToastrService(ɵɵinject(TOAST_CONFIG), ɵɵinject(Overlay), ɵɵinject(INJECTOR), ɵɵinject(DomSanitizer), ɵɵinject(NgZone)); }, token: ToastrService, providedIn: \"root\" });\nToastrService = __decorate([ __param(0, Inject(TOAST_CONFIG))\n], ToastrService);\n\nlet Toast = class Toast {\n constructor(toastrService, toastPackage, ngZone) {\n this.toastrService = toastrService;\n this.toastPackage = toastPackage;\n this.ngZone = ngZone;\n /** width of progress bar */\n this.width = -1;\n /** a combination of toast type and options.toastClass */\n this.toastClasses = '';\n /** controls animation */\n this.state = {\n value: 'inactive',\n params: {\n easeTime: this.toastPackage.config.easeTime,\n easing: 'ease-in'\n }\n };\n this.message = toastPackage.message;\n this.title = toastPackage.title;\n this.options = toastPackage.config;\n this.originalTimeout = toastPackage.config.timeOut;\n this.toastClasses = `${toastPackage.toastType} ${toastPackage.config.toastClass}`;\n this.sub = toastPackage.toastRef.afterActivate().subscribe(() => {\n this.activateToast();\n });\n this.sub1 = toastPackage.toastRef.manualClosed().subscribe(() => {\n this.remove();\n });\n this.sub2 = toastPackage.toastRef.timeoutReset().subscribe(() => {\n this.resetTimeout();\n });\n this.sub3 = toastPackage.toastRef.countDuplicate().subscribe(count => {\n this.duplicatesCount = count;\n });\n }\n /** hides component when waiting to be displayed */\n get displayStyle() {\n if (this.state.value === 'inactive') {\n return 'none';\n }\n }\n ngOnDestroy() {\n this.sub.unsubscribe();\n this.sub1.unsubscribe();\n this.sub2.unsubscribe();\n this.sub3.unsubscribe();\n clearInterval(this.intervalId);\n clearTimeout(this.timeout);\n }\n /**\n * activates toast and sets timeout\n */\n activateToast() {\n this.state = Object.assign(Object.assign({}, this.state), { value: 'active' });\n if (!(this.options.disableTimeOut === true || this.options.disableTimeOut === 'timeOut') && this.options.timeOut) {\n this.outsideTimeout(() => this.remove(), this.options.timeOut);\n this.hideTime = new Date().getTime() + this.options.timeOut;\n if (this.options.progressBar) {\n this.outsideInterval(() => this.updateProgress(), 10);\n }\n }\n }\n /**\n * updates progress bar width\n */\n updateProgress() {\n if (this.width === 0 || this.width === 100 || !this.options.timeOut) {\n return;\n }\n const now = new Date().getTime();\n const remaining = this.hideTime - now;\n this.width = (remaining / this.options.timeOut) * 100;\n if (this.options.progressAnimation === 'increasing') {\n this.width = 100 - this.width;\n }\n if (this.width <= 0) {\n this.width = 0;\n }\n if (this.width >= 100) {\n this.width = 100;\n }\n }\n resetTimeout() {\n clearTimeout(this.timeout);\n clearInterval(this.intervalId);\n this.state = Object.assign(Object.assign({}, this.state), { value: 'active' });\n this.outsideTimeout(() => this.remove(), this.originalTimeout);\n this.options.timeOut = this.originalTimeout;\n this.hideTime = new Date().getTime() + (this.options.timeOut || 0);\n this.width = -1;\n if (this.options.progressBar) {\n this.outsideInterval(() => this.updateProgress(), 10);\n }\n }\n /**\n * tells toastrService to remove this toast after animation time\n */\n remove() {\n if (this.state.value === 'removed') {\n return;\n }\n clearTimeout(this.timeout);\n this.state = Object.assign(Object.assign({}, this.state), { value: 'removed' });\n this.outsideTimeout(() => this.toastrService.remove(this.toastPackage.toastId), +this.toastPackage.config.easeTime);\n }\n tapToast() {\n if (this.state.value === 'removed') {\n return;\n }\n this.toastPackage.triggerTap();\n if (this.options.tapToDismiss) {\n this.remove();\n }\n }\n stickAround() {\n if (this.state.value === 'removed') {\n return;\n }\n clearTimeout(this.timeout);\n this.options.timeOut = 0;\n this.hideTime = 0;\n // disable progressBar\n clearInterval(this.intervalId);\n this.width = 0;\n }\n delayedHideToast() {\n if ((this.options.disableTimeOut === true || this.options.disableTimeOut === 'extendedTimeOut') ||\n this.options.extendedTimeOut === 0 ||\n this.state.value === 'removed') {\n return;\n }\n this.outsideTimeout(() => this.remove(), this.options.extendedTimeOut);\n this.options.timeOut = this.options.extendedTimeOut;\n this.hideTime = new Date().getTime() + (this.options.timeOut || 0);\n this.width = -1;\n if (this.options.progressBar) {\n this.outsideInterval(() => this.updateProgress(), 10);\n }\n }\n outsideTimeout(func, timeout) {\n if (this.ngZone) {\n this.ngZone.runOutsideAngular(() => (this.timeout = setTimeout(() => this.runInsideAngular(func), timeout)));\n }\n else {\n this.timeout = setTimeout(() => func(), timeout);\n }\n }\n outsideInterval(func, timeout) {\n if (this.ngZone) {\n this.ngZone.runOutsideAngular(() => (this.intervalId = setInterval(() => this.runInsideAngular(func), timeout)));\n }\n else {\n this.intervalId = setInterval(() => func(), timeout);\n }\n }\n runInsideAngular(func) {\n if (this.ngZone) {\n this.ngZone.run(() => func());\n }\n else {\n func();\n }\n }\n};\nToast.ɵfac = function Toast_Factory(t) { return new (t || Toast)(ɵngcc0.ɵɵdirectiveInject(ToastrService), ɵngcc0.ɵɵdirectiveInject(ToastPackage), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.NgZone)); };\nToast.ɵcmp = /*@__PURE__*/ ɵngcc0.ɵɵdefineComponent({ type: Toast, selectors: [[\"\", \"toast-component\", \"\"]], hostVars: 5, hostBindings: function Toast_HostBindings(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵlistener(\"click\", function Toast_click_HostBindingHandler() { return ctx.tapToast(); })(\"mouseenter\", function Toast_mouseenter_HostBindingHandler() { return ctx.stickAround(); })(\"mouseleave\", function Toast_mouseleave_HostBindingHandler() { return ctx.delayedHideToast(); });\n } if (rf & 2) {\n ɵngcc0.ɵɵsyntheticHostProperty(\"@flyInOut\", ctx.state);\n ɵngcc0.ɵɵclassMap(ctx.toastClasses);\n ɵngcc0.ɵɵstyleProp(\"display\", ctx.displayStyle);\n } }, attrs: _c0, decls: 5, vars: 5, consts: [[\"class\", \"toast-close-button\", \"aria-label\", \"Close\", 3, \"click\", 4, \"ngIf\"], [3, \"class\", 4, \"ngIf\"], [\"role\", \"alertdialog\", \"aria-live\", \"polite\", 3, \"class\", \"innerHTML\", 4, \"ngIf\"], [\"role\", \"alertdialog\", \"aria-live\", \"polite\", 3, \"class\", 4, \"ngIf\"], [4, \"ngIf\"], [\"aria-label\", \"Close\", 1, \"toast-close-button\", 3, \"click\"], [\"aria-hidden\", \"true\"], [\"role\", \"alertdialog\", \"aria-live\", \"polite\", 3, \"innerHTML\"], [\"role\", \"alertdialog\", \"aria-live\", \"polite\"], [1, \"toast-progress\"]], template: function Toast_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵtemplate(0, Toast_button_0_Template, 3, 0, \"button\", 0);\n ɵngcc0.ɵɵtemplate(1, Toast_div_1_Template, 3, 5, \"div\", 1);\n ɵngcc0.ɵɵtemplate(2, Toast_div_2_Template, 1, 3, \"div\", 2);\n ɵngcc0.ɵɵtemplate(3, Toast_div_3_Template, 2, 4, \"div\", 3);\n ɵngcc0.ɵɵtemplate(4, Toast_div_4_Template, 2, 2, \"div\", 4);\n } if (rf & 2) {\n ɵngcc0.ɵɵproperty(\"ngIf\", ctx.options.closeButton);\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵproperty(\"ngIf\", ctx.title);\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵproperty(\"ngIf\", ctx.message && ctx.options.enableHtml);\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵproperty(\"ngIf\", ctx.message && !ctx.options.enableHtml);\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵproperty(\"ngIf\", ctx.options.progressBar);\n } }, dependencies: [ɵngcc2.NgIf], encapsulation: 2, data: { animation: [\n trigger('flyInOut', [\n state('inactive', style({ opacity: 0 })),\n state('active', style({ opacity: 1 })),\n state('removed', style({ opacity: 0 })),\n transition('inactive => active', animate('{{ easeTime }}ms {{ easing }}')),\n transition('active => removed', animate('{{ easeTime }}ms {{ easing }}'))\n ])\n ] } });\nToast.ctorParameters = () => [\n { type: ToastrService },\n { type: ToastPackage },\n { type: NgZone }\n];\n__decorate([\n HostBinding('class')\n], Toast.prototype, \"toastClasses\", void 0);\n__decorate([\n HostBinding('@flyInOut')\n], Toast.prototype, \"state\", void 0);\n__decorate([\n HostBinding('style.display')\n], Toast.prototype, \"displayStyle\", null);\n__decorate([\n HostListener('click')\n], Toast.prototype, \"tapToast\", null);\n__decorate([\n HostListener('mouseenter')\n], Toast.prototype, \"stickAround\", null);\n__decorate([\n HostListener('mouseleave')\n], Toast.prototype, \"delayedHideToast\", null);\n\nvar ToastrModule_1;\nconst DefaultGlobalConfig = Object.assign(Object.assign({}, DefaultNoComponentGlobalConfig), { toastComponent: Toast });\nlet ToastrModule = ToastrModule_1 = class ToastrModule {\n static forRoot(config = {}) {\n return {\n ngModule: ToastrModule_1,\n providers: [\n {\n provide: TOAST_CONFIG,\n useValue: {\n default: DefaultGlobalConfig,\n config,\n },\n },\n ],\n };\n }\n};\nToastrModule.ɵfac = function ToastrModule_Factory(t) { return new (t || ToastrModule)(); };\nToastrModule.ɵmod = /*@__PURE__*/ ɵngcc0.ɵɵdefineNgModule({ type: ToastrModule });\nToastrModule.ɵinj = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjector({ imports: [CommonModule] });\nlet ToastrComponentlessModule = class ToastrComponentlessModule {\n static forRoot(config = {}) {\n return {\n ngModule: ToastrModule,\n providers: [\n {\n provide: TOAST_CONFIG,\n useValue: {\n default: DefaultNoComponentGlobalConfig,\n config,\n },\n },\n ],\n };\n }\n};\nToastrComponentlessModule.ɵfac = function ToastrComponentlessModule_Factory(t) { return new (t || ToastrComponentlessModule)(); };\nToastrComponentlessModule.ɵmod = /*@__PURE__*/ ɵngcc0.ɵɵdefineNgModule({ type: ToastrComponentlessModule });\nToastrComponentlessModule.ɵinj = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjector({ imports: [CommonModule] });\n\nvar ToastNoAnimationModule_1;\nlet ToastNoAnimation = class ToastNoAnimation {\n constructor(toastrService, toastPackage, appRef) {\n this.toastrService = toastrService;\n this.toastPackage = toastPackage;\n this.appRef = appRef;\n /** width of progress bar */\n this.width = -1;\n /** a combination of toast type and options.toastClass */\n this.toastClasses = '';\n /** controls animation */\n this.state = 'inactive';\n this.message = toastPackage.message;\n this.title = toastPackage.title;\n this.options = toastPackage.config;\n this.originalTimeout = toastPackage.config.timeOut;\n this.toastClasses = `${toastPackage.toastType} ${toastPackage.config.toastClass}`;\n this.sub = toastPackage.toastRef.afterActivate().subscribe(() => {\n this.activateToast();\n });\n this.sub1 = toastPackage.toastRef.manualClosed().subscribe(() => {\n this.remove();\n });\n this.sub2 = toastPackage.toastRef.timeoutReset().subscribe(() => {\n this.resetTimeout();\n });\n this.sub3 = toastPackage.toastRef.countDuplicate().subscribe(count => {\n this.duplicatesCount = count;\n });\n }\n /** hides component when waiting to be displayed */\n get displayStyle() {\n if (this.state === 'inactive') {\n return 'none';\n }\n }\n ngOnDestroy() {\n this.sub.unsubscribe();\n this.sub1.unsubscribe();\n this.sub2.unsubscribe();\n this.sub3.unsubscribe();\n clearInterval(this.intervalId);\n clearTimeout(this.timeout);\n }\n /**\n * activates toast and sets timeout\n */\n activateToast() {\n this.state = 'active';\n if (!(this.options.disableTimeOut === true || this.options.disableTimeOut === 'timeOut') && this.options.timeOut) {\n this.timeout = setTimeout(() => {\n this.remove();\n }, this.options.timeOut);\n this.hideTime = new Date().getTime() + this.options.timeOut;\n if (this.options.progressBar) {\n this.intervalId = setInterval(() => this.updateProgress(), 10);\n }\n }\n if (this.options.onActivateTick) {\n this.appRef.tick();\n }\n }\n /**\n * updates progress bar width\n */\n updateProgress() {\n if (this.width === 0 || this.width === 100 || !this.options.timeOut) {\n return;\n }\n const now = new Date().getTime();\n const remaining = this.hideTime - now;\n this.width = (remaining / this.options.timeOut) * 100;\n if (this.options.progressAnimation === 'increasing') {\n this.width = 100 - this.width;\n }\n if (this.width <= 0) {\n this.width = 0;\n }\n if (this.width >= 100) {\n this.width = 100;\n }\n }\n resetTimeout() {\n clearTimeout(this.timeout);\n clearInterval(this.intervalId);\n this.state = 'active';\n this.options.timeOut = this.originalTimeout;\n this.timeout = setTimeout(() => this.remove(), this.originalTimeout);\n this.hideTime = new Date().getTime() + (this.originalTimeout || 0);\n this.width = -1;\n if (this.options.progressBar) {\n this.intervalId = setInterval(() => this.updateProgress(), 10);\n }\n }\n /**\n * tells toastrService to remove this toast after animation time\n */\n remove() {\n if (this.state === 'removed') {\n return;\n }\n clearTimeout(this.timeout);\n this.state = 'removed';\n this.timeout = setTimeout(() => this.toastrService.remove(this.toastPackage.toastId));\n }\n tapToast() {\n if (this.state === 'removed') {\n return;\n }\n this.toastPackage.triggerTap();\n if (this.options.tapToDismiss) {\n this.remove();\n }\n }\n stickAround() {\n if (this.state === 'removed') {\n return;\n }\n clearTimeout(this.timeout);\n this.options.timeOut = 0;\n this.hideTime = 0;\n // disable progressBar\n clearInterval(this.intervalId);\n this.width = 0;\n }\n delayedHideToast() {\n if ((this.options.disableTimeOut === true || this.options.disableTimeOut === 'extendedTimeOut') ||\n this.options.extendedTimeOut === 0 ||\n this.state === 'removed') {\n return;\n }\n this.timeout = setTimeout(() => this.remove(), this.options.extendedTimeOut);\n this.options.timeOut = this.options.extendedTimeOut;\n this.hideTime = new Date().getTime() + (this.options.timeOut || 0);\n this.width = -1;\n if (this.options.progressBar) {\n this.intervalId = setInterval(() => this.updateProgress(), 10);\n }\n }\n};\nToastNoAnimation.ɵfac = function ToastNoAnimation_Factory(t) { return new (t || ToastNoAnimation)(ɵngcc0.ɵɵdirectiveInject(ToastrService), ɵngcc0.ɵɵdirectiveInject(ToastPackage), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ApplicationRef)); };\nToastNoAnimation.ɵcmp = /*@__PURE__*/ ɵngcc0.ɵɵdefineComponent({ type: ToastNoAnimation, selectors: [[\"\", \"toast-component\", \"\"]], hostVars: 4, hostBindings: function ToastNoAnimation_HostBindings(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵlistener(\"click\", function ToastNoAnimation_click_HostBindingHandler() { return ctx.tapToast(); })(\"mouseenter\", function ToastNoAnimation_mouseenter_HostBindingHandler() { return ctx.stickAround(); })(\"mouseleave\", function ToastNoAnimation_mouseleave_HostBindingHandler() { return ctx.delayedHideToast(); });\n } if (rf & 2) {\n ɵngcc0.ɵɵclassMap(ctx.toastClasses);\n ɵngcc0.ɵɵstyleProp(\"display\", ctx.displayStyle);\n } }, attrs: _c0, decls: 5, vars: 5, consts: [[\"class\", \"toast-close-button\", \"aria-label\", \"Close\", 3, \"click\", 4, \"ngIf\"], [3, \"class\", 4, \"ngIf\"], [\"role\", \"alert\", \"aria-live\", \"polite\", 3, \"class\", \"innerHTML\", 4, \"ngIf\"], [\"role\", \"alert\", \"aria-live\", \"polite\", 3, \"class\", 4, \"ngIf\"], [4, \"ngIf\"], [\"aria-label\", \"Close\", 1, \"toast-close-button\", 3, \"click\"], [\"aria-hidden\", \"true\"], [\"role\", \"alert\", \"aria-live\", \"polite\", 3, \"innerHTML\"], [\"role\", \"alert\", \"aria-live\", \"polite\"], [1, \"toast-progress\"]], template: function ToastNoAnimation_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵtemplate(0, ToastNoAnimation_button_0_Template, 3, 0, \"button\", 0);\n ɵngcc0.ɵɵtemplate(1, ToastNoAnimation_div_1_Template, 3, 5, \"div\", 1);\n ɵngcc0.ɵɵtemplate(2, ToastNoAnimation_div_2_Template, 1, 3, \"div\", 2);\n ɵngcc0.ɵɵtemplate(3, ToastNoAnimation_div_3_Template, 2, 4, \"div\", 3);\n ɵngcc0.ɵɵtemplate(4, ToastNoAnimation_div_4_Template, 2, 2, \"div\", 4);\n } if (rf & 2) {\n ɵngcc0.ɵɵproperty(\"ngIf\", ctx.options.closeButton);\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵproperty(\"ngIf\", ctx.title);\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵproperty(\"ngIf\", ctx.message && ctx.options.enableHtml);\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵproperty(\"ngIf\", ctx.message && !ctx.options.enableHtml);\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵproperty(\"ngIf\", ctx.options.progressBar);\n } }, dependencies: [ɵngcc2.NgIf], encapsulation: 2 });\nToastNoAnimation.ctorParameters = () => [\n { type: ToastrService },\n { type: ToastPackage },\n { type: ApplicationRef }\n];\n__decorate([\n HostBinding('class')\n], ToastNoAnimation.prototype, \"toastClasses\", void 0);\n__decorate([\n HostBinding('style.display')\n], ToastNoAnimation.prototype, \"displayStyle\", null);\n__decorate([\n HostListener('click')\n], ToastNoAnimation.prototype, \"tapToast\", null);\n__decorate([\n HostListener('mouseenter')\n], ToastNoAnimation.prototype, \"stickAround\", null);\n__decorate([\n HostListener('mouseleave')\n], ToastNoAnimation.prototype, \"delayedHideToast\", null);\nconst DefaultNoAnimationsGlobalConfig = Object.assign(Object.assign({}, DefaultNoComponentGlobalConfig), { toastComponent: ToastNoAnimation });\nlet ToastNoAnimationModule = ToastNoAnimationModule_1 = class ToastNoAnimationModule {\n static forRoot(config = {}) {\n return {\n ngModule: ToastNoAnimationModule_1,\n providers: [\n {\n provide: TOAST_CONFIG,\n useValue: {\n default: DefaultNoAnimationsGlobalConfig,\n config,\n },\n },\n ],\n };\n }\n};\nToastNoAnimationModule.ɵfac = function ToastNoAnimationModule_Factory(t) { return new (t || ToastNoAnimationModule)(); };\nToastNoAnimationModule.ɵmod = /*@__PURE__*/ ɵngcc0.ɵɵdefineNgModule({ type: ToastNoAnimationModule });\nToastNoAnimationModule.ɵinj = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjector({ imports: [CommonModule] });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(ToastContainerDirective, [{\n type: Directive,\n args: [{\n selector: '[toastContainer]',\n exportAs: 'toastContainer'\n }]\n }], function () { return [{ type: ɵngcc0.ElementRef }]; }, null); })();\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(ToastContainerModule, [{\n type: NgModule,\n args: [{\n declarations: [ToastContainerDirective],\n exports: [ToastContainerDirective]\n }]\n }], null, null); })();\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(ToastContainerModule, { declarations: [ToastContainerDirective], exports: [ToastContainerDirective] }); })();\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(OverlayContainer, [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; }, null); })();\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(Overlay, [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], function () { return [{ type: OverlayContainer }, { type: ɵngcc0.ComponentFactoryResolver }, { type: ɵngcc0.ApplicationRef }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; }, null); })();\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(ToastrService, [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [TOAST_CONFIG]\n }] }, { type: Overlay }, { type: ɵngcc0.Injector }, { type: ɵngcc1.DomSanitizer }, { type: ɵngcc0.NgZone }]; }, null); })();\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(Toast, [{\n type: Component,\n args: [{\n selector: '[toast-component]',\n template: `\n \n × \n \n \n {{ title }} [{{ duplicatesCount + 1 }}] \n
\n \n
\n \n {{ message }}\n
\n \n `,\n animations: [\n trigger('flyInOut', [\n state('inactive', style({ opacity: 0 })),\n state('active', style({ opacity: 1 })),\n state('removed', style({ opacity: 0 })),\n transition('inactive => active', animate('{{ easeTime }}ms {{ easing }}')),\n transition('active => removed', animate('{{ easeTime }}ms {{ easing }}'))\n ])\n ],\n preserveWhitespaces: false\n }]\n }], function () { return [{ type: ToastrService }, { type: ToastPackage }, { type: ɵngcc0.NgZone }]; }, { toastClasses: [{\n type: HostBinding,\n args: ['class']\n }], state: [{\n type: HostBinding,\n args: ['@flyInOut']\n }], displayStyle: [{\n type: HostBinding,\n args: ['style.display']\n }], tapToast: [{\n type: HostListener,\n args: ['click']\n }], stickAround: [{\n type: HostListener,\n args: ['mouseenter']\n }], delayedHideToast: [{\n type: HostListener,\n args: ['mouseleave']\n }] }); })();\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(ToastrModule, [{\n type: NgModule,\n args: [{\n imports: [CommonModule],\n declarations: [Toast],\n exports: [Toast],\n entryComponents: [Toast]\n }]\n }], null, null); })();\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(ToastrModule, { declarations: function () { return [Toast]; }, imports: function () { return [CommonModule]; }, exports: function () { return [Toast]; } }); })();\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(ToastrComponentlessModule, [{\n type: NgModule,\n args: [{\n imports: [CommonModule]\n }]\n }], null, null); })();\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(ToastrComponentlessModule, { imports: function () { return [CommonModule]; } }); })();\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(ToastNoAnimation, [{\n type: Component,\n args: [{\n selector: '[toast-component]',\n template: `\n \n × \n \n \n {{ title }} [{{ duplicatesCount + 1 }}] \n
\n \n
\n \n {{ message }}\n
\n \n `\n }]\n }], function () { return [{ type: ToastrService }, { type: ToastPackage }, { type: ɵngcc0.ApplicationRef }]; }, { toastClasses: [{\n type: HostBinding,\n args: ['class']\n }], displayStyle: [{\n type: HostBinding,\n args: ['style.display']\n }], tapToast: [{\n type: HostListener,\n args: ['click']\n }], stickAround: [{\n type: HostListener,\n args: ['mouseenter']\n }], delayedHideToast: [{\n type: HostListener,\n args: ['mouseleave']\n }] }); })();\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(ToastNoAnimationModule, [{\n type: NgModule,\n args: [{\n imports: [CommonModule],\n declarations: [ToastNoAnimation],\n exports: [ToastNoAnimation],\n entryComponents: [ToastNoAnimation]\n }]\n }], null, null); })();\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(ToastNoAnimationModule, { declarations: function () { return [ToastNoAnimation]; }, imports: function () { return [CommonModule]; }, exports: function () { return [ToastNoAnimation]; } }); })();\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { BasePortalHost, ComponentPortal, DefaultGlobalConfig, DefaultNoAnimationsGlobalConfig, DefaultNoComponentGlobalConfig, Overlay, OverlayContainer, OverlayRef, TOAST_CONFIG, Toast, ToastContainerDirective, ToastContainerModule, ToastInjector, ToastNoAnimation, ToastNoAnimationModule, ToastPackage, ToastRef, ToastrComponentlessModule, ToastrModule, ToastrService };\n\n","import { Subject } from './Subject';\nimport { ObjectUnsubscribedError } from './util/ObjectUnsubscribedError';\nexport class BehaviorSubject extends Subject {\n constructor(_value) {\n super();\n this._value = _value;\n }\n get value() {\n return this.getValue();\n }\n _subscribe(subscriber) {\n const subscription = super._subscribe(subscriber);\n if (subscription && !subscription.closed) {\n subscriber.next(this._value);\n }\n return subscription;\n }\n getValue() {\n if (this.hasError) {\n throw this.thrownError;\n }\n else if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n else {\n return this._value;\n }\n }\n next(value) {\n super.next(this._value = value);\n }\n}\n","import { Subscriber } from './Subscriber';\nexport class InnerSubscriber extends Subscriber {\n constructor(parent, outerValue, outerIndex) {\n super();\n this.parent = parent;\n this.outerValue = outerValue;\n this.outerIndex = outerIndex;\n this.index = 0;\n }\n _next(value) {\n this.parent.notifyNext(this.outerValue, value, this.outerIndex, this.index++, this);\n }\n _error(error) {\n this.parent.notifyError(error, this);\n this.unsubscribe();\n }\n _complete() {\n this.parent.notifyComplete(this);\n this.unsubscribe();\n }\n}\n","import { empty } from './observable/empty';\nimport { of } from './observable/of';\nimport { throwError } from './observable/throwError';\nexport var NotificationKind;\n(function (NotificationKind) {\n NotificationKind[\"NEXT\"] = \"N\";\n NotificationKind[\"ERROR\"] = \"E\";\n NotificationKind[\"COMPLETE\"] = \"C\";\n})(NotificationKind || (NotificationKind = {}));\nexport class Notification {\n constructor(kind, value, error) {\n this.kind = kind;\n this.value = value;\n this.error = error;\n this.hasValue = kind === 'N';\n }\n observe(observer) {\n switch (this.kind) {\n case 'N':\n return observer.next && observer.next(this.value);\n case 'E':\n return observer.error && observer.error(this.error);\n case 'C':\n return observer.complete && observer.complete();\n }\n }\n do(next, error, complete) {\n const kind = this.kind;\n switch (kind) {\n case 'N':\n return next && next(this.value);\n case 'E':\n return error && error(this.error);\n case 'C':\n return complete && complete();\n }\n }\n accept(nextOrObserver, error, complete) {\n if (nextOrObserver && typeof nextOrObserver.next === 'function') {\n return this.observe(nextOrObserver);\n }\n else {\n return this.do(nextOrObserver, error, complete);\n }\n }\n toObservable() {\n const kind = this.kind;\n switch (kind) {\n case 'N':\n return of(this.value);\n case 'E':\n return throwError(this.error);\n case 'C':\n return empty();\n }\n throw new Error('unexpected notification kind value');\n }\n static createNext(value) {\n if (typeof value !== 'undefined') {\n return new Notification('N', value);\n }\n return Notification.undefinedValueNotification;\n }\n static createError(err) {\n return new Notification('E', undefined, err);\n }\n static createComplete() {\n return Notification.completeNotification;\n }\n}\nNotification.completeNotification = new Notification('C');\nNotification.undefinedValueNotification = new Notification('N', undefined);\n","import { canReportError } from './util/canReportError';\nimport { toSubscriber } from './util/toSubscriber';\nimport { observable as Symbol_observable } from './symbol/observable';\nimport { pipeFromArray } from './util/pipe';\nimport { config } from './config';\nexport class Observable {\n constructor(subscribe) {\n this._isScalar = false;\n if (subscribe) {\n this._subscribe = subscribe;\n }\n }\n lift(operator) {\n const observable = new Observable();\n observable.source = this;\n observable.operator = operator;\n return observable;\n }\n subscribe(observerOrNext, error, complete) {\n const { operator } = this;\n const sink = toSubscriber(observerOrNext, error, complete);\n if (operator) {\n sink.add(operator.call(sink, this.source));\n }\n else {\n sink.add(this.source || (config.useDeprecatedSynchronousErrorHandling && !sink.syncErrorThrowable) ?\n this._subscribe(sink) :\n this._trySubscribe(sink));\n }\n if (config.useDeprecatedSynchronousErrorHandling) {\n if (sink.syncErrorThrowable) {\n sink.syncErrorThrowable = false;\n if (sink.syncErrorThrown) {\n throw sink.syncErrorValue;\n }\n }\n }\n return sink;\n }\n _trySubscribe(sink) {\n try {\n return this._subscribe(sink);\n }\n catch (err) {\n if (config.useDeprecatedSynchronousErrorHandling) {\n sink.syncErrorThrown = true;\n sink.syncErrorValue = err;\n }\n if (canReportError(sink)) {\n sink.error(err);\n }\n else {\n console.warn(err);\n }\n }\n }\n forEach(next, promiseCtor) {\n promiseCtor = getPromiseCtor(promiseCtor);\n return new promiseCtor((resolve, reject) => {\n let subscription;\n subscription = this.subscribe((value) => {\n try {\n next(value);\n }\n catch (err) {\n reject(err);\n if (subscription) {\n subscription.unsubscribe();\n }\n }\n }, reject, resolve);\n });\n }\n _subscribe(subscriber) {\n const { source } = this;\n return source && source.subscribe(subscriber);\n }\n [Symbol_observable]() {\n return this;\n }\n pipe(...operations) {\n if (operations.length === 0) {\n return this;\n }\n return pipeFromArray(operations)(this);\n }\n toPromise(promiseCtor) {\n promiseCtor = getPromiseCtor(promiseCtor);\n return new promiseCtor((resolve, reject) => {\n let value;\n this.subscribe((x) => value = x, (err) => reject(err), () => resolve(value));\n });\n }\n}\nObservable.create = (subscribe) => {\n return new Observable(subscribe);\n};\nfunction getPromiseCtor(promiseCtor) {\n if (!promiseCtor) {\n promiseCtor = config.Promise || Promise;\n }\n if (!promiseCtor) {\n throw new Error('no Promise impl found');\n }\n return promiseCtor;\n}\n","import { config } from './config';\nimport { hostReportError } from './util/hostReportError';\nexport const empty = {\n closed: true,\n next(value) { },\n error(err) {\n if (config.useDeprecatedSynchronousErrorHandling) {\n throw err;\n }\n else {\n hostReportError(err);\n }\n },\n complete() { }\n};\n","import { Subscriber } from './Subscriber';\nexport class OuterSubscriber extends Subscriber {\n notifyNext(outerValue, innerValue, outerIndex, innerIndex, innerSub) {\n this.destination.next(innerValue);\n }\n notifyError(error, innerSub) {\n this.destination.error(error);\n }\n notifyComplete(innerSub) {\n this.destination.complete();\n }\n}\n","import { Subject } from './Subject';\nimport { queue } from './scheduler/queue';\nimport { Subscription } from './Subscription';\nimport { ObserveOnSubscriber } from './operators/observeOn';\nimport { ObjectUnsubscribedError } from './util/ObjectUnsubscribedError';\nimport { SubjectSubscription } from './SubjectSubscription';\nexport class ReplaySubject extends Subject {\n constructor(bufferSize = Number.POSITIVE_INFINITY, windowTime = Number.POSITIVE_INFINITY, scheduler) {\n super();\n this.scheduler = scheduler;\n this._events = [];\n this._infiniteTimeWindow = false;\n this._bufferSize = bufferSize < 1 ? 1 : bufferSize;\n this._windowTime = windowTime < 1 ? 1 : windowTime;\n if (windowTime === Number.POSITIVE_INFINITY) {\n this._infiniteTimeWindow = true;\n this.next = this.nextInfiniteTimeWindow;\n }\n else {\n this.next = this.nextTimeWindow;\n }\n }\n nextInfiniteTimeWindow(value) {\n if (!this.isStopped) {\n const _events = this._events;\n _events.push(value);\n if (_events.length > this._bufferSize) {\n _events.shift();\n }\n }\n super.next(value);\n }\n nextTimeWindow(value) {\n if (!this.isStopped) {\n this._events.push(new ReplayEvent(this._getNow(), value));\n this._trimBufferThenGetEvents();\n }\n super.next(value);\n }\n _subscribe(subscriber) {\n const _infiniteTimeWindow = this._infiniteTimeWindow;\n const _events = _infiniteTimeWindow ? this._events : this._trimBufferThenGetEvents();\n const scheduler = this.scheduler;\n const len = _events.length;\n let subscription;\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n else if (this.isStopped || this.hasError) {\n subscription = Subscription.EMPTY;\n }\n else {\n this.observers.push(subscriber);\n subscription = new SubjectSubscription(this, subscriber);\n }\n if (scheduler) {\n subscriber.add(subscriber = new ObserveOnSubscriber(subscriber, scheduler));\n }\n if (_infiniteTimeWindow) {\n for (let i = 0; i < len && !subscriber.closed; i++) {\n subscriber.next(_events[i]);\n }\n }\n else {\n for (let i = 0; i < len && !subscriber.closed; i++) {\n subscriber.next(_events[i].value);\n }\n }\n if (this.hasError) {\n subscriber.error(this.thrownError);\n }\n else if (this.isStopped) {\n subscriber.complete();\n }\n return subscription;\n }\n _getNow() {\n return (this.scheduler || queue).now();\n }\n _trimBufferThenGetEvents() {\n const now = this._getNow();\n const _bufferSize = this._bufferSize;\n const _windowTime = this._windowTime;\n const _events = this._events;\n const eventsCount = _events.length;\n let spliceCount = 0;\n while (spliceCount < eventsCount) {\n if ((now - _events[spliceCount].time) < _windowTime) {\n break;\n }\n spliceCount++;\n }\n if (eventsCount > _bufferSize) {\n spliceCount = Math.max(spliceCount, eventsCount - _bufferSize);\n }\n if (spliceCount > 0) {\n _events.splice(0, spliceCount);\n }\n return _events;\n }\n}\nclass ReplayEvent {\n constructor(time, value) {\n this.time = time;\n this.value = value;\n }\n}\n","export class Scheduler {\n constructor(SchedulerAction, now = Scheduler.now) {\n this.SchedulerAction = SchedulerAction;\n this.now = now;\n }\n schedule(work, delay = 0, state) {\n return new this.SchedulerAction(this, work).schedule(state, delay);\n }\n}\nScheduler.now = () => Date.now();\n","import { Observable } from './Observable';\nimport { Subscriber } from './Subscriber';\nimport { Subscription } from './Subscription';\nimport { ObjectUnsubscribedError } from './util/ObjectUnsubscribedError';\nimport { SubjectSubscription } from './SubjectSubscription';\nimport { rxSubscriber as rxSubscriberSymbol } from '../internal/symbol/rxSubscriber';\nexport class SubjectSubscriber extends Subscriber {\n constructor(destination) {\n super(destination);\n this.destination = destination;\n }\n}\nexport class Subject extends Observable {\n constructor() {\n super();\n this.observers = [];\n this.closed = false;\n this.isStopped = false;\n this.hasError = false;\n this.thrownError = null;\n }\n [rxSubscriberSymbol]() {\n return new SubjectSubscriber(this);\n }\n lift(operator) {\n const subject = new AnonymousSubject(this, this);\n subject.operator = operator;\n return subject;\n }\n next(value) {\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n if (!this.isStopped) {\n const { observers } = this;\n const len = observers.length;\n const copy = observers.slice();\n for (let i = 0; i < len; i++) {\n copy[i].next(value);\n }\n }\n }\n error(err) {\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n this.hasError = true;\n this.thrownError = err;\n this.isStopped = true;\n const { observers } = this;\n const len = observers.length;\n const copy = observers.slice();\n for (let i = 0; i < len; i++) {\n copy[i].error(err);\n }\n this.observers.length = 0;\n }\n complete() {\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n this.isStopped = true;\n const { observers } = this;\n const len = observers.length;\n const copy = observers.slice();\n for (let i = 0; i < len; i++) {\n copy[i].complete();\n }\n this.observers.length = 0;\n }\n unsubscribe() {\n this.isStopped = true;\n this.closed = true;\n this.observers = null;\n }\n _trySubscribe(subscriber) {\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n else {\n return super._trySubscribe(subscriber);\n }\n }\n _subscribe(subscriber) {\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n else if (this.hasError) {\n subscriber.error(this.thrownError);\n return Subscription.EMPTY;\n }\n else if (this.isStopped) {\n subscriber.complete();\n return Subscription.EMPTY;\n }\n else {\n this.observers.push(subscriber);\n return new SubjectSubscription(this, subscriber);\n }\n }\n asObservable() {\n const observable = new Observable();\n observable.source = this;\n return observable;\n }\n}\nSubject.create = (destination, source) => {\n return new AnonymousSubject(destination, source);\n};\nexport class AnonymousSubject extends Subject {\n constructor(destination, source) {\n super();\n this.destination = destination;\n this.source = source;\n }\n next(value) {\n const { destination } = this;\n if (destination && destination.next) {\n destination.next(value);\n }\n }\n error(err) {\n const { destination } = this;\n if (destination && destination.error) {\n this.destination.error(err);\n }\n }\n complete() {\n const { destination } = this;\n if (destination && destination.complete) {\n this.destination.complete();\n }\n }\n _subscribe(subscriber) {\n const { source } = this;\n if (source) {\n return this.source.subscribe(subscriber);\n }\n else {\n return Subscription.EMPTY;\n }\n }\n}\n","import { Subscription } from './Subscription';\nexport class SubjectSubscription extends Subscription {\n constructor(subject, subscriber) {\n super();\n this.subject = subject;\n this.subscriber = subscriber;\n this.closed = false;\n }\n unsubscribe() {\n if (this.closed) {\n return;\n }\n this.closed = true;\n const subject = this.subject;\n const observers = subject.observers;\n this.subject = null;\n if (!observers || observers.length === 0 || subject.isStopped || subject.closed) {\n return;\n }\n const subscriberIndex = observers.indexOf(this.subscriber);\n if (subscriberIndex !== -1) {\n observers.splice(subscriberIndex, 1);\n }\n }\n}\n","import { isFunction } from './util/isFunction';\nimport { empty as emptyObserver } from './Observer';\nimport { Subscription } from './Subscription';\nimport { rxSubscriber as rxSubscriberSymbol } from '../internal/symbol/rxSubscriber';\nimport { config } from './config';\nimport { hostReportError } from './util/hostReportError';\nexport class Subscriber extends Subscription {\n constructor(destinationOrNext, error, complete) {\n super();\n this.syncErrorValue = null;\n this.syncErrorThrown = false;\n this.syncErrorThrowable = false;\n this.isStopped = false;\n switch (arguments.length) {\n case 0:\n this.destination = emptyObserver;\n break;\n case 1:\n if (!destinationOrNext) {\n this.destination = emptyObserver;\n break;\n }\n if (typeof destinationOrNext === 'object') {\n if (destinationOrNext instanceof Subscriber) {\n this.syncErrorThrowable = destinationOrNext.syncErrorThrowable;\n this.destination = destinationOrNext;\n destinationOrNext.add(this);\n }\n else {\n this.syncErrorThrowable = true;\n this.destination = new SafeSubscriber(this, destinationOrNext);\n }\n break;\n }\n default:\n this.syncErrorThrowable = true;\n this.destination = new SafeSubscriber(this, destinationOrNext, error, complete);\n break;\n }\n }\n [rxSubscriberSymbol]() { return this; }\n static create(next, error, complete) {\n const subscriber = new Subscriber(next, error, complete);\n subscriber.syncErrorThrowable = false;\n return subscriber;\n }\n next(value) {\n if (!this.isStopped) {\n this._next(value);\n }\n }\n error(err) {\n if (!this.isStopped) {\n this.isStopped = true;\n this._error(err);\n }\n }\n complete() {\n if (!this.isStopped) {\n this.isStopped = true;\n this._complete();\n }\n }\n unsubscribe() {\n if (this.closed) {\n return;\n }\n this.isStopped = true;\n super.unsubscribe();\n }\n _next(value) {\n this.destination.next(value);\n }\n _error(err) {\n this.destination.error(err);\n this.unsubscribe();\n }\n _complete() {\n this.destination.complete();\n this.unsubscribe();\n }\n _unsubscribeAndRecycle() {\n const { _parentOrParents } = this;\n this._parentOrParents = null;\n this.unsubscribe();\n this.closed = false;\n this.isStopped = false;\n this._parentOrParents = _parentOrParents;\n return this;\n }\n}\nexport class SafeSubscriber extends Subscriber {\n constructor(_parentSubscriber, observerOrNext, error, complete) {\n super();\n this._parentSubscriber = _parentSubscriber;\n let next;\n let context = this;\n if (isFunction(observerOrNext)) {\n next = observerOrNext;\n }\n else if (observerOrNext) {\n next = observerOrNext.next;\n error = observerOrNext.error;\n complete = observerOrNext.complete;\n if (observerOrNext !== emptyObserver) {\n context = Object.create(observerOrNext);\n if (isFunction(context.unsubscribe)) {\n this.add(context.unsubscribe.bind(context));\n }\n context.unsubscribe = this.unsubscribe.bind(this);\n }\n }\n this._context = context;\n this._next = next;\n this._error = error;\n this._complete = complete;\n }\n next(value) {\n if (!this.isStopped && this._next) {\n const { _parentSubscriber } = this;\n if (!config.useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) {\n this.__tryOrUnsub(this._next, value);\n }\n else if (this.__tryOrSetError(_parentSubscriber, this._next, value)) {\n this.unsubscribe();\n }\n }\n }\n error(err) {\n if (!this.isStopped) {\n const { _parentSubscriber } = this;\n const { useDeprecatedSynchronousErrorHandling } = config;\n if (this._error) {\n if (!useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) {\n this.__tryOrUnsub(this._error, err);\n this.unsubscribe();\n }\n else {\n this.__tryOrSetError(_parentSubscriber, this._error, err);\n this.unsubscribe();\n }\n }\n else if (!_parentSubscriber.syncErrorThrowable) {\n this.unsubscribe();\n if (useDeprecatedSynchronousErrorHandling) {\n throw err;\n }\n hostReportError(err);\n }\n else {\n if (useDeprecatedSynchronousErrorHandling) {\n _parentSubscriber.syncErrorValue = err;\n _parentSubscriber.syncErrorThrown = true;\n }\n else {\n hostReportError(err);\n }\n this.unsubscribe();\n }\n }\n }\n complete() {\n if (!this.isStopped) {\n const { _parentSubscriber } = this;\n if (this._complete) {\n const wrappedComplete = () => this._complete.call(this._context);\n if (!config.useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) {\n this.__tryOrUnsub(wrappedComplete);\n this.unsubscribe();\n }\n else {\n this.__tryOrSetError(_parentSubscriber, wrappedComplete);\n this.unsubscribe();\n }\n }\n else {\n this.unsubscribe();\n }\n }\n }\n __tryOrUnsub(fn, value) {\n try {\n fn.call(this._context, value);\n }\n catch (err) {\n this.unsubscribe();\n if (config.useDeprecatedSynchronousErrorHandling) {\n throw err;\n }\n else {\n hostReportError(err);\n }\n }\n }\n __tryOrSetError(parent, fn, value) {\n if (!config.useDeprecatedSynchronousErrorHandling) {\n throw new Error('bad call');\n }\n try {\n fn.call(this._context, value);\n }\n catch (err) {\n if (config.useDeprecatedSynchronousErrorHandling) {\n parent.syncErrorValue = err;\n parent.syncErrorThrown = true;\n return true;\n }\n else {\n hostReportError(err);\n return true;\n }\n }\n return false;\n }\n _unsubscribe() {\n const { _parentSubscriber } = this;\n this._context = null;\n this._parentSubscriber = null;\n _parentSubscriber.unsubscribe();\n }\n}\n","import { isArray } from './util/isArray';\nimport { isObject } from './util/isObject';\nimport { isFunction } from './util/isFunction';\nimport { UnsubscriptionError } from './util/UnsubscriptionError';\nexport class Subscription {\n constructor(unsubscribe) {\n this.closed = false;\n this._parentOrParents = null;\n this._subscriptions = null;\n if (unsubscribe) {\n this._ctorUnsubscribe = true;\n this._unsubscribe = unsubscribe;\n }\n }\n unsubscribe() {\n let errors;\n if (this.closed) {\n return;\n }\n let { _parentOrParents, _ctorUnsubscribe, _unsubscribe, _subscriptions } = this;\n this.closed = true;\n this._parentOrParents = null;\n this._subscriptions = null;\n if (_parentOrParents instanceof Subscription) {\n _parentOrParents.remove(this);\n }\n else if (_parentOrParents !== null) {\n for (let index = 0; index < _parentOrParents.length; ++index) {\n const parent = _parentOrParents[index];\n parent.remove(this);\n }\n }\n if (isFunction(_unsubscribe)) {\n if (_ctorUnsubscribe) {\n this._unsubscribe = undefined;\n }\n try {\n _unsubscribe.call(this);\n }\n catch (e) {\n errors = e instanceof UnsubscriptionError ? flattenUnsubscriptionErrors(e.errors) : [e];\n }\n }\n if (isArray(_subscriptions)) {\n let index = -1;\n let len = _subscriptions.length;\n while (++index < len) {\n const sub = _subscriptions[index];\n if (isObject(sub)) {\n try {\n sub.unsubscribe();\n }\n catch (e) {\n errors = errors || [];\n if (e instanceof UnsubscriptionError) {\n errors = errors.concat(flattenUnsubscriptionErrors(e.errors));\n }\n else {\n errors.push(e);\n }\n }\n }\n }\n }\n if (errors) {\n throw new UnsubscriptionError(errors);\n }\n }\n add(teardown) {\n let subscription = teardown;\n if (!teardown) {\n return Subscription.EMPTY;\n }\n switch (typeof teardown) {\n case 'function':\n subscription = new Subscription(teardown);\n case 'object':\n if (subscription === this || subscription.closed || typeof subscription.unsubscribe !== 'function') {\n return subscription;\n }\n else if (this.closed) {\n subscription.unsubscribe();\n return subscription;\n }\n else if (!(subscription instanceof Subscription)) {\n const tmp = subscription;\n subscription = new Subscription();\n subscription._subscriptions = [tmp];\n }\n break;\n default: {\n throw new Error('unrecognized teardown ' + teardown + ' added to Subscription.');\n }\n }\n let { _parentOrParents } = subscription;\n if (_parentOrParents === null) {\n subscription._parentOrParents = this;\n }\n else if (_parentOrParents instanceof Subscription) {\n if (_parentOrParents === this) {\n return subscription;\n }\n subscription._parentOrParents = [_parentOrParents, this];\n }\n else if (_parentOrParents.indexOf(this) === -1) {\n _parentOrParents.push(this);\n }\n else {\n return subscription;\n }\n const subscriptions = this._subscriptions;\n if (subscriptions === null) {\n this._subscriptions = [subscription];\n }\n else {\n subscriptions.push(subscription);\n }\n return subscription;\n }\n remove(subscription) {\n const subscriptions = this._subscriptions;\n if (subscriptions) {\n const subscriptionIndex = subscriptions.indexOf(subscription);\n if (subscriptionIndex !== -1) {\n subscriptions.splice(subscriptionIndex, 1);\n }\n }\n }\n}\nSubscription.EMPTY = (function (empty) {\n empty.closed = true;\n return empty;\n}(new Subscription()));\nfunction flattenUnsubscriptionErrors(errors) {\n return errors.reduce((errs, err) => errs.concat((err instanceof UnsubscriptionError) ? err.errors : err), []);\n}\n","let _enable_super_gross_mode_that_will_cause_bad_things = false;\nexport const config = {\n Promise: undefined,\n set useDeprecatedSynchronousErrorHandling(value) {\n if (value) {\n const error = new Error();\n console.warn('DEPRECATED! RxJS was set to use deprecated synchronous error handling behavior by code at: \\n' + error.stack);\n }\n else if (_enable_super_gross_mode_that_will_cause_bad_things) {\n console.log('RxJS: Back to a better error behavior. Thank you. <3');\n }\n _enable_super_gross_mode_that_will_cause_bad_things = value;\n },\n get useDeprecatedSynchronousErrorHandling() {\n return _enable_super_gross_mode_that_will_cause_bad_things;\n },\n};\n","import { Subscriber } from './Subscriber';\nimport { Observable } from './Observable';\nimport { subscribeTo } from './util/subscribeTo';\nexport class SimpleInnerSubscriber extends Subscriber {\n constructor(parent) {\n super();\n this.parent = parent;\n }\n _next(value) {\n this.parent.notifyNext(value);\n }\n _error(error) {\n this.parent.notifyError(error);\n this.unsubscribe();\n }\n _complete() {\n this.parent.notifyComplete();\n this.unsubscribe();\n }\n}\nexport class ComplexInnerSubscriber extends Subscriber {\n constructor(parent, outerValue, outerIndex) {\n super();\n this.parent = parent;\n this.outerValue = outerValue;\n this.outerIndex = outerIndex;\n }\n _next(value) {\n this.parent.notifyNext(this.outerValue, value, this.outerIndex, this);\n }\n _error(error) {\n this.parent.notifyError(error);\n this.unsubscribe();\n }\n _complete() {\n this.parent.notifyComplete(this);\n this.unsubscribe();\n }\n}\nexport class SimpleOuterSubscriber extends Subscriber {\n notifyNext(innerValue) {\n this.destination.next(innerValue);\n }\n notifyError(err) {\n this.destination.error(err);\n }\n notifyComplete() {\n this.destination.complete();\n }\n}\nexport class ComplexOuterSubscriber extends Subscriber {\n notifyNext(_outerValue, innerValue, _outerIndex, _innerSub) {\n this.destination.next(innerValue);\n }\n notifyError(error) {\n this.destination.error(error);\n }\n notifyComplete(_innerSub) {\n this.destination.complete();\n }\n}\nexport function innerSubscribe(result, innerSubscriber) {\n if (innerSubscriber.closed) {\n return undefined;\n }\n if (result instanceof Observable) {\n return result.subscribe(innerSubscriber);\n }\n let subscription;\n try {\n subscription = subscribeTo(result)(innerSubscriber);\n }\n catch (error) {\n innerSubscriber.error(error);\n }\n return subscription;\n}\n","import { SubjectSubscriber } from '../Subject';\nimport { Observable } from '../Observable';\nimport { Subscriber } from '../Subscriber';\nimport { Subscription } from '../Subscription';\nimport { refCount as higherOrderRefCount } from '../operators/refCount';\nexport class ConnectableObservable extends Observable {\n constructor(source, subjectFactory) {\n super();\n this.source = source;\n this.subjectFactory = subjectFactory;\n this._refCount = 0;\n this._isComplete = false;\n }\n _subscribe(subscriber) {\n return this.getSubject().subscribe(subscriber);\n }\n getSubject() {\n const subject = this._subject;\n if (!subject || subject.isStopped) {\n this._subject = this.subjectFactory();\n }\n return this._subject;\n }\n connect() {\n let connection = this._connection;\n if (!connection) {\n this._isComplete = false;\n connection = this._connection = new Subscription();\n connection.add(this.source\n .subscribe(new ConnectableSubscriber(this.getSubject(), this)));\n if (connection.closed) {\n this._connection = null;\n connection = Subscription.EMPTY;\n }\n }\n return connection;\n }\n refCount() {\n return higherOrderRefCount()(this);\n }\n}\nexport const connectableObservableDescriptor = (() => {\n const connectableProto = ConnectableObservable.prototype;\n return {\n operator: { value: null },\n _refCount: { value: 0, writable: true },\n _subject: { value: null, writable: true },\n _connection: { value: null, writable: true },\n _subscribe: { value: connectableProto._subscribe },\n _isComplete: { value: connectableProto._isComplete, writable: true },\n getSubject: { value: connectableProto.getSubject },\n connect: { value: connectableProto.connect },\n refCount: { value: connectableProto.refCount }\n };\n})();\nclass ConnectableSubscriber extends SubjectSubscriber {\n constructor(destination, connectable) {\n super(destination);\n this.connectable = connectable;\n }\n _error(err) {\n this._unsubscribe();\n super._error(err);\n }\n _complete() {\n this.connectable._isComplete = true;\n this._unsubscribe();\n super._complete();\n }\n _unsubscribe() {\n const connectable = this.connectable;\n if (connectable) {\n this.connectable = null;\n const connection = connectable._connection;\n connectable._refCount = 0;\n connectable._subject = null;\n connectable._connection = null;\n if (connection) {\n connection.unsubscribe();\n }\n }\n }\n}\nclass RefCountOperator {\n constructor(connectable) {\n this.connectable = connectable;\n }\n call(subscriber, source) {\n const { connectable } = this;\n connectable._refCount++;\n const refCounter = new RefCountSubscriber(subscriber, connectable);\n const subscription = source.subscribe(refCounter);\n if (!refCounter.closed) {\n refCounter.connection = connectable.connect();\n }\n return subscription;\n }\n}\nclass RefCountSubscriber extends Subscriber {\n constructor(destination, connectable) {\n super(destination);\n this.connectable = connectable;\n }\n _unsubscribe() {\n const { connectable } = this;\n if (!connectable) {\n this.connection = null;\n return;\n }\n this.connectable = null;\n const refCount = connectable._refCount;\n if (refCount <= 0) {\n this.connection = null;\n return;\n }\n connectable._refCount = refCount - 1;\n if (refCount > 1) {\n this.connection = null;\n return;\n }\n const { connection } = this;\n const sharedConnection = connectable._connection;\n this.connection = null;\n if (sharedConnection && (!connection || sharedConnection === connection)) {\n sharedConnection.unsubscribe();\n }\n }\n}\n","import { isScheduler } from '../util/isScheduler';\nimport { isArray } from '../util/isArray';\nimport { OuterSubscriber } from '../OuterSubscriber';\nimport { subscribeToResult } from '../util/subscribeToResult';\nimport { fromArray } from './fromArray';\nconst NONE = {};\nexport function combineLatest(...observables) {\n let resultSelector = undefined;\n let scheduler = undefined;\n if (isScheduler(observables[observables.length - 1])) {\n scheduler = observables.pop();\n }\n if (typeof observables[observables.length - 1] === 'function') {\n resultSelector = observables.pop();\n }\n if (observables.length === 1 && isArray(observables[0])) {\n observables = observables[0];\n }\n return fromArray(observables, scheduler).lift(new CombineLatestOperator(resultSelector));\n}\nexport class CombineLatestOperator {\n constructor(resultSelector) {\n this.resultSelector = resultSelector;\n }\n call(subscriber, source) {\n return source.subscribe(new CombineLatestSubscriber(subscriber, this.resultSelector));\n }\n}\nexport class CombineLatestSubscriber extends OuterSubscriber {\n constructor(destination, resultSelector) {\n super(destination);\n this.resultSelector = resultSelector;\n this.active = 0;\n this.values = [];\n this.observables = [];\n }\n _next(observable) {\n this.values.push(NONE);\n this.observables.push(observable);\n }\n _complete() {\n const observables = this.observables;\n const len = observables.length;\n if (len === 0) {\n this.destination.complete();\n }\n else {\n this.active = len;\n this.toRespond = len;\n for (let i = 0; i < len; i++) {\n const observable = observables[i];\n this.add(subscribeToResult(this, observable, undefined, i));\n }\n }\n }\n notifyComplete(unused) {\n if ((this.active -= 1) === 0) {\n this.destination.complete();\n }\n }\n notifyNext(_outerValue, innerValue, outerIndex) {\n const values = this.values;\n const oldVal = values[outerIndex];\n const toRespond = !this.toRespond\n ? 0\n : oldVal === NONE ? --this.toRespond : this.toRespond;\n values[outerIndex] = innerValue;\n if (toRespond === 0) {\n if (this.resultSelector) {\n this._tryResultSelector(values);\n }\n else {\n this.destination.next(values.slice());\n }\n }\n }\n _tryResultSelector(values) {\n let result;\n try {\n result = this.resultSelector.apply(this, values);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.next(result);\n }\n}\n","import { of } from './of';\nimport { concatAll } from '../operators/concatAll';\nexport function concat(...observables) {\n return concatAll()(of(...observables));\n}\n","import { Observable } from '../Observable';\nimport { from } from './from';\nimport { empty } from './empty';\nexport function defer(observableFactory) {\n return new Observable(subscriber => {\n let input;\n try {\n input = observableFactory();\n }\n catch (err) {\n subscriber.error(err);\n return undefined;\n }\n const source = input ? from(input) : empty();\n return source.subscribe(subscriber);\n });\n}\n","import { Observable } from '../Observable';\nexport const EMPTY = new Observable(subscriber => subscriber.complete());\nexport function empty(scheduler) {\n return scheduler ? emptyScheduled(scheduler) : EMPTY;\n}\nfunction emptyScheduled(scheduler) {\n return new Observable(subscriber => scheduler.schedule(() => subscriber.complete()));\n}\n","import { Observable } from '../Observable';\nimport { isArray } from '../util/isArray';\nimport { map } from '../operators/map';\nimport { isObject } from '../util/isObject';\nimport { from } from './from';\nexport function forkJoin(...sources) {\n if (sources.length === 1) {\n const first = sources[0];\n if (isArray(first)) {\n return forkJoinInternal(first, null);\n }\n if (isObject(first) && Object.getPrototypeOf(first) === Object.prototype) {\n const keys = Object.keys(first);\n return forkJoinInternal(keys.map(key => first[key]), keys);\n }\n }\n if (typeof sources[sources.length - 1] === 'function') {\n const resultSelector = sources.pop();\n sources = (sources.length === 1 && isArray(sources[0])) ? sources[0] : sources;\n return forkJoinInternal(sources, null).pipe(map((args) => resultSelector(...args)));\n }\n return forkJoinInternal(sources, null);\n}\nfunction forkJoinInternal(sources, keys) {\n return new Observable(subscriber => {\n const len = sources.length;\n if (len === 0) {\n subscriber.complete();\n return;\n }\n const values = new Array(len);\n let completed = 0;\n let emitted = 0;\n for (let i = 0; i < len; i++) {\n const source = from(sources[i]);\n let hasValue = false;\n subscriber.add(source.subscribe({\n next: value => {\n if (!hasValue) {\n hasValue = true;\n emitted++;\n }\n values[i] = value;\n },\n error: err => subscriber.error(err),\n complete: () => {\n completed++;\n if (completed === len || !hasValue) {\n if (emitted === len) {\n subscriber.next(keys ?\n keys.reduce((result, key, i) => (result[key] = values[i], result), {}) :\n values);\n }\n subscriber.complete();\n }\n }\n }));\n }\n });\n}\n","import { Observable } from '../Observable';\nimport { subscribeTo } from '../util/subscribeTo';\nimport { scheduled } from '../scheduled/scheduled';\nexport function from(input, scheduler) {\n if (!scheduler) {\n if (input instanceof Observable) {\n return input;\n }\n return new Observable(subscribeTo(input));\n }\n else {\n return scheduled(input, scheduler);\n }\n}\n","import { Observable } from '../Observable';\nimport { subscribeToArray } from '../util/subscribeToArray';\nimport { scheduleArray } from '../scheduled/scheduleArray';\nexport function fromArray(input, scheduler) {\n if (!scheduler) {\n return new Observable(subscribeToArray(input));\n }\n else {\n return scheduleArray(input, scheduler);\n }\n}\n","import { Observable } from '../Observable';\nimport { isArray } from '../util/isArray';\nimport { isFunction } from '../util/isFunction';\nimport { map } from '../operators/map';\nconst toString = (() => Object.prototype.toString)();\nexport function fromEvent(target, eventName, options, resultSelector) {\n if (isFunction(options)) {\n resultSelector = options;\n options = undefined;\n }\n if (resultSelector) {\n return fromEvent(target, eventName, options).pipe(map(args => isArray(args) ? resultSelector(...args) : resultSelector(args)));\n }\n return new Observable(subscriber => {\n function handler(e) {\n if (arguments.length > 1) {\n subscriber.next(Array.prototype.slice.call(arguments));\n }\n else {\n subscriber.next(e);\n }\n }\n setupSubscription(target, eventName, handler, subscriber, options);\n });\n}\nfunction setupSubscription(sourceObj, eventName, handler, subscriber, options) {\n let unsubscribe;\n if (isEventTarget(sourceObj)) {\n const source = sourceObj;\n sourceObj.addEventListener(eventName, handler, options);\n unsubscribe = () => source.removeEventListener(eventName, handler, options);\n }\n else if (isJQueryStyleEventEmitter(sourceObj)) {\n const source = sourceObj;\n sourceObj.on(eventName, handler);\n unsubscribe = () => source.off(eventName, handler);\n }\n else if (isNodeStyleEventEmitter(sourceObj)) {\n const source = sourceObj;\n sourceObj.addListener(eventName, handler);\n unsubscribe = () => source.removeListener(eventName, handler);\n }\n else if (sourceObj && sourceObj.length) {\n for (let i = 0, len = sourceObj.length; i < len; i++) {\n setupSubscription(sourceObj[i], eventName, handler, subscriber, options);\n }\n }\n else {\n throw new TypeError('Invalid event target');\n }\n subscriber.add(unsubscribe);\n}\nfunction isNodeStyleEventEmitter(sourceObj) {\n return sourceObj && typeof sourceObj.addListener === 'function' && typeof sourceObj.removeListener === 'function';\n}\nfunction isJQueryStyleEventEmitter(sourceObj) {\n return sourceObj && typeof sourceObj.on === 'function' && typeof sourceObj.off === 'function';\n}\nfunction isEventTarget(sourceObj) {\n return sourceObj && typeof sourceObj.addEventListener === 'function' && typeof sourceObj.removeEventListener === 'function';\n}\n","import { Observable } from '../Observable';\nimport { isScheduler } from '../util/isScheduler';\nimport { mergeAll } from '../operators/mergeAll';\nimport { fromArray } from './fromArray';\nexport function merge(...observables) {\n let concurrent = Number.POSITIVE_INFINITY;\n let scheduler = null;\n let last = observables[observables.length - 1];\n if (isScheduler(last)) {\n scheduler = observables.pop();\n if (observables.length > 1 && typeof observables[observables.length - 1] === 'number') {\n concurrent = observables.pop();\n }\n }\n else if (typeof last === 'number') {\n concurrent = observables.pop();\n }\n if (scheduler === null && observables.length === 1 && observables[0] instanceof Observable) {\n return observables[0];\n }\n return mergeAll(concurrent)(fromArray(observables, scheduler));\n}\n","import { Observable } from '../Observable';\nimport { noop } from '../util/noop';\nexport const NEVER = new Observable(noop);\nexport function never() {\n return NEVER;\n}\n","import { isScheduler } from '../util/isScheduler';\nimport { fromArray } from './fromArray';\nimport { scheduleArray } from '../scheduled/scheduleArray';\nexport function of(...args) {\n let scheduler = args[args.length - 1];\n if (isScheduler(scheduler)) {\n args.pop();\n return scheduleArray(args, scheduler);\n }\n else {\n return fromArray(args);\n }\n}\n","import { isArray } from '../util/isArray';\nimport { fromArray } from './fromArray';\nimport { OuterSubscriber } from '../OuterSubscriber';\nimport { subscribeToResult } from '../util/subscribeToResult';\nexport function race(...observables) {\n if (observables.length === 1) {\n if (isArray(observables[0])) {\n observables = observables[0];\n }\n else {\n return observables[0];\n }\n }\n return fromArray(observables, undefined).lift(new RaceOperator());\n}\nexport class RaceOperator {\n call(subscriber, source) {\n return source.subscribe(new RaceSubscriber(subscriber));\n }\n}\nexport class RaceSubscriber extends OuterSubscriber {\n constructor(destination) {\n super(destination);\n this.hasFirst = false;\n this.observables = [];\n this.subscriptions = [];\n }\n _next(observable) {\n this.observables.push(observable);\n }\n _complete() {\n const observables = this.observables;\n const len = observables.length;\n if (len === 0) {\n this.destination.complete();\n }\n else {\n for (let i = 0; i < len && !this.hasFirst; i++) {\n const observable = observables[i];\n const subscription = subscribeToResult(this, observable, undefined, i);\n if (this.subscriptions) {\n this.subscriptions.push(subscription);\n }\n this.add(subscription);\n }\n this.observables = null;\n }\n }\n notifyNext(_outerValue, innerValue, outerIndex) {\n if (!this.hasFirst) {\n this.hasFirst = true;\n for (let i = 0; i < this.subscriptions.length; i++) {\n if (i !== outerIndex) {\n let subscription = this.subscriptions[i];\n subscription.unsubscribe();\n this.remove(subscription);\n }\n }\n this.subscriptions = null;\n }\n this.destination.next(innerValue);\n }\n}\n","import { Observable } from '../Observable';\nexport function throwError(error, scheduler) {\n if (!scheduler) {\n return new Observable(subscriber => subscriber.error(error));\n }\n else {\n return new Observable(subscriber => scheduler.schedule(dispatch, 0, { error, subscriber }));\n }\n}\nfunction dispatch({ error, subscriber }) {\n subscriber.error(error);\n}\n","import { Observable } from '../Observable';\nimport { async } from '../scheduler/async';\nimport { isNumeric } from '../util/isNumeric';\nimport { isScheduler } from '../util/isScheduler';\nexport function timer(dueTime = 0, periodOrScheduler, scheduler) {\n let period = -1;\n if (isNumeric(periodOrScheduler)) {\n period = Number(periodOrScheduler) < 1 && 1 || Number(periodOrScheduler);\n }\n else if (isScheduler(periodOrScheduler)) {\n scheduler = periodOrScheduler;\n }\n if (!isScheduler(scheduler)) {\n scheduler = async;\n }\n return new Observable(subscriber => {\n const due = isNumeric(dueTime)\n ? dueTime\n : (+dueTime - scheduler.now());\n return scheduler.schedule(dispatch, due, {\n index: 0, period, subscriber\n });\n });\n}\nfunction dispatch(state) {\n const { index, period, subscriber } = state;\n subscriber.next(index);\n if (subscriber.closed) {\n return;\n }\n else if (period === -1) {\n return subscriber.complete();\n }\n state.index = index + 1;\n this.schedule(state, period);\n}\n","import { SimpleOuterSubscriber, innerSubscribe, SimpleInnerSubscriber } from '../innerSubscribe';\nexport function audit(durationSelector) {\n return function auditOperatorFunction(source) {\n return source.lift(new AuditOperator(durationSelector));\n };\n}\nclass AuditOperator {\n constructor(durationSelector) {\n this.durationSelector = durationSelector;\n }\n call(subscriber, source) {\n return source.subscribe(new AuditSubscriber(subscriber, this.durationSelector));\n }\n}\nclass AuditSubscriber extends SimpleOuterSubscriber {\n constructor(destination, durationSelector) {\n super(destination);\n this.durationSelector = durationSelector;\n this.hasValue = false;\n }\n _next(value) {\n this.value = value;\n this.hasValue = true;\n if (!this.throttled) {\n let duration;\n try {\n const { durationSelector } = this;\n duration = durationSelector(value);\n }\n catch (err) {\n return this.destination.error(err);\n }\n const innerSubscription = innerSubscribe(duration, new SimpleInnerSubscriber(this));\n if (!innerSubscription || innerSubscription.closed) {\n this.clearThrottle();\n }\n else {\n this.add(this.throttled = innerSubscription);\n }\n }\n }\n clearThrottle() {\n const { value, hasValue, throttled } = this;\n if (throttled) {\n this.remove(throttled);\n this.throttled = undefined;\n throttled.unsubscribe();\n }\n if (hasValue) {\n this.value = undefined;\n this.hasValue = false;\n this.destination.next(value);\n }\n }\n notifyNext() {\n this.clearThrottle();\n }\n notifyComplete() {\n this.clearThrottle();\n }\n}\n","import { async } from '../scheduler/async';\nimport { audit } from './audit';\nimport { timer } from '../observable/timer';\nexport function auditTime(duration, scheduler = async) {\n return audit(() => timer(duration, scheduler));\n}\n","import { SimpleOuterSubscriber, SimpleInnerSubscriber, innerSubscribe } from '../innerSubscribe';\nexport function catchError(selector) {\n return function catchErrorOperatorFunction(source) {\n const operator = new CatchOperator(selector);\n const caught = source.lift(operator);\n return (operator.caught = caught);\n };\n}\nclass CatchOperator {\n constructor(selector) {\n this.selector = selector;\n }\n call(subscriber, source) {\n return source.subscribe(new CatchSubscriber(subscriber, this.selector, this.caught));\n }\n}\nclass CatchSubscriber extends SimpleOuterSubscriber {\n constructor(destination, selector, caught) {\n super(destination);\n this.selector = selector;\n this.caught = caught;\n }\n error(err) {\n if (!this.isStopped) {\n let result;\n try {\n result = this.selector(err, this.caught);\n }\n catch (err2) {\n super.error(err2);\n return;\n }\n this._unsubscribeAndRecycle();\n const innerSubscriber = new SimpleInnerSubscriber(this);\n this.add(innerSubscriber);\n const innerSubscription = innerSubscribe(result, innerSubscriber);\n if (innerSubscription !== innerSubscriber) {\n this.add(innerSubscription);\n }\n }\n }\n}\n","import { mergeAll } from './mergeAll';\nexport function concatAll() {\n return mergeAll(1);\n}\n","import { mergeMap } from './mergeMap';\nexport function concatMap(project, resultSelector) {\n return mergeMap(project, resultSelector, 1);\n}\n","import { Subscriber } from '../Subscriber';\nimport { async } from '../scheduler/async';\nexport function debounceTime(dueTime, scheduler = async) {\n return (source) => source.lift(new DebounceTimeOperator(dueTime, scheduler));\n}\nclass DebounceTimeOperator {\n constructor(dueTime, scheduler) {\n this.dueTime = dueTime;\n this.scheduler = scheduler;\n }\n call(subscriber, source) {\n return source.subscribe(new DebounceTimeSubscriber(subscriber, this.dueTime, this.scheduler));\n }\n}\nclass DebounceTimeSubscriber extends Subscriber {\n constructor(destination, dueTime, scheduler) {\n super(destination);\n this.dueTime = dueTime;\n this.scheduler = scheduler;\n this.debouncedSubscription = null;\n this.lastValue = null;\n this.hasValue = false;\n }\n _next(value) {\n this.clearDebounce();\n this.lastValue = value;\n this.hasValue = true;\n this.add(this.debouncedSubscription = this.scheduler.schedule(dispatchNext, this.dueTime, this));\n }\n _complete() {\n this.debouncedNext();\n this.destination.complete();\n }\n debouncedNext() {\n this.clearDebounce();\n if (this.hasValue) {\n const { lastValue } = this;\n this.lastValue = null;\n this.hasValue = false;\n this.destination.next(lastValue);\n }\n }\n clearDebounce() {\n const debouncedSubscription = this.debouncedSubscription;\n if (debouncedSubscription !== null) {\n this.remove(debouncedSubscription);\n debouncedSubscription.unsubscribe();\n this.debouncedSubscription = null;\n }\n }\n}\nfunction dispatchNext(subscriber) {\n subscriber.debouncedNext();\n}\n","import { Subscriber } from '../Subscriber';\nexport function defaultIfEmpty(defaultValue = null) {\n return (source) => source.lift(new DefaultIfEmptyOperator(defaultValue));\n}\nclass DefaultIfEmptyOperator {\n constructor(defaultValue) {\n this.defaultValue = defaultValue;\n }\n call(subscriber, source) {\n return source.subscribe(new DefaultIfEmptySubscriber(subscriber, this.defaultValue));\n }\n}\nclass DefaultIfEmptySubscriber extends Subscriber {\n constructor(destination, defaultValue) {\n super(destination);\n this.defaultValue = defaultValue;\n this.isEmpty = true;\n }\n _next(value) {\n this.isEmpty = false;\n this.destination.next(value);\n }\n _complete() {\n if (this.isEmpty) {\n this.destination.next(this.defaultValue);\n }\n this.destination.complete();\n }\n}\n","import { async } from '../scheduler/async';\nimport { isDate } from '../util/isDate';\nimport { Subscriber } from '../Subscriber';\nimport { Notification } from '../Notification';\nexport function delay(delay, scheduler = async) {\n const absoluteDelay = isDate(delay);\n const delayFor = absoluteDelay ? (+delay - scheduler.now()) : Math.abs(delay);\n return (source) => source.lift(new DelayOperator(delayFor, scheduler));\n}\nclass DelayOperator {\n constructor(delay, scheduler) {\n this.delay = delay;\n this.scheduler = scheduler;\n }\n call(subscriber, source) {\n return source.subscribe(new DelaySubscriber(subscriber, this.delay, this.scheduler));\n }\n}\nclass DelaySubscriber extends Subscriber {\n constructor(destination, delay, scheduler) {\n super(destination);\n this.delay = delay;\n this.scheduler = scheduler;\n this.queue = [];\n this.active = false;\n this.errored = false;\n }\n static dispatch(state) {\n const source = state.source;\n const queue = source.queue;\n const scheduler = state.scheduler;\n const destination = state.destination;\n while (queue.length > 0 && (queue[0].time - scheduler.now()) <= 0) {\n queue.shift().notification.observe(destination);\n }\n if (queue.length > 0) {\n const delay = Math.max(0, queue[0].time - scheduler.now());\n this.schedule(state, delay);\n }\n else {\n this.unsubscribe();\n source.active = false;\n }\n }\n _schedule(scheduler) {\n this.active = true;\n const destination = this.destination;\n destination.add(scheduler.schedule(DelaySubscriber.dispatch, this.delay, {\n source: this, destination: this.destination, scheduler: scheduler\n }));\n }\n scheduleNotification(notification) {\n if (this.errored === true) {\n return;\n }\n const scheduler = this.scheduler;\n const message = new DelayMessage(scheduler.now() + this.delay, notification);\n this.queue.push(message);\n if (this.active === false) {\n this._schedule(scheduler);\n }\n }\n _next(value) {\n this.scheduleNotification(Notification.createNext(value));\n }\n _error(err) {\n this.errored = true;\n this.queue = [];\n this.destination.error(err);\n this.unsubscribe();\n }\n _complete() {\n this.scheduleNotification(Notification.createComplete());\n this.unsubscribe();\n }\n}\nclass DelayMessage {\n constructor(time, notification) {\n this.time = time;\n this.notification = notification;\n }\n}\n","import { Subscriber } from '../Subscriber';\nexport function distinctUntilChanged(compare, keySelector) {\n return (source) => source.lift(new DistinctUntilChangedOperator(compare, keySelector));\n}\nclass DistinctUntilChangedOperator {\n constructor(compare, keySelector) {\n this.compare = compare;\n this.keySelector = keySelector;\n }\n call(subscriber, source) {\n return source.subscribe(new DistinctUntilChangedSubscriber(subscriber, this.compare, this.keySelector));\n }\n}\nclass DistinctUntilChangedSubscriber extends Subscriber {\n constructor(destination, compare, keySelector) {\n super(destination);\n this.keySelector = keySelector;\n this.hasKey = false;\n if (typeof compare === 'function') {\n this.compare = compare;\n }\n }\n compare(x, y) {\n return x === y;\n }\n _next(value) {\n let key;\n try {\n const { keySelector } = this;\n key = keySelector ? keySelector(value) : value;\n }\n catch (err) {\n return this.destination.error(err);\n }\n let result = false;\n if (this.hasKey) {\n try {\n const { compare } = this;\n result = compare(this.key, key);\n }\n catch (err) {\n return this.destination.error(err);\n }\n }\n else {\n this.hasKey = true;\n }\n if (!result) {\n this.key = key;\n this.destination.next(value);\n }\n }\n}\n","import { Subscriber } from '../Subscriber';\nexport function filter(predicate, thisArg) {\n return function filterOperatorFunction(source) {\n return source.lift(new FilterOperator(predicate, thisArg));\n };\n}\nclass FilterOperator {\n constructor(predicate, thisArg) {\n this.predicate = predicate;\n this.thisArg = thisArg;\n }\n call(subscriber, source) {\n return source.subscribe(new FilterSubscriber(subscriber, this.predicate, this.thisArg));\n }\n}\nclass FilterSubscriber extends Subscriber {\n constructor(destination, predicate, thisArg) {\n super(destination);\n this.predicate = predicate;\n this.thisArg = thisArg;\n this.count = 0;\n }\n _next(value) {\n let result;\n try {\n result = this.predicate.call(this.thisArg, value, this.count++);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n if (result) {\n this.destination.next(value);\n }\n }\n}\n","import { Subscriber } from '../Subscriber';\nimport { Subscription } from '../Subscription';\nexport function finalize(callback) {\n return (source) => source.lift(new FinallyOperator(callback));\n}\nclass FinallyOperator {\n constructor(callback) {\n this.callback = callback;\n }\n call(subscriber, source) {\n return source.subscribe(new FinallySubscriber(subscriber, this.callback));\n }\n}\nclass FinallySubscriber extends Subscriber {\n constructor(destination, callback) {\n super(destination);\n this.add(new Subscription(callback));\n }\n}\n","import { EmptyError } from '../util/EmptyError';\nimport { filter } from './filter';\nimport { take } from './take';\nimport { defaultIfEmpty } from './defaultIfEmpty';\nimport { throwIfEmpty } from './throwIfEmpty';\nimport { identity } from '../util/identity';\nexport function first(predicate, defaultValue) {\n const hasDefaultValue = arguments.length >= 2;\n return (source) => source.pipe(predicate ? filter((v, i) => predicate(v, i, source)) : identity, take(1), hasDefaultValue ? defaultIfEmpty(defaultValue) : throwIfEmpty(() => new EmptyError()));\n}\n","import { EmptyError } from '../util/EmptyError';\nimport { filter } from './filter';\nimport { takeLast } from './takeLast';\nimport { throwIfEmpty } from './throwIfEmpty';\nimport { defaultIfEmpty } from './defaultIfEmpty';\nimport { identity } from '../util/identity';\nexport function last(predicate, defaultValue) {\n const hasDefaultValue = arguments.length >= 2;\n return (source) => source.pipe(predicate ? filter((v, i) => predicate(v, i, source)) : identity, takeLast(1), hasDefaultValue ? defaultIfEmpty(defaultValue) : throwIfEmpty(() => new EmptyError()));\n}\n","import { Subscriber } from '../Subscriber';\nexport function map(project, thisArg) {\n return function mapOperation(source) {\n if (typeof project !== 'function') {\n throw new TypeError('argument is not a function. Are you looking for `mapTo()`?');\n }\n return source.lift(new MapOperator(project, thisArg));\n };\n}\nexport class MapOperator {\n constructor(project, thisArg) {\n this.project = project;\n this.thisArg = thisArg;\n }\n call(subscriber, source) {\n return source.subscribe(new MapSubscriber(subscriber, this.project, this.thisArg));\n }\n}\nclass MapSubscriber extends Subscriber {\n constructor(destination, project, thisArg) {\n super(destination);\n this.project = project;\n this.count = 0;\n this.thisArg = thisArg || this;\n }\n _next(value) {\n let result;\n try {\n result = this.project.call(this.thisArg, value, this.count++);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.next(result);\n }\n}\n","import { Subscriber } from '../Subscriber';\nexport function mapTo(value) {\n return (source) => source.lift(new MapToOperator(value));\n}\nclass MapToOperator {\n constructor(value) {\n this.value = value;\n }\n call(subscriber, source) {\n return source.subscribe(new MapToSubscriber(subscriber, this.value));\n }\n}\nclass MapToSubscriber extends Subscriber {\n constructor(destination, value) {\n super(destination);\n this.value = value;\n }\n _next(x) {\n this.destination.next(this.value);\n }\n}\n","import { mergeMap } from './mergeMap';\nimport { identity } from '../util/identity';\nexport function mergeAll(concurrent = Number.POSITIVE_INFINITY) {\n return mergeMap(identity, concurrent);\n}\n","import { map } from './map';\nimport { from } from '../observable/from';\nimport { SimpleOuterSubscriber, SimpleInnerSubscriber, innerSubscribe } from '../innerSubscribe';\nexport function mergeMap(project, resultSelector, concurrent = Number.POSITIVE_INFINITY) {\n if (typeof resultSelector === 'function') {\n return (source) => source.pipe(mergeMap((a, i) => from(project(a, i)).pipe(map((b, ii) => resultSelector(a, b, i, ii))), concurrent));\n }\n else if (typeof resultSelector === 'number') {\n concurrent = resultSelector;\n }\n return (source) => source.lift(new MergeMapOperator(project, concurrent));\n}\nexport class MergeMapOperator {\n constructor(project, concurrent = Number.POSITIVE_INFINITY) {\n this.project = project;\n this.concurrent = concurrent;\n }\n call(observer, source) {\n return source.subscribe(new MergeMapSubscriber(observer, this.project, this.concurrent));\n }\n}\nexport class MergeMapSubscriber extends SimpleOuterSubscriber {\n constructor(destination, project, concurrent = Number.POSITIVE_INFINITY) {\n super(destination);\n this.project = project;\n this.concurrent = concurrent;\n this.hasCompleted = false;\n this.buffer = [];\n this.active = 0;\n this.index = 0;\n }\n _next(value) {\n if (this.active < this.concurrent) {\n this._tryNext(value);\n }\n else {\n this.buffer.push(value);\n }\n }\n _tryNext(value) {\n let result;\n const index = this.index++;\n try {\n result = this.project(value, index);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.active++;\n this._innerSub(result);\n }\n _innerSub(ish) {\n const innerSubscriber = new SimpleInnerSubscriber(this);\n const destination = this.destination;\n destination.add(innerSubscriber);\n const innerSubscription = innerSubscribe(ish, innerSubscriber);\n if (innerSubscription !== innerSubscriber) {\n destination.add(innerSubscription);\n }\n }\n _complete() {\n this.hasCompleted = true;\n if (this.active === 0 && this.buffer.length === 0) {\n this.destination.complete();\n }\n this.unsubscribe();\n }\n notifyNext(innerValue) {\n this.destination.next(innerValue);\n }\n notifyComplete() {\n const buffer = this.buffer;\n this.active--;\n if (buffer.length > 0) {\n this._next(buffer.shift());\n }\n else if (this.active === 0 && this.hasCompleted) {\n this.destination.complete();\n }\n }\n}\nexport const flatMap = mergeMap;\n","import { connectableObservableDescriptor } from '../observable/ConnectableObservable';\nexport function multicast(subjectOrSubjectFactory, selector) {\n return function multicastOperatorFunction(source) {\n let subjectFactory;\n if (typeof subjectOrSubjectFactory === 'function') {\n subjectFactory = subjectOrSubjectFactory;\n }\n else {\n subjectFactory = function subjectFactory() {\n return subjectOrSubjectFactory;\n };\n }\n if (typeof selector === 'function') {\n return source.lift(new MulticastOperator(subjectFactory, selector));\n }\n const connectable = Object.create(source, connectableObservableDescriptor);\n connectable.source = source;\n connectable.subjectFactory = subjectFactory;\n return connectable;\n };\n}\nexport class MulticastOperator {\n constructor(subjectFactory, selector) {\n this.subjectFactory = subjectFactory;\n this.selector = selector;\n }\n call(subscriber, source) {\n const { selector } = this;\n const subject = this.subjectFactory();\n const subscription = selector(subject).subscribe(subscriber);\n subscription.add(source.subscribe(subject));\n return subscription;\n }\n}\n","import { Subscriber } from '../Subscriber';\nimport { Notification } from '../Notification';\nexport function observeOn(scheduler, delay = 0) {\n return function observeOnOperatorFunction(source) {\n return source.lift(new ObserveOnOperator(scheduler, delay));\n };\n}\nexport class ObserveOnOperator {\n constructor(scheduler, delay = 0) {\n this.scheduler = scheduler;\n this.delay = delay;\n }\n call(subscriber, source) {\n return source.subscribe(new ObserveOnSubscriber(subscriber, this.scheduler, this.delay));\n }\n}\nexport class ObserveOnSubscriber extends Subscriber {\n constructor(destination, scheduler, delay = 0) {\n super(destination);\n this.scheduler = scheduler;\n this.delay = delay;\n }\n static dispatch(arg) {\n const { notification, destination } = arg;\n notification.observe(destination);\n this.unsubscribe();\n }\n scheduleMessage(notification) {\n const destination = this.destination;\n destination.add(this.scheduler.schedule(ObserveOnSubscriber.dispatch, this.delay, new ObserveOnMessage(notification, this.destination)));\n }\n _next(value) {\n this.scheduleMessage(Notification.createNext(value));\n }\n _error(err) {\n this.scheduleMessage(Notification.createError(err));\n this.unsubscribe();\n }\n _complete() {\n this.scheduleMessage(Notification.createComplete());\n this.unsubscribe();\n }\n}\nexport class ObserveOnMessage {\n constructor(notification, destination) {\n this.notification = notification;\n this.destination = destination;\n }\n}\n","import { Subscriber } from '../Subscriber';\nexport function refCount() {\n return function refCountOperatorFunction(source) {\n return source.lift(new RefCountOperator(source));\n };\n}\nclass RefCountOperator {\n constructor(connectable) {\n this.connectable = connectable;\n }\n call(subscriber, source) {\n const { connectable } = this;\n connectable._refCount++;\n const refCounter = new RefCountSubscriber(subscriber, connectable);\n const subscription = source.subscribe(refCounter);\n if (!refCounter.closed) {\n refCounter.connection = connectable.connect();\n }\n return subscription;\n }\n}\nclass RefCountSubscriber extends Subscriber {\n constructor(destination, connectable) {\n super(destination);\n this.connectable = connectable;\n }\n _unsubscribe() {\n const { connectable } = this;\n if (!connectable) {\n this.connection = null;\n return;\n }\n this.connectable = null;\n const refCount = connectable._refCount;\n if (refCount <= 0) {\n this.connection = null;\n return;\n }\n connectable._refCount = refCount - 1;\n if (refCount > 1) {\n this.connection = null;\n return;\n }\n const { connection } = this;\n const sharedConnection = connectable._connection;\n this.connection = null;\n if (sharedConnection && (!connection || sharedConnection === connection)) {\n sharedConnection.unsubscribe();\n }\n }\n}\n","import { Subscriber } from '../Subscriber';\nexport function scan(accumulator, seed) {\n let hasSeed = false;\n if (arguments.length >= 2) {\n hasSeed = true;\n }\n return function scanOperatorFunction(source) {\n return source.lift(new ScanOperator(accumulator, seed, hasSeed));\n };\n}\nclass ScanOperator {\n constructor(accumulator, seed, hasSeed = false) {\n this.accumulator = accumulator;\n this.seed = seed;\n this.hasSeed = hasSeed;\n }\n call(subscriber, source) {\n return source.subscribe(new ScanSubscriber(subscriber, this.accumulator, this.seed, this.hasSeed));\n }\n}\nclass ScanSubscriber extends Subscriber {\n constructor(destination, accumulator, _seed, hasSeed) {\n super(destination);\n this.accumulator = accumulator;\n this._seed = _seed;\n this.hasSeed = hasSeed;\n this.index = 0;\n }\n get seed() {\n return this._seed;\n }\n set seed(value) {\n this.hasSeed = true;\n this._seed = value;\n }\n _next(value) {\n if (!this.hasSeed) {\n this.seed = value;\n this.destination.next(value);\n }\n else {\n return this._tryNext(value);\n }\n }\n _tryNext(value) {\n const index = this.index++;\n let result;\n try {\n result = this.accumulator(this.seed, value, index);\n }\n catch (err) {\n this.destination.error(err);\n }\n this.seed = result;\n this.destination.next(result);\n }\n}\n","import { multicast } from './multicast';\nimport { refCount } from './refCount';\nimport { Subject } from '../Subject';\nfunction shareSubjectFactory() {\n return new Subject();\n}\nexport function share() {\n return (source) => refCount()(multicast(shareSubjectFactory)(source));\n}\n","import { ReplaySubject } from '../ReplaySubject';\nexport function shareReplay(configOrBufferSize, windowTime, scheduler) {\n let config;\n if (configOrBufferSize && typeof configOrBufferSize === 'object') {\n config = configOrBufferSize;\n }\n else {\n config = {\n bufferSize: configOrBufferSize,\n windowTime,\n refCount: false,\n scheduler,\n };\n }\n return (source) => source.lift(shareReplayOperator(config));\n}\nfunction shareReplayOperator({ bufferSize = Number.POSITIVE_INFINITY, windowTime = Number.POSITIVE_INFINITY, refCount: useRefCount, scheduler, }) {\n let subject;\n let refCount = 0;\n let subscription;\n let hasError = false;\n let isComplete = false;\n return function shareReplayOperation(source) {\n refCount++;\n let innerSub;\n if (!subject || hasError) {\n hasError = false;\n subject = new ReplaySubject(bufferSize, windowTime, scheduler);\n innerSub = subject.subscribe(this);\n subscription = source.subscribe({\n next(value) {\n subject.next(value);\n },\n error(err) {\n hasError = true;\n subject.error(err);\n },\n complete() {\n isComplete = true;\n subscription = undefined;\n subject.complete();\n },\n });\n if (isComplete) {\n subscription = undefined;\n }\n }\n else {\n innerSub = subject.subscribe(this);\n }\n this.add(() => {\n refCount--;\n innerSub.unsubscribe();\n innerSub = undefined;\n if (subscription && !isComplete && useRefCount && refCount === 0) {\n subscription.unsubscribe();\n subscription = undefined;\n subject = undefined;\n }\n });\n };\n}\n","import { concat } from '../observable/concat';\nimport { isScheduler } from '../util/isScheduler';\nexport function startWith(...array) {\n const scheduler = array[array.length - 1];\n if (isScheduler(scheduler)) {\n array.pop();\n return (source) => concat(array, source, scheduler);\n }\n else {\n return (source) => concat(array, source);\n }\n}\n","import { map } from './map';\nimport { from } from '../observable/from';\nimport { SimpleOuterSubscriber, SimpleInnerSubscriber, innerSubscribe } from '../innerSubscribe';\nexport function switchMap(project, resultSelector) {\n if (typeof resultSelector === 'function') {\n return (source) => source.pipe(switchMap((a, i) => from(project(a, i)).pipe(map((b, ii) => resultSelector(a, b, i, ii)))));\n }\n return (source) => source.lift(new SwitchMapOperator(project));\n}\nclass SwitchMapOperator {\n constructor(project) {\n this.project = project;\n }\n call(subscriber, source) {\n return source.subscribe(new SwitchMapSubscriber(subscriber, this.project));\n }\n}\nclass SwitchMapSubscriber extends SimpleOuterSubscriber {\n constructor(destination, project) {\n super(destination);\n this.project = project;\n this.index = 0;\n }\n _next(value) {\n let result;\n const index = this.index++;\n try {\n result = this.project(value, index);\n }\n catch (error) {\n this.destination.error(error);\n return;\n }\n this._innerSub(result);\n }\n _innerSub(result) {\n const innerSubscription = this.innerSubscription;\n if (innerSubscription) {\n innerSubscription.unsubscribe();\n }\n const innerSubscriber = new SimpleInnerSubscriber(this);\n const destination = this.destination;\n destination.add(innerSubscriber);\n this.innerSubscription = innerSubscribe(result, innerSubscriber);\n if (this.innerSubscription !== innerSubscriber) {\n destination.add(this.innerSubscription);\n }\n }\n _complete() {\n const { innerSubscription } = this;\n if (!innerSubscription || innerSubscription.closed) {\n super._complete();\n }\n this.unsubscribe();\n }\n _unsubscribe() {\n this.innerSubscription = undefined;\n }\n notifyComplete() {\n this.innerSubscription = undefined;\n if (this.isStopped) {\n super._complete();\n }\n }\n notifyNext(innerValue) {\n this.destination.next(innerValue);\n }\n}\n","import { Subscriber } from '../Subscriber';\nimport { ArgumentOutOfRangeError } from '../util/ArgumentOutOfRangeError';\nimport { empty } from '../observable/empty';\nexport function take(count) {\n return (source) => {\n if (count === 0) {\n return empty();\n }\n else {\n return source.lift(new TakeOperator(count));\n }\n };\n}\nclass TakeOperator {\n constructor(total) {\n this.total = total;\n if (this.total < 0) {\n throw new ArgumentOutOfRangeError;\n }\n }\n call(subscriber, source) {\n return source.subscribe(new TakeSubscriber(subscriber, this.total));\n }\n}\nclass TakeSubscriber extends Subscriber {\n constructor(destination, total) {\n super(destination);\n this.total = total;\n this.count = 0;\n }\n _next(value) {\n const total = this.total;\n const count = ++this.count;\n if (count <= total) {\n this.destination.next(value);\n if (count === total) {\n this.destination.complete();\n this.unsubscribe();\n }\n }\n }\n}\n","import { Subscriber } from '../Subscriber';\nimport { ArgumentOutOfRangeError } from '../util/ArgumentOutOfRangeError';\nimport { empty } from '../observable/empty';\nexport function takeLast(count) {\n return function takeLastOperatorFunction(source) {\n if (count === 0) {\n return empty();\n }\n else {\n return source.lift(new TakeLastOperator(count));\n }\n };\n}\nclass TakeLastOperator {\n constructor(total) {\n this.total = total;\n if (this.total < 0) {\n throw new ArgumentOutOfRangeError;\n }\n }\n call(subscriber, source) {\n return source.subscribe(new TakeLastSubscriber(subscriber, this.total));\n }\n}\nclass TakeLastSubscriber extends Subscriber {\n constructor(destination, total) {\n super(destination);\n this.total = total;\n this.ring = new Array();\n this.count = 0;\n }\n _next(value) {\n const ring = this.ring;\n const total = this.total;\n const count = this.count++;\n if (ring.length < total) {\n ring.push(value);\n }\n else {\n const index = count % total;\n ring[index] = value;\n }\n }\n _complete() {\n const destination = this.destination;\n let count = this.count;\n if (count > 0) {\n const total = this.count >= this.total ? this.total : this.count;\n const ring = this.ring;\n for (let i = 0; i < total; i++) {\n const idx = (count++) % total;\n destination.next(ring[idx]);\n }\n }\n destination.complete();\n }\n}\n","import { innerSubscribe, SimpleInnerSubscriber, SimpleOuterSubscriber } from '../innerSubscribe';\nexport function takeUntil(notifier) {\n return (source) => source.lift(new TakeUntilOperator(notifier));\n}\nclass TakeUntilOperator {\n constructor(notifier) {\n this.notifier = notifier;\n }\n call(subscriber, source) {\n const takeUntilSubscriber = new TakeUntilSubscriber(subscriber);\n const notifierSubscription = innerSubscribe(this.notifier, new SimpleInnerSubscriber(takeUntilSubscriber));\n if (notifierSubscription && !takeUntilSubscriber.seenValue) {\n takeUntilSubscriber.add(notifierSubscription);\n return source.subscribe(takeUntilSubscriber);\n }\n return takeUntilSubscriber;\n }\n}\nclass TakeUntilSubscriber extends SimpleOuterSubscriber {\n constructor(destination) {\n super(destination);\n this.seenValue = false;\n }\n notifyNext() {\n this.seenValue = true;\n this.complete();\n }\n notifyComplete() {\n }\n}\n","import { Subscriber } from '../Subscriber';\nexport function takeWhile(predicate, inclusive = false) {\n return (source) => source.lift(new TakeWhileOperator(predicate, inclusive));\n}\nclass TakeWhileOperator {\n constructor(predicate, inclusive) {\n this.predicate = predicate;\n this.inclusive = inclusive;\n }\n call(subscriber, source) {\n return source.subscribe(new TakeWhileSubscriber(subscriber, this.predicate, this.inclusive));\n }\n}\nclass TakeWhileSubscriber extends Subscriber {\n constructor(destination, predicate, inclusive) {\n super(destination);\n this.predicate = predicate;\n this.inclusive = inclusive;\n this.index = 0;\n }\n _next(value) {\n const destination = this.destination;\n let result;\n try {\n result = this.predicate(value, this.index++);\n }\n catch (err) {\n destination.error(err);\n return;\n }\n this.nextOrComplete(value, result);\n }\n nextOrComplete(value, predicateResult) {\n const destination = this.destination;\n if (Boolean(predicateResult)) {\n destination.next(value);\n }\n else {\n if (this.inclusive) {\n destination.next(value);\n }\n destination.complete();\n }\n }\n}\n","import { Subscriber } from '../Subscriber';\nimport { noop } from '../util/noop';\nimport { isFunction } from '../util/isFunction';\nexport function tap(nextOrObserver, error, complete) {\n return function tapOperatorFunction(source) {\n return source.lift(new DoOperator(nextOrObserver, error, complete));\n };\n}\nclass DoOperator {\n constructor(nextOrObserver, error, complete) {\n this.nextOrObserver = nextOrObserver;\n this.error = error;\n this.complete = complete;\n }\n call(subscriber, source) {\n return source.subscribe(new TapSubscriber(subscriber, this.nextOrObserver, this.error, this.complete));\n }\n}\nclass TapSubscriber extends Subscriber {\n constructor(destination, observerOrNext, error, complete) {\n super(destination);\n this._tapNext = noop;\n this._tapError = noop;\n this._tapComplete = noop;\n this._tapError = error || noop;\n this._tapComplete = complete || noop;\n if (isFunction(observerOrNext)) {\n this._context = this;\n this._tapNext = observerOrNext;\n }\n else if (observerOrNext) {\n this._context = observerOrNext;\n this._tapNext = observerOrNext.next || noop;\n this._tapError = observerOrNext.error || noop;\n this._tapComplete = observerOrNext.complete || noop;\n }\n }\n _next(value) {\n try {\n this._tapNext.call(this._context, value);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.next(value);\n }\n _error(err) {\n try {\n this._tapError.call(this._context, err);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.error(err);\n }\n _complete() {\n try {\n this._tapComplete.call(this._context);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n return this.destination.complete();\n }\n}\n","import { EmptyError } from '../util/EmptyError';\nimport { Subscriber } from '../Subscriber';\nexport function throwIfEmpty(errorFactory = defaultErrorFactory) {\n return (source) => {\n return source.lift(new ThrowIfEmptyOperator(errorFactory));\n };\n}\nclass ThrowIfEmptyOperator {\n constructor(errorFactory) {\n this.errorFactory = errorFactory;\n }\n call(subscriber, source) {\n return source.subscribe(new ThrowIfEmptySubscriber(subscriber, this.errorFactory));\n }\n}\nclass ThrowIfEmptySubscriber extends Subscriber {\n constructor(destination, errorFactory) {\n super(destination);\n this.errorFactory = errorFactory;\n this.hasValue = false;\n }\n _next(value) {\n this.hasValue = true;\n this.destination.next(value);\n }\n _complete() {\n if (!this.hasValue) {\n let err;\n try {\n err = this.errorFactory();\n }\n catch (e) {\n err = e;\n }\n this.destination.error(err);\n }\n else {\n return this.destination.complete();\n }\n }\n}\nfunction defaultErrorFactory() {\n return new EmptyError();\n}\n","import { OuterSubscriber } from '../OuterSubscriber';\nimport { subscribeToResult } from '../util/subscribeToResult';\nexport function withLatestFrom(...args) {\n return (source) => {\n let project;\n if (typeof args[args.length - 1] === 'function') {\n project = args.pop();\n }\n const observables = args;\n return source.lift(new WithLatestFromOperator(observables, project));\n };\n}\nclass WithLatestFromOperator {\n constructor(observables, project) {\n this.observables = observables;\n this.project = project;\n }\n call(subscriber, source) {\n return source.subscribe(new WithLatestFromSubscriber(subscriber, this.observables, this.project));\n }\n}\nclass WithLatestFromSubscriber extends OuterSubscriber {\n constructor(destination, observables, project) {\n super(destination);\n this.observables = observables;\n this.project = project;\n this.toRespond = [];\n const len = observables.length;\n this.values = new Array(len);\n for (let i = 0; i < len; i++) {\n this.toRespond.push(i);\n }\n for (let i = 0; i < len; i++) {\n let observable = observables[i];\n this.add(subscribeToResult(this, observable, undefined, i));\n }\n }\n notifyNext(_outerValue, innerValue, outerIndex) {\n this.values[outerIndex] = innerValue;\n const toRespond = this.toRespond;\n if (toRespond.length > 0) {\n const found = toRespond.indexOf(outerIndex);\n if (found !== -1) {\n toRespond.splice(found, 1);\n }\n }\n }\n notifyComplete() {\n }\n _next(value) {\n if (this.toRespond.length === 0) {\n const args = [value, ...this.values];\n if (this.project) {\n this._tryProject(args);\n }\n else {\n this.destination.next(args);\n }\n }\n }\n _tryProject(args) {\n let result;\n try {\n result = this.project.apply(this, args);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.next(result);\n }\n}\n","import { Observable } from '../Observable';\nimport { Subscription } from '../Subscription';\nexport function scheduleArray(input, scheduler) {\n return new Observable(subscriber => {\n const sub = new Subscription();\n let i = 0;\n sub.add(scheduler.schedule(function () {\n if (i === input.length) {\n subscriber.complete();\n return;\n }\n subscriber.next(input[i++]);\n if (!subscriber.closed) {\n sub.add(this.schedule());\n }\n }));\n return sub;\n });\n}\n","import { Observable } from '../Observable';\nimport { Subscription } from '../Subscription';\nimport { iterator as Symbol_iterator } from '../symbol/iterator';\nexport function scheduleIterable(input, scheduler) {\n if (!input) {\n throw new Error('Iterable cannot be null');\n }\n return new Observable(subscriber => {\n const sub = new Subscription();\n let iterator;\n sub.add(() => {\n if (iterator && typeof iterator.return === 'function') {\n iterator.return();\n }\n });\n sub.add(scheduler.schedule(() => {\n iterator = input[Symbol_iterator]();\n sub.add(scheduler.schedule(function () {\n if (subscriber.closed) {\n return;\n }\n let value;\n let done;\n try {\n const result = iterator.next();\n value = result.value;\n done = result.done;\n }\n catch (err) {\n subscriber.error(err);\n return;\n }\n if (done) {\n subscriber.complete();\n }\n else {\n subscriber.next(value);\n this.schedule();\n }\n }));\n }));\n return sub;\n });\n}\n","import { Observable } from '../Observable';\nimport { Subscription } from '../Subscription';\nimport { observable as Symbol_observable } from '../symbol/observable';\nexport function scheduleObservable(input, scheduler) {\n return new Observable(subscriber => {\n const sub = new Subscription();\n sub.add(scheduler.schedule(() => {\n const observable = input[Symbol_observable]();\n sub.add(observable.subscribe({\n next(value) { sub.add(scheduler.schedule(() => subscriber.next(value))); },\n error(err) { sub.add(scheduler.schedule(() => subscriber.error(err))); },\n complete() { sub.add(scheduler.schedule(() => subscriber.complete())); },\n }));\n }));\n return sub;\n });\n}\n","import { Observable } from '../Observable';\nimport { Subscription } from '../Subscription';\nexport function schedulePromise(input, scheduler) {\n return new Observable(subscriber => {\n const sub = new Subscription();\n sub.add(scheduler.schedule(() => input.then(value => {\n sub.add(scheduler.schedule(() => {\n subscriber.next(value);\n sub.add(scheduler.schedule(() => subscriber.complete()));\n }));\n }, err => {\n sub.add(scheduler.schedule(() => subscriber.error(err)));\n })));\n return sub;\n });\n}\n","import { scheduleObservable } from './scheduleObservable';\nimport { schedulePromise } from './schedulePromise';\nimport { scheduleArray } from './scheduleArray';\nimport { scheduleIterable } from './scheduleIterable';\nimport { isInteropObservable } from '../util/isInteropObservable';\nimport { isPromise } from '../util/isPromise';\nimport { isArrayLike } from '../util/isArrayLike';\nimport { isIterable } from '../util/isIterable';\nexport function scheduled(input, scheduler) {\n if (input != null) {\n if (isInteropObservable(input)) {\n return scheduleObservable(input, scheduler);\n }\n else if (isPromise(input)) {\n return schedulePromise(input, scheduler);\n }\n else if (isArrayLike(input)) {\n return scheduleArray(input, scheduler);\n }\n else if (isIterable(input) || typeof input === 'string') {\n return scheduleIterable(input, scheduler);\n }\n }\n throw new TypeError((input !== null && typeof input || input) + ' is not observable');\n}\n","import { Subscription } from '../Subscription';\nexport class Action extends Subscription {\n constructor(scheduler, work) {\n super();\n }\n schedule(state, delay = 0) {\n return this;\n }\n}\n","import { AsyncAction } from './AsyncAction';\nexport class AnimationFrameAction extends AsyncAction {\n constructor(scheduler, work) {\n super(scheduler, work);\n this.scheduler = scheduler;\n this.work = work;\n }\n requestAsyncId(scheduler, id, delay = 0) {\n if (delay !== null && delay > 0) {\n return super.requestAsyncId(scheduler, id, delay);\n }\n scheduler.actions.push(this);\n return scheduler.scheduled || (scheduler.scheduled = requestAnimationFrame(() => scheduler.flush(null)));\n }\n recycleAsyncId(scheduler, id, delay = 0) {\n if ((delay !== null && delay > 0) || (delay === null && this.delay > 0)) {\n return super.recycleAsyncId(scheduler, id, delay);\n }\n if (scheduler.actions.length === 0) {\n cancelAnimationFrame(id);\n scheduler.scheduled = undefined;\n }\n return undefined;\n }\n}\n","import { AsyncScheduler } from './AsyncScheduler';\nexport class AnimationFrameScheduler extends AsyncScheduler {\n flush(action) {\n this.active = true;\n this.scheduled = undefined;\n const { actions } = this;\n let error;\n let index = -1;\n let count = actions.length;\n action = action || actions.shift();\n do {\n if (error = action.execute(action.state, action.delay)) {\n break;\n }\n } while (++index < count && (action = actions.shift()));\n this.active = false;\n if (error) {\n while (++index < count && (action = actions.shift())) {\n action.unsubscribe();\n }\n throw error;\n }\n }\n}\n","import { Immediate } from '../util/Immediate';\nimport { AsyncAction } from './AsyncAction';\nexport class AsapAction extends AsyncAction {\n constructor(scheduler, work) {\n super(scheduler, work);\n this.scheduler = scheduler;\n this.work = work;\n }\n requestAsyncId(scheduler, id, delay = 0) {\n if (delay !== null && delay > 0) {\n return super.requestAsyncId(scheduler, id, delay);\n }\n scheduler.actions.push(this);\n return scheduler.scheduled || (scheduler.scheduled = Immediate.setImmediate(scheduler.flush.bind(scheduler, null)));\n }\n recycleAsyncId(scheduler, id, delay = 0) {\n if ((delay !== null && delay > 0) || (delay === null && this.delay > 0)) {\n return super.recycleAsyncId(scheduler, id, delay);\n }\n if (scheduler.actions.length === 0) {\n Immediate.clearImmediate(id);\n scheduler.scheduled = undefined;\n }\n return undefined;\n }\n}\n","import { AsyncScheduler } from './AsyncScheduler';\nexport class AsapScheduler extends AsyncScheduler {\n flush(action) {\n this.active = true;\n this.scheduled = undefined;\n const { actions } = this;\n let error;\n let index = -1;\n let count = actions.length;\n action = action || actions.shift();\n do {\n if (error = action.execute(action.state, action.delay)) {\n break;\n }\n } while (++index < count && (action = actions.shift()));\n this.active = false;\n if (error) {\n while (++index < count && (action = actions.shift())) {\n action.unsubscribe();\n }\n throw error;\n }\n }\n}\n","import { Action } from './Action';\nexport class AsyncAction extends Action {\n constructor(scheduler, work) {\n super(scheduler, work);\n this.scheduler = scheduler;\n this.work = work;\n this.pending = false;\n }\n schedule(state, delay = 0) {\n if (this.closed) {\n return this;\n }\n this.state = state;\n const id = this.id;\n const scheduler = this.scheduler;\n if (id != null) {\n this.id = this.recycleAsyncId(scheduler, id, delay);\n }\n this.pending = true;\n this.delay = delay;\n this.id = this.id || this.requestAsyncId(scheduler, this.id, delay);\n return this;\n }\n requestAsyncId(scheduler, id, delay = 0) {\n return setInterval(scheduler.flush.bind(scheduler, this), delay);\n }\n recycleAsyncId(scheduler, id, delay = 0) {\n if (delay !== null && this.delay === delay && this.pending === false) {\n return id;\n }\n clearInterval(id);\n return undefined;\n }\n execute(state, delay) {\n if (this.closed) {\n return new Error('executing a cancelled action');\n }\n this.pending = false;\n const error = this._execute(state, delay);\n if (error) {\n return error;\n }\n else if (this.pending === false && this.id != null) {\n this.id = this.recycleAsyncId(this.scheduler, this.id, null);\n }\n }\n _execute(state, delay) {\n let errored = false;\n let errorValue = undefined;\n try {\n this.work(state);\n }\n catch (e) {\n errored = true;\n errorValue = !!e && e || new Error(e);\n }\n if (errored) {\n this.unsubscribe();\n return errorValue;\n }\n }\n _unsubscribe() {\n const id = this.id;\n const scheduler = this.scheduler;\n const actions = scheduler.actions;\n const index = actions.indexOf(this);\n this.work = null;\n this.state = null;\n this.pending = false;\n this.scheduler = null;\n if (index !== -1) {\n actions.splice(index, 1);\n }\n if (id != null) {\n this.id = this.recycleAsyncId(scheduler, id, null);\n }\n this.delay = null;\n }\n}\n","import { Scheduler } from '../Scheduler';\nexport class AsyncScheduler extends Scheduler {\n constructor(SchedulerAction, now = Scheduler.now) {\n super(SchedulerAction, () => {\n if (AsyncScheduler.delegate && AsyncScheduler.delegate !== this) {\n return AsyncScheduler.delegate.now();\n }\n else {\n return now();\n }\n });\n this.actions = [];\n this.active = false;\n this.scheduled = undefined;\n }\n schedule(work, delay = 0, state) {\n if (AsyncScheduler.delegate && AsyncScheduler.delegate !== this) {\n return AsyncScheduler.delegate.schedule(work, delay, state);\n }\n else {\n return super.schedule(work, delay, state);\n }\n }\n flush(action) {\n const { actions } = this;\n if (this.active) {\n actions.push(action);\n return;\n }\n let error;\n this.active = true;\n do {\n if (error = action.execute(action.state, action.delay)) {\n break;\n }\n } while (action = actions.shift());\n this.active = false;\n if (error) {\n while (action = actions.shift()) {\n action.unsubscribe();\n }\n throw error;\n }\n }\n}\n","import { AsyncAction } from './AsyncAction';\nexport class QueueAction extends AsyncAction {\n constructor(scheduler, work) {\n super(scheduler, work);\n this.scheduler = scheduler;\n this.work = work;\n }\n schedule(state, delay = 0) {\n if (delay > 0) {\n return super.schedule(state, delay);\n }\n this.delay = delay;\n this.state = state;\n this.scheduler.flush(this);\n return this;\n }\n execute(state, delay) {\n return (delay > 0 || this.closed) ?\n super.execute(state, delay) :\n this._execute(state, delay);\n }\n requestAsyncId(scheduler, id, delay = 0) {\n if ((delay !== null && delay > 0) || (delay === null && this.delay > 0)) {\n return super.requestAsyncId(scheduler, id, delay);\n }\n return scheduler.flush(this);\n }\n}\n","import { AsyncScheduler } from './AsyncScheduler';\nexport class QueueScheduler extends AsyncScheduler {\n}\n","import { AnimationFrameAction } from './AnimationFrameAction';\nimport { AnimationFrameScheduler } from './AnimationFrameScheduler';\nexport const animationFrameScheduler = new AnimationFrameScheduler(AnimationFrameAction);\nexport const animationFrame = animationFrameScheduler;\n","import { AsapAction } from './AsapAction';\nimport { AsapScheduler } from './AsapScheduler';\nexport const asapScheduler = new AsapScheduler(AsapAction);\nexport const asap = asapScheduler;\n","import { AsyncAction } from './AsyncAction';\nimport { AsyncScheduler } from './AsyncScheduler';\nexport const asyncScheduler = new AsyncScheduler(AsyncAction);\nexport const async = asyncScheduler;\n","import { QueueAction } from './QueueAction';\nimport { QueueScheduler } from './QueueScheduler';\nexport const queueScheduler = new QueueScheduler(QueueAction);\nexport const queue = queueScheduler;\n","export function getSymbolIterator() {\n if (typeof Symbol !== 'function' || !Symbol.iterator) {\n return '@@iterator';\n }\n return Symbol.iterator;\n}\nexport const iterator = getSymbolIterator();\nexport const $$iterator = iterator;\n","export const observable = (() => typeof Symbol === 'function' && Symbol.observable || '@@observable')();\n","export const rxSubscriber = (() => typeof Symbol === 'function'\n ? Symbol('rxSubscriber')\n : '@@rxSubscriber_' + Math.random())();\nexport const $$rxSubscriber = rxSubscriber;\n","const ArgumentOutOfRangeErrorImpl = (() => {\n function ArgumentOutOfRangeErrorImpl() {\n Error.call(this);\n this.message = 'argument out of range';\n this.name = 'ArgumentOutOfRangeError';\n return this;\n }\n ArgumentOutOfRangeErrorImpl.prototype = Object.create(Error.prototype);\n return ArgumentOutOfRangeErrorImpl;\n})();\nexport const ArgumentOutOfRangeError = ArgumentOutOfRangeErrorImpl;\n","const EmptyErrorImpl = (() => {\n function EmptyErrorImpl() {\n Error.call(this);\n this.message = 'no elements in sequence';\n this.name = 'EmptyError';\n return this;\n }\n EmptyErrorImpl.prototype = Object.create(Error.prototype);\n return EmptyErrorImpl;\n})();\nexport const EmptyError = EmptyErrorImpl;\n","let nextHandle = 1;\nconst RESOLVED = (() => Promise.resolve())();\nconst activeHandles = {};\nfunction findAndClearHandle(handle) {\n if (handle in activeHandles) {\n delete activeHandles[handle];\n return true;\n }\n return false;\n}\nexport const Immediate = {\n setImmediate(cb) {\n const handle = nextHandle++;\n activeHandles[handle] = true;\n RESOLVED.then(() => findAndClearHandle(handle) && cb());\n return handle;\n },\n clearImmediate(handle) {\n findAndClearHandle(handle);\n },\n};\nexport const TestTools = {\n pending() {\n return Object.keys(activeHandles).length;\n }\n};\n","const ObjectUnsubscribedErrorImpl = (() => {\n function ObjectUnsubscribedErrorImpl() {\n Error.call(this);\n this.message = 'object unsubscribed';\n this.name = 'ObjectUnsubscribedError';\n return this;\n }\n ObjectUnsubscribedErrorImpl.prototype = Object.create(Error.prototype);\n return ObjectUnsubscribedErrorImpl;\n})();\nexport const ObjectUnsubscribedError = ObjectUnsubscribedErrorImpl;\n","const UnsubscriptionErrorImpl = (() => {\n function UnsubscriptionErrorImpl(errors) {\n Error.call(this);\n this.message = errors ?\n `${errors.length} errors occurred during unsubscription:\n${errors.map((err, i) => `${i + 1}) ${err.toString()}`).join('\\n ')}` : '';\n this.name = 'UnsubscriptionError';\n this.errors = errors;\n return this;\n }\n UnsubscriptionErrorImpl.prototype = Object.create(Error.prototype);\n return UnsubscriptionErrorImpl;\n})();\nexport const UnsubscriptionError = UnsubscriptionErrorImpl;\n","import { Subscriber } from '../Subscriber';\nexport function canReportError(observer) {\n while (observer) {\n const { closed, destination, isStopped } = observer;\n if (closed || isStopped) {\n return false;\n }\n else if (destination && destination instanceof Subscriber) {\n observer = destination;\n }\n else {\n observer = null;\n }\n }\n return true;\n}\n","export function hostReportError(err) {\n setTimeout(() => { throw err; }, 0);\n}\n","export function identity(x) {\n return x;\n}\n","export const isArray = (() => Array.isArray || ((x) => x && typeof x.length === 'number'))();\n","export const isArrayLike = ((x) => x && typeof x.length === 'number' && typeof x !== 'function');\n","export function isDate(value) {\n return value instanceof Date && !isNaN(+value);\n}\n","export function isFunction(x) {\n return typeof x === 'function';\n}\n","import { observable as Symbol_observable } from '../symbol/observable';\nexport function isInteropObservable(input) {\n return input && typeof input[Symbol_observable] === 'function';\n}\n","import { iterator as Symbol_iterator } from '../symbol/iterator';\nexport function isIterable(input) {\n return input && typeof input[Symbol_iterator] === 'function';\n}\n","import { isArray } from './isArray';\nexport function isNumeric(val) {\n return !isArray(val) && (val - parseFloat(val) + 1) >= 0;\n}\n","export function isObject(x) {\n return x !== null && typeof x === 'object';\n}\n","import { Observable } from '../Observable';\nexport function isObservable(obj) {\n return !!obj && (obj instanceof Observable || (typeof obj.lift === 'function' && typeof obj.subscribe === 'function'));\n}\n","export function isPromise(value) {\n return !!value && typeof value.subscribe !== 'function' && typeof value.then === 'function';\n}\n","export function isScheduler(value) {\n return value && typeof value.schedule === 'function';\n}\n","export function noop() { }\n","import { identity } from './identity';\nexport function pipe(...fns) {\n return pipeFromArray(fns);\n}\nexport function pipeFromArray(fns) {\n if (fns.length === 0) {\n return identity;\n }\n if (fns.length === 1) {\n return fns[0];\n }\n return function piped(input) {\n return fns.reduce((prev, fn) => fn(prev), input);\n };\n}\n","import { subscribeToArray } from './subscribeToArray';\nimport { subscribeToPromise } from './subscribeToPromise';\nimport { subscribeToIterable } from './subscribeToIterable';\nimport { subscribeToObservable } from './subscribeToObservable';\nimport { isArrayLike } from './isArrayLike';\nimport { isPromise } from './isPromise';\nimport { isObject } from './isObject';\nimport { iterator as Symbol_iterator } from '../symbol/iterator';\nimport { observable as Symbol_observable } from '../symbol/observable';\nexport const subscribeTo = (result) => {\n if (!!result && typeof result[Symbol_observable] === 'function') {\n return subscribeToObservable(result);\n }\n else if (isArrayLike(result)) {\n return subscribeToArray(result);\n }\n else if (isPromise(result)) {\n return subscribeToPromise(result);\n }\n else if (!!result && typeof result[Symbol_iterator] === 'function') {\n return subscribeToIterable(result);\n }\n else {\n const value = isObject(result) ? 'an invalid object' : `'${result}'`;\n const msg = `You provided ${value} where a stream was expected.`\n + ' You can provide an Observable, Promise, Array, or Iterable.';\n throw new TypeError(msg);\n }\n};\n","export const subscribeToArray = (array) => (subscriber) => {\n for (let i = 0, len = array.length; i < len && !subscriber.closed; i++) {\n subscriber.next(array[i]);\n }\n subscriber.complete();\n};\n","import { iterator as Symbol_iterator } from '../symbol/iterator';\nexport const subscribeToIterable = (iterable) => (subscriber) => {\n const iterator = iterable[Symbol_iterator]();\n do {\n let item;\n try {\n item = iterator.next();\n }\n catch (err) {\n subscriber.error(err);\n return subscriber;\n }\n if (item.done) {\n subscriber.complete();\n break;\n }\n subscriber.next(item.value);\n if (subscriber.closed) {\n break;\n }\n } while (true);\n if (typeof iterator.return === 'function') {\n subscriber.add(() => {\n if (iterator.return) {\n iterator.return();\n }\n });\n }\n return subscriber;\n};\n","import { observable as Symbol_observable } from '../symbol/observable';\nexport const subscribeToObservable = (obj) => (subscriber) => {\n const obs = obj[Symbol_observable]();\n if (typeof obs.subscribe !== 'function') {\n throw new TypeError('Provided object does not correctly implement Symbol.observable');\n }\n else {\n return obs.subscribe(subscriber);\n }\n};\n","import { hostReportError } from './hostReportError';\nexport const subscribeToPromise = (promise) => (subscriber) => {\n promise.then((value) => {\n if (!subscriber.closed) {\n subscriber.next(value);\n subscriber.complete();\n }\n }, (err) => subscriber.error(err))\n .then(null, hostReportError);\n return subscriber;\n};\n","import { InnerSubscriber } from '../InnerSubscriber';\nimport { subscribeTo } from './subscribeTo';\nimport { Observable } from '../Observable';\nexport function subscribeToResult(outerSubscriber, result, outerValue, outerIndex, innerSubscriber = new InnerSubscriber(outerSubscriber, outerValue, outerIndex)) {\n if (innerSubscriber.closed) {\n return undefined;\n }\n if (result instanceof Observable) {\n return result.subscribe(innerSubscriber);\n }\n return subscribeTo(result)(innerSubscriber);\n}\n","import { Subscriber } from '../Subscriber';\nimport { rxSubscriber as rxSubscriberSymbol } from '../symbol/rxSubscriber';\nimport { empty as emptyObserver } from '../Observer';\nexport function toSubscriber(nextOrObserver, error, complete) {\n if (nextOrObserver) {\n if (nextOrObserver instanceof Subscriber) {\n return nextOrObserver;\n }\n if (nextOrObserver[rxSubscriberSymbol]) {\n return nextOrObserver[rxSubscriberSymbol]();\n }\n }\n if (!nextOrObserver && !error && !complete) {\n return new Subscriber(emptyObserver);\n }\n return new Subscriber(nextOrObserver, error, complete);\n}\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subject_1 = require(\"./Subject\");\nvar Subscription_1 = require(\"./Subscription\");\nvar AsyncSubject = (function (_super) {\n __extends(AsyncSubject, _super);\n function AsyncSubject() {\n var _this = _super !== null && _super.apply(this, arguments) || this;\n _this.value = null;\n _this.hasNext = false;\n _this.hasCompleted = false;\n return _this;\n }\n AsyncSubject.prototype._subscribe = function (subscriber) {\n if (this.hasError) {\n subscriber.error(this.thrownError);\n return Subscription_1.Subscription.EMPTY;\n }\n else if (this.hasCompleted && this.hasNext) {\n subscriber.next(this.value);\n subscriber.complete();\n return Subscription_1.Subscription.EMPTY;\n }\n return _super.prototype._subscribe.call(this, subscriber);\n };\n AsyncSubject.prototype.next = function (value) {\n if (!this.hasCompleted) {\n this.value = value;\n this.hasNext = true;\n }\n };\n AsyncSubject.prototype.error = function (error) {\n if (!this.hasCompleted) {\n _super.prototype.error.call(this, error);\n }\n };\n AsyncSubject.prototype.complete = function () {\n this.hasCompleted = true;\n if (this.hasNext) {\n _super.prototype.next.call(this, this.value);\n }\n _super.prototype.complete.call(this);\n };\n return AsyncSubject;\n}(Subject_1.Subject));\nexports.AsyncSubject = AsyncSubject;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subject_1 = require(\"./Subject\");\nvar ObjectUnsubscribedError_1 = require(\"./util/ObjectUnsubscribedError\");\nvar BehaviorSubject = (function (_super) {\n __extends(BehaviorSubject, _super);\n function BehaviorSubject(_value) {\n var _this = _super.call(this) || this;\n _this._value = _value;\n return _this;\n }\n Object.defineProperty(BehaviorSubject.prototype, \"value\", {\n get: function () {\n return this.getValue();\n },\n enumerable: true,\n configurable: true\n });\n BehaviorSubject.prototype._subscribe = function (subscriber) {\n var subscription = _super.prototype._subscribe.call(this, subscriber);\n if (subscription && !subscription.closed) {\n subscriber.next(this._value);\n }\n return subscription;\n };\n BehaviorSubject.prototype.getValue = function () {\n if (this.hasError) {\n throw this.thrownError;\n }\n else if (this.closed) {\n throw new ObjectUnsubscribedError_1.ObjectUnsubscribedError();\n }\n else {\n return this._value;\n }\n };\n BehaviorSubject.prototype.next = function (value) {\n _super.prototype.next.call(this, this._value = value);\n };\n return BehaviorSubject;\n}(Subject_1.Subject));\nexports.BehaviorSubject = BehaviorSubject;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"./Subscriber\");\nvar InnerSubscriber = (function (_super) {\n __extends(InnerSubscriber, _super);\n function InnerSubscriber(parent, outerValue, outerIndex) {\n var _this = _super.call(this) || this;\n _this.parent = parent;\n _this.outerValue = outerValue;\n _this.outerIndex = outerIndex;\n _this.index = 0;\n return _this;\n }\n InnerSubscriber.prototype._next = function (value) {\n this.parent.notifyNext(this.outerValue, value, this.outerIndex, this.index++, this);\n };\n InnerSubscriber.prototype._error = function (error) {\n this.parent.notifyError(error, this);\n this.unsubscribe();\n };\n InnerSubscriber.prototype._complete = function () {\n this.parent.notifyComplete(this);\n this.unsubscribe();\n };\n return InnerSubscriber;\n}(Subscriber_1.Subscriber));\nexports.InnerSubscriber = InnerSubscriber;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar empty_1 = require(\"./observable/empty\");\nvar of_1 = require(\"./observable/of\");\nvar throwError_1 = require(\"./observable/throwError\");\nvar NotificationKind;\n(function (NotificationKind) {\n NotificationKind[\"NEXT\"] = \"N\";\n NotificationKind[\"ERROR\"] = \"E\";\n NotificationKind[\"COMPLETE\"] = \"C\";\n})(NotificationKind = exports.NotificationKind || (exports.NotificationKind = {}));\nvar Notification = (function () {\n function Notification(kind, value, error) {\n this.kind = kind;\n this.value = value;\n this.error = error;\n this.hasValue = kind === 'N';\n }\n Notification.prototype.observe = function (observer) {\n switch (this.kind) {\n case 'N':\n return observer.next && observer.next(this.value);\n case 'E':\n return observer.error && observer.error(this.error);\n case 'C':\n return observer.complete && observer.complete();\n }\n };\n Notification.prototype.do = function (next, error, complete) {\n var kind = this.kind;\n switch (kind) {\n case 'N':\n return next && next(this.value);\n case 'E':\n return error && error(this.error);\n case 'C':\n return complete && complete();\n }\n };\n Notification.prototype.accept = function (nextOrObserver, error, complete) {\n if (nextOrObserver && typeof nextOrObserver.next === 'function') {\n return this.observe(nextOrObserver);\n }\n else {\n return this.do(nextOrObserver, error, complete);\n }\n };\n Notification.prototype.toObservable = function () {\n var kind = this.kind;\n switch (kind) {\n case 'N':\n return of_1.of(this.value);\n case 'E':\n return throwError_1.throwError(this.error);\n case 'C':\n return empty_1.empty();\n }\n throw new Error('unexpected notification kind value');\n };\n Notification.createNext = function (value) {\n if (typeof value !== 'undefined') {\n return new Notification('N', value);\n }\n return Notification.undefinedValueNotification;\n };\n Notification.createError = function (err) {\n return new Notification('E', undefined, err);\n };\n Notification.createComplete = function () {\n return Notification.completeNotification;\n };\n Notification.completeNotification = new Notification('C');\n Notification.undefinedValueNotification = new Notification('N', undefined);\n return Notification;\n}());\nexports.Notification = Notification;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar canReportError_1 = require(\"./util/canReportError\");\nvar toSubscriber_1 = require(\"./util/toSubscriber\");\nvar observable_1 = require(\"./symbol/observable\");\nvar pipe_1 = require(\"./util/pipe\");\nvar config_1 = require(\"./config\");\nvar Observable = (function () {\n function Observable(subscribe) {\n this._isScalar = false;\n if (subscribe) {\n this._subscribe = subscribe;\n }\n }\n Observable.prototype.lift = function (operator) {\n var observable = new Observable();\n observable.source = this;\n observable.operator = operator;\n return observable;\n };\n Observable.prototype.subscribe = function (observerOrNext, error, complete) {\n var operator = this.operator;\n var sink = toSubscriber_1.toSubscriber(observerOrNext, error, complete);\n if (operator) {\n sink.add(operator.call(sink, this.source));\n }\n else {\n sink.add(this.source || (config_1.config.useDeprecatedSynchronousErrorHandling && !sink.syncErrorThrowable) ?\n this._subscribe(sink) :\n this._trySubscribe(sink));\n }\n if (config_1.config.useDeprecatedSynchronousErrorHandling) {\n if (sink.syncErrorThrowable) {\n sink.syncErrorThrowable = false;\n if (sink.syncErrorThrown) {\n throw sink.syncErrorValue;\n }\n }\n }\n return sink;\n };\n Observable.prototype._trySubscribe = function (sink) {\n try {\n return this._subscribe(sink);\n }\n catch (err) {\n if (config_1.config.useDeprecatedSynchronousErrorHandling) {\n sink.syncErrorThrown = true;\n sink.syncErrorValue = err;\n }\n if (canReportError_1.canReportError(sink)) {\n sink.error(err);\n }\n else {\n console.warn(err);\n }\n }\n };\n Observable.prototype.forEach = function (next, promiseCtor) {\n var _this = this;\n promiseCtor = getPromiseCtor(promiseCtor);\n return new promiseCtor(function (resolve, reject) {\n var subscription;\n subscription = _this.subscribe(function (value) {\n try {\n next(value);\n }\n catch (err) {\n reject(err);\n if (subscription) {\n subscription.unsubscribe();\n }\n }\n }, reject, resolve);\n });\n };\n Observable.prototype._subscribe = function (subscriber) {\n var source = this.source;\n return source && source.subscribe(subscriber);\n };\n Observable.prototype[observable_1.observable] = function () {\n return this;\n };\n Observable.prototype.pipe = function () {\n var operations = [];\n for (var _i = 0; _i < arguments.length; _i++) {\n operations[_i] = arguments[_i];\n }\n if (operations.length === 0) {\n return this;\n }\n return pipe_1.pipeFromArray(operations)(this);\n };\n Observable.prototype.toPromise = function (promiseCtor) {\n var _this = this;\n promiseCtor = getPromiseCtor(promiseCtor);\n return new promiseCtor(function (resolve, reject) {\n var value;\n _this.subscribe(function (x) { return value = x; }, function (err) { return reject(err); }, function () { return resolve(value); });\n });\n };\n Observable.create = function (subscribe) {\n return new Observable(subscribe);\n };\n return Observable;\n}());\nexports.Observable = Observable;\nfunction getPromiseCtor(promiseCtor) {\n if (!promiseCtor) {\n promiseCtor = config_1.config.Promise || Promise;\n }\n if (!promiseCtor) {\n throw new Error('no Promise impl found');\n }\n return promiseCtor;\n}\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar config_1 = require(\"./config\");\nvar hostReportError_1 = require(\"./util/hostReportError\");\nexports.empty = {\n closed: true,\n next: function (value) { },\n error: function (err) {\n if (config_1.config.useDeprecatedSynchronousErrorHandling) {\n throw err;\n }\n else {\n hostReportError_1.hostReportError(err);\n }\n },\n complete: function () { }\n};\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"./Subscriber\");\nvar OuterSubscriber = (function (_super) {\n __extends(OuterSubscriber, _super);\n function OuterSubscriber() {\n return _super !== null && _super.apply(this, arguments) || this;\n }\n OuterSubscriber.prototype.notifyNext = function (outerValue, innerValue, outerIndex, innerIndex, innerSub) {\n this.destination.next(innerValue);\n };\n OuterSubscriber.prototype.notifyError = function (error, innerSub) {\n this.destination.error(error);\n };\n OuterSubscriber.prototype.notifyComplete = function (innerSub) {\n this.destination.complete();\n };\n return OuterSubscriber;\n}(Subscriber_1.Subscriber));\nexports.OuterSubscriber = OuterSubscriber;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subject_1 = require(\"./Subject\");\nvar queue_1 = require(\"./scheduler/queue\");\nvar Subscription_1 = require(\"./Subscription\");\nvar observeOn_1 = require(\"./operators/observeOn\");\nvar ObjectUnsubscribedError_1 = require(\"./util/ObjectUnsubscribedError\");\nvar SubjectSubscription_1 = require(\"./SubjectSubscription\");\nvar ReplaySubject = (function (_super) {\n __extends(ReplaySubject, _super);\n function ReplaySubject(bufferSize, windowTime, scheduler) {\n if (bufferSize === void 0) { bufferSize = Number.POSITIVE_INFINITY; }\n if (windowTime === void 0) { windowTime = Number.POSITIVE_INFINITY; }\n var _this = _super.call(this) || this;\n _this.scheduler = scheduler;\n _this._events = [];\n _this._infiniteTimeWindow = false;\n _this._bufferSize = bufferSize < 1 ? 1 : bufferSize;\n _this._windowTime = windowTime < 1 ? 1 : windowTime;\n if (windowTime === Number.POSITIVE_INFINITY) {\n _this._infiniteTimeWindow = true;\n _this.next = _this.nextInfiniteTimeWindow;\n }\n else {\n _this.next = _this.nextTimeWindow;\n }\n return _this;\n }\n ReplaySubject.prototype.nextInfiniteTimeWindow = function (value) {\n if (!this.isStopped) {\n var _events = this._events;\n _events.push(value);\n if (_events.length > this._bufferSize) {\n _events.shift();\n }\n }\n _super.prototype.next.call(this, value);\n };\n ReplaySubject.prototype.nextTimeWindow = function (value) {\n if (!this.isStopped) {\n this._events.push(new ReplayEvent(this._getNow(), value));\n this._trimBufferThenGetEvents();\n }\n _super.prototype.next.call(this, value);\n };\n ReplaySubject.prototype._subscribe = function (subscriber) {\n var _infiniteTimeWindow = this._infiniteTimeWindow;\n var _events = _infiniteTimeWindow ? this._events : this._trimBufferThenGetEvents();\n var scheduler = this.scheduler;\n var len = _events.length;\n var subscription;\n if (this.closed) {\n throw new ObjectUnsubscribedError_1.ObjectUnsubscribedError();\n }\n else if (this.isStopped || this.hasError) {\n subscription = Subscription_1.Subscription.EMPTY;\n }\n else {\n this.observers.push(subscriber);\n subscription = new SubjectSubscription_1.SubjectSubscription(this, subscriber);\n }\n if (scheduler) {\n subscriber.add(subscriber = new observeOn_1.ObserveOnSubscriber(subscriber, scheduler));\n }\n if (_infiniteTimeWindow) {\n for (var i = 0; i < len && !subscriber.closed; i++) {\n subscriber.next(_events[i]);\n }\n }\n else {\n for (var i = 0; i < len && !subscriber.closed; i++) {\n subscriber.next(_events[i].value);\n }\n }\n if (this.hasError) {\n subscriber.error(this.thrownError);\n }\n else if (this.isStopped) {\n subscriber.complete();\n }\n return subscription;\n };\n ReplaySubject.prototype._getNow = function () {\n return (this.scheduler || queue_1.queue).now();\n };\n ReplaySubject.prototype._trimBufferThenGetEvents = function () {\n var now = this._getNow();\n var _bufferSize = this._bufferSize;\n var _windowTime = this._windowTime;\n var _events = this._events;\n var eventsCount = _events.length;\n var spliceCount = 0;\n while (spliceCount < eventsCount) {\n if ((now - _events[spliceCount].time) < _windowTime) {\n break;\n }\n spliceCount++;\n }\n if (eventsCount > _bufferSize) {\n spliceCount = Math.max(spliceCount, eventsCount - _bufferSize);\n }\n if (spliceCount > 0) {\n _events.splice(0, spliceCount);\n }\n return _events;\n };\n return ReplaySubject;\n}(Subject_1.Subject));\nexports.ReplaySubject = ReplaySubject;\nvar ReplayEvent = (function () {\n function ReplayEvent(time, value) {\n this.time = time;\n this.value = value;\n }\n return ReplayEvent;\n}());\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Scheduler = (function () {\n function Scheduler(SchedulerAction, now) {\n if (now === void 0) { now = Scheduler.now; }\n this.SchedulerAction = SchedulerAction;\n this.now = now;\n }\n Scheduler.prototype.schedule = function (work, delay, state) {\n if (delay === void 0) { delay = 0; }\n return new this.SchedulerAction(this, work).schedule(state, delay);\n };\n Scheduler.now = function () { return Date.now(); };\n return Scheduler;\n}());\nexports.Scheduler = Scheduler;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Observable_1 = require(\"./Observable\");\nvar Subscriber_1 = require(\"./Subscriber\");\nvar Subscription_1 = require(\"./Subscription\");\nvar ObjectUnsubscribedError_1 = require(\"./util/ObjectUnsubscribedError\");\nvar SubjectSubscription_1 = require(\"./SubjectSubscription\");\nvar rxSubscriber_1 = require(\"../internal/symbol/rxSubscriber\");\nvar SubjectSubscriber = (function (_super) {\n __extends(SubjectSubscriber, _super);\n function SubjectSubscriber(destination) {\n var _this = _super.call(this, destination) || this;\n _this.destination = destination;\n return _this;\n }\n return SubjectSubscriber;\n}(Subscriber_1.Subscriber));\nexports.SubjectSubscriber = SubjectSubscriber;\nvar Subject = (function (_super) {\n __extends(Subject, _super);\n function Subject() {\n var _this = _super.call(this) || this;\n _this.observers = [];\n _this.closed = false;\n _this.isStopped = false;\n _this.hasError = false;\n _this.thrownError = null;\n return _this;\n }\n Subject.prototype[rxSubscriber_1.rxSubscriber] = function () {\n return new SubjectSubscriber(this);\n };\n Subject.prototype.lift = function (operator) {\n var subject = new AnonymousSubject(this, this);\n subject.operator = operator;\n return subject;\n };\n Subject.prototype.next = function (value) {\n if (this.closed) {\n throw new ObjectUnsubscribedError_1.ObjectUnsubscribedError();\n }\n if (!this.isStopped) {\n var observers = this.observers;\n var len = observers.length;\n var copy = observers.slice();\n for (var i = 0; i < len; i++) {\n copy[i].next(value);\n }\n }\n };\n Subject.prototype.error = function (err) {\n if (this.closed) {\n throw new ObjectUnsubscribedError_1.ObjectUnsubscribedError();\n }\n this.hasError = true;\n this.thrownError = err;\n this.isStopped = true;\n var observers = this.observers;\n var len = observers.length;\n var copy = observers.slice();\n for (var i = 0; i < len; i++) {\n copy[i].error(err);\n }\n this.observers.length = 0;\n };\n Subject.prototype.complete = function () {\n if (this.closed) {\n throw new ObjectUnsubscribedError_1.ObjectUnsubscribedError();\n }\n this.isStopped = true;\n var observers = this.observers;\n var len = observers.length;\n var copy = observers.slice();\n for (var i = 0; i < len; i++) {\n copy[i].complete();\n }\n this.observers.length = 0;\n };\n Subject.prototype.unsubscribe = function () {\n this.isStopped = true;\n this.closed = true;\n this.observers = null;\n };\n Subject.prototype._trySubscribe = function (subscriber) {\n if (this.closed) {\n throw new ObjectUnsubscribedError_1.ObjectUnsubscribedError();\n }\n else {\n return _super.prototype._trySubscribe.call(this, subscriber);\n }\n };\n Subject.prototype._subscribe = function (subscriber) {\n if (this.closed) {\n throw new ObjectUnsubscribedError_1.ObjectUnsubscribedError();\n }\n else if (this.hasError) {\n subscriber.error(this.thrownError);\n return Subscription_1.Subscription.EMPTY;\n }\n else if (this.isStopped) {\n subscriber.complete();\n return Subscription_1.Subscription.EMPTY;\n }\n else {\n this.observers.push(subscriber);\n return new SubjectSubscription_1.SubjectSubscription(this, subscriber);\n }\n };\n Subject.prototype.asObservable = function () {\n var observable = new Observable_1.Observable();\n observable.source = this;\n return observable;\n };\n Subject.create = function (destination, source) {\n return new AnonymousSubject(destination, source);\n };\n return Subject;\n}(Observable_1.Observable));\nexports.Subject = Subject;\nvar AnonymousSubject = (function (_super) {\n __extends(AnonymousSubject, _super);\n function AnonymousSubject(destination, source) {\n var _this = _super.call(this) || this;\n _this.destination = destination;\n _this.source = source;\n return _this;\n }\n AnonymousSubject.prototype.next = function (value) {\n var destination = this.destination;\n if (destination && destination.next) {\n destination.next(value);\n }\n };\n AnonymousSubject.prototype.error = function (err) {\n var destination = this.destination;\n if (destination && destination.error) {\n this.destination.error(err);\n }\n };\n AnonymousSubject.prototype.complete = function () {\n var destination = this.destination;\n if (destination && destination.complete) {\n this.destination.complete();\n }\n };\n AnonymousSubject.prototype._subscribe = function (subscriber) {\n var source = this.source;\n if (source) {\n return this.source.subscribe(subscriber);\n }\n else {\n return Subscription_1.Subscription.EMPTY;\n }\n };\n return AnonymousSubject;\n}(Subject));\nexports.AnonymousSubject = AnonymousSubject;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscription_1 = require(\"./Subscription\");\nvar SubjectSubscription = (function (_super) {\n __extends(SubjectSubscription, _super);\n function SubjectSubscription(subject, subscriber) {\n var _this = _super.call(this) || this;\n _this.subject = subject;\n _this.subscriber = subscriber;\n _this.closed = false;\n return _this;\n }\n SubjectSubscription.prototype.unsubscribe = function () {\n if (this.closed) {\n return;\n }\n this.closed = true;\n var subject = this.subject;\n var observers = subject.observers;\n this.subject = null;\n if (!observers || observers.length === 0 || subject.isStopped || subject.closed) {\n return;\n }\n var subscriberIndex = observers.indexOf(this.subscriber);\n if (subscriberIndex !== -1) {\n observers.splice(subscriberIndex, 1);\n }\n };\n return SubjectSubscription;\n}(Subscription_1.Subscription));\nexports.SubjectSubscription = SubjectSubscription;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar isFunction_1 = require(\"./util/isFunction\");\nvar Observer_1 = require(\"./Observer\");\nvar Subscription_1 = require(\"./Subscription\");\nvar rxSubscriber_1 = require(\"../internal/symbol/rxSubscriber\");\nvar config_1 = require(\"./config\");\nvar hostReportError_1 = require(\"./util/hostReportError\");\nvar Subscriber = (function (_super) {\n __extends(Subscriber, _super);\n function Subscriber(destinationOrNext, error, complete) {\n var _this = _super.call(this) || this;\n _this.syncErrorValue = null;\n _this.syncErrorThrown = false;\n _this.syncErrorThrowable = false;\n _this.isStopped = false;\n switch (arguments.length) {\n case 0:\n _this.destination = Observer_1.empty;\n break;\n case 1:\n if (!destinationOrNext) {\n _this.destination = Observer_1.empty;\n break;\n }\n if (typeof destinationOrNext === 'object') {\n if (destinationOrNext instanceof Subscriber) {\n _this.syncErrorThrowable = destinationOrNext.syncErrorThrowable;\n _this.destination = destinationOrNext;\n destinationOrNext.add(_this);\n }\n else {\n _this.syncErrorThrowable = true;\n _this.destination = new SafeSubscriber(_this, destinationOrNext);\n }\n break;\n }\n default:\n _this.syncErrorThrowable = true;\n _this.destination = new SafeSubscriber(_this, destinationOrNext, error, complete);\n break;\n }\n return _this;\n }\n Subscriber.prototype[rxSubscriber_1.rxSubscriber] = function () { return this; };\n Subscriber.create = function (next, error, complete) {\n var subscriber = new Subscriber(next, error, complete);\n subscriber.syncErrorThrowable = false;\n return subscriber;\n };\n Subscriber.prototype.next = function (value) {\n if (!this.isStopped) {\n this._next(value);\n }\n };\n Subscriber.prototype.error = function (err) {\n if (!this.isStopped) {\n this.isStopped = true;\n this._error(err);\n }\n };\n Subscriber.prototype.complete = function () {\n if (!this.isStopped) {\n this.isStopped = true;\n this._complete();\n }\n };\n Subscriber.prototype.unsubscribe = function () {\n if (this.closed) {\n return;\n }\n this.isStopped = true;\n _super.prototype.unsubscribe.call(this);\n };\n Subscriber.prototype._next = function (value) {\n this.destination.next(value);\n };\n Subscriber.prototype._error = function (err) {\n this.destination.error(err);\n this.unsubscribe();\n };\n Subscriber.prototype._complete = function () {\n this.destination.complete();\n this.unsubscribe();\n };\n Subscriber.prototype._unsubscribeAndRecycle = function () {\n var _parentOrParents = this._parentOrParents;\n this._parentOrParents = null;\n this.unsubscribe();\n this.closed = false;\n this.isStopped = false;\n this._parentOrParents = _parentOrParents;\n return this;\n };\n return Subscriber;\n}(Subscription_1.Subscription));\nexports.Subscriber = Subscriber;\nvar SafeSubscriber = (function (_super) {\n __extends(SafeSubscriber, _super);\n function SafeSubscriber(_parentSubscriber, observerOrNext, error, complete) {\n var _this = _super.call(this) || this;\n _this._parentSubscriber = _parentSubscriber;\n var next;\n var context = _this;\n if (isFunction_1.isFunction(observerOrNext)) {\n next = observerOrNext;\n }\n else if (observerOrNext) {\n next = observerOrNext.next;\n error = observerOrNext.error;\n complete = observerOrNext.complete;\n if (observerOrNext !== Observer_1.empty) {\n context = Object.create(observerOrNext);\n if (isFunction_1.isFunction(context.unsubscribe)) {\n _this.add(context.unsubscribe.bind(context));\n }\n context.unsubscribe = _this.unsubscribe.bind(_this);\n }\n }\n _this._context = context;\n _this._next = next;\n _this._error = error;\n _this._complete = complete;\n return _this;\n }\n SafeSubscriber.prototype.next = function (value) {\n if (!this.isStopped && this._next) {\n var _parentSubscriber = this._parentSubscriber;\n if (!config_1.config.useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) {\n this.__tryOrUnsub(this._next, value);\n }\n else if (this.__tryOrSetError(_parentSubscriber, this._next, value)) {\n this.unsubscribe();\n }\n }\n };\n SafeSubscriber.prototype.error = function (err) {\n if (!this.isStopped) {\n var _parentSubscriber = this._parentSubscriber;\n var useDeprecatedSynchronousErrorHandling = config_1.config.useDeprecatedSynchronousErrorHandling;\n if (this._error) {\n if (!useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) {\n this.__tryOrUnsub(this._error, err);\n this.unsubscribe();\n }\n else {\n this.__tryOrSetError(_parentSubscriber, this._error, err);\n this.unsubscribe();\n }\n }\n else if (!_parentSubscriber.syncErrorThrowable) {\n this.unsubscribe();\n if (useDeprecatedSynchronousErrorHandling) {\n throw err;\n }\n hostReportError_1.hostReportError(err);\n }\n else {\n if (useDeprecatedSynchronousErrorHandling) {\n _parentSubscriber.syncErrorValue = err;\n _parentSubscriber.syncErrorThrown = true;\n }\n else {\n hostReportError_1.hostReportError(err);\n }\n this.unsubscribe();\n }\n }\n };\n SafeSubscriber.prototype.complete = function () {\n var _this = this;\n if (!this.isStopped) {\n var _parentSubscriber = this._parentSubscriber;\n if (this._complete) {\n var wrappedComplete = function () { return _this._complete.call(_this._context); };\n if (!config_1.config.useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) {\n this.__tryOrUnsub(wrappedComplete);\n this.unsubscribe();\n }\n else {\n this.__tryOrSetError(_parentSubscriber, wrappedComplete);\n this.unsubscribe();\n }\n }\n else {\n this.unsubscribe();\n }\n }\n };\n SafeSubscriber.prototype.__tryOrUnsub = function (fn, value) {\n try {\n fn.call(this._context, value);\n }\n catch (err) {\n this.unsubscribe();\n if (config_1.config.useDeprecatedSynchronousErrorHandling) {\n throw err;\n }\n else {\n hostReportError_1.hostReportError(err);\n }\n }\n };\n SafeSubscriber.prototype.__tryOrSetError = function (parent, fn, value) {\n if (!config_1.config.useDeprecatedSynchronousErrorHandling) {\n throw new Error('bad call');\n }\n try {\n fn.call(this._context, value);\n }\n catch (err) {\n if (config_1.config.useDeprecatedSynchronousErrorHandling) {\n parent.syncErrorValue = err;\n parent.syncErrorThrown = true;\n return true;\n }\n else {\n hostReportError_1.hostReportError(err);\n return true;\n }\n }\n return false;\n };\n SafeSubscriber.prototype._unsubscribe = function () {\n var _parentSubscriber = this._parentSubscriber;\n this._context = null;\n this._parentSubscriber = null;\n _parentSubscriber.unsubscribe();\n };\n return SafeSubscriber;\n}(Subscriber));\nexports.SafeSubscriber = SafeSubscriber;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar isArray_1 = require(\"./util/isArray\");\nvar isObject_1 = require(\"./util/isObject\");\nvar isFunction_1 = require(\"./util/isFunction\");\nvar UnsubscriptionError_1 = require(\"./util/UnsubscriptionError\");\nvar Subscription = (function () {\n function Subscription(unsubscribe) {\n this.closed = false;\n this._parentOrParents = null;\n this._subscriptions = null;\n if (unsubscribe) {\n this._ctorUnsubscribe = true;\n this._unsubscribe = unsubscribe;\n }\n }\n Subscription.prototype.unsubscribe = function () {\n var errors;\n if (this.closed) {\n return;\n }\n var _a = this, _parentOrParents = _a._parentOrParents, _ctorUnsubscribe = _a._ctorUnsubscribe, _unsubscribe = _a._unsubscribe, _subscriptions = _a._subscriptions;\n this.closed = true;\n this._parentOrParents = null;\n this._subscriptions = null;\n if (_parentOrParents instanceof Subscription) {\n _parentOrParents.remove(this);\n }\n else if (_parentOrParents !== null) {\n for (var index = 0; index < _parentOrParents.length; ++index) {\n var parent_1 = _parentOrParents[index];\n parent_1.remove(this);\n }\n }\n if (isFunction_1.isFunction(_unsubscribe)) {\n if (_ctorUnsubscribe) {\n this._unsubscribe = undefined;\n }\n try {\n _unsubscribe.call(this);\n }\n catch (e) {\n errors = e instanceof UnsubscriptionError_1.UnsubscriptionError ? flattenUnsubscriptionErrors(e.errors) : [e];\n }\n }\n if (isArray_1.isArray(_subscriptions)) {\n var index = -1;\n var len = _subscriptions.length;\n while (++index < len) {\n var sub = _subscriptions[index];\n if (isObject_1.isObject(sub)) {\n try {\n sub.unsubscribe();\n }\n catch (e) {\n errors = errors || [];\n if (e instanceof UnsubscriptionError_1.UnsubscriptionError) {\n errors = errors.concat(flattenUnsubscriptionErrors(e.errors));\n }\n else {\n errors.push(e);\n }\n }\n }\n }\n }\n if (errors) {\n throw new UnsubscriptionError_1.UnsubscriptionError(errors);\n }\n };\n Subscription.prototype.add = function (teardown) {\n var subscription = teardown;\n if (!teardown) {\n return Subscription.EMPTY;\n }\n switch (typeof teardown) {\n case 'function':\n subscription = new Subscription(teardown);\n case 'object':\n if (subscription === this || subscription.closed || typeof subscription.unsubscribe !== 'function') {\n return subscription;\n }\n else if (this.closed) {\n subscription.unsubscribe();\n return subscription;\n }\n else if (!(subscription instanceof Subscription)) {\n var tmp = subscription;\n subscription = new Subscription();\n subscription._subscriptions = [tmp];\n }\n break;\n default: {\n throw new Error('unrecognized teardown ' + teardown + ' added to Subscription.');\n }\n }\n var _parentOrParents = subscription._parentOrParents;\n if (_parentOrParents === null) {\n subscription._parentOrParents = this;\n }\n else if (_parentOrParents instanceof Subscription) {\n if (_parentOrParents === this) {\n return subscription;\n }\n subscription._parentOrParents = [_parentOrParents, this];\n }\n else if (_parentOrParents.indexOf(this) === -1) {\n _parentOrParents.push(this);\n }\n else {\n return subscription;\n }\n var subscriptions = this._subscriptions;\n if (subscriptions === null) {\n this._subscriptions = [subscription];\n }\n else {\n subscriptions.push(subscription);\n }\n return subscription;\n };\n Subscription.prototype.remove = function (subscription) {\n var subscriptions = this._subscriptions;\n if (subscriptions) {\n var subscriptionIndex = subscriptions.indexOf(subscription);\n if (subscriptionIndex !== -1) {\n subscriptions.splice(subscriptionIndex, 1);\n }\n }\n };\n Subscription.EMPTY = (function (empty) {\n empty.closed = true;\n return empty;\n }(new Subscription()));\n return Subscription;\n}());\nexports.Subscription = Subscription;\nfunction flattenUnsubscriptionErrors(errors) {\n return errors.reduce(function (errs, err) { return errs.concat((err instanceof UnsubscriptionError_1.UnsubscriptionError) ? err.errors : err); }, []);\n}\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar _enable_super_gross_mode_that_will_cause_bad_things = false;\nexports.config = {\n Promise: undefined,\n set useDeprecatedSynchronousErrorHandling(value) {\n if (value) {\n var error = new Error();\n console.warn('DEPRECATED! RxJS was set to use deprecated synchronous error handling behavior by code at: \\n' + error.stack);\n }\n else if (_enable_super_gross_mode_that_will_cause_bad_things) {\n console.log('RxJS: Back to a better error behavior. Thank you. <3');\n }\n _enable_super_gross_mode_that_will_cause_bad_things = value;\n },\n get useDeprecatedSynchronousErrorHandling() {\n return _enable_super_gross_mode_that_will_cause_bad_things;\n },\n};\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"./Subscriber\");\nvar Observable_1 = require(\"./Observable\");\nvar subscribeTo_1 = require(\"./util/subscribeTo\");\nvar SimpleInnerSubscriber = (function (_super) {\n __extends(SimpleInnerSubscriber, _super);\n function SimpleInnerSubscriber(parent) {\n var _this = _super.call(this) || this;\n _this.parent = parent;\n return _this;\n }\n SimpleInnerSubscriber.prototype._next = function (value) {\n this.parent.notifyNext(value);\n };\n SimpleInnerSubscriber.prototype._error = function (error) {\n this.parent.notifyError(error);\n this.unsubscribe();\n };\n SimpleInnerSubscriber.prototype._complete = function () {\n this.parent.notifyComplete();\n this.unsubscribe();\n };\n return SimpleInnerSubscriber;\n}(Subscriber_1.Subscriber));\nexports.SimpleInnerSubscriber = SimpleInnerSubscriber;\nvar ComplexInnerSubscriber = (function (_super) {\n __extends(ComplexInnerSubscriber, _super);\n function ComplexInnerSubscriber(parent, outerValue, outerIndex) {\n var _this = _super.call(this) || this;\n _this.parent = parent;\n _this.outerValue = outerValue;\n _this.outerIndex = outerIndex;\n return _this;\n }\n ComplexInnerSubscriber.prototype._next = function (value) {\n this.parent.notifyNext(this.outerValue, value, this.outerIndex, this);\n };\n ComplexInnerSubscriber.prototype._error = function (error) {\n this.parent.notifyError(error);\n this.unsubscribe();\n };\n ComplexInnerSubscriber.prototype._complete = function () {\n this.parent.notifyComplete(this);\n this.unsubscribe();\n };\n return ComplexInnerSubscriber;\n}(Subscriber_1.Subscriber));\nexports.ComplexInnerSubscriber = ComplexInnerSubscriber;\nvar SimpleOuterSubscriber = (function (_super) {\n __extends(SimpleOuterSubscriber, _super);\n function SimpleOuterSubscriber() {\n return _super !== null && _super.apply(this, arguments) || this;\n }\n SimpleOuterSubscriber.prototype.notifyNext = function (innerValue) {\n this.destination.next(innerValue);\n };\n SimpleOuterSubscriber.prototype.notifyError = function (err) {\n this.destination.error(err);\n };\n SimpleOuterSubscriber.prototype.notifyComplete = function () {\n this.destination.complete();\n };\n return SimpleOuterSubscriber;\n}(Subscriber_1.Subscriber));\nexports.SimpleOuterSubscriber = SimpleOuterSubscriber;\nvar ComplexOuterSubscriber = (function (_super) {\n __extends(ComplexOuterSubscriber, _super);\n function ComplexOuterSubscriber() {\n return _super !== null && _super.apply(this, arguments) || this;\n }\n ComplexOuterSubscriber.prototype.notifyNext = function (_outerValue, innerValue, _outerIndex, _innerSub) {\n this.destination.next(innerValue);\n };\n ComplexOuterSubscriber.prototype.notifyError = function (error) {\n this.destination.error(error);\n };\n ComplexOuterSubscriber.prototype.notifyComplete = function (_innerSub) {\n this.destination.complete();\n };\n return ComplexOuterSubscriber;\n}(Subscriber_1.Subscriber));\nexports.ComplexOuterSubscriber = ComplexOuterSubscriber;\nfunction innerSubscribe(result, innerSubscriber) {\n if (innerSubscriber.closed) {\n return undefined;\n }\n if (result instanceof Observable_1.Observable) {\n return result.subscribe(innerSubscriber);\n }\n var subscription;\n try {\n subscription = subscribeTo_1.subscribeTo(result)(innerSubscriber);\n }\n catch (error) {\n innerSubscriber.error(error);\n }\n return subscription;\n}\nexports.innerSubscribe = innerSubscribe;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subject_1 = require(\"../Subject\");\nvar Observable_1 = require(\"../Observable\");\nvar Subscriber_1 = require(\"../Subscriber\");\nvar Subscription_1 = require(\"../Subscription\");\nvar refCount_1 = require(\"../operators/refCount\");\nvar ConnectableObservable = (function (_super) {\n __extends(ConnectableObservable, _super);\n function ConnectableObservable(source, subjectFactory) {\n var _this = _super.call(this) || this;\n _this.source = source;\n _this.subjectFactory = subjectFactory;\n _this._refCount = 0;\n _this._isComplete = false;\n return _this;\n }\n ConnectableObservable.prototype._subscribe = function (subscriber) {\n return this.getSubject().subscribe(subscriber);\n };\n ConnectableObservable.prototype.getSubject = function () {\n var subject = this._subject;\n if (!subject || subject.isStopped) {\n this._subject = this.subjectFactory();\n }\n return this._subject;\n };\n ConnectableObservable.prototype.connect = function () {\n var connection = this._connection;\n if (!connection) {\n this._isComplete = false;\n connection = this._connection = new Subscription_1.Subscription();\n connection.add(this.source\n .subscribe(new ConnectableSubscriber(this.getSubject(), this)));\n if (connection.closed) {\n this._connection = null;\n connection = Subscription_1.Subscription.EMPTY;\n }\n }\n return connection;\n };\n ConnectableObservable.prototype.refCount = function () {\n return refCount_1.refCount()(this);\n };\n return ConnectableObservable;\n}(Observable_1.Observable));\nexports.ConnectableObservable = ConnectableObservable;\nexports.connectableObservableDescriptor = (function () {\n var connectableProto = ConnectableObservable.prototype;\n return {\n operator: { value: null },\n _refCount: { value: 0, writable: true },\n _subject: { value: null, writable: true },\n _connection: { value: null, writable: true },\n _subscribe: { value: connectableProto._subscribe },\n _isComplete: { value: connectableProto._isComplete, writable: true },\n getSubject: { value: connectableProto.getSubject },\n connect: { value: connectableProto.connect },\n refCount: { value: connectableProto.refCount }\n };\n})();\nvar ConnectableSubscriber = (function (_super) {\n __extends(ConnectableSubscriber, _super);\n function ConnectableSubscriber(destination, connectable) {\n var _this = _super.call(this, destination) || this;\n _this.connectable = connectable;\n return _this;\n }\n ConnectableSubscriber.prototype._error = function (err) {\n this._unsubscribe();\n _super.prototype._error.call(this, err);\n };\n ConnectableSubscriber.prototype._complete = function () {\n this.connectable._isComplete = true;\n this._unsubscribe();\n _super.prototype._complete.call(this);\n };\n ConnectableSubscriber.prototype._unsubscribe = function () {\n var connectable = this.connectable;\n if (connectable) {\n this.connectable = null;\n var connection = connectable._connection;\n connectable._refCount = 0;\n connectable._subject = null;\n connectable._connection = null;\n if (connection) {\n connection.unsubscribe();\n }\n }\n };\n return ConnectableSubscriber;\n}(Subject_1.SubjectSubscriber));\nvar RefCountOperator = (function () {\n function RefCountOperator(connectable) {\n this.connectable = connectable;\n }\n RefCountOperator.prototype.call = function (subscriber, source) {\n var connectable = this.connectable;\n connectable._refCount++;\n var refCounter = new RefCountSubscriber(subscriber, connectable);\n var subscription = source.subscribe(refCounter);\n if (!refCounter.closed) {\n refCounter.connection = connectable.connect();\n }\n return subscription;\n };\n return RefCountOperator;\n}());\nvar RefCountSubscriber = (function (_super) {\n __extends(RefCountSubscriber, _super);\n function RefCountSubscriber(destination, connectable) {\n var _this = _super.call(this, destination) || this;\n _this.connectable = connectable;\n return _this;\n }\n RefCountSubscriber.prototype._unsubscribe = function () {\n var connectable = this.connectable;\n if (!connectable) {\n this.connection = null;\n return;\n }\n this.connectable = null;\n var refCount = connectable._refCount;\n if (refCount <= 0) {\n this.connection = null;\n return;\n }\n connectable._refCount = refCount - 1;\n if (refCount > 1) {\n this.connection = null;\n return;\n }\n var connection = this.connection;\n var sharedConnection = connectable._connection;\n this.connection = null;\n if (sharedConnection && (!connection || sharedConnection === connection)) {\n sharedConnection.unsubscribe();\n }\n };\n return RefCountSubscriber;\n}(Subscriber_1.Subscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Observable_1 = require(\"../Observable\");\nvar asap_1 = require(\"../scheduler/asap\");\nvar isNumeric_1 = require(\"../util/isNumeric\");\nvar SubscribeOnObservable = (function (_super) {\n __extends(SubscribeOnObservable, _super);\n function SubscribeOnObservable(source, delayTime, scheduler) {\n if (delayTime === void 0) { delayTime = 0; }\n if (scheduler === void 0) { scheduler = asap_1.asap; }\n var _this = _super.call(this) || this;\n _this.source = source;\n _this.delayTime = delayTime;\n _this.scheduler = scheduler;\n if (!isNumeric_1.isNumeric(delayTime) || delayTime < 0) {\n _this.delayTime = 0;\n }\n if (!scheduler || typeof scheduler.schedule !== 'function') {\n _this.scheduler = asap_1.asap;\n }\n return _this;\n }\n SubscribeOnObservable.create = function (source, delay, scheduler) {\n if (delay === void 0) { delay = 0; }\n if (scheduler === void 0) { scheduler = asap_1.asap; }\n return new SubscribeOnObservable(source, delay, scheduler);\n };\n SubscribeOnObservable.dispatch = function (arg) {\n var source = arg.source, subscriber = arg.subscriber;\n return this.add(source.subscribe(subscriber));\n };\n SubscribeOnObservable.prototype._subscribe = function (subscriber) {\n var delay = this.delayTime;\n var source = this.source;\n var scheduler = this.scheduler;\n return scheduler.schedule(SubscribeOnObservable.dispatch, delay, {\n source: source, subscriber: subscriber\n });\n };\n return SubscribeOnObservable;\n}(Observable_1.Observable));\nexports.SubscribeOnObservable = SubscribeOnObservable;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar isScheduler_1 = require(\"../util/isScheduler\");\nvar isArray_1 = require(\"../util/isArray\");\nvar OuterSubscriber_1 = require(\"../OuterSubscriber\");\nvar subscribeToResult_1 = require(\"../util/subscribeToResult\");\nvar fromArray_1 = require(\"./fromArray\");\nvar NONE = {};\nfunction combineLatest() {\n var observables = [];\n for (var _i = 0; _i < arguments.length; _i++) {\n observables[_i] = arguments[_i];\n }\n var resultSelector = undefined;\n var scheduler = undefined;\n if (isScheduler_1.isScheduler(observables[observables.length - 1])) {\n scheduler = observables.pop();\n }\n if (typeof observables[observables.length - 1] === 'function') {\n resultSelector = observables.pop();\n }\n if (observables.length === 1 && isArray_1.isArray(observables[0])) {\n observables = observables[0];\n }\n return fromArray_1.fromArray(observables, scheduler).lift(new CombineLatestOperator(resultSelector));\n}\nexports.combineLatest = combineLatest;\nvar CombineLatestOperator = (function () {\n function CombineLatestOperator(resultSelector) {\n this.resultSelector = resultSelector;\n }\n CombineLatestOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new CombineLatestSubscriber(subscriber, this.resultSelector));\n };\n return CombineLatestOperator;\n}());\nexports.CombineLatestOperator = CombineLatestOperator;\nvar CombineLatestSubscriber = (function (_super) {\n __extends(CombineLatestSubscriber, _super);\n function CombineLatestSubscriber(destination, resultSelector) {\n var _this = _super.call(this, destination) || this;\n _this.resultSelector = resultSelector;\n _this.active = 0;\n _this.values = [];\n _this.observables = [];\n return _this;\n }\n CombineLatestSubscriber.prototype._next = function (observable) {\n this.values.push(NONE);\n this.observables.push(observable);\n };\n CombineLatestSubscriber.prototype._complete = function () {\n var observables = this.observables;\n var len = observables.length;\n if (len === 0) {\n this.destination.complete();\n }\n else {\n this.active = len;\n this.toRespond = len;\n for (var i = 0; i < len; i++) {\n var observable = observables[i];\n this.add(subscribeToResult_1.subscribeToResult(this, observable, undefined, i));\n }\n }\n };\n CombineLatestSubscriber.prototype.notifyComplete = function (unused) {\n if ((this.active -= 1) === 0) {\n this.destination.complete();\n }\n };\n CombineLatestSubscriber.prototype.notifyNext = function (_outerValue, innerValue, outerIndex) {\n var values = this.values;\n var oldVal = values[outerIndex];\n var toRespond = !this.toRespond\n ? 0\n : oldVal === NONE ? --this.toRespond : this.toRespond;\n values[outerIndex] = innerValue;\n if (toRespond === 0) {\n if (this.resultSelector) {\n this._tryResultSelector(values);\n }\n else {\n this.destination.next(values.slice());\n }\n }\n };\n CombineLatestSubscriber.prototype._tryResultSelector = function (values) {\n var result;\n try {\n result = this.resultSelector.apply(this, values);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.next(result);\n };\n return CombineLatestSubscriber;\n}(OuterSubscriber_1.OuterSubscriber));\nexports.CombineLatestSubscriber = CombineLatestSubscriber;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar of_1 = require(\"./of\");\nvar concatAll_1 = require(\"../operators/concatAll\");\nfunction concat() {\n var observables = [];\n for (var _i = 0; _i < arguments.length; _i++) {\n observables[_i] = arguments[_i];\n }\n return concatAll_1.concatAll()(of_1.of.apply(void 0, observables));\n}\nexports.concat = concat;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Observable_1 = require(\"../Observable\");\nvar from_1 = require(\"./from\");\nvar empty_1 = require(\"./empty\");\nfunction defer(observableFactory) {\n return new Observable_1.Observable(function (subscriber) {\n var input;\n try {\n input = observableFactory();\n }\n catch (err) {\n subscriber.error(err);\n return undefined;\n }\n var source = input ? from_1.from(input) : empty_1.empty();\n return source.subscribe(subscriber);\n });\n}\nexports.defer = defer;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Observable_1 = require(\"../Observable\");\nexports.EMPTY = new Observable_1.Observable(function (subscriber) { return subscriber.complete(); });\nfunction empty(scheduler) {\n return scheduler ? emptyScheduled(scheduler) : exports.EMPTY;\n}\nexports.empty = empty;\nfunction emptyScheduled(scheduler) {\n return new Observable_1.Observable(function (subscriber) { return scheduler.schedule(function () { return subscriber.complete(); }); });\n}\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Observable_1 = require(\"../Observable\");\nvar subscribeTo_1 = require(\"../util/subscribeTo\");\nvar scheduled_1 = require(\"../scheduled/scheduled\");\nfunction from(input, scheduler) {\n if (!scheduler) {\n if (input instanceof Observable_1.Observable) {\n return input;\n }\n return new Observable_1.Observable(subscribeTo_1.subscribeTo(input));\n }\n else {\n return scheduled_1.scheduled(input, scheduler);\n }\n}\nexports.from = from;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Observable_1 = require(\"../Observable\");\nvar subscribeToArray_1 = require(\"../util/subscribeToArray\");\nvar scheduleArray_1 = require(\"../scheduled/scheduleArray\");\nfunction fromArray(input, scheduler) {\n if (!scheduler) {\n return new Observable_1.Observable(subscribeToArray_1.subscribeToArray(input));\n }\n else {\n return scheduleArray_1.scheduleArray(input, scheduler);\n }\n}\nexports.fromArray = fromArray;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Observable_1 = require(\"../Observable\");\nvar isScheduler_1 = require(\"../util/isScheduler\");\nvar mergeAll_1 = require(\"../operators/mergeAll\");\nvar fromArray_1 = require(\"./fromArray\");\nfunction merge() {\n var observables = [];\n for (var _i = 0; _i < arguments.length; _i++) {\n observables[_i] = arguments[_i];\n }\n var concurrent = Number.POSITIVE_INFINITY;\n var scheduler = null;\n var last = observables[observables.length - 1];\n if (isScheduler_1.isScheduler(last)) {\n scheduler = observables.pop();\n if (observables.length > 1 && typeof observables[observables.length - 1] === 'number') {\n concurrent = observables.pop();\n }\n }\n else if (typeof last === 'number') {\n concurrent = observables.pop();\n }\n if (scheduler === null && observables.length === 1 && observables[0] instanceof Observable_1.Observable) {\n return observables[0];\n }\n return mergeAll_1.mergeAll(concurrent)(fromArray_1.fromArray(observables, scheduler));\n}\nexports.merge = merge;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar isScheduler_1 = require(\"../util/isScheduler\");\nvar fromArray_1 = require(\"./fromArray\");\nvar scheduleArray_1 = require(\"../scheduled/scheduleArray\");\nfunction of() {\n var args = [];\n for (var _i = 0; _i < arguments.length; _i++) {\n args[_i] = arguments[_i];\n }\n var scheduler = args[args.length - 1];\n if (isScheduler_1.isScheduler(scheduler)) {\n args.pop();\n return scheduleArray_1.scheduleArray(args, scheduler);\n }\n else {\n return fromArray_1.fromArray(args);\n }\n}\nexports.of = of;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar isArray_1 = require(\"../util/isArray\");\nvar fromArray_1 = require(\"./fromArray\");\nvar OuterSubscriber_1 = require(\"../OuterSubscriber\");\nvar subscribeToResult_1 = require(\"../util/subscribeToResult\");\nfunction race() {\n var observables = [];\n for (var _i = 0; _i < arguments.length; _i++) {\n observables[_i] = arguments[_i];\n }\n if (observables.length === 1) {\n if (isArray_1.isArray(observables[0])) {\n observables = observables[0];\n }\n else {\n return observables[0];\n }\n }\n return fromArray_1.fromArray(observables, undefined).lift(new RaceOperator());\n}\nexports.race = race;\nvar RaceOperator = (function () {\n function RaceOperator() {\n }\n RaceOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new RaceSubscriber(subscriber));\n };\n return RaceOperator;\n}());\nexports.RaceOperator = RaceOperator;\nvar RaceSubscriber = (function (_super) {\n __extends(RaceSubscriber, _super);\n function RaceSubscriber(destination) {\n var _this = _super.call(this, destination) || this;\n _this.hasFirst = false;\n _this.observables = [];\n _this.subscriptions = [];\n return _this;\n }\n RaceSubscriber.prototype._next = function (observable) {\n this.observables.push(observable);\n };\n RaceSubscriber.prototype._complete = function () {\n var observables = this.observables;\n var len = observables.length;\n if (len === 0) {\n this.destination.complete();\n }\n else {\n for (var i = 0; i < len && !this.hasFirst; i++) {\n var observable = observables[i];\n var subscription = subscribeToResult_1.subscribeToResult(this, observable, undefined, i);\n if (this.subscriptions) {\n this.subscriptions.push(subscription);\n }\n this.add(subscription);\n }\n this.observables = null;\n }\n };\n RaceSubscriber.prototype.notifyNext = function (_outerValue, innerValue, outerIndex) {\n if (!this.hasFirst) {\n this.hasFirst = true;\n for (var i = 0; i < this.subscriptions.length; i++) {\n if (i !== outerIndex) {\n var subscription = this.subscriptions[i];\n subscription.unsubscribe();\n this.remove(subscription);\n }\n }\n this.subscriptions = null;\n }\n this.destination.next(innerValue);\n };\n return RaceSubscriber;\n}(OuterSubscriber_1.OuterSubscriber));\nexports.RaceSubscriber = RaceSubscriber;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Observable_1 = require(\"../Observable\");\nfunction throwError(error, scheduler) {\n if (!scheduler) {\n return new Observable_1.Observable(function (subscriber) { return subscriber.error(error); });\n }\n else {\n return new Observable_1.Observable(function (subscriber) { return scheduler.schedule(dispatch, 0, { error: error, subscriber: subscriber }); });\n }\n}\nexports.throwError = throwError;\nfunction dispatch(_a) {\n var error = _a.error, subscriber = _a.subscriber;\n subscriber.error(error);\n}\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Observable_1 = require(\"../Observable\");\nvar async_1 = require(\"../scheduler/async\");\nvar isNumeric_1 = require(\"../util/isNumeric\");\nvar isScheduler_1 = require(\"../util/isScheduler\");\nfunction timer(dueTime, periodOrScheduler, scheduler) {\n if (dueTime === void 0) { dueTime = 0; }\n var period = -1;\n if (isNumeric_1.isNumeric(periodOrScheduler)) {\n period = Number(periodOrScheduler) < 1 && 1 || Number(periodOrScheduler);\n }\n else if (isScheduler_1.isScheduler(periodOrScheduler)) {\n scheduler = periodOrScheduler;\n }\n if (!isScheduler_1.isScheduler(scheduler)) {\n scheduler = async_1.async;\n }\n return new Observable_1.Observable(function (subscriber) {\n var due = isNumeric_1.isNumeric(dueTime)\n ? dueTime\n : (+dueTime - scheduler.now());\n return scheduler.schedule(dispatch, due, {\n index: 0, period: period, subscriber: subscriber\n });\n });\n}\nexports.timer = timer;\nfunction dispatch(state) {\n var index = state.index, period = state.period, subscriber = state.subscriber;\n subscriber.next(index);\n if (subscriber.closed) {\n return;\n }\n else if (period === -1) {\n return subscriber.complete();\n }\n state.index = index + 1;\n this.schedule(state, period);\n}\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar fromArray_1 = require(\"./fromArray\");\nvar isArray_1 = require(\"../util/isArray\");\nvar Subscriber_1 = require(\"../Subscriber\");\nvar iterator_1 = require(\"../../internal/symbol/iterator\");\nvar innerSubscribe_1 = require(\"../innerSubscribe\");\nfunction zip() {\n var observables = [];\n for (var _i = 0; _i < arguments.length; _i++) {\n observables[_i] = arguments[_i];\n }\n var resultSelector = observables[observables.length - 1];\n if (typeof resultSelector === 'function') {\n observables.pop();\n }\n return fromArray_1.fromArray(observables, undefined).lift(new ZipOperator(resultSelector));\n}\nexports.zip = zip;\nvar ZipOperator = (function () {\n function ZipOperator(resultSelector) {\n this.resultSelector = resultSelector;\n }\n ZipOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new ZipSubscriber(subscriber, this.resultSelector));\n };\n return ZipOperator;\n}());\nexports.ZipOperator = ZipOperator;\nvar ZipSubscriber = (function (_super) {\n __extends(ZipSubscriber, _super);\n function ZipSubscriber(destination, resultSelector, values) {\n if (values === void 0) { values = Object.create(null); }\n var _this = _super.call(this, destination) || this;\n _this.resultSelector = resultSelector;\n _this.iterators = [];\n _this.active = 0;\n _this.resultSelector = (typeof resultSelector === 'function') ? resultSelector : undefined;\n return _this;\n }\n ZipSubscriber.prototype._next = function (value) {\n var iterators = this.iterators;\n if (isArray_1.isArray(value)) {\n iterators.push(new StaticArrayIterator(value));\n }\n else if (typeof value[iterator_1.iterator] === 'function') {\n iterators.push(new StaticIterator(value[iterator_1.iterator]()));\n }\n else {\n iterators.push(new ZipBufferIterator(this.destination, this, value));\n }\n };\n ZipSubscriber.prototype._complete = function () {\n var iterators = this.iterators;\n var len = iterators.length;\n this.unsubscribe();\n if (len === 0) {\n this.destination.complete();\n return;\n }\n this.active = len;\n for (var i = 0; i < len; i++) {\n var iterator = iterators[i];\n if (iterator.stillUnsubscribed) {\n var destination = this.destination;\n destination.add(iterator.subscribe());\n }\n else {\n this.active--;\n }\n }\n };\n ZipSubscriber.prototype.notifyInactive = function () {\n this.active--;\n if (this.active === 0) {\n this.destination.complete();\n }\n };\n ZipSubscriber.prototype.checkIterators = function () {\n var iterators = this.iterators;\n var len = iterators.length;\n var destination = this.destination;\n for (var i = 0; i < len; i++) {\n var iterator = iterators[i];\n if (typeof iterator.hasValue === 'function' && !iterator.hasValue()) {\n return;\n }\n }\n var shouldComplete = false;\n var args = [];\n for (var i = 0; i < len; i++) {\n var iterator = iterators[i];\n var result = iterator.next();\n if (iterator.hasCompleted()) {\n shouldComplete = true;\n }\n if (result.done) {\n destination.complete();\n return;\n }\n args.push(result.value);\n }\n if (this.resultSelector) {\n this._tryresultSelector(args);\n }\n else {\n destination.next(args);\n }\n if (shouldComplete) {\n destination.complete();\n }\n };\n ZipSubscriber.prototype._tryresultSelector = function (args) {\n var result;\n try {\n result = this.resultSelector.apply(this, args);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.next(result);\n };\n return ZipSubscriber;\n}(Subscriber_1.Subscriber));\nexports.ZipSubscriber = ZipSubscriber;\nvar StaticIterator = (function () {\n function StaticIterator(iterator) {\n this.iterator = iterator;\n this.nextResult = iterator.next();\n }\n StaticIterator.prototype.hasValue = function () {\n return true;\n };\n StaticIterator.prototype.next = function () {\n var result = this.nextResult;\n this.nextResult = this.iterator.next();\n return result;\n };\n StaticIterator.prototype.hasCompleted = function () {\n var nextResult = this.nextResult;\n return Boolean(nextResult && nextResult.done);\n };\n return StaticIterator;\n}());\nvar StaticArrayIterator = (function () {\n function StaticArrayIterator(array) {\n this.array = array;\n this.index = 0;\n this.length = 0;\n this.length = array.length;\n }\n StaticArrayIterator.prototype[iterator_1.iterator] = function () {\n return this;\n };\n StaticArrayIterator.prototype.next = function (value) {\n var i = this.index++;\n var array = this.array;\n return i < this.length ? { value: array[i], done: false } : { value: null, done: true };\n };\n StaticArrayIterator.prototype.hasValue = function () {\n return this.array.length > this.index;\n };\n StaticArrayIterator.prototype.hasCompleted = function () {\n return this.array.length === this.index;\n };\n return StaticArrayIterator;\n}());\nvar ZipBufferIterator = (function (_super) {\n __extends(ZipBufferIterator, _super);\n function ZipBufferIterator(destination, parent, observable) {\n var _this = _super.call(this, destination) || this;\n _this.parent = parent;\n _this.observable = observable;\n _this.stillUnsubscribed = true;\n _this.buffer = [];\n _this.isComplete = false;\n return _this;\n }\n ZipBufferIterator.prototype[iterator_1.iterator] = function () {\n return this;\n };\n ZipBufferIterator.prototype.next = function () {\n var buffer = this.buffer;\n if (buffer.length === 0 && this.isComplete) {\n return { value: null, done: true };\n }\n else {\n return { value: buffer.shift(), done: false };\n }\n };\n ZipBufferIterator.prototype.hasValue = function () {\n return this.buffer.length > 0;\n };\n ZipBufferIterator.prototype.hasCompleted = function () {\n return this.buffer.length === 0 && this.isComplete;\n };\n ZipBufferIterator.prototype.notifyComplete = function () {\n if (this.buffer.length > 0) {\n this.isComplete = true;\n this.parent.notifyInactive();\n }\n else {\n this.destination.complete();\n }\n };\n ZipBufferIterator.prototype.notifyNext = function (innerValue) {\n this.buffer.push(innerValue);\n this.parent.checkIterators();\n };\n ZipBufferIterator.prototype.subscribe = function () {\n return innerSubscribe_1.innerSubscribe(this.observable, new innerSubscribe_1.SimpleInnerSubscriber(this));\n };\n return ZipBufferIterator;\n}(innerSubscribe_1.SimpleOuterSubscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar innerSubscribe_1 = require(\"../innerSubscribe\");\nfunction audit(durationSelector) {\n return function auditOperatorFunction(source) {\n return source.lift(new AuditOperator(durationSelector));\n };\n}\nexports.audit = audit;\nvar AuditOperator = (function () {\n function AuditOperator(durationSelector) {\n this.durationSelector = durationSelector;\n }\n AuditOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new AuditSubscriber(subscriber, this.durationSelector));\n };\n return AuditOperator;\n}());\nvar AuditSubscriber = (function (_super) {\n __extends(AuditSubscriber, _super);\n function AuditSubscriber(destination, durationSelector) {\n var _this = _super.call(this, destination) || this;\n _this.durationSelector = durationSelector;\n _this.hasValue = false;\n return _this;\n }\n AuditSubscriber.prototype._next = function (value) {\n this.value = value;\n this.hasValue = true;\n if (!this.throttled) {\n var duration = void 0;\n try {\n var durationSelector = this.durationSelector;\n duration = durationSelector(value);\n }\n catch (err) {\n return this.destination.error(err);\n }\n var innerSubscription = innerSubscribe_1.innerSubscribe(duration, new innerSubscribe_1.SimpleInnerSubscriber(this));\n if (!innerSubscription || innerSubscription.closed) {\n this.clearThrottle();\n }\n else {\n this.add(this.throttled = innerSubscription);\n }\n }\n };\n AuditSubscriber.prototype.clearThrottle = function () {\n var _a = this, value = _a.value, hasValue = _a.hasValue, throttled = _a.throttled;\n if (throttled) {\n this.remove(throttled);\n this.throttled = undefined;\n throttled.unsubscribe();\n }\n if (hasValue) {\n this.value = undefined;\n this.hasValue = false;\n this.destination.next(value);\n }\n };\n AuditSubscriber.prototype.notifyNext = function () {\n this.clearThrottle();\n };\n AuditSubscriber.prototype.notifyComplete = function () {\n this.clearThrottle();\n };\n return AuditSubscriber;\n}(innerSubscribe_1.SimpleOuterSubscriber));\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar async_1 = require(\"../scheduler/async\");\nvar audit_1 = require(\"./audit\");\nvar timer_1 = require(\"../observable/timer\");\nfunction auditTime(duration, scheduler) {\n if (scheduler === void 0) { scheduler = async_1.async; }\n return audit_1.audit(function () { return timer_1.timer(duration, scheduler); });\n}\nexports.auditTime = auditTime;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar innerSubscribe_1 = require(\"../innerSubscribe\");\nfunction buffer(closingNotifier) {\n return function bufferOperatorFunction(source) {\n return source.lift(new BufferOperator(closingNotifier));\n };\n}\nexports.buffer = buffer;\nvar BufferOperator = (function () {\n function BufferOperator(closingNotifier) {\n this.closingNotifier = closingNotifier;\n }\n BufferOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new BufferSubscriber(subscriber, this.closingNotifier));\n };\n return BufferOperator;\n}());\nvar BufferSubscriber = (function (_super) {\n __extends(BufferSubscriber, _super);\n function BufferSubscriber(destination, closingNotifier) {\n var _this = _super.call(this, destination) || this;\n _this.buffer = [];\n _this.add(innerSubscribe_1.innerSubscribe(closingNotifier, new innerSubscribe_1.SimpleInnerSubscriber(_this)));\n return _this;\n }\n BufferSubscriber.prototype._next = function (value) {\n this.buffer.push(value);\n };\n BufferSubscriber.prototype.notifyNext = function () {\n var buffer = this.buffer;\n this.buffer = [];\n this.destination.next(buffer);\n };\n return BufferSubscriber;\n}(innerSubscribe_1.SimpleOuterSubscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nfunction bufferCount(bufferSize, startBufferEvery) {\n if (startBufferEvery === void 0) { startBufferEvery = null; }\n return function bufferCountOperatorFunction(source) {\n return source.lift(new BufferCountOperator(bufferSize, startBufferEvery));\n };\n}\nexports.bufferCount = bufferCount;\nvar BufferCountOperator = (function () {\n function BufferCountOperator(bufferSize, startBufferEvery) {\n this.bufferSize = bufferSize;\n this.startBufferEvery = startBufferEvery;\n if (!startBufferEvery || bufferSize === startBufferEvery) {\n this.subscriberClass = BufferCountSubscriber;\n }\n else {\n this.subscriberClass = BufferSkipCountSubscriber;\n }\n }\n BufferCountOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new this.subscriberClass(subscriber, this.bufferSize, this.startBufferEvery));\n };\n return BufferCountOperator;\n}());\nvar BufferCountSubscriber = (function (_super) {\n __extends(BufferCountSubscriber, _super);\n function BufferCountSubscriber(destination, bufferSize) {\n var _this = _super.call(this, destination) || this;\n _this.bufferSize = bufferSize;\n _this.buffer = [];\n return _this;\n }\n BufferCountSubscriber.prototype._next = function (value) {\n var buffer = this.buffer;\n buffer.push(value);\n if (buffer.length == this.bufferSize) {\n this.destination.next(buffer);\n this.buffer = [];\n }\n };\n BufferCountSubscriber.prototype._complete = function () {\n var buffer = this.buffer;\n if (buffer.length > 0) {\n this.destination.next(buffer);\n }\n _super.prototype._complete.call(this);\n };\n return BufferCountSubscriber;\n}(Subscriber_1.Subscriber));\nvar BufferSkipCountSubscriber = (function (_super) {\n __extends(BufferSkipCountSubscriber, _super);\n function BufferSkipCountSubscriber(destination, bufferSize, startBufferEvery) {\n var _this = _super.call(this, destination) || this;\n _this.bufferSize = bufferSize;\n _this.startBufferEvery = startBufferEvery;\n _this.buffers = [];\n _this.count = 0;\n return _this;\n }\n BufferSkipCountSubscriber.prototype._next = function (value) {\n var _a = this, bufferSize = _a.bufferSize, startBufferEvery = _a.startBufferEvery, buffers = _a.buffers, count = _a.count;\n this.count++;\n if (count % startBufferEvery === 0) {\n buffers.push([]);\n }\n for (var i = buffers.length; i--;) {\n var buffer = buffers[i];\n buffer.push(value);\n if (buffer.length === bufferSize) {\n buffers.splice(i, 1);\n this.destination.next(buffer);\n }\n }\n };\n BufferSkipCountSubscriber.prototype._complete = function () {\n var _a = this, buffers = _a.buffers, destination = _a.destination;\n while (buffers.length > 0) {\n var buffer = buffers.shift();\n if (buffer.length > 0) {\n destination.next(buffer);\n }\n }\n _super.prototype._complete.call(this);\n };\n return BufferSkipCountSubscriber;\n}(Subscriber_1.Subscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar async_1 = require(\"../scheduler/async\");\nvar Subscriber_1 = require(\"../Subscriber\");\nvar isScheduler_1 = require(\"../util/isScheduler\");\nfunction bufferTime(bufferTimeSpan) {\n var length = arguments.length;\n var scheduler = async_1.async;\n if (isScheduler_1.isScheduler(arguments[arguments.length - 1])) {\n scheduler = arguments[arguments.length - 1];\n length--;\n }\n var bufferCreationInterval = null;\n if (length >= 2) {\n bufferCreationInterval = arguments[1];\n }\n var maxBufferSize = Number.POSITIVE_INFINITY;\n if (length >= 3) {\n maxBufferSize = arguments[2];\n }\n return function bufferTimeOperatorFunction(source) {\n return source.lift(new BufferTimeOperator(bufferTimeSpan, bufferCreationInterval, maxBufferSize, scheduler));\n };\n}\nexports.bufferTime = bufferTime;\nvar BufferTimeOperator = (function () {\n function BufferTimeOperator(bufferTimeSpan, bufferCreationInterval, maxBufferSize, scheduler) {\n this.bufferTimeSpan = bufferTimeSpan;\n this.bufferCreationInterval = bufferCreationInterval;\n this.maxBufferSize = maxBufferSize;\n this.scheduler = scheduler;\n }\n BufferTimeOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new BufferTimeSubscriber(subscriber, this.bufferTimeSpan, this.bufferCreationInterval, this.maxBufferSize, this.scheduler));\n };\n return BufferTimeOperator;\n}());\nvar Context = (function () {\n function Context() {\n this.buffer = [];\n }\n return Context;\n}());\nvar BufferTimeSubscriber = (function (_super) {\n __extends(BufferTimeSubscriber, _super);\n function BufferTimeSubscriber(destination, bufferTimeSpan, bufferCreationInterval, maxBufferSize, scheduler) {\n var _this = _super.call(this, destination) || this;\n _this.bufferTimeSpan = bufferTimeSpan;\n _this.bufferCreationInterval = bufferCreationInterval;\n _this.maxBufferSize = maxBufferSize;\n _this.scheduler = scheduler;\n _this.contexts = [];\n var context = _this.openContext();\n _this.timespanOnly = bufferCreationInterval == null || bufferCreationInterval < 0;\n if (_this.timespanOnly) {\n var timeSpanOnlyState = { subscriber: _this, context: context, bufferTimeSpan: bufferTimeSpan };\n _this.add(context.closeAction = scheduler.schedule(dispatchBufferTimeSpanOnly, bufferTimeSpan, timeSpanOnlyState));\n }\n else {\n var closeState = { subscriber: _this, context: context };\n var creationState = { bufferTimeSpan: bufferTimeSpan, bufferCreationInterval: bufferCreationInterval, subscriber: _this, scheduler: scheduler };\n _this.add(context.closeAction = scheduler.schedule(dispatchBufferClose, bufferTimeSpan, closeState));\n _this.add(scheduler.schedule(dispatchBufferCreation, bufferCreationInterval, creationState));\n }\n return _this;\n }\n BufferTimeSubscriber.prototype._next = function (value) {\n var contexts = this.contexts;\n var len = contexts.length;\n var filledBufferContext;\n for (var i = 0; i < len; i++) {\n var context_1 = contexts[i];\n var buffer = context_1.buffer;\n buffer.push(value);\n if (buffer.length == this.maxBufferSize) {\n filledBufferContext = context_1;\n }\n }\n if (filledBufferContext) {\n this.onBufferFull(filledBufferContext);\n }\n };\n BufferTimeSubscriber.prototype._error = function (err) {\n this.contexts.length = 0;\n _super.prototype._error.call(this, err);\n };\n BufferTimeSubscriber.prototype._complete = function () {\n var _a = this, contexts = _a.contexts, destination = _a.destination;\n while (contexts.length > 0) {\n var context_2 = contexts.shift();\n destination.next(context_2.buffer);\n }\n _super.prototype._complete.call(this);\n };\n BufferTimeSubscriber.prototype._unsubscribe = function () {\n this.contexts = null;\n };\n BufferTimeSubscriber.prototype.onBufferFull = function (context) {\n this.closeContext(context);\n var closeAction = context.closeAction;\n closeAction.unsubscribe();\n this.remove(closeAction);\n if (!this.closed && this.timespanOnly) {\n context = this.openContext();\n var bufferTimeSpan = this.bufferTimeSpan;\n var timeSpanOnlyState = { subscriber: this, context: context, bufferTimeSpan: bufferTimeSpan };\n this.add(context.closeAction = this.scheduler.schedule(dispatchBufferTimeSpanOnly, bufferTimeSpan, timeSpanOnlyState));\n }\n };\n BufferTimeSubscriber.prototype.openContext = function () {\n var context = new Context();\n this.contexts.push(context);\n return context;\n };\n BufferTimeSubscriber.prototype.closeContext = function (context) {\n this.destination.next(context.buffer);\n var contexts = this.contexts;\n var spliceIndex = contexts ? contexts.indexOf(context) : -1;\n if (spliceIndex >= 0) {\n contexts.splice(contexts.indexOf(context), 1);\n }\n };\n return BufferTimeSubscriber;\n}(Subscriber_1.Subscriber));\nfunction dispatchBufferTimeSpanOnly(state) {\n var subscriber = state.subscriber;\n var prevContext = state.context;\n if (prevContext) {\n subscriber.closeContext(prevContext);\n }\n if (!subscriber.closed) {\n state.context = subscriber.openContext();\n state.context.closeAction = this.schedule(state, state.bufferTimeSpan);\n }\n}\nfunction dispatchBufferCreation(state) {\n var bufferCreationInterval = state.bufferCreationInterval, bufferTimeSpan = state.bufferTimeSpan, subscriber = state.subscriber, scheduler = state.scheduler;\n var context = subscriber.openContext();\n var action = this;\n if (!subscriber.closed) {\n subscriber.add(context.closeAction = scheduler.schedule(dispatchBufferClose, bufferTimeSpan, { subscriber: subscriber, context: context }));\n action.schedule(state, bufferCreationInterval);\n }\n}\nfunction dispatchBufferClose(arg) {\n var subscriber = arg.subscriber, context = arg.context;\n subscriber.closeContext(context);\n}\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscription_1 = require(\"../Subscription\");\nvar subscribeToResult_1 = require(\"../util/subscribeToResult\");\nvar OuterSubscriber_1 = require(\"../OuterSubscriber\");\nfunction bufferToggle(openings, closingSelector) {\n return function bufferToggleOperatorFunction(source) {\n return source.lift(new BufferToggleOperator(openings, closingSelector));\n };\n}\nexports.bufferToggle = bufferToggle;\nvar BufferToggleOperator = (function () {\n function BufferToggleOperator(openings, closingSelector) {\n this.openings = openings;\n this.closingSelector = closingSelector;\n }\n BufferToggleOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new BufferToggleSubscriber(subscriber, this.openings, this.closingSelector));\n };\n return BufferToggleOperator;\n}());\nvar BufferToggleSubscriber = (function (_super) {\n __extends(BufferToggleSubscriber, _super);\n function BufferToggleSubscriber(destination, openings, closingSelector) {\n var _this = _super.call(this, destination) || this;\n _this.closingSelector = closingSelector;\n _this.contexts = [];\n _this.add(subscribeToResult_1.subscribeToResult(_this, openings));\n return _this;\n }\n BufferToggleSubscriber.prototype._next = function (value) {\n var contexts = this.contexts;\n var len = contexts.length;\n for (var i = 0; i < len; i++) {\n contexts[i].buffer.push(value);\n }\n };\n BufferToggleSubscriber.prototype._error = function (err) {\n var contexts = this.contexts;\n while (contexts.length > 0) {\n var context_1 = contexts.shift();\n context_1.subscription.unsubscribe();\n context_1.buffer = null;\n context_1.subscription = null;\n }\n this.contexts = null;\n _super.prototype._error.call(this, err);\n };\n BufferToggleSubscriber.prototype._complete = function () {\n var contexts = this.contexts;\n while (contexts.length > 0) {\n var context_2 = contexts.shift();\n this.destination.next(context_2.buffer);\n context_2.subscription.unsubscribe();\n context_2.buffer = null;\n context_2.subscription = null;\n }\n this.contexts = null;\n _super.prototype._complete.call(this);\n };\n BufferToggleSubscriber.prototype.notifyNext = function (outerValue, innerValue) {\n outerValue ? this.closeBuffer(outerValue) : this.openBuffer(innerValue);\n };\n BufferToggleSubscriber.prototype.notifyComplete = function (innerSub) {\n this.closeBuffer(innerSub.context);\n };\n BufferToggleSubscriber.prototype.openBuffer = function (value) {\n try {\n var closingSelector = this.closingSelector;\n var closingNotifier = closingSelector.call(this, value);\n if (closingNotifier) {\n this.trySubscribe(closingNotifier);\n }\n }\n catch (err) {\n this._error(err);\n }\n };\n BufferToggleSubscriber.prototype.closeBuffer = function (context) {\n var contexts = this.contexts;\n if (contexts && context) {\n var buffer = context.buffer, subscription = context.subscription;\n this.destination.next(buffer);\n contexts.splice(contexts.indexOf(context), 1);\n this.remove(subscription);\n subscription.unsubscribe();\n }\n };\n BufferToggleSubscriber.prototype.trySubscribe = function (closingNotifier) {\n var contexts = this.contexts;\n var buffer = [];\n var subscription = new Subscription_1.Subscription();\n var context = { buffer: buffer, subscription: subscription };\n contexts.push(context);\n var innerSubscription = subscribeToResult_1.subscribeToResult(this, closingNotifier, context);\n if (!innerSubscription || innerSubscription.closed) {\n this.closeBuffer(context);\n }\n else {\n innerSubscription.context = context;\n this.add(innerSubscription);\n subscription.add(innerSubscription);\n }\n };\n return BufferToggleSubscriber;\n}(OuterSubscriber_1.OuterSubscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscription_1 = require(\"../Subscription\");\nvar innerSubscribe_1 = require(\"../innerSubscribe\");\nfunction bufferWhen(closingSelector) {\n return function (source) {\n return source.lift(new BufferWhenOperator(closingSelector));\n };\n}\nexports.bufferWhen = bufferWhen;\nvar BufferWhenOperator = (function () {\n function BufferWhenOperator(closingSelector) {\n this.closingSelector = closingSelector;\n }\n BufferWhenOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new BufferWhenSubscriber(subscriber, this.closingSelector));\n };\n return BufferWhenOperator;\n}());\nvar BufferWhenSubscriber = (function (_super) {\n __extends(BufferWhenSubscriber, _super);\n function BufferWhenSubscriber(destination, closingSelector) {\n var _this = _super.call(this, destination) || this;\n _this.closingSelector = closingSelector;\n _this.subscribing = false;\n _this.openBuffer();\n return _this;\n }\n BufferWhenSubscriber.prototype._next = function (value) {\n this.buffer.push(value);\n };\n BufferWhenSubscriber.prototype._complete = function () {\n var buffer = this.buffer;\n if (buffer) {\n this.destination.next(buffer);\n }\n _super.prototype._complete.call(this);\n };\n BufferWhenSubscriber.prototype._unsubscribe = function () {\n this.buffer = undefined;\n this.subscribing = false;\n };\n BufferWhenSubscriber.prototype.notifyNext = function () {\n this.openBuffer();\n };\n BufferWhenSubscriber.prototype.notifyComplete = function () {\n if (this.subscribing) {\n this.complete();\n }\n else {\n this.openBuffer();\n }\n };\n BufferWhenSubscriber.prototype.openBuffer = function () {\n var closingSubscription = this.closingSubscription;\n if (closingSubscription) {\n this.remove(closingSubscription);\n closingSubscription.unsubscribe();\n }\n var buffer = this.buffer;\n if (this.buffer) {\n this.destination.next(buffer);\n }\n this.buffer = [];\n var closingNotifier;\n try {\n var closingSelector = this.closingSelector;\n closingNotifier = closingSelector();\n }\n catch (err) {\n return this.error(err);\n }\n closingSubscription = new Subscription_1.Subscription();\n this.closingSubscription = closingSubscription;\n this.add(closingSubscription);\n this.subscribing = true;\n closingSubscription.add(innerSubscribe_1.innerSubscribe(closingNotifier, new innerSubscribe_1.SimpleInnerSubscriber(this)));\n this.subscribing = false;\n };\n return BufferWhenSubscriber;\n}(innerSubscribe_1.SimpleOuterSubscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar innerSubscribe_1 = require(\"../innerSubscribe\");\nfunction catchError(selector) {\n return function catchErrorOperatorFunction(source) {\n var operator = new CatchOperator(selector);\n var caught = source.lift(operator);\n return (operator.caught = caught);\n };\n}\nexports.catchError = catchError;\nvar CatchOperator = (function () {\n function CatchOperator(selector) {\n this.selector = selector;\n }\n CatchOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new CatchSubscriber(subscriber, this.selector, this.caught));\n };\n return CatchOperator;\n}());\nvar CatchSubscriber = (function (_super) {\n __extends(CatchSubscriber, _super);\n function CatchSubscriber(destination, selector, caught) {\n var _this = _super.call(this, destination) || this;\n _this.selector = selector;\n _this.caught = caught;\n return _this;\n }\n CatchSubscriber.prototype.error = function (err) {\n if (!this.isStopped) {\n var result = void 0;\n try {\n result = this.selector(err, this.caught);\n }\n catch (err2) {\n _super.prototype.error.call(this, err2);\n return;\n }\n this._unsubscribeAndRecycle();\n var innerSubscriber = new innerSubscribe_1.SimpleInnerSubscriber(this);\n this.add(innerSubscriber);\n var innerSubscription = innerSubscribe_1.innerSubscribe(result, innerSubscriber);\n if (innerSubscription !== innerSubscriber) {\n this.add(innerSubscription);\n }\n }\n };\n return CatchSubscriber;\n}(innerSubscribe_1.SimpleOuterSubscriber));\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar combineLatest_1 = require(\"../observable/combineLatest\");\nfunction combineAll(project) {\n return function (source) { return source.lift(new combineLatest_1.CombineLatestOperator(project)); };\n}\nexports.combineAll = combineAll;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar isArray_1 = require(\"../util/isArray\");\nvar combineLatest_1 = require(\"../observable/combineLatest\");\nvar from_1 = require(\"../observable/from\");\nvar none = {};\nfunction combineLatest() {\n var observables = [];\n for (var _i = 0; _i < arguments.length; _i++) {\n observables[_i] = arguments[_i];\n }\n var project = null;\n if (typeof observables[observables.length - 1] === 'function') {\n project = observables.pop();\n }\n if (observables.length === 1 && isArray_1.isArray(observables[0])) {\n observables = observables[0].slice();\n }\n return function (source) { return source.lift.call(from_1.from([source].concat(observables)), new combineLatest_1.CombineLatestOperator(project)); };\n}\nexports.combineLatest = combineLatest;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar concat_1 = require(\"../observable/concat\");\nfunction concat() {\n var observables = [];\n for (var _i = 0; _i < arguments.length; _i++) {\n observables[_i] = arguments[_i];\n }\n return function (source) { return source.lift.call(concat_1.concat.apply(void 0, [source].concat(observables))); };\n}\nexports.concat = concat;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar mergeAll_1 = require(\"./mergeAll\");\nfunction concatAll() {\n return mergeAll_1.mergeAll(1);\n}\nexports.concatAll = concatAll;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar mergeMap_1 = require(\"./mergeMap\");\nfunction concatMap(project, resultSelector) {\n return mergeMap_1.mergeMap(project, resultSelector, 1);\n}\nexports.concatMap = concatMap;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar concatMap_1 = require(\"./concatMap\");\nfunction concatMapTo(innerObservable, resultSelector) {\n return concatMap_1.concatMap(function () { return innerObservable; }, resultSelector);\n}\nexports.concatMapTo = concatMapTo;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nfunction count(predicate) {\n return function (source) { return source.lift(new CountOperator(predicate, source)); };\n}\nexports.count = count;\nvar CountOperator = (function () {\n function CountOperator(predicate, source) {\n this.predicate = predicate;\n this.source = source;\n }\n CountOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new CountSubscriber(subscriber, this.predicate, this.source));\n };\n return CountOperator;\n}());\nvar CountSubscriber = (function (_super) {\n __extends(CountSubscriber, _super);\n function CountSubscriber(destination, predicate, source) {\n var _this = _super.call(this, destination) || this;\n _this.predicate = predicate;\n _this.source = source;\n _this.count = 0;\n _this.index = 0;\n return _this;\n }\n CountSubscriber.prototype._next = function (value) {\n if (this.predicate) {\n this._tryPredicate(value);\n }\n else {\n this.count++;\n }\n };\n CountSubscriber.prototype._tryPredicate = function (value) {\n var result;\n try {\n result = this.predicate(value, this.index++, this.source);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n if (result) {\n this.count++;\n }\n };\n CountSubscriber.prototype._complete = function () {\n this.destination.next(this.count);\n this.destination.complete();\n };\n return CountSubscriber;\n}(Subscriber_1.Subscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar innerSubscribe_1 = require(\"../innerSubscribe\");\nfunction debounce(durationSelector) {\n return function (source) { return source.lift(new DebounceOperator(durationSelector)); };\n}\nexports.debounce = debounce;\nvar DebounceOperator = (function () {\n function DebounceOperator(durationSelector) {\n this.durationSelector = durationSelector;\n }\n DebounceOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new DebounceSubscriber(subscriber, this.durationSelector));\n };\n return DebounceOperator;\n}());\nvar DebounceSubscriber = (function (_super) {\n __extends(DebounceSubscriber, _super);\n function DebounceSubscriber(destination, durationSelector) {\n var _this = _super.call(this, destination) || this;\n _this.durationSelector = durationSelector;\n _this.hasValue = false;\n return _this;\n }\n DebounceSubscriber.prototype._next = function (value) {\n try {\n var result = this.durationSelector.call(this, value);\n if (result) {\n this._tryNext(value, result);\n }\n }\n catch (err) {\n this.destination.error(err);\n }\n };\n DebounceSubscriber.prototype._complete = function () {\n this.emitValue();\n this.destination.complete();\n };\n DebounceSubscriber.prototype._tryNext = function (value, duration) {\n var subscription = this.durationSubscription;\n this.value = value;\n this.hasValue = true;\n if (subscription) {\n subscription.unsubscribe();\n this.remove(subscription);\n }\n subscription = innerSubscribe_1.innerSubscribe(duration, new innerSubscribe_1.SimpleInnerSubscriber(this));\n if (subscription && !subscription.closed) {\n this.add(this.durationSubscription = subscription);\n }\n };\n DebounceSubscriber.prototype.notifyNext = function () {\n this.emitValue();\n };\n DebounceSubscriber.prototype.notifyComplete = function () {\n this.emitValue();\n };\n DebounceSubscriber.prototype.emitValue = function () {\n if (this.hasValue) {\n var value = this.value;\n var subscription = this.durationSubscription;\n if (subscription) {\n this.durationSubscription = undefined;\n subscription.unsubscribe();\n this.remove(subscription);\n }\n this.value = undefined;\n this.hasValue = false;\n _super.prototype._next.call(this, value);\n }\n };\n return DebounceSubscriber;\n}(innerSubscribe_1.SimpleOuterSubscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nvar async_1 = require(\"../scheduler/async\");\nfunction debounceTime(dueTime, scheduler) {\n if (scheduler === void 0) { scheduler = async_1.async; }\n return function (source) { return source.lift(new DebounceTimeOperator(dueTime, scheduler)); };\n}\nexports.debounceTime = debounceTime;\nvar DebounceTimeOperator = (function () {\n function DebounceTimeOperator(dueTime, scheduler) {\n this.dueTime = dueTime;\n this.scheduler = scheduler;\n }\n DebounceTimeOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new DebounceTimeSubscriber(subscriber, this.dueTime, this.scheduler));\n };\n return DebounceTimeOperator;\n}());\nvar DebounceTimeSubscriber = (function (_super) {\n __extends(DebounceTimeSubscriber, _super);\n function DebounceTimeSubscriber(destination, dueTime, scheduler) {\n var _this = _super.call(this, destination) || this;\n _this.dueTime = dueTime;\n _this.scheduler = scheduler;\n _this.debouncedSubscription = null;\n _this.lastValue = null;\n _this.hasValue = false;\n return _this;\n }\n DebounceTimeSubscriber.prototype._next = function (value) {\n this.clearDebounce();\n this.lastValue = value;\n this.hasValue = true;\n this.add(this.debouncedSubscription = this.scheduler.schedule(dispatchNext, this.dueTime, this));\n };\n DebounceTimeSubscriber.prototype._complete = function () {\n this.debouncedNext();\n this.destination.complete();\n };\n DebounceTimeSubscriber.prototype.debouncedNext = function () {\n this.clearDebounce();\n if (this.hasValue) {\n var lastValue = this.lastValue;\n this.lastValue = null;\n this.hasValue = false;\n this.destination.next(lastValue);\n }\n };\n DebounceTimeSubscriber.prototype.clearDebounce = function () {\n var debouncedSubscription = this.debouncedSubscription;\n if (debouncedSubscription !== null) {\n this.remove(debouncedSubscription);\n debouncedSubscription.unsubscribe();\n this.debouncedSubscription = null;\n }\n };\n return DebounceTimeSubscriber;\n}(Subscriber_1.Subscriber));\nfunction dispatchNext(subscriber) {\n subscriber.debouncedNext();\n}\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nfunction defaultIfEmpty(defaultValue) {\n if (defaultValue === void 0) { defaultValue = null; }\n return function (source) { return source.lift(new DefaultIfEmptyOperator(defaultValue)); };\n}\nexports.defaultIfEmpty = defaultIfEmpty;\nvar DefaultIfEmptyOperator = (function () {\n function DefaultIfEmptyOperator(defaultValue) {\n this.defaultValue = defaultValue;\n }\n DefaultIfEmptyOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new DefaultIfEmptySubscriber(subscriber, this.defaultValue));\n };\n return DefaultIfEmptyOperator;\n}());\nvar DefaultIfEmptySubscriber = (function (_super) {\n __extends(DefaultIfEmptySubscriber, _super);\n function DefaultIfEmptySubscriber(destination, defaultValue) {\n var _this = _super.call(this, destination) || this;\n _this.defaultValue = defaultValue;\n _this.isEmpty = true;\n return _this;\n }\n DefaultIfEmptySubscriber.prototype._next = function (value) {\n this.isEmpty = false;\n this.destination.next(value);\n };\n DefaultIfEmptySubscriber.prototype._complete = function () {\n if (this.isEmpty) {\n this.destination.next(this.defaultValue);\n }\n this.destination.complete();\n };\n return DefaultIfEmptySubscriber;\n}(Subscriber_1.Subscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar async_1 = require(\"../scheduler/async\");\nvar isDate_1 = require(\"../util/isDate\");\nvar Subscriber_1 = require(\"../Subscriber\");\nvar Notification_1 = require(\"../Notification\");\nfunction delay(delay, scheduler) {\n if (scheduler === void 0) { scheduler = async_1.async; }\n var absoluteDelay = isDate_1.isDate(delay);\n var delayFor = absoluteDelay ? (+delay - scheduler.now()) : Math.abs(delay);\n return function (source) { return source.lift(new DelayOperator(delayFor, scheduler)); };\n}\nexports.delay = delay;\nvar DelayOperator = (function () {\n function DelayOperator(delay, scheduler) {\n this.delay = delay;\n this.scheduler = scheduler;\n }\n DelayOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new DelaySubscriber(subscriber, this.delay, this.scheduler));\n };\n return DelayOperator;\n}());\nvar DelaySubscriber = (function (_super) {\n __extends(DelaySubscriber, _super);\n function DelaySubscriber(destination, delay, scheduler) {\n var _this = _super.call(this, destination) || this;\n _this.delay = delay;\n _this.scheduler = scheduler;\n _this.queue = [];\n _this.active = false;\n _this.errored = false;\n return _this;\n }\n DelaySubscriber.dispatch = function (state) {\n var source = state.source;\n var queue = source.queue;\n var scheduler = state.scheduler;\n var destination = state.destination;\n while (queue.length > 0 && (queue[0].time - scheduler.now()) <= 0) {\n queue.shift().notification.observe(destination);\n }\n if (queue.length > 0) {\n var delay_1 = Math.max(0, queue[0].time - scheduler.now());\n this.schedule(state, delay_1);\n }\n else {\n this.unsubscribe();\n source.active = false;\n }\n };\n DelaySubscriber.prototype._schedule = function (scheduler) {\n this.active = true;\n var destination = this.destination;\n destination.add(scheduler.schedule(DelaySubscriber.dispatch, this.delay, {\n source: this, destination: this.destination, scheduler: scheduler\n }));\n };\n DelaySubscriber.prototype.scheduleNotification = function (notification) {\n if (this.errored === true) {\n return;\n }\n var scheduler = this.scheduler;\n var message = new DelayMessage(scheduler.now() + this.delay, notification);\n this.queue.push(message);\n if (this.active === false) {\n this._schedule(scheduler);\n }\n };\n DelaySubscriber.prototype._next = function (value) {\n this.scheduleNotification(Notification_1.Notification.createNext(value));\n };\n DelaySubscriber.prototype._error = function (err) {\n this.errored = true;\n this.queue = [];\n this.destination.error(err);\n this.unsubscribe();\n };\n DelaySubscriber.prototype._complete = function () {\n this.scheduleNotification(Notification_1.Notification.createComplete());\n this.unsubscribe();\n };\n return DelaySubscriber;\n}(Subscriber_1.Subscriber));\nvar DelayMessage = (function () {\n function DelayMessage(time, notification) {\n this.time = time;\n this.notification = notification;\n }\n return DelayMessage;\n}());\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nvar Observable_1 = require(\"../Observable\");\nvar OuterSubscriber_1 = require(\"../OuterSubscriber\");\nvar subscribeToResult_1 = require(\"../util/subscribeToResult\");\nfunction delayWhen(delayDurationSelector, subscriptionDelay) {\n if (subscriptionDelay) {\n return function (source) {\n return new SubscriptionDelayObservable(source, subscriptionDelay)\n .lift(new DelayWhenOperator(delayDurationSelector));\n };\n }\n return function (source) { return source.lift(new DelayWhenOperator(delayDurationSelector)); };\n}\nexports.delayWhen = delayWhen;\nvar DelayWhenOperator = (function () {\n function DelayWhenOperator(delayDurationSelector) {\n this.delayDurationSelector = delayDurationSelector;\n }\n DelayWhenOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new DelayWhenSubscriber(subscriber, this.delayDurationSelector));\n };\n return DelayWhenOperator;\n}());\nvar DelayWhenSubscriber = (function (_super) {\n __extends(DelayWhenSubscriber, _super);\n function DelayWhenSubscriber(destination, delayDurationSelector) {\n var _this = _super.call(this, destination) || this;\n _this.delayDurationSelector = delayDurationSelector;\n _this.completed = false;\n _this.delayNotifierSubscriptions = [];\n _this.index = 0;\n return _this;\n }\n DelayWhenSubscriber.prototype.notifyNext = function (outerValue, _innerValue, _outerIndex, _innerIndex, innerSub) {\n this.destination.next(outerValue);\n this.removeSubscription(innerSub);\n this.tryComplete();\n };\n DelayWhenSubscriber.prototype.notifyError = function (error, innerSub) {\n this._error(error);\n };\n DelayWhenSubscriber.prototype.notifyComplete = function (innerSub) {\n var value = this.removeSubscription(innerSub);\n if (value) {\n this.destination.next(value);\n }\n this.tryComplete();\n };\n DelayWhenSubscriber.prototype._next = function (value) {\n var index = this.index++;\n try {\n var delayNotifier = this.delayDurationSelector(value, index);\n if (delayNotifier) {\n this.tryDelay(delayNotifier, value);\n }\n }\n catch (err) {\n this.destination.error(err);\n }\n };\n DelayWhenSubscriber.prototype._complete = function () {\n this.completed = true;\n this.tryComplete();\n this.unsubscribe();\n };\n DelayWhenSubscriber.prototype.removeSubscription = function (subscription) {\n subscription.unsubscribe();\n var subscriptionIdx = this.delayNotifierSubscriptions.indexOf(subscription);\n if (subscriptionIdx !== -1) {\n this.delayNotifierSubscriptions.splice(subscriptionIdx, 1);\n }\n return subscription.outerValue;\n };\n DelayWhenSubscriber.prototype.tryDelay = function (delayNotifier, value) {\n var notifierSubscription = subscribeToResult_1.subscribeToResult(this, delayNotifier, value);\n if (notifierSubscription && !notifierSubscription.closed) {\n var destination = this.destination;\n destination.add(notifierSubscription);\n this.delayNotifierSubscriptions.push(notifierSubscription);\n }\n };\n DelayWhenSubscriber.prototype.tryComplete = function () {\n if (this.completed && this.delayNotifierSubscriptions.length === 0) {\n this.destination.complete();\n }\n };\n return DelayWhenSubscriber;\n}(OuterSubscriber_1.OuterSubscriber));\nvar SubscriptionDelayObservable = (function (_super) {\n __extends(SubscriptionDelayObservable, _super);\n function SubscriptionDelayObservable(source, subscriptionDelay) {\n var _this = _super.call(this) || this;\n _this.source = source;\n _this.subscriptionDelay = subscriptionDelay;\n return _this;\n }\n SubscriptionDelayObservable.prototype._subscribe = function (subscriber) {\n this.subscriptionDelay.subscribe(new SubscriptionDelaySubscriber(subscriber, this.source));\n };\n return SubscriptionDelayObservable;\n}(Observable_1.Observable));\nvar SubscriptionDelaySubscriber = (function (_super) {\n __extends(SubscriptionDelaySubscriber, _super);\n function SubscriptionDelaySubscriber(parent, source) {\n var _this = _super.call(this) || this;\n _this.parent = parent;\n _this.source = source;\n _this.sourceSubscribed = false;\n return _this;\n }\n SubscriptionDelaySubscriber.prototype._next = function (unused) {\n this.subscribeToSource();\n };\n SubscriptionDelaySubscriber.prototype._error = function (err) {\n this.unsubscribe();\n this.parent.error(err);\n };\n SubscriptionDelaySubscriber.prototype._complete = function () {\n this.unsubscribe();\n this.subscribeToSource();\n };\n SubscriptionDelaySubscriber.prototype.subscribeToSource = function () {\n if (!this.sourceSubscribed) {\n this.sourceSubscribed = true;\n this.unsubscribe();\n this.source.subscribe(this.parent);\n }\n };\n return SubscriptionDelaySubscriber;\n}(Subscriber_1.Subscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nfunction dematerialize() {\n return function dematerializeOperatorFunction(source) {\n return source.lift(new DeMaterializeOperator());\n };\n}\nexports.dematerialize = dematerialize;\nvar DeMaterializeOperator = (function () {\n function DeMaterializeOperator() {\n }\n DeMaterializeOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new DeMaterializeSubscriber(subscriber));\n };\n return DeMaterializeOperator;\n}());\nvar DeMaterializeSubscriber = (function (_super) {\n __extends(DeMaterializeSubscriber, _super);\n function DeMaterializeSubscriber(destination) {\n return _super.call(this, destination) || this;\n }\n DeMaterializeSubscriber.prototype._next = function (value) {\n value.observe(this.destination);\n };\n return DeMaterializeSubscriber;\n}(Subscriber_1.Subscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar innerSubscribe_1 = require(\"../innerSubscribe\");\nfunction distinct(keySelector, flushes) {\n return function (source) { return source.lift(new DistinctOperator(keySelector, flushes)); };\n}\nexports.distinct = distinct;\nvar DistinctOperator = (function () {\n function DistinctOperator(keySelector, flushes) {\n this.keySelector = keySelector;\n this.flushes = flushes;\n }\n DistinctOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new DistinctSubscriber(subscriber, this.keySelector, this.flushes));\n };\n return DistinctOperator;\n}());\nvar DistinctSubscriber = (function (_super) {\n __extends(DistinctSubscriber, _super);\n function DistinctSubscriber(destination, keySelector, flushes) {\n var _this = _super.call(this, destination) || this;\n _this.keySelector = keySelector;\n _this.values = new Set();\n if (flushes) {\n _this.add(innerSubscribe_1.innerSubscribe(flushes, new innerSubscribe_1.SimpleInnerSubscriber(_this)));\n }\n return _this;\n }\n DistinctSubscriber.prototype.notifyNext = function () {\n this.values.clear();\n };\n DistinctSubscriber.prototype.notifyError = function (error) {\n this._error(error);\n };\n DistinctSubscriber.prototype._next = function (value) {\n if (this.keySelector) {\n this._useKeySelector(value);\n }\n else {\n this._finalizeNext(value, value);\n }\n };\n DistinctSubscriber.prototype._useKeySelector = function (value) {\n var key;\n var destination = this.destination;\n try {\n key = this.keySelector(value);\n }\n catch (err) {\n destination.error(err);\n return;\n }\n this._finalizeNext(key, value);\n };\n DistinctSubscriber.prototype._finalizeNext = function (key, value) {\n var values = this.values;\n if (!values.has(key)) {\n values.add(key);\n this.destination.next(value);\n }\n };\n return DistinctSubscriber;\n}(innerSubscribe_1.SimpleOuterSubscriber));\nexports.DistinctSubscriber = DistinctSubscriber;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nfunction distinctUntilChanged(compare, keySelector) {\n return function (source) { return source.lift(new DistinctUntilChangedOperator(compare, keySelector)); };\n}\nexports.distinctUntilChanged = distinctUntilChanged;\nvar DistinctUntilChangedOperator = (function () {\n function DistinctUntilChangedOperator(compare, keySelector) {\n this.compare = compare;\n this.keySelector = keySelector;\n }\n DistinctUntilChangedOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new DistinctUntilChangedSubscriber(subscriber, this.compare, this.keySelector));\n };\n return DistinctUntilChangedOperator;\n}());\nvar DistinctUntilChangedSubscriber = (function (_super) {\n __extends(DistinctUntilChangedSubscriber, _super);\n function DistinctUntilChangedSubscriber(destination, compare, keySelector) {\n var _this = _super.call(this, destination) || this;\n _this.keySelector = keySelector;\n _this.hasKey = false;\n if (typeof compare === 'function') {\n _this.compare = compare;\n }\n return _this;\n }\n DistinctUntilChangedSubscriber.prototype.compare = function (x, y) {\n return x === y;\n };\n DistinctUntilChangedSubscriber.prototype._next = function (value) {\n var key;\n try {\n var keySelector = this.keySelector;\n key = keySelector ? keySelector(value) : value;\n }\n catch (err) {\n return this.destination.error(err);\n }\n var result = false;\n if (this.hasKey) {\n try {\n var compare = this.compare;\n result = compare(this.key, key);\n }\n catch (err) {\n return this.destination.error(err);\n }\n }\n else {\n this.hasKey = true;\n }\n if (!result) {\n this.key = key;\n this.destination.next(value);\n }\n };\n return DistinctUntilChangedSubscriber;\n}(Subscriber_1.Subscriber));\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar distinctUntilChanged_1 = require(\"./distinctUntilChanged\");\nfunction distinctUntilKeyChanged(key, compare) {\n return distinctUntilChanged_1.distinctUntilChanged(function (x, y) { return compare ? compare(x[key], y[key]) : x[key] === y[key]; });\n}\nexports.distinctUntilKeyChanged = distinctUntilKeyChanged;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar ArgumentOutOfRangeError_1 = require(\"../util/ArgumentOutOfRangeError\");\nvar filter_1 = require(\"./filter\");\nvar throwIfEmpty_1 = require(\"./throwIfEmpty\");\nvar defaultIfEmpty_1 = require(\"./defaultIfEmpty\");\nvar take_1 = require(\"./take\");\nfunction elementAt(index, defaultValue) {\n if (index < 0) {\n throw new ArgumentOutOfRangeError_1.ArgumentOutOfRangeError();\n }\n var hasDefaultValue = arguments.length >= 2;\n return function (source) { return source.pipe(filter_1.filter(function (v, i) { return i === index; }), take_1.take(1), hasDefaultValue\n ? defaultIfEmpty_1.defaultIfEmpty(defaultValue)\n : throwIfEmpty_1.throwIfEmpty(function () { return new ArgumentOutOfRangeError_1.ArgumentOutOfRangeError(); })); };\n}\nexports.elementAt = elementAt;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nfunction every(predicate, thisArg) {\n return function (source) { return source.lift(new EveryOperator(predicate, thisArg, source)); };\n}\nexports.every = every;\nvar EveryOperator = (function () {\n function EveryOperator(predicate, thisArg, source) {\n this.predicate = predicate;\n this.thisArg = thisArg;\n this.source = source;\n }\n EveryOperator.prototype.call = function (observer, source) {\n return source.subscribe(new EverySubscriber(observer, this.predicate, this.thisArg, this.source));\n };\n return EveryOperator;\n}());\nvar EverySubscriber = (function (_super) {\n __extends(EverySubscriber, _super);\n function EverySubscriber(destination, predicate, thisArg, source) {\n var _this = _super.call(this, destination) || this;\n _this.predicate = predicate;\n _this.thisArg = thisArg;\n _this.source = source;\n _this.index = 0;\n _this.thisArg = thisArg || _this;\n return _this;\n }\n EverySubscriber.prototype.notifyComplete = function (everyValueMatch) {\n this.destination.next(everyValueMatch);\n this.destination.complete();\n };\n EverySubscriber.prototype._next = function (value) {\n var result = false;\n try {\n result = this.predicate.call(this.thisArg, value, this.index++, this.source);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n if (!result) {\n this.notifyComplete(false);\n }\n };\n EverySubscriber.prototype._complete = function () {\n this.notifyComplete(true);\n };\n return EverySubscriber;\n}(Subscriber_1.Subscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar innerSubscribe_1 = require(\"../innerSubscribe\");\nfunction exhaust() {\n return function (source) { return source.lift(new SwitchFirstOperator()); };\n}\nexports.exhaust = exhaust;\nvar SwitchFirstOperator = (function () {\n function SwitchFirstOperator() {\n }\n SwitchFirstOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new SwitchFirstSubscriber(subscriber));\n };\n return SwitchFirstOperator;\n}());\nvar SwitchFirstSubscriber = (function (_super) {\n __extends(SwitchFirstSubscriber, _super);\n function SwitchFirstSubscriber(destination) {\n var _this = _super.call(this, destination) || this;\n _this.hasCompleted = false;\n _this.hasSubscription = false;\n return _this;\n }\n SwitchFirstSubscriber.prototype._next = function (value) {\n if (!this.hasSubscription) {\n this.hasSubscription = true;\n this.add(innerSubscribe_1.innerSubscribe(value, new innerSubscribe_1.SimpleInnerSubscriber(this)));\n }\n };\n SwitchFirstSubscriber.prototype._complete = function () {\n this.hasCompleted = true;\n if (!this.hasSubscription) {\n this.destination.complete();\n }\n };\n SwitchFirstSubscriber.prototype.notifyComplete = function () {\n this.hasSubscription = false;\n if (this.hasCompleted) {\n this.destination.complete();\n }\n };\n return SwitchFirstSubscriber;\n}(innerSubscribe_1.SimpleOuterSubscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar map_1 = require(\"./map\");\nvar from_1 = require(\"../observable/from\");\nvar innerSubscribe_1 = require(\"../innerSubscribe\");\nfunction exhaustMap(project, resultSelector) {\n if (resultSelector) {\n return function (source) { return source.pipe(exhaustMap(function (a, i) { return from_1.from(project(a, i)).pipe(map_1.map(function (b, ii) { return resultSelector(a, b, i, ii); })); })); };\n }\n return function (source) {\n return source.lift(new ExhaustMapOperator(project));\n };\n}\nexports.exhaustMap = exhaustMap;\nvar ExhaustMapOperator = (function () {\n function ExhaustMapOperator(project) {\n this.project = project;\n }\n ExhaustMapOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new ExhaustMapSubscriber(subscriber, this.project));\n };\n return ExhaustMapOperator;\n}());\nvar ExhaustMapSubscriber = (function (_super) {\n __extends(ExhaustMapSubscriber, _super);\n function ExhaustMapSubscriber(destination, project) {\n var _this = _super.call(this, destination) || this;\n _this.project = project;\n _this.hasSubscription = false;\n _this.hasCompleted = false;\n _this.index = 0;\n return _this;\n }\n ExhaustMapSubscriber.prototype._next = function (value) {\n if (!this.hasSubscription) {\n this.tryNext(value);\n }\n };\n ExhaustMapSubscriber.prototype.tryNext = function (value) {\n var result;\n var index = this.index++;\n try {\n result = this.project(value, index);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.hasSubscription = true;\n this._innerSub(result);\n };\n ExhaustMapSubscriber.prototype._innerSub = function (result) {\n var innerSubscriber = new innerSubscribe_1.SimpleInnerSubscriber(this);\n var destination = this.destination;\n destination.add(innerSubscriber);\n var innerSubscription = innerSubscribe_1.innerSubscribe(result, innerSubscriber);\n if (innerSubscription !== innerSubscriber) {\n destination.add(innerSubscription);\n }\n };\n ExhaustMapSubscriber.prototype._complete = function () {\n this.hasCompleted = true;\n if (!this.hasSubscription) {\n this.destination.complete();\n }\n this.unsubscribe();\n };\n ExhaustMapSubscriber.prototype.notifyNext = function (innerValue) {\n this.destination.next(innerValue);\n };\n ExhaustMapSubscriber.prototype.notifyError = function (err) {\n this.destination.error(err);\n };\n ExhaustMapSubscriber.prototype.notifyComplete = function () {\n this.hasSubscription = false;\n if (this.hasCompleted) {\n this.destination.complete();\n }\n };\n return ExhaustMapSubscriber;\n}(innerSubscribe_1.SimpleOuterSubscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar innerSubscribe_1 = require(\"../innerSubscribe\");\nfunction expand(project, concurrent, scheduler) {\n if (concurrent === void 0) { concurrent = Number.POSITIVE_INFINITY; }\n concurrent = (concurrent || 0) < 1 ? Number.POSITIVE_INFINITY : concurrent;\n return function (source) { return source.lift(new ExpandOperator(project, concurrent, scheduler)); };\n}\nexports.expand = expand;\nvar ExpandOperator = (function () {\n function ExpandOperator(project, concurrent, scheduler) {\n this.project = project;\n this.concurrent = concurrent;\n this.scheduler = scheduler;\n }\n ExpandOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new ExpandSubscriber(subscriber, this.project, this.concurrent, this.scheduler));\n };\n return ExpandOperator;\n}());\nexports.ExpandOperator = ExpandOperator;\nvar ExpandSubscriber = (function (_super) {\n __extends(ExpandSubscriber, _super);\n function ExpandSubscriber(destination, project, concurrent, scheduler) {\n var _this = _super.call(this, destination) || this;\n _this.project = project;\n _this.concurrent = concurrent;\n _this.scheduler = scheduler;\n _this.index = 0;\n _this.active = 0;\n _this.hasCompleted = false;\n if (concurrent < Number.POSITIVE_INFINITY) {\n _this.buffer = [];\n }\n return _this;\n }\n ExpandSubscriber.dispatch = function (arg) {\n var subscriber = arg.subscriber, result = arg.result, value = arg.value, index = arg.index;\n subscriber.subscribeToProjection(result, value, index);\n };\n ExpandSubscriber.prototype._next = function (value) {\n var destination = this.destination;\n if (destination.closed) {\n this._complete();\n return;\n }\n var index = this.index++;\n if (this.active < this.concurrent) {\n destination.next(value);\n try {\n var project = this.project;\n var result = project(value, index);\n if (!this.scheduler) {\n this.subscribeToProjection(result, value, index);\n }\n else {\n var state = { subscriber: this, result: result, value: value, index: index };\n var destination_1 = this.destination;\n destination_1.add(this.scheduler.schedule(ExpandSubscriber.dispatch, 0, state));\n }\n }\n catch (e) {\n destination.error(e);\n }\n }\n else {\n this.buffer.push(value);\n }\n };\n ExpandSubscriber.prototype.subscribeToProjection = function (result, value, index) {\n this.active++;\n var destination = this.destination;\n destination.add(innerSubscribe_1.innerSubscribe(result, new innerSubscribe_1.SimpleInnerSubscriber(this)));\n };\n ExpandSubscriber.prototype._complete = function () {\n this.hasCompleted = true;\n if (this.hasCompleted && this.active === 0) {\n this.destination.complete();\n }\n this.unsubscribe();\n };\n ExpandSubscriber.prototype.notifyNext = function (innerValue) {\n this._next(innerValue);\n };\n ExpandSubscriber.prototype.notifyComplete = function () {\n var buffer = this.buffer;\n this.active--;\n if (buffer && buffer.length > 0) {\n this._next(buffer.shift());\n }\n if (this.hasCompleted && this.active === 0) {\n this.destination.complete();\n }\n };\n return ExpandSubscriber;\n}(innerSubscribe_1.SimpleOuterSubscriber));\nexports.ExpandSubscriber = ExpandSubscriber;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nfunction filter(predicate, thisArg) {\n return function filterOperatorFunction(source) {\n return source.lift(new FilterOperator(predicate, thisArg));\n };\n}\nexports.filter = filter;\nvar FilterOperator = (function () {\n function FilterOperator(predicate, thisArg) {\n this.predicate = predicate;\n this.thisArg = thisArg;\n }\n FilterOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new FilterSubscriber(subscriber, this.predicate, this.thisArg));\n };\n return FilterOperator;\n}());\nvar FilterSubscriber = (function (_super) {\n __extends(FilterSubscriber, _super);\n function FilterSubscriber(destination, predicate, thisArg) {\n var _this = _super.call(this, destination) || this;\n _this.predicate = predicate;\n _this.thisArg = thisArg;\n _this.count = 0;\n return _this;\n }\n FilterSubscriber.prototype._next = function (value) {\n var result;\n try {\n result = this.predicate.call(this.thisArg, value, this.count++);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n if (result) {\n this.destination.next(value);\n }\n };\n return FilterSubscriber;\n}(Subscriber_1.Subscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nvar Subscription_1 = require(\"../Subscription\");\nfunction finalize(callback) {\n return function (source) { return source.lift(new FinallyOperator(callback)); };\n}\nexports.finalize = finalize;\nvar FinallyOperator = (function () {\n function FinallyOperator(callback) {\n this.callback = callback;\n }\n FinallyOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new FinallySubscriber(subscriber, this.callback));\n };\n return FinallyOperator;\n}());\nvar FinallySubscriber = (function (_super) {\n __extends(FinallySubscriber, _super);\n function FinallySubscriber(destination, callback) {\n var _this = _super.call(this, destination) || this;\n _this.add(new Subscription_1.Subscription(callback));\n return _this;\n }\n return FinallySubscriber;\n}(Subscriber_1.Subscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nfunction find(predicate, thisArg) {\n if (typeof predicate !== 'function') {\n throw new TypeError('predicate is not a function');\n }\n return function (source) { return source.lift(new FindValueOperator(predicate, source, false, thisArg)); };\n}\nexports.find = find;\nvar FindValueOperator = (function () {\n function FindValueOperator(predicate, source, yieldIndex, thisArg) {\n this.predicate = predicate;\n this.source = source;\n this.yieldIndex = yieldIndex;\n this.thisArg = thisArg;\n }\n FindValueOperator.prototype.call = function (observer, source) {\n return source.subscribe(new FindValueSubscriber(observer, this.predicate, this.source, this.yieldIndex, this.thisArg));\n };\n return FindValueOperator;\n}());\nexports.FindValueOperator = FindValueOperator;\nvar FindValueSubscriber = (function (_super) {\n __extends(FindValueSubscriber, _super);\n function FindValueSubscriber(destination, predicate, source, yieldIndex, thisArg) {\n var _this = _super.call(this, destination) || this;\n _this.predicate = predicate;\n _this.source = source;\n _this.yieldIndex = yieldIndex;\n _this.thisArg = thisArg;\n _this.index = 0;\n return _this;\n }\n FindValueSubscriber.prototype.notifyComplete = function (value) {\n var destination = this.destination;\n destination.next(value);\n destination.complete();\n this.unsubscribe();\n };\n FindValueSubscriber.prototype._next = function (value) {\n var _a = this, predicate = _a.predicate, thisArg = _a.thisArg;\n var index = this.index++;\n try {\n var result = predicate.call(thisArg || this, value, index, this.source);\n if (result) {\n this.notifyComplete(this.yieldIndex ? index : value);\n }\n }\n catch (err) {\n this.destination.error(err);\n }\n };\n FindValueSubscriber.prototype._complete = function () {\n this.notifyComplete(this.yieldIndex ? -1 : undefined);\n };\n return FindValueSubscriber;\n}(Subscriber_1.Subscriber));\nexports.FindValueSubscriber = FindValueSubscriber;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar find_1 = require(\"../operators/find\");\nfunction findIndex(predicate, thisArg) {\n return function (source) { return source.lift(new find_1.FindValueOperator(predicate, source, true, thisArg)); };\n}\nexports.findIndex = findIndex;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar EmptyError_1 = require(\"../util/EmptyError\");\nvar filter_1 = require(\"./filter\");\nvar take_1 = require(\"./take\");\nvar defaultIfEmpty_1 = require(\"./defaultIfEmpty\");\nvar throwIfEmpty_1 = require(\"./throwIfEmpty\");\nvar identity_1 = require(\"../util/identity\");\nfunction first(predicate, defaultValue) {\n var hasDefaultValue = arguments.length >= 2;\n return function (source) { return source.pipe(predicate ? filter_1.filter(function (v, i) { return predicate(v, i, source); }) : identity_1.identity, take_1.take(1), hasDefaultValue ? defaultIfEmpty_1.defaultIfEmpty(defaultValue) : throwIfEmpty_1.throwIfEmpty(function () { return new EmptyError_1.EmptyError(); })); };\n}\nexports.first = first;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nvar Subscription_1 = require(\"../Subscription\");\nvar Observable_1 = require(\"../Observable\");\nvar Subject_1 = require(\"../Subject\");\nfunction groupBy(keySelector, elementSelector, durationSelector, subjectSelector) {\n return function (source) {\n return source.lift(new GroupByOperator(keySelector, elementSelector, durationSelector, subjectSelector));\n };\n}\nexports.groupBy = groupBy;\nvar GroupByOperator = (function () {\n function GroupByOperator(keySelector, elementSelector, durationSelector, subjectSelector) {\n this.keySelector = keySelector;\n this.elementSelector = elementSelector;\n this.durationSelector = durationSelector;\n this.subjectSelector = subjectSelector;\n }\n GroupByOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new GroupBySubscriber(subscriber, this.keySelector, this.elementSelector, this.durationSelector, this.subjectSelector));\n };\n return GroupByOperator;\n}());\nvar GroupBySubscriber = (function (_super) {\n __extends(GroupBySubscriber, _super);\n function GroupBySubscriber(destination, keySelector, elementSelector, durationSelector, subjectSelector) {\n var _this = _super.call(this, destination) || this;\n _this.keySelector = keySelector;\n _this.elementSelector = elementSelector;\n _this.durationSelector = durationSelector;\n _this.subjectSelector = subjectSelector;\n _this.groups = null;\n _this.attemptedToUnsubscribe = false;\n _this.count = 0;\n return _this;\n }\n GroupBySubscriber.prototype._next = function (value) {\n var key;\n try {\n key = this.keySelector(value);\n }\n catch (err) {\n this.error(err);\n return;\n }\n this._group(value, key);\n };\n GroupBySubscriber.prototype._group = function (value, key) {\n var groups = this.groups;\n if (!groups) {\n groups = this.groups = new Map();\n }\n var group = groups.get(key);\n var element;\n if (this.elementSelector) {\n try {\n element = this.elementSelector(value);\n }\n catch (err) {\n this.error(err);\n }\n }\n else {\n element = value;\n }\n if (!group) {\n group = (this.subjectSelector ? this.subjectSelector() : new Subject_1.Subject());\n groups.set(key, group);\n var groupedObservable = new GroupedObservable(key, group, this);\n this.destination.next(groupedObservable);\n if (this.durationSelector) {\n var duration = void 0;\n try {\n duration = this.durationSelector(new GroupedObservable(key, group));\n }\n catch (err) {\n this.error(err);\n return;\n }\n this.add(duration.subscribe(new GroupDurationSubscriber(key, group, this)));\n }\n }\n if (!group.closed) {\n group.next(element);\n }\n };\n GroupBySubscriber.prototype._error = function (err) {\n var groups = this.groups;\n if (groups) {\n groups.forEach(function (group, key) {\n group.error(err);\n });\n groups.clear();\n }\n this.destination.error(err);\n };\n GroupBySubscriber.prototype._complete = function () {\n var groups = this.groups;\n if (groups) {\n groups.forEach(function (group, key) {\n group.complete();\n });\n groups.clear();\n }\n this.destination.complete();\n };\n GroupBySubscriber.prototype.removeGroup = function (key) {\n this.groups.delete(key);\n };\n GroupBySubscriber.prototype.unsubscribe = function () {\n if (!this.closed) {\n this.attemptedToUnsubscribe = true;\n if (this.count === 0) {\n _super.prototype.unsubscribe.call(this);\n }\n }\n };\n return GroupBySubscriber;\n}(Subscriber_1.Subscriber));\nvar GroupDurationSubscriber = (function (_super) {\n __extends(GroupDurationSubscriber, _super);\n function GroupDurationSubscriber(key, group, parent) {\n var _this = _super.call(this, group) || this;\n _this.key = key;\n _this.group = group;\n _this.parent = parent;\n return _this;\n }\n GroupDurationSubscriber.prototype._next = function (value) {\n this.complete();\n };\n GroupDurationSubscriber.prototype._unsubscribe = function () {\n var _a = this, parent = _a.parent, key = _a.key;\n this.key = this.parent = null;\n if (parent) {\n parent.removeGroup(key);\n }\n };\n return GroupDurationSubscriber;\n}(Subscriber_1.Subscriber));\nvar GroupedObservable = (function (_super) {\n __extends(GroupedObservable, _super);\n function GroupedObservable(key, groupSubject, refCountSubscription) {\n var _this = _super.call(this) || this;\n _this.key = key;\n _this.groupSubject = groupSubject;\n _this.refCountSubscription = refCountSubscription;\n return _this;\n }\n GroupedObservable.prototype._subscribe = function (subscriber) {\n var subscription = new Subscription_1.Subscription();\n var _a = this, refCountSubscription = _a.refCountSubscription, groupSubject = _a.groupSubject;\n if (refCountSubscription && !refCountSubscription.closed) {\n subscription.add(new InnerRefCountSubscription(refCountSubscription));\n }\n subscription.add(groupSubject.subscribe(subscriber));\n return subscription;\n };\n return GroupedObservable;\n}(Observable_1.Observable));\nexports.GroupedObservable = GroupedObservable;\nvar InnerRefCountSubscription = (function (_super) {\n __extends(InnerRefCountSubscription, _super);\n function InnerRefCountSubscription(parent) {\n var _this = _super.call(this) || this;\n _this.parent = parent;\n parent.count++;\n return _this;\n }\n InnerRefCountSubscription.prototype.unsubscribe = function () {\n var parent = this.parent;\n if (!parent.closed && !this.closed) {\n _super.prototype.unsubscribe.call(this);\n parent.count -= 1;\n if (parent.count === 0 && parent.attemptedToUnsubscribe) {\n parent.unsubscribe();\n }\n }\n };\n return InnerRefCountSubscription;\n}(Subscription_1.Subscription));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nfunction ignoreElements() {\n return function ignoreElementsOperatorFunction(source) {\n return source.lift(new IgnoreElementsOperator());\n };\n}\nexports.ignoreElements = ignoreElements;\nvar IgnoreElementsOperator = (function () {\n function IgnoreElementsOperator() {\n }\n IgnoreElementsOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new IgnoreElementsSubscriber(subscriber));\n };\n return IgnoreElementsOperator;\n}());\nvar IgnoreElementsSubscriber = (function (_super) {\n __extends(IgnoreElementsSubscriber, _super);\n function IgnoreElementsSubscriber() {\n return _super !== null && _super.apply(this, arguments) || this;\n }\n IgnoreElementsSubscriber.prototype._next = function (unused) {\n };\n return IgnoreElementsSubscriber;\n}(Subscriber_1.Subscriber));\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar audit_1 = require(\"./audit\");\nexports.audit = audit_1.audit;\nvar auditTime_1 = require(\"./auditTime\");\nexports.auditTime = auditTime_1.auditTime;\nvar buffer_1 = require(\"./buffer\");\nexports.buffer = buffer_1.buffer;\nvar bufferCount_1 = require(\"./bufferCount\");\nexports.bufferCount = bufferCount_1.bufferCount;\nvar bufferTime_1 = require(\"./bufferTime\");\nexports.bufferTime = bufferTime_1.bufferTime;\nvar bufferToggle_1 = require(\"./bufferToggle\");\nexports.bufferToggle = bufferToggle_1.bufferToggle;\nvar bufferWhen_1 = require(\"./bufferWhen\");\nexports.bufferWhen = bufferWhen_1.bufferWhen;\nvar catchError_1 = require(\"./catchError\");\nexports.catchError = catchError_1.catchError;\nvar combineAll_1 = require(\"./combineAll\");\nexports.combineAll = combineAll_1.combineAll;\nvar combineLatest_1 = require(\"./combineLatest\");\nexports.combineLatest = combineLatest_1.combineLatest;\nvar concat_1 = require(\"./concat\");\nexports.concat = concat_1.concat;\nvar concatAll_1 = require(\"./concatAll\");\nexports.concatAll = concatAll_1.concatAll;\nvar concatMap_1 = require(\"./concatMap\");\nexports.concatMap = concatMap_1.concatMap;\nvar concatMapTo_1 = require(\"./concatMapTo\");\nexports.concatMapTo = concatMapTo_1.concatMapTo;\nvar count_1 = require(\"./count\");\nexports.count = count_1.count;\nvar debounce_1 = require(\"./debounce\");\nexports.debounce = debounce_1.debounce;\nvar debounceTime_1 = require(\"./debounceTime\");\nexports.debounceTime = debounceTime_1.debounceTime;\nvar defaultIfEmpty_1 = require(\"./defaultIfEmpty\");\nexports.defaultIfEmpty = defaultIfEmpty_1.defaultIfEmpty;\nvar delay_1 = require(\"./delay\");\nexports.delay = delay_1.delay;\nvar delayWhen_1 = require(\"./delayWhen\");\nexports.delayWhen = delayWhen_1.delayWhen;\nvar dematerialize_1 = require(\"./dematerialize\");\nexports.dematerialize = dematerialize_1.dematerialize;\nvar distinct_1 = require(\"./distinct\");\nexports.distinct = distinct_1.distinct;\nvar distinctUntilChanged_1 = require(\"./distinctUntilChanged\");\nexports.distinctUntilChanged = distinctUntilChanged_1.distinctUntilChanged;\nvar distinctUntilKeyChanged_1 = require(\"./distinctUntilKeyChanged\");\nexports.distinctUntilKeyChanged = distinctUntilKeyChanged_1.distinctUntilKeyChanged;\nvar elementAt_1 = require(\"./elementAt\");\nexports.elementAt = elementAt_1.elementAt;\nvar every_1 = require(\"./every\");\nexports.every = every_1.every;\nvar exhaust_1 = require(\"./exhaust\");\nexports.exhaust = exhaust_1.exhaust;\nvar exhaustMap_1 = require(\"./exhaustMap\");\nexports.exhaustMap = exhaustMap_1.exhaustMap;\nvar expand_1 = require(\"./expand\");\nexports.expand = expand_1.expand;\nvar filter_1 = require(\"./filter\");\nexports.filter = filter_1.filter;\nvar finalize_1 = require(\"./finalize\");\nexports.finalize = finalize_1.finalize;\nvar find_1 = require(\"./find\");\nexports.find = find_1.find;\nvar findIndex_1 = require(\"./findIndex\");\nexports.findIndex = findIndex_1.findIndex;\nvar first_1 = require(\"./first\");\nexports.first = first_1.first;\nvar groupBy_1 = require(\"./groupBy\");\nexports.groupBy = groupBy_1.groupBy;\nvar ignoreElements_1 = require(\"./ignoreElements\");\nexports.ignoreElements = ignoreElements_1.ignoreElements;\nvar isEmpty_1 = require(\"./isEmpty\");\nexports.isEmpty = isEmpty_1.isEmpty;\nvar last_1 = require(\"./last\");\nexports.last = last_1.last;\nvar map_1 = require(\"./map\");\nexports.map = map_1.map;\nvar mapTo_1 = require(\"./mapTo\");\nexports.mapTo = mapTo_1.mapTo;\nvar materialize_1 = require(\"./materialize\");\nexports.materialize = materialize_1.materialize;\nvar max_1 = require(\"./max\");\nexports.max = max_1.max;\nvar merge_1 = require(\"./merge\");\nexports.merge = merge_1.merge;\nvar mergeAll_1 = require(\"./mergeAll\");\nexports.mergeAll = mergeAll_1.mergeAll;\nvar mergeMap_1 = require(\"./mergeMap\");\nexports.mergeMap = mergeMap_1.mergeMap;\nvar mergeMap_2 = require(\"./mergeMap\");\nexports.flatMap = mergeMap_2.mergeMap;\nvar mergeMapTo_1 = require(\"./mergeMapTo\");\nexports.mergeMapTo = mergeMapTo_1.mergeMapTo;\nvar mergeScan_1 = require(\"./mergeScan\");\nexports.mergeScan = mergeScan_1.mergeScan;\nvar min_1 = require(\"./min\");\nexports.min = min_1.min;\nvar multicast_1 = require(\"./multicast\");\nexports.multicast = multicast_1.multicast;\nvar observeOn_1 = require(\"./observeOn\");\nexports.observeOn = observeOn_1.observeOn;\nvar onErrorResumeNext_1 = require(\"./onErrorResumeNext\");\nexports.onErrorResumeNext = onErrorResumeNext_1.onErrorResumeNext;\nvar pairwise_1 = require(\"./pairwise\");\nexports.pairwise = pairwise_1.pairwise;\nvar partition_1 = require(\"./partition\");\nexports.partition = partition_1.partition;\nvar pluck_1 = require(\"./pluck\");\nexports.pluck = pluck_1.pluck;\nvar publish_1 = require(\"./publish\");\nexports.publish = publish_1.publish;\nvar publishBehavior_1 = require(\"./publishBehavior\");\nexports.publishBehavior = publishBehavior_1.publishBehavior;\nvar publishLast_1 = require(\"./publishLast\");\nexports.publishLast = publishLast_1.publishLast;\nvar publishReplay_1 = require(\"./publishReplay\");\nexports.publishReplay = publishReplay_1.publishReplay;\nvar race_1 = require(\"./race\");\nexports.race = race_1.race;\nvar reduce_1 = require(\"./reduce\");\nexports.reduce = reduce_1.reduce;\nvar repeat_1 = require(\"./repeat\");\nexports.repeat = repeat_1.repeat;\nvar repeatWhen_1 = require(\"./repeatWhen\");\nexports.repeatWhen = repeatWhen_1.repeatWhen;\nvar retry_1 = require(\"./retry\");\nexports.retry = retry_1.retry;\nvar retryWhen_1 = require(\"./retryWhen\");\nexports.retryWhen = retryWhen_1.retryWhen;\nvar refCount_1 = require(\"./refCount\");\nexports.refCount = refCount_1.refCount;\nvar sample_1 = require(\"./sample\");\nexports.sample = sample_1.sample;\nvar sampleTime_1 = require(\"./sampleTime\");\nexports.sampleTime = sampleTime_1.sampleTime;\nvar scan_1 = require(\"./scan\");\nexports.scan = scan_1.scan;\nvar sequenceEqual_1 = require(\"./sequenceEqual\");\nexports.sequenceEqual = sequenceEqual_1.sequenceEqual;\nvar share_1 = require(\"./share\");\nexports.share = share_1.share;\nvar shareReplay_1 = require(\"./shareReplay\");\nexports.shareReplay = shareReplay_1.shareReplay;\nvar single_1 = require(\"./single\");\nexports.single = single_1.single;\nvar skip_1 = require(\"./skip\");\nexports.skip = skip_1.skip;\nvar skipLast_1 = require(\"./skipLast\");\nexports.skipLast = skipLast_1.skipLast;\nvar skipUntil_1 = require(\"./skipUntil\");\nexports.skipUntil = skipUntil_1.skipUntil;\nvar skipWhile_1 = require(\"./skipWhile\");\nexports.skipWhile = skipWhile_1.skipWhile;\nvar startWith_1 = require(\"./startWith\");\nexports.startWith = startWith_1.startWith;\nvar subscribeOn_1 = require(\"./subscribeOn\");\nexports.subscribeOn = subscribeOn_1.subscribeOn;\nvar switchAll_1 = require(\"./switchAll\");\nexports.switchAll = switchAll_1.switchAll;\nvar switchMap_1 = require(\"./switchMap\");\nexports.switchMap = switchMap_1.switchMap;\nvar switchMapTo_1 = require(\"./switchMapTo\");\nexports.switchMapTo = switchMapTo_1.switchMapTo;\nvar take_1 = require(\"./take\");\nexports.take = take_1.take;\nvar takeLast_1 = require(\"./takeLast\");\nexports.takeLast = takeLast_1.takeLast;\nvar takeUntil_1 = require(\"./takeUntil\");\nexports.takeUntil = takeUntil_1.takeUntil;\nvar takeWhile_1 = require(\"./takeWhile\");\nexports.takeWhile = takeWhile_1.takeWhile;\nvar tap_1 = require(\"./tap\");\nexports.tap = tap_1.tap;\nvar throttle_1 = require(\"./throttle\");\nexports.throttle = throttle_1.throttle;\nvar throttleTime_1 = require(\"./throttleTime\");\nexports.throttleTime = throttleTime_1.throttleTime;\nvar timeInterval_1 = require(\"./timeInterval\");\nexports.timeInterval = timeInterval_1.timeInterval;\nvar timeout_1 = require(\"./timeout\");\nexports.timeout = timeout_1.timeout;\nvar timeoutWith_1 = require(\"./timeoutWith\");\nexports.timeoutWith = timeoutWith_1.timeoutWith;\nvar timestamp_1 = require(\"./timestamp\");\nexports.timestamp = timestamp_1.timestamp;\nvar toArray_1 = require(\"./toArray\");\nexports.toArray = toArray_1.toArray;\nvar window_1 = require(\"./window\");\nexports.window = window_1.window;\nvar windowCount_1 = require(\"./windowCount\");\nexports.windowCount = windowCount_1.windowCount;\nvar windowTime_1 = require(\"./windowTime\");\nexports.windowTime = windowTime_1.windowTime;\nvar windowToggle_1 = require(\"./windowToggle\");\nexports.windowToggle = windowToggle_1.windowToggle;\nvar windowWhen_1 = require(\"./windowWhen\");\nexports.windowWhen = windowWhen_1.windowWhen;\nvar withLatestFrom_1 = require(\"./withLatestFrom\");\nexports.withLatestFrom = withLatestFrom_1.withLatestFrom;\nvar zip_1 = require(\"./zip\");\nexports.zip = zip_1.zip;\nvar zipAll_1 = require(\"./zipAll\");\nexports.zipAll = zipAll_1.zipAll;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nfunction isEmpty() {\n return function (source) { return source.lift(new IsEmptyOperator()); };\n}\nexports.isEmpty = isEmpty;\nvar IsEmptyOperator = (function () {\n function IsEmptyOperator() {\n }\n IsEmptyOperator.prototype.call = function (observer, source) {\n return source.subscribe(new IsEmptySubscriber(observer));\n };\n return IsEmptyOperator;\n}());\nvar IsEmptySubscriber = (function (_super) {\n __extends(IsEmptySubscriber, _super);\n function IsEmptySubscriber(destination) {\n return _super.call(this, destination) || this;\n }\n IsEmptySubscriber.prototype.notifyComplete = function (isEmpty) {\n var destination = this.destination;\n destination.next(isEmpty);\n destination.complete();\n };\n IsEmptySubscriber.prototype._next = function (value) {\n this.notifyComplete(false);\n };\n IsEmptySubscriber.prototype._complete = function () {\n this.notifyComplete(true);\n };\n return IsEmptySubscriber;\n}(Subscriber_1.Subscriber));\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar EmptyError_1 = require(\"../util/EmptyError\");\nvar filter_1 = require(\"./filter\");\nvar takeLast_1 = require(\"./takeLast\");\nvar throwIfEmpty_1 = require(\"./throwIfEmpty\");\nvar defaultIfEmpty_1 = require(\"./defaultIfEmpty\");\nvar identity_1 = require(\"../util/identity\");\nfunction last(predicate, defaultValue) {\n var hasDefaultValue = arguments.length >= 2;\n return function (source) { return source.pipe(predicate ? filter_1.filter(function (v, i) { return predicate(v, i, source); }) : identity_1.identity, takeLast_1.takeLast(1), hasDefaultValue ? defaultIfEmpty_1.defaultIfEmpty(defaultValue) : throwIfEmpty_1.throwIfEmpty(function () { return new EmptyError_1.EmptyError(); })); };\n}\nexports.last = last;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nfunction map(project, thisArg) {\n return function mapOperation(source) {\n if (typeof project !== 'function') {\n throw new TypeError('argument is not a function. Are you looking for `mapTo()`?');\n }\n return source.lift(new MapOperator(project, thisArg));\n };\n}\nexports.map = map;\nvar MapOperator = (function () {\n function MapOperator(project, thisArg) {\n this.project = project;\n this.thisArg = thisArg;\n }\n MapOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new MapSubscriber(subscriber, this.project, this.thisArg));\n };\n return MapOperator;\n}());\nexports.MapOperator = MapOperator;\nvar MapSubscriber = (function (_super) {\n __extends(MapSubscriber, _super);\n function MapSubscriber(destination, project, thisArg) {\n var _this = _super.call(this, destination) || this;\n _this.project = project;\n _this.count = 0;\n _this.thisArg = thisArg || _this;\n return _this;\n }\n MapSubscriber.prototype._next = function (value) {\n var result;\n try {\n result = this.project.call(this.thisArg, value, this.count++);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.next(result);\n };\n return MapSubscriber;\n}(Subscriber_1.Subscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nfunction mapTo(value) {\n return function (source) { return source.lift(new MapToOperator(value)); };\n}\nexports.mapTo = mapTo;\nvar MapToOperator = (function () {\n function MapToOperator(value) {\n this.value = value;\n }\n MapToOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new MapToSubscriber(subscriber, this.value));\n };\n return MapToOperator;\n}());\nvar MapToSubscriber = (function (_super) {\n __extends(MapToSubscriber, _super);\n function MapToSubscriber(destination, value) {\n var _this = _super.call(this, destination) || this;\n _this.value = value;\n return _this;\n }\n MapToSubscriber.prototype._next = function (x) {\n this.destination.next(this.value);\n };\n return MapToSubscriber;\n}(Subscriber_1.Subscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nvar Notification_1 = require(\"../Notification\");\nfunction materialize() {\n return function materializeOperatorFunction(source) {\n return source.lift(new MaterializeOperator());\n };\n}\nexports.materialize = materialize;\nvar MaterializeOperator = (function () {\n function MaterializeOperator() {\n }\n MaterializeOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new MaterializeSubscriber(subscriber));\n };\n return MaterializeOperator;\n}());\nvar MaterializeSubscriber = (function (_super) {\n __extends(MaterializeSubscriber, _super);\n function MaterializeSubscriber(destination) {\n return _super.call(this, destination) || this;\n }\n MaterializeSubscriber.prototype._next = function (value) {\n this.destination.next(Notification_1.Notification.createNext(value));\n };\n MaterializeSubscriber.prototype._error = function (err) {\n var destination = this.destination;\n destination.next(Notification_1.Notification.createError(err));\n destination.complete();\n };\n MaterializeSubscriber.prototype._complete = function () {\n var destination = this.destination;\n destination.next(Notification_1.Notification.createComplete());\n destination.complete();\n };\n return MaterializeSubscriber;\n}(Subscriber_1.Subscriber));\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar reduce_1 = require(\"./reduce\");\nfunction max(comparer) {\n var max = (typeof comparer === 'function')\n ? function (x, y) { return comparer(x, y) > 0 ? x : y; }\n : function (x, y) { return x > y ? x : y; };\n return reduce_1.reduce(max);\n}\nexports.max = max;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar merge_1 = require(\"../observable/merge\");\nfunction merge() {\n var observables = [];\n for (var _i = 0; _i < arguments.length; _i++) {\n observables[_i] = arguments[_i];\n }\n return function (source) { return source.lift.call(merge_1.merge.apply(void 0, [source].concat(observables))); };\n}\nexports.merge = merge;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar mergeMap_1 = require(\"./mergeMap\");\nvar identity_1 = require(\"../util/identity\");\nfunction mergeAll(concurrent) {\n if (concurrent === void 0) { concurrent = Number.POSITIVE_INFINITY; }\n return mergeMap_1.mergeMap(identity_1.identity, concurrent);\n}\nexports.mergeAll = mergeAll;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar map_1 = require(\"./map\");\nvar from_1 = require(\"../observable/from\");\nvar innerSubscribe_1 = require(\"../innerSubscribe\");\nfunction mergeMap(project, resultSelector, concurrent) {\n if (concurrent === void 0) { concurrent = Number.POSITIVE_INFINITY; }\n if (typeof resultSelector === 'function') {\n return function (source) { return source.pipe(mergeMap(function (a, i) { return from_1.from(project(a, i)).pipe(map_1.map(function (b, ii) { return resultSelector(a, b, i, ii); })); }, concurrent)); };\n }\n else if (typeof resultSelector === 'number') {\n concurrent = resultSelector;\n }\n return function (source) { return source.lift(new MergeMapOperator(project, concurrent)); };\n}\nexports.mergeMap = mergeMap;\nvar MergeMapOperator = (function () {\n function MergeMapOperator(project, concurrent) {\n if (concurrent === void 0) { concurrent = Number.POSITIVE_INFINITY; }\n this.project = project;\n this.concurrent = concurrent;\n }\n MergeMapOperator.prototype.call = function (observer, source) {\n return source.subscribe(new MergeMapSubscriber(observer, this.project, this.concurrent));\n };\n return MergeMapOperator;\n}());\nexports.MergeMapOperator = MergeMapOperator;\nvar MergeMapSubscriber = (function (_super) {\n __extends(MergeMapSubscriber, _super);\n function MergeMapSubscriber(destination, project, concurrent) {\n if (concurrent === void 0) { concurrent = Number.POSITIVE_INFINITY; }\n var _this = _super.call(this, destination) || this;\n _this.project = project;\n _this.concurrent = concurrent;\n _this.hasCompleted = false;\n _this.buffer = [];\n _this.active = 0;\n _this.index = 0;\n return _this;\n }\n MergeMapSubscriber.prototype._next = function (value) {\n if (this.active < this.concurrent) {\n this._tryNext(value);\n }\n else {\n this.buffer.push(value);\n }\n };\n MergeMapSubscriber.prototype._tryNext = function (value) {\n var result;\n var index = this.index++;\n try {\n result = this.project(value, index);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.active++;\n this._innerSub(result);\n };\n MergeMapSubscriber.prototype._innerSub = function (ish) {\n var innerSubscriber = new innerSubscribe_1.SimpleInnerSubscriber(this);\n var destination = this.destination;\n destination.add(innerSubscriber);\n var innerSubscription = innerSubscribe_1.innerSubscribe(ish, innerSubscriber);\n if (innerSubscription !== innerSubscriber) {\n destination.add(innerSubscription);\n }\n };\n MergeMapSubscriber.prototype._complete = function () {\n this.hasCompleted = true;\n if (this.active === 0 && this.buffer.length === 0) {\n this.destination.complete();\n }\n this.unsubscribe();\n };\n MergeMapSubscriber.prototype.notifyNext = function (innerValue) {\n this.destination.next(innerValue);\n };\n MergeMapSubscriber.prototype.notifyComplete = function () {\n var buffer = this.buffer;\n this.active--;\n if (buffer.length > 0) {\n this._next(buffer.shift());\n }\n else if (this.active === 0 && this.hasCompleted) {\n this.destination.complete();\n }\n };\n return MergeMapSubscriber;\n}(innerSubscribe_1.SimpleOuterSubscriber));\nexports.MergeMapSubscriber = MergeMapSubscriber;\nexports.flatMap = mergeMap;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar mergeMap_1 = require(\"./mergeMap\");\nfunction mergeMapTo(innerObservable, resultSelector, concurrent) {\n if (concurrent === void 0) { concurrent = Number.POSITIVE_INFINITY; }\n if (typeof resultSelector === 'function') {\n return mergeMap_1.mergeMap(function () { return innerObservable; }, resultSelector, concurrent);\n }\n if (typeof resultSelector === 'number') {\n concurrent = resultSelector;\n }\n return mergeMap_1.mergeMap(function () { return innerObservable; }, concurrent);\n}\nexports.mergeMapTo = mergeMapTo;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar innerSubscribe_1 = require(\"../innerSubscribe\");\nfunction mergeScan(accumulator, seed, concurrent) {\n if (concurrent === void 0) { concurrent = Number.POSITIVE_INFINITY; }\n return function (source) { return source.lift(new MergeScanOperator(accumulator, seed, concurrent)); };\n}\nexports.mergeScan = mergeScan;\nvar MergeScanOperator = (function () {\n function MergeScanOperator(accumulator, seed, concurrent) {\n this.accumulator = accumulator;\n this.seed = seed;\n this.concurrent = concurrent;\n }\n MergeScanOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new MergeScanSubscriber(subscriber, this.accumulator, this.seed, this.concurrent));\n };\n return MergeScanOperator;\n}());\nexports.MergeScanOperator = MergeScanOperator;\nvar MergeScanSubscriber = (function (_super) {\n __extends(MergeScanSubscriber, _super);\n function MergeScanSubscriber(destination, accumulator, acc, concurrent) {\n var _this = _super.call(this, destination) || this;\n _this.accumulator = accumulator;\n _this.acc = acc;\n _this.concurrent = concurrent;\n _this.hasValue = false;\n _this.hasCompleted = false;\n _this.buffer = [];\n _this.active = 0;\n _this.index = 0;\n return _this;\n }\n MergeScanSubscriber.prototype._next = function (value) {\n if (this.active < this.concurrent) {\n var index = this.index++;\n var destination = this.destination;\n var ish = void 0;\n try {\n var accumulator = this.accumulator;\n ish = accumulator(this.acc, value, index);\n }\n catch (e) {\n return destination.error(e);\n }\n this.active++;\n this._innerSub(ish);\n }\n else {\n this.buffer.push(value);\n }\n };\n MergeScanSubscriber.prototype._innerSub = function (ish) {\n var innerSubscriber = new innerSubscribe_1.SimpleInnerSubscriber(this);\n var destination = this.destination;\n destination.add(innerSubscriber);\n var innerSubscription = innerSubscribe_1.innerSubscribe(ish, innerSubscriber);\n if (innerSubscription !== innerSubscriber) {\n destination.add(innerSubscription);\n }\n };\n MergeScanSubscriber.prototype._complete = function () {\n this.hasCompleted = true;\n if (this.active === 0 && this.buffer.length === 0) {\n if (this.hasValue === false) {\n this.destination.next(this.acc);\n }\n this.destination.complete();\n }\n this.unsubscribe();\n };\n MergeScanSubscriber.prototype.notifyNext = function (innerValue) {\n var destination = this.destination;\n this.acc = innerValue;\n this.hasValue = true;\n destination.next(innerValue);\n };\n MergeScanSubscriber.prototype.notifyComplete = function () {\n var buffer = this.buffer;\n this.active--;\n if (buffer.length > 0) {\n this._next(buffer.shift());\n }\n else if (this.active === 0 && this.hasCompleted) {\n if (this.hasValue === false) {\n this.destination.next(this.acc);\n }\n this.destination.complete();\n }\n };\n return MergeScanSubscriber;\n}(innerSubscribe_1.SimpleOuterSubscriber));\nexports.MergeScanSubscriber = MergeScanSubscriber;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar reduce_1 = require(\"./reduce\");\nfunction min(comparer) {\n var min = (typeof comparer === 'function')\n ? function (x, y) { return comparer(x, y) < 0 ? x : y; }\n : function (x, y) { return x < y ? x : y; };\n return reduce_1.reduce(min);\n}\nexports.min = min;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar ConnectableObservable_1 = require(\"../observable/ConnectableObservable\");\nfunction multicast(subjectOrSubjectFactory, selector) {\n return function multicastOperatorFunction(source) {\n var subjectFactory;\n if (typeof subjectOrSubjectFactory === 'function') {\n subjectFactory = subjectOrSubjectFactory;\n }\n else {\n subjectFactory = function subjectFactory() {\n return subjectOrSubjectFactory;\n };\n }\n if (typeof selector === 'function') {\n return source.lift(new MulticastOperator(subjectFactory, selector));\n }\n var connectable = Object.create(source, ConnectableObservable_1.connectableObservableDescriptor);\n connectable.source = source;\n connectable.subjectFactory = subjectFactory;\n return connectable;\n };\n}\nexports.multicast = multicast;\nvar MulticastOperator = (function () {\n function MulticastOperator(subjectFactory, selector) {\n this.subjectFactory = subjectFactory;\n this.selector = selector;\n }\n MulticastOperator.prototype.call = function (subscriber, source) {\n var selector = this.selector;\n var subject = this.subjectFactory();\n var subscription = selector(subject).subscribe(subscriber);\n subscription.add(source.subscribe(subject));\n return subscription;\n };\n return MulticastOperator;\n}());\nexports.MulticastOperator = MulticastOperator;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nvar Notification_1 = require(\"../Notification\");\nfunction observeOn(scheduler, delay) {\n if (delay === void 0) { delay = 0; }\n return function observeOnOperatorFunction(source) {\n return source.lift(new ObserveOnOperator(scheduler, delay));\n };\n}\nexports.observeOn = observeOn;\nvar ObserveOnOperator = (function () {\n function ObserveOnOperator(scheduler, delay) {\n if (delay === void 0) { delay = 0; }\n this.scheduler = scheduler;\n this.delay = delay;\n }\n ObserveOnOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new ObserveOnSubscriber(subscriber, this.scheduler, this.delay));\n };\n return ObserveOnOperator;\n}());\nexports.ObserveOnOperator = ObserveOnOperator;\nvar ObserveOnSubscriber = (function (_super) {\n __extends(ObserveOnSubscriber, _super);\n function ObserveOnSubscriber(destination, scheduler, delay) {\n if (delay === void 0) { delay = 0; }\n var _this = _super.call(this, destination) || this;\n _this.scheduler = scheduler;\n _this.delay = delay;\n return _this;\n }\n ObserveOnSubscriber.dispatch = function (arg) {\n var notification = arg.notification, destination = arg.destination;\n notification.observe(destination);\n this.unsubscribe();\n };\n ObserveOnSubscriber.prototype.scheduleMessage = function (notification) {\n var destination = this.destination;\n destination.add(this.scheduler.schedule(ObserveOnSubscriber.dispatch, this.delay, new ObserveOnMessage(notification, this.destination)));\n };\n ObserveOnSubscriber.prototype._next = function (value) {\n this.scheduleMessage(Notification_1.Notification.createNext(value));\n };\n ObserveOnSubscriber.prototype._error = function (err) {\n this.scheduleMessage(Notification_1.Notification.createError(err));\n this.unsubscribe();\n };\n ObserveOnSubscriber.prototype._complete = function () {\n this.scheduleMessage(Notification_1.Notification.createComplete());\n this.unsubscribe();\n };\n return ObserveOnSubscriber;\n}(Subscriber_1.Subscriber));\nexports.ObserveOnSubscriber = ObserveOnSubscriber;\nvar ObserveOnMessage = (function () {\n function ObserveOnMessage(notification, destination) {\n this.notification = notification;\n this.destination = destination;\n }\n return ObserveOnMessage;\n}());\nexports.ObserveOnMessage = ObserveOnMessage;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar from_1 = require(\"../observable/from\");\nvar isArray_1 = require(\"../util/isArray\");\nvar innerSubscribe_1 = require(\"../innerSubscribe\");\nfunction onErrorResumeNext() {\n var nextSources = [];\n for (var _i = 0; _i < arguments.length; _i++) {\n nextSources[_i] = arguments[_i];\n }\n if (nextSources.length === 1 && isArray_1.isArray(nextSources[0])) {\n nextSources = nextSources[0];\n }\n return function (source) { return source.lift(new OnErrorResumeNextOperator(nextSources)); };\n}\nexports.onErrorResumeNext = onErrorResumeNext;\nfunction onErrorResumeNextStatic() {\n var nextSources = [];\n for (var _i = 0; _i < arguments.length; _i++) {\n nextSources[_i] = arguments[_i];\n }\n var source = undefined;\n if (nextSources.length === 1 && isArray_1.isArray(nextSources[0])) {\n nextSources = nextSources[0];\n }\n source = nextSources.shift();\n return from_1.from(source).lift(new OnErrorResumeNextOperator(nextSources));\n}\nexports.onErrorResumeNextStatic = onErrorResumeNextStatic;\nvar OnErrorResumeNextOperator = (function () {\n function OnErrorResumeNextOperator(nextSources) {\n this.nextSources = nextSources;\n }\n OnErrorResumeNextOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new OnErrorResumeNextSubscriber(subscriber, this.nextSources));\n };\n return OnErrorResumeNextOperator;\n}());\nvar OnErrorResumeNextSubscriber = (function (_super) {\n __extends(OnErrorResumeNextSubscriber, _super);\n function OnErrorResumeNextSubscriber(destination, nextSources) {\n var _this = _super.call(this, destination) || this;\n _this.destination = destination;\n _this.nextSources = nextSources;\n return _this;\n }\n OnErrorResumeNextSubscriber.prototype.notifyError = function () {\n this.subscribeToNextSource();\n };\n OnErrorResumeNextSubscriber.prototype.notifyComplete = function () {\n this.subscribeToNextSource();\n };\n OnErrorResumeNextSubscriber.prototype._error = function (err) {\n this.subscribeToNextSource();\n this.unsubscribe();\n };\n OnErrorResumeNextSubscriber.prototype._complete = function () {\n this.subscribeToNextSource();\n this.unsubscribe();\n };\n OnErrorResumeNextSubscriber.prototype.subscribeToNextSource = function () {\n var next = this.nextSources.shift();\n if (!!next) {\n var innerSubscriber = new innerSubscribe_1.SimpleInnerSubscriber(this);\n var destination = this.destination;\n destination.add(innerSubscriber);\n var innerSubscription = innerSubscribe_1.innerSubscribe(next, innerSubscriber);\n if (innerSubscription !== innerSubscriber) {\n destination.add(innerSubscription);\n }\n }\n else {\n this.destination.complete();\n }\n };\n return OnErrorResumeNextSubscriber;\n}(innerSubscribe_1.SimpleOuterSubscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nfunction pairwise() {\n return function (source) { return source.lift(new PairwiseOperator()); };\n}\nexports.pairwise = pairwise;\nvar PairwiseOperator = (function () {\n function PairwiseOperator() {\n }\n PairwiseOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new PairwiseSubscriber(subscriber));\n };\n return PairwiseOperator;\n}());\nvar PairwiseSubscriber = (function (_super) {\n __extends(PairwiseSubscriber, _super);\n function PairwiseSubscriber(destination) {\n var _this = _super.call(this, destination) || this;\n _this.hasPrev = false;\n return _this;\n }\n PairwiseSubscriber.prototype._next = function (value) {\n var pair;\n if (this.hasPrev) {\n pair = [this.prev, value];\n }\n else {\n this.hasPrev = true;\n }\n this.prev = value;\n if (pair) {\n this.destination.next(pair);\n }\n };\n return PairwiseSubscriber;\n}(Subscriber_1.Subscriber));\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar not_1 = require(\"../util/not\");\nvar filter_1 = require(\"./filter\");\nfunction partition(predicate, thisArg) {\n return function (source) { return [\n filter_1.filter(predicate, thisArg)(source),\n filter_1.filter(not_1.not(predicate, thisArg))(source)\n ]; };\n}\nexports.partition = partition;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar map_1 = require(\"./map\");\nfunction pluck() {\n var properties = [];\n for (var _i = 0; _i < arguments.length; _i++) {\n properties[_i] = arguments[_i];\n }\n var length = properties.length;\n if (length === 0) {\n throw new Error('list of properties cannot be empty.');\n }\n return function (source) { return map_1.map(plucker(properties, length))(source); };\n}\nexports.pluck = pluck;\nfunction plucker(props, length) {\n var mapper = function (x) {\n var currentProp = x;\n for (var i = 0; i < length; i++) {\n var p = currentProp != null ? currentProp[props[i]] : undefined;\n if (p !== void 0) {\n currentProp = p;\n }\n else {\n return undefined;\n }\n }\n return currentProp;\n };\n return mapper;\n}\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subject_1 = require(\"../Subject\");\nvar multicast_1 = require(\"./multicast\");\nfunction publish(selector) {\n return selector ?\n multicast_1.multicast(function () { return new Subject_1.Subject(); }, selector) :\n multicast_1.multicast(new Subject_1.Subject());\n}\nexports.publish = publish;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar BehaviorSubject_1 = require(\"../BehaviorSubject\");\nvar multicast_1 = require(\"./multicast\");\nfunction publishBehavior(value) {\n return function (source) { return multicast_1.multicast(new BehaviorSubject_1.BehaviorSubject(value))(source); };\n}\nexports.publishBehavior = publishBehavior;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar AsyncSubject_1 = require(\"../AsyncSubject\");\nvar multicast_1 = require(\"./multicast\");\nfunction publishLast() {\n return function (source) { return multicast_1.multicast(new AsyncSubject_1.AsyncSubject())(source); };\n}\nexports.publishLast = publishLast;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar ReplaySubject_1 = require(\"../ReplaySubject\");\nvar multicast_1 = require(\"./multicast\");\nfunction publishReplay(bufferSize, windowTime, selectorOrScheduler, scheduler) {\n if (selectorOrScheduler && typeof selectorOrScheduler !== 'function') {\n scheduler = selectorOrScheduler;\n }\n var selector = typeof selectorOrScheduler === 'function' ? selectorOrScheduler : undefined;\n var subject = new ReplaySubject_1.ReplaySubject(bufferSize, windowTime, scheduler);\n return function (source) { return multicast_1.multicast(function () { return subject; }, selector)(source); };\n}\nexports.publishReplay = publishReplay;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar isArray_1 = require(\"../util/isArray\");\nvar race_1 = require(\"../observable/race\");\nfunction race() {\n var observables = [];\n for (var _i = 0; _i < arguments.length; _i++) {\n observables[_i] = arguments[_i];\n }\n return function raceOperatorFunction(source) {\n if (observables.length === 1 && isArray_1.isArray(observables[0])) {\n observables = observables[0];\n }\n return source.lift.call(race_1.race.apply(void 0, [source].concat(observables)));\n };\n}\nexports.race = race;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar scan_1 = require(\"./scan\");\nvar takeLast_1 = require(\"./takeLast\");\nvar defaultIfEmpty_1 = require(\"./defaultIfEmpty\");\nvar pipe_1 = require(\"../util/pipe\");\nfunction reduce(accumulator, seed) {\n if (arguments.length >= 2) {\n return function reduceOperatorFunctionWithSeed(source) {\n return pipe_1.pipe(scan_1.scan(accumulator, seed), takeLast_1.takeLast(1), defaultIfEmpty_1.defaultIfEmpty(seed))(source);\n };\n }\n return function reduceOperatorFunction(source) {\n return pipe_1.pipe(scan_1.scan(function (acc, value, index) { return accumulator(acc, value, index + 1); }), takeLast_1.takeLast(1))(source);\n };\n}\nexports.reduce = reduce;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nfunction refCount() {\n return function refCountOperatorFunction(source) {\n return source.lift(new RefCountOperator(source));\n };\n}\nexports.refCount = refCount;\nvar RefCountOperator = (function () {\n function RefCountOperator(connectable) {\n this.connectable = connectable;\n }\n RefCountOperator.prototype.call = function (subscriber, source) {\n var connectable = this.connectable;\n connectable._refCount++;\n var refCounter = new RefCountSubscriber(subscriber, connectable);\n var subscription = source.subscribe(refCounter);\n if (!refCounter.closed) {\n refCounter.connection = connectable.connect();\n }\n return subscription;\n };\n return RefCountOperator;\n}());\nvar RefCountSubscriber = (function (_super) {\n __extends(RefCountSubscriber, _super);\n function RefCountSubscriber(destination, connectable) {\n var _this = _super.call(this, destination) || this;\n _this.connectable = connectable;\n return _this;\n }\n RefCountSubscriber.prototype._unsubscribe = function () {\n var connectable = this.connectable;\n if (!connectable) {\n this.connection = null;\n return;\n }\n this.connectable = null;\n var refCount = connectable._refCount;\n if (refCount <= 0) {\n this.connection = null;\n return;\n }\n connectable._refCount = refCount - 1;\n if (refCount > 1) {\n this.connection = null;\n return;\n }\n var connection = this.connection;\n var sharedConnection = connectable._connection;\n this.connection = null;\n if (sharedConnection && (!connection || sharedConnection === connection)) {\n sharedConnection.unsubscribe();\n }\n };\n return RefCountSubscriber;\n}(Subscriber_1.Subscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nvar empty_1 = require(\"../observable/empty\");\nfunction repeat(count) {\n if (count === void 0) { count = -1; }\n return function (source) {\n if (count === 0) {\n return empty_1.empty();\n }\n else if (count < 0) {\n return source.lift(new RepeatOperator(-1, source));\n }\n else {\n return source.lift(new RepeatOperator(count - 1, source));\n }\n };\n}\nexports.repeat = repeat;\nvar RepeatOperator = (function () {\n function RepeatOperator(count, source) {\n this.count = count;\n this.source = source;\n }\n RepeatOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new RepeatSubscriber(subscriber, this.count, this.source));\n };\n return RepeatOperator;\n}());\nvar RepeatSubscriber = (function (_super) {\n __extends(RepeatSubscriber, _super);\n function RepeatSubscriber(destination, count, source) {\n var _this = _super.call(this, destination) || this;\n _this.count = count;\n _this.source = source;\n return _this;\n }\n RepeatSubscriber.prototype.complete = function () {\n if (!this.isStopped) {\n var _a = this, source = _a.source, count = _a.count;\n if (count === 0) {\n return _super.prototype.complete.call(this);\n }\n else if (count > -1) {\n this.count = count - 1;\n }\n source.subscribe(this._unsubscribeAndRecycle());\n }\n };\n return RepeatSubscriber;\n}(Subscriber_1.Subscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subject_1 = require(\"../Subject\");\nvar innerSubscribe_1 = require(\"../innerSubscribe\");\nfunction repeatWhen(notifier) {\n return function (source) { return source.lift(new RepeatWhenOperator(notifier)); };\n}\nexports.repeatWhen = repeatWhen;\nvar RepeatWhenOperator = (function () {\n function RepeatWhenOperator(notifier) {\n this.notifier = notifier;\n }\n RepeatWhenOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new RepeatWhenSubscriber(subscriber, this.notifier, source));\n };\n return RepeatWhenOperator;\n}());\nvar RepeatWhenSubscriber = (function (_super) {\n __extends(RepeatWhenSubscriber, _super);\n function RepeatWhenSubscriber(destination, notifier, source) {\n var _this = _super.call(this, destination) || this;\n _this.notifier = notifier;\n _this.source = source;\n _this.sourceIsBeingSubscribedTo = true;\n return _this;\n }\n RepeatWhenSubscriber.prototype.notifyNext = function () {\n this.sourceIsBeingSubscribedTo = true;\n this.source.subscribe(this);\n };\n RepeatWhenSubscriber.prototype.notifyComplete = function () {\n if (this.sourceIsBeingSubscribedTo === false) {\n return _super.prototype.complete.call(this);\n }\n };\n RepeatWhenSubscriber.prototype.complete = function () {\n this.sourceIsBeingSubscribedTo = false;\n if (!this.isStopped) {\n if (!this.retries) {\n this.subscribeToRetries();\n }\n if (!this.retriesSubscription || this.retriesSubscription.closed) {\n return _super.prototype.complete.call(this);\n }\n this._unsubscribeAndRecycle();\n this.notifications.next(undefined);\n }\n };\n RepeatWhenSubscriber.prototype._unsubscribe = function () {\n var _a = this, notifications = _a.notifications, retriesSubscription = _a.retriesSubscription;\n if (notifications) {\n notifications.unsubscribe();\n this.notifications = undefined;\n }\n if (retriesSubscription) {\n retriesSubscription.unsubscribe();\n this.retriesSubscription = undefined;\n }\n this.retries = undefined;\n };\n RepeatWhenSubscriber.prototype._unsubscribeAndRecycle = function () {\n var _unsubscribe = this._unsubscribe;\n this._unsubscribe = null;\n _super.prototype._unsubscribeAndRecycle.call(this);\n this._unsubscribe = _unsubscribe;\n return this;\n };\n RepeatWhenSubscriber.prototype.subscribeToRetries = function () {\n this.notifications = new Subject_1.Subject();\n var retries;\n try {\n var notifier = this.notifier;\n retries = notifier(this.notifications);\n }\n catch (e) {\n return _super.prototype.complete.call(this);\n }\n this.retries = retries;\n this.retriesSubscription = innerSubscribe_1.innerSubscribe(retries, new innerSubscribe_1.SimpleInnerSubscriber(this));\n };\n return RepeatWhenSubscriber;\n}(innerSubscribe_1.SimpleOuterSubscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nfunction retry(count) {\n if (count === void 0) { count = -1; }\n return function (source) { return source.lift(new RetryOperator(count, source)); };\n}\nexports.retry = retry;\nvar RetryOperator = (function () {\n function RetryOperator(count, source) {\n this.count = count;\n this.source = source;\n }\n RetryOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new RetrySubscriber(subscriber, this.count, this.source));\n };\n return RetryOperator;\n}());\nvar RetrySubscriber = (function (_super) {\n __extends(RetrySubscriber, _super);\n function RetrySubscriber(destination, count, source) {\n var _this = _super.call(this, destination) || this;\n _this.count = count;\n _this.source = source;\n return _this;\n }\n RetrySubscriber.prototype.error = function (err) {\n if (!this.isStopped) {\n var _a = this, source = _a.source, count = _a.count;\n if (count === 0) {\n return _super.prototype.error.call(this, err);\n }\n else if (count > -1) {\n this.count = count - 1;\n }\n source.subscribe(this._unsubscribeAndRecycle());\n }\n };\n return RetrySubscriber;\n}(Subscriber_1.Subscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subject_1 = require(\"../Subject\");\nvar innerSubscribe_1 = require(\"../innerSubscribe\");\nfunction retryWhen(notifier) {\n return function (source) { return source.lift(new RetryWhenOperator(notifier, source)); };\n}\nexports.retryWhen = retryWhen;\nvar RetryWhenOperator = (function () {\n function RetryWhenOperator(notifier, source) {\n this.notifier = notifier;\n this.source = source;\n }\n RetryWhenOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new RetryWhenSubscriber(subscriber, this.notifier, this.source));\n };\n return RetryWhenOperator;\n}());\nvar RetryWhenSubscriber = (function (_super) {\n __extends(RetryWhenSubscriber, _super);\n function RetryWhenSubscriber(destination, notifier, source) {\n var _this = _super.call(this, destination) || this;\n _this.notifier = notifier;\n _this.source = source;\n return _this;\n }\n RetryWhenSubscriber.prototype.error = function (err) {\n if (!this.isStopped) {\n var errors = this.errors;\n var retries = this.retries;\n var retriesSubscription = this.retriesSubscription;\n if (!retries) {\n errors = new Subject_1.Subject();\n try {\n var notifier = this.notifier;\n retries = notifier(errors);\n }\n catch (e) {\n return _super.prototype.error.call(this, e);\n }\n retriesSubscription = innerSubscribe_1.innerSubscribe(retries, new innerSubscribe_1.SimpleInnerSubscriber(this));\n }\n else {\n this.errors = undefined;\n this.retriesSubscription = undefined;\n }\n this._unsubscribeAndRecycle();\n this.errors = errors;\n this.retries = retries;\n this.retriesSubscription = retriesSubscription;\n errors.next(err);\n }\n };\n RetryWhenSubscriber.prototype._unsubscribe = function () {\n var _a = this, errors = _a.errors, retriesSubscription = _a.retriesSubscription;\n if (errors) {\n errors.unsubscribe();\n this.errors = undefined;\n }\n if (retriesSubscription) {\n retriesSubscription.unsubscribe();\n this.retriesSubscription = undefined;\n }\n this.retries = undefined;\n };\n RetryWhenSubscriber.prototype.notifyNext = function () {\n var _unsubscribe = this._unsubscribe;\n this._unsubscribe = null;\n this._unsubscribeAndRecycle();\n this._unsubscribe = _unsubscribe;\n this.source.subscribe(this);\n };\n return RetryWhenSubscriber;\n}(innerSubscribe_1.SimpleOuterSubscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar innerSubscribe_1 = require(\"../innerSubscribe\");\nfunction sample(notifier) {\n return function (source) { return source.lift(new SampleOperator(notifier)); };\n}\nexports.sample = sample;\nvar SampleOperator = (function () {\n function SampleOperator(notifier) {\n this.notifier = notifier;\n }\n SampleOperator.prototype.call = function (subscriber, source) {\n var sampleSubscriber = new SampleSubscriber(subscriber);\n var subscription = source.subscribe(sampleSubscriber);\n subscription.add(innerSubscribe_1.innerSubscribe(this.notifier, new innerSubscribe_1.SimpleInnerSubscriber(sampleSubscriber)));\n return subscription;\n };\n return SampleOperator;\n}());\nvar SampleSubscriber = (function (_super) {\n __extends(SampleSubscriber, _super);\n function SampleSubscriber() {\n var _this = _super !== null && _super.apply(this, arguments) || this;\n _this.hasValue = false;\n return _this;\n }\n SampleSubscriber.prototype._next = function (value) {\n this.value = value;\n this.hasValue = true;\n };\n SampleSubscriber.prototype.notifyNext = function () {\n this.emitValue();\n };\n SampleSubscriber.prototype.notifyComplete = function () {\n this.emitValue();\n };\n SampleSubscriber.prototype.emitValue = function () {\n if (this.hasValue) {\n this.hasValue = false;\n this.destination.next(this.value);\n }\n };\n return SampleSubscriber;\n}(innerSubscribe_1.SimpleOuterSubscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nvar async_1 = require(\"../scheduler/async\");\nfunction sampleTime(period, scheduler) {\n if (scheduler === void 0) { scheduler = async_1.async; }\n return function (source) { return source.lift(new SampleTimeOperator(period, scheduler)); };\n}\nexports.sampleTime = sampleTime;\nvar SampleTimeOperator = (function () {\n function SampleTimeOperator(period, scheduler) {\n this.period = period;\n this.scheduler = scheduler;\n }\n SampleTimeOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new SampleTimeSubscriber(subscriber, this.period, this.scheduler));\n };\n return SampleTimeOperator;\n}());\nvar SampleTimeSubscriber = (function (_super) {\n __extends(SampleTimeSubscriber, _super);\n function SampleTimeSubscriber(destination, period, scheduler) {\n var _this = _super.call(this, destination) || this;\n _this.period = period;\n _this.scheduler = scheduler;\n _this.hasValue = false;\n _this.add(scheduler.schedule(dispatchNotification, period, { subscriber: _this, period: period }));\n return _this;\n }\n SampleTimeSubscriber.prototype._next = function (value) {\n this.lastValue = value;\n this.hasValue = true;\n };\n SampleTimeSubscriber.prototype.notifyNext = function () {\n if (this.hasValue) {\n this.hasValue = false;\n this.destination.next(this.lastValue);\n }\n };\n return SampleTimeSubscriber;\n}(Subscriber_1.Subscriber));\nfunction dispatchNotification(state) {\n var subscriber = state.subscriber, period = state.period;\n subscriber.notifyNext();\n this.schedule(state, period);\n}\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nfunction scan(accumulator, seed) {\n var hasSeed = false;\n if (arguments.length >= 2) {\n hasSeed = true;\n }\n return function scanOperatorFunction(source) {\n return source.lift(new ScanOperator(accumulator, seed, hasSeed));\n };\n}\nexports.scan = scan;\nvar ScanOperator = (function () {\n function ScanOperator(accumulator, seed, hasSeed) {\n if (hasSeed === void 0) { hasSeed = false; }\n this.accumulator = accumulator;\n this.seed = seed;\n this.hasSeed = hasSeed;\n }\n ScanOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new ScanSubscriber(subscriber, this.accumulator, this.seed, this.hasSeed));\n };\n return ScanOperator;\n}());\nvar ScanSubscriber = (function (_super) {\n __extends(ScanSubscriber, _super);\n function ScanSubscriber(destination, accumulator, _seed, hasSeed) {\n var _this = _super.call(this, destination) || this;\n _this.accumulator = accumulator;\n _this._seed = _seed;\n _this.hasSeed = hasSeed;\n _this.index = 0;\n return _this;\n }\n Object.defineProperty(ScanSubscriber.prototype, \"seed\", {\n get: function () {\n return this._seed;\n },\n set: function (value) {\n this.hasSeed = true;\n this._seed = value;\n },\n enumerable: true,\n configurable: true\n });\n ScanSubscriber.prototype._next = function (value) {\n if (!this.hasSeed) {\n this.seed = value;\n this.destination.next(value);\n }\n else {\n return this._tryNext(value);\n }\n };\n ScanSubscriber.prototype._tryNext = function (value) {\n var index = this.index++;\n var result;\n try {\n result = this.accumulator(this.seed, value, index);\n }\n catch (err) {\n this.destination.error(err);\n }\n this.seed = result;\n this.destination.next(result);\n };\n return ScanSubscriber;\n}(Subscriber_1.Subscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nfunction sequenceEqual(compareTo, comparator) {\n return function (source) { return source.lift(new SequenceEqualOperator(compareTo, comparator)); };\n}\nexports.sequenceEqual = sequenceEqual;\nvar SequenceEqualOperator = (function () {\n function SequenceEqualOperator(compareTo, comparator) {\n this.compareTo = compareTo;\n this.comparator = comparator;\n }\n SequenceEqualOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new SequenceEqualSubscriber(subscriber, this.compareTo, this.comparator));\n };\n return SequenceEqualOperator;\n}());\nexports.SequenceEqualOperator = SequenceEqualOperator;\nvar SequenceEqualSubscriber = (function (_super) {\n __extends(SequenceEqualSubscriber, _super);\n function SequenceEqualSubscriber(destination, compareTo, comparator) {\n var _this = _super.call(this, destination) || this;\n _this.compareTo = compareTo;\n _this.comparator = comparator;\n _this._a = [];\n _this._b = [];\n _this._oneComplete = false;\n _this.destination.add(compareTo.subscribe(new SequenceEqualCompareToSubscriber(destination, _this)));\n return _this;\n }\n SequenceEqualSubscriber.prototype._next = function (value) {\n if (this._oneComplete && this._b.length === 0) {\n this.emit(false);\n }\n else {\n this._a.push(value);\n this.checkValues();\n }\n };\n SequenceEqualSubscriber.prototype._complete = function () {\n if (this._oneComplete) {\n this.emit(this._a.length === 0 && this._b.length === 0);\n }\n else {\n this._oneComplete = true;\n }\n this.unsubscribe();\n };\n SequenceEqualSubscriber.prototype.checkValues = function () {\n var _c = this, _a = _c._a, _b = _c._b, comparator = _c.comparator;\n while (_a.length > 0 && _b.length > 0) {\n var a = _a.shift();\n var b = _b.shift();\n var areEqual = false;\n try {\n areEqual = comparator ? comparator(a, b) : a === b;\n }\n catch (e) {\n this.destination.error(e);\n }\n if (!areEqual) {\n this.emit(false);\n }\n }\n };\n SequenceEqualSubscriber.prototype.emit = function (value) {\n var destination = this.destination;\n destination.next(value);\n destination.complete();\n };\n SequenceEqualSubscriber.prototype.nextB = function (value) {\n if (this._oneComplete && this._a.length === 0) {\n this.emit(false);\n }\n else {\n this._b.push(value);\n this.checkValues();\n }\n };\n SequenceEqualSubscriber.prototype.completeB = function () {\n if (this._oneComplete) {\n this.emit(this._a.length === 0 && this._b.length === 0);\n }\n else {\n this._oneComplete = true;\n }\n };\n return SequenceEqualSubscriber;\n}(Subscriber_1.Subscriber));\nexports.SequenceEqualSubscriber = SequenceEqualSubscriber;\nvar SequenceEqualCompareToSubscriber = (function (_super) {\n __extends(SequenceEqualCompareToSubscriber, _super);\n function SequenceEqualCompareToSubscriber(destination, parent) {\n var _this = _super.call(this, destination) || this;\n _this.parent = parent;\n return _this;\n }\n SequenceEqualCompareToSubscriber.prototype._next = function (value) {\n this.parent.nextB(value);\n };\n SequenceEqualCompareToSubscriber.prototype._error = function (err) {\n this.parent.error(err);\n this.unsubscribe();\n };\n SequenceEqualCompareToSubscriber.prototype._complete = function () {\n this.parent.completeB();\n this.unsubscribe();\n };\n return SequenceEqualCompareToSubscriber;\n}(Subscriber_1.Subscriber));\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar multicast_1 = require(\"./multicast\");\nvar refCount_1 = require(\"./refCount\");\nvar Subject_1 = require(\"../Subject\");\nfunction shareSubjectFactory() {\n return new Subject_1.Subject();\n}\nfunction share() {\n return function (source) { return refCount_1.refCount()(multicast_1.multicast(shareSubjectFactory)(source)); };\n}\nexports.share = share;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar ReplaySubject_1 = require(\"../ReplaySubject\");\nfunction shareReplay(configOrBufferSize, windowTime, scheduler) {\n var config;\n if (configOrBufferSize && typeof configOrBufferSize === 'object') {\n config = configOrBufferSize;\n }\n else {\n config = {\n bufferSize: configOrBufferSize,\n windowTime: windowTime,\n refCount: false,\n scheduler: scheduler,\n };\n }\n return function (source) { return source.lift(shareReplayOperator(config)); };\n}\nexports.shareReplay = shareReplay;\nfunction shareReplayOperator(_a) {\n var _b = _a.bufferSize, bufferSize = _b === void 0 ? Number.POSITIVE_INFINITY : _b, _c = _a.windowTime, windowTime = _c === void 0 ? Number.POSITIVE_INFINITY : _c, useRefCount = _a.refCount, scheduler = _a.scheduler;\n var subject;\n var refCount = 0;\n var subscription;\n var hasError = false;\n var isComplete = false;\n return function shareReplayOperation(source) {\n refCount++;\n var innerSub;\n if (!subject || hasError) {\n hasError = false;\n subject = new ReplaySubject_1.ReplaySubject(bufferSize, windowTime, scheduler);\n innerSub = subject.subscribe(this);\n subscription = source.subscribe({\n next: function (value) {\n subject.next(value);\n },\n error: function (err) {\n hasError = true;\n subject.error(err);\n },\n complete: function () {\n isComplete = true;\n subscription = undefined;\n subject.complete();\n },\n });\n if (isComplete) {\n subscription = undefined;\n }\n }\n else {\n innerSub = subject.subscribe(this);\n }\n this.add(function () {\n refCount--;\n innerSub.unsubscribe();\n innerSub = undefined;\n if (subscription && !isComplete && useRefCount && refCount === 0) {\n subscription.unsubscribe();\n subscription = undefined;\n subject = undefined;\n }\n });\n };\n}\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nvar EmptyError_1 = require(\"../util/EmptyError\");\nfunction single(predicate) {\n return function (source) { return source.lift(new SingleOperator(predicate, source)); };\n}\nexports.single = single;\nvar SingleOperator = (function () {\n function SingleOperator(predicate, source) {\n this.predicate = predicate;\n this.source = source;\n }\n SingleOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new SingleSubscriber(subscriber, this.predicate, this.source));\n };\n return SingleOperator;\n}());\nvar SingleSubscriber = (function (_super) {\n __extends(SingleSubscriber, _super);\n function SingleSubscriber(destination, predicate, source) {\n var _this = _super.call(this, destination) || this;\n _this.predicate = predicate;\n _this.source = source;\n _this.seenValue = false;\n _this.index = 0;\n return _this;\n }\n SingleSubscriber.prototype.applySingleValue = function (value) {\n if (this.seenValue) {\n this.destination.error('Sequence contains more than one element');\n }\n else {\n this.seenValue = true;\n this.singleValue = value;\n }\n };\n SingleSubscriber.prototype._next = function (value) {\n var index = this.index++;\n if (this.predicate) {\n this.tryNext(value, index);\n }\n else {\n this.applySingleValue(value);\n }\n };\n SingleSubscriber.prototype.tryNext = function (value, index) {\n try {\n if (this.predicate(value, index, this.source)) {\n this.applySingleValue(value);\n }\n }\n catch (err) {\n this.destination.error(err);\n }\n };\n SingleSubscriber.prototype._complete = function () {\n var destination = this.destination;\n if (this.index > 0) {\n destination.next(this.seenValue ? this.singleValue : undefined);\n destination.complete();\n }\n else {\n destination.error(new EmptyError_1.EmptyError);\n }\n };\n return SingleSubscriber;\n}(Subscriber_1.Subscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nfunction skip(count) {\n return function (source) { return source.lift(new SkipOperator(count)); };\n}\nexports.skip = skip;\nvar SkipOperator = (function () {\n function SkipOperator(total) {\n this.total = total;\n }\n SkipOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new SkipSubscriber(subscriber, this.total));\n };\n return SkipOperator;\n}());\nvar SkipSubscriber = (function (_super) {\n __extends(SkipSubscriber, _super);\n function SkipSubscriber(destination, total) {\n var _this = _super.call(this, destination) || this;\n _this.total = total;\n _this.count = 0;\n return _this;\n }\n SkipSubscriber.prototype._next = function (x) {\n if (++this.count > this.total) {\n this.destination.next(x);\n }\n };\n return SkipSubscriber;\n}(Subscriber_1.Subscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nvar ArgumentOutOfRangeError_1 = require(\"../util/ArgumentOutOfRangeError\");\nfunction skipLast(count) {\n return function (source) { return source.lift(new SkipLastOperator(count)); };\n}\nexports.skipLast = skipLast;\nvar SkipLastOperator = (function () {\n function SkipLastOperator(_skipCount) {\n this._skipCount = _skipCount;\n if (this._skipCount < 0) {\n throw new ArgumentOutOfRangeError_1.ArgumentOutOfRangeError;\n }\n }\n SkipLastOperator.prototype.call = function (subscriber, source) {\n if (this._skipCount === 0) {\n return source.subscribe(new Subscriber_1.Subscriber(subscriber));\n }\n else {\n return source.subscribe(new SkipLastSubscriber(subscriber, this._skipCount));\n }\n };\n return SkipLastOperator;\n}());\nvar SkipLastSubscriber = (function (_super) {\n __extends(SkipLastSubscriber, _super);\n function SkipLastSubscriber(destination, _skipCount) {\n var _this = _super.call(this, destination) || this;\n _this._skipCount = _skipCount;\n _this._count = 0;\n _this._ring = new Array(_skipCount);\n return _this;\n }\n SkipLastSubscriber.prototype._next = function (value) {\n var skipCount = this._skipCount;\n var count = this._count++;\n if (count < skipCount) {\n this._ring[count] = value;\n }\n else {\n var currentIndex = count % skipCount;\n var ring = this._ring;\n var oldValue = ring[currentIndex];\n ring[currentIndex] = value;\n this.destination.next(oldValue);\n }\n };\n return SkipLastSubscriber;\n}(Subscriber_1.Subscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar innerSubscribe_1 = require(\"../innerSubscribe\");\nfunction skipUntil(notifier) {\n return function (source) { return source.lift(new SkipUntilOperator(notifier)); };\n}\nexports.skipUntil = skipUntil;\nvar SkipUntilOperator = (function () {\n function SkipUntilOperator(notifier) {\n this.notifier = notifier;\n }\n SkipUntilOperator.prototype.call = function (destination, source) {\n return source.subscribe(new SkipUntilSubscriber(destination, this.notifier));\n };\n return SkipUntilOperator;\n}());\nvar SkipUntilSubscriber = (function (_super) {\n __extends(SkipUntilSubscriber, _super);\n function SkipUntilSubscriber(destination, notifier) {\n var _this = _super.call(this, destination) || this;\n _this.hasValue = false;\n var innerSubscriber = new innerSubscribe_1.SimpleInnerSubscriber(_this);\n _this.add(innerSubscriber);\n _this.innerSubscription = innerSubscriber;\n var innerSubscription = innerSubscribe_1.innerSubscribe(notifier, innerSubscriber);\n if (innerSubscription !== innerSubscriber) {\n _this.add(innerSubscription);\n _this.innerSubscription = innerSubscription;\n }\n return _this;\n }\n SkipUntilSubscriber.prototype._next = function (value) {\n if (this.hasValue) {\n _super.prototype._next.call(this, value);\n }\n };\n SkipUntilSubscriber.prototype.notifyNext = function () {\n this.hasValue = true;\n if (this.innerSubscription) {\n this.innerSubscription.unsubscribe();\n }\n };\n SkipUntilSubscriber.prototype.notifyComplete = function () {\n };\n return SkipUntilSubscriber;\n}(innerSubscribe_1.SimpleOuterSubscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nfunction skipWhile(predicate) {\n return function (source) { return source.lift(new SkipWhileOperator(predicate)); };\n}\nexports.skipWhile = skipWhile;\nvar SkipWhileOperator = (function () {\n function SkipWhileOperator(predicate) {\n this.predicate = predicate;\n }\n SkipWhileOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new SkipWhileSubscriber(subscriber, this.predicate));\n };\n return SkipWhileOperator;\n}());\nvar SkipWhileSubscriber = (function (_super) {\n __extends(SkipWhileSubscriber, _super);\n function SkipWhileSubscriber(destination, predicate) {\n var _this = _super.call(this, destination) || this;\n _this.predicate = predicate;\n _this.skipping = true;\n _this.index = 0;\n return _this;\n }\n SkipWhileSubscriber.prototype._next = function (value) {\n var destination = this.destination;\n if (this.skipping) {\n this.tryCallPredicate(value);\n }\n if (!this.skipping) {\n destination.next(value);\n }\n };\n SkipWhileSubscriber.prototype.tryCallPredicate = function (value) {\n try {\n var result = this.predicate(value, this.index++);\n this.skipping = Boolean(result);\n }\n catch (err) {\n this.destination.error(err);\n }\n };\n return SkipWhileSubscriber;\n}(Subscriber_1.Subscriber));\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar concat_1 = require(\"../observable/concat\");\nvar isScheduler_1 = require(\"../util/isScheduler\");\nfunction startWith() {\n var array = [];\n for (var _i = 0; _i < arguments.length; _i++) {\n array[_i] = arguments[_i];\n }\n var scheduler = array[array.length - 1];\n if (isScheduler_1.isScheduler(scheduler)) {\n array.pop();\n return function (source) { return concat_1.concat(array, source, scheduler); };\n }\n else {\n return function (source) { return concat_1.concat(array, source); };\n }\n}\nexports.startWith = startWith;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar SubscribeOnObservable_1 = require(\"../observable/SubscribeOnObservable\");\nfunction subscribeOn(scheduler, delay) {\n if (delay === void 0) { delay = 0; }\n return function subscribeOnOperatorFunction(source) {\n return source.lift(new SubscribeOnOperator(scheduler, delay));\n };\n}\nexports.subscribeOn = subscribeOn;\nvar SubscribeOnOperator = (function () {\n function SubscribeOnOperator(scheduler, delay) {\n this.scheduler = scheduler;\n this.delay = delay;\n }\n SubscribeOnOperator.prototype.call = function (subscriber, source) {\n return new SubscribeOnObservable_1.SubscribeOnObservable(source, this.delay, this.scheduler).subscribe(subscriber);\n };\n return SubscribeOnOperator;\n}());\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar switchMap_1 = require(\"./switchMap\");\nvar identity_1 = require(\"../util/identity\");\nfunction switchAll() {\n return switchMap_1.switchMap(identity_1.identity);\n}\nexports.switchAll = switchAll;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar map_1 = require(\"./map\");\nvar from_1 = require(\"../observable/from\");\nvar innerSubscribe_1 = require(\"../innerSubscribe\");\nfunction switchMap(project, resultSelector) {\n if (typeof resultSelector === 'function') {\n return function (source) { return source.pipe(switchMap(function (a, i) { return from_1.from(project(a, i)).pipe(map_1.map(function (b, ii) { return resultSelector(a, b, i, ii); })); })); };\n }\n return function (source) { return source.lift(new SwitchMapOperator(project)); };\n}\nexports.switchMap = switchMap;\nvar SwitchMapOperator = (function () {\n function SwitchMapOperator(project) {\n this.project = project;\n }\n SwitchMapOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new SwitchMapSubscriber(subscriber, this.project));\n };\n return SwitchMapOperator;\n}());\nvar SwitchMapSubscriber = (function (_super) {\n __extends(SwitchMapSubscriber, _super);\n function SwitchMapSubscriber(destination, project) {\n var _this = _super.call(this, destination) || this;\n _this.project = project;\n _this.index = 0;\n return _this;\n }\n SwitchMapSubscriber.prototype._next = function (value) {\n var result;\n var index = this.index++;\n try {\n result = this.project(value, index);\n }\n catch (error) {\n this.destination.error(error);\n return;\n }\n this._innerSub(result);\n };\n SwitchMapSubscriber.prototype._innerSub = function (result) {\n var innerSubscription = this.innerSubscription;\n if (innerSubscription) {\n innerSubscription.unsubscribe();\n }\n var innerSubscriber = new innerSubscribe_1.SimpleInnerSubscriber(this);\n var destination = this.destination;\n destination.add(innerSubscriber);\n this.innerSubscription = innerSubscribe_1.innerSubscribe(result, innerSubscriber);\n if (this.innerSubscription !== innerSubscriber) {\n destination.add(this.innerSubscription);\n }\n };\n SwitchMapSubscriber.prototype._complete = function () {\n var innerSubscription = this.innerSubscription;\n if (!innerSubscription || innerSubscription.closed) {\n _super.prototype._complete.call(this);\n }\n this.unsubscribe();\n };\n SwitchMapSubscriber.prototype._unsubscribe = function () {\n this.innerSubscription = undefined;\n };\n SwitchMapSubscriber.prototype.notifyComplete = function () {\n this.innerSubscription = undefined;\n if (this.isStopped) {\n _super.prototype._complete.call(this);\n }\n };\n SwitchMapSubscriber.prototype.notifyNext = function (innerValue) {\n this.destination.next(innerValue);\n };\n return SwitchMapSubscriber;\n}(innerSubscribe_1.SimpleOuterSubscriber));\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar switchMap_1 = require(\"./switchMap\");\nfunction switchMapTo(innerObservable, resultSelector) {\n return resultSelector ? switchMap_1.switchMap(function () { return innerObservable; }, resultSelector) : switchMap_1.switchMap(function () { return innerObservable; });\n}\nexports.switchMapTo = switchMapTo;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nvar ArgumentOutOfRangeError_1 = require(\"../util/ArgumentOutOfRangeError\");\nvar empty_1 = require(\"../observable/empty\");\nfunction take(count) {\n return function (source) {\n if (count === 0) {\n return empty_1.empty();\n }\n else {\n return source.lift(new TakeOperator(count));\n }\n };\n}\nexports.take = take;\nvar TakeOperator = (function () {\n function TakeOperator(total) {\n this.total = total;\n if (this.total < 0) {\n throw new ArgumentOutOfRangeError_1.ArgumentOutOfRangeError;\n }\n }\n TakeOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new TakeSubscriber(subscriber, this.total));\n };\n return TakeOperator;\n}());\nvar TakeSubscriber = (function (_super) {\n __extends(TakeSubscriber, _super);\n function TakeSubscriber(destination, total) {\n var _this = _super.call(this, destination) || this;\n _this.total = total;\n _this.count = 0;\n return _this;\n }\n TakeSubscriber.prototype._next = function (value) {\n var total = this.total;\n var count = ++this.count;\n if (count <= total) {\n this.destination.next(value);\n if (count === total) {\n this.destination.complete();\n this.unsubscribe();\n }\n }\n };\n return TakeSubscriber;\n}(Subscriber_1.Subscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nvar ArgumentOutOfRangeError_1 = require(\"../util/ArgumentOutOfRangeError\");\nvar empty_1 = require(\"../observable/empty\");\nfunction takeLast(count) {\n return function takeLastOperatorFunction(source) {\n if (count === 0) {\n return empty_1.empty();\n }\n else {\n return source.lift(new TakeLastOperator(count));\n }\n };\n}\nexports.takeLast = takeLast;\nvar TakeLastOperator = (function () {\n function TakeLastOperator(total) {\n this.total = total;\n if (this.total < 0) {\n throw new ArgumentOutOfRangeError_1.ArgumentOutOfRangeError;\n }\n }\n TakeLastOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new TakeLastSubscriber(subscriber, this.total));\n };\n return TakeLastOperator;\n}());\nvar TakeLastSubscriber = (function (_super) {\n __extends(TakeLastSubscriber, _super);\n function TakeLastSubscriber(destination, total) {\n var _this = _super.call(this, destination) || this;\n _this.total = total;\n _this.ring = new Array();\n _this.count = 0;\n return _this;\n }\n TakeLastSubscriber.prototype._next = function (value) {\n var ring = this.ring;\n var total = this.total;\n var count = this.count++;\n if (ring.length < total) {\n ring.push(value);\n }\n else {\n var index = count % total;\n ring[index] = value;\n }\n };\n TakeLastSubscriber.prototype._complete = function () {\n var destination = this.destination;\n var count = this.count;\n if (count > 0) {\n var total = this.count >= this.total ? this.total : this.count;\n var ring = this.ring;\n for (var i = 0; i < total; i++) {\n var idx = (count++) % total;\n destination.next(ring[idx]);\n }\n }\n destination.complete();\n };\n return TakeLastSubscriber;\n}(Subscriber_1.Subscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar innerSubscribe_1 = require(\"../innerSubscribe\");\nfunction takeUntil(notifier) {\n return function (source) { return source.lift(new TakeUntilOperator(notifier)); };\n}\nexports.takeUntil = takeUntil;\nvar TakeUntilOperator = (function () {\n function TakeUntilOperator(notifier) {\n this.notifier = notifier;\n }\n TakeUntilOperator.prototype.call = function (subscriber, source) {\n var takeUntilSubscriber = new TakeUntilSubscriber(subscriber);\n var notifierSubscription = innerSubscribe_1.innerSubscribe(this.notifier, new innerSubscribe_1.SimpleInnerSubscriber(takeUntilSubscriber));\n if (notifierSubscription && !takeUntilSubscriber.seenValue) {\n takeUntilSubscriber.add(notifierSubscription);\n return source.subscribe(takeUntilSubscriber);\n }\n return takeUntilSubscriber;\n };\n return TakeUntilOperator;\n}());\nvar TakeUntilSubscriber = (function (_super) {\n __extends(TakeUntilSubscriber, _super);\n function TakeUntilSubscriber(destination) {\n var _this = _super.call(this, destination) || this;\n _this.seenValue = false;\n return _this;\n }\n TakeUntilSubscriber.prototype.notifyNext = function () {\n this.seenValue = true;\n this.complete();\n };\n TakeUntilSubscriber.prototype.notifyComplete = function () {\n };\n return TakeUntilSubscriber;\n}(innerSubscribe_1.SimpleOuterSubscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nfunction takeWhile(predicate, inclusive) {\n if (inclusive === void 0) { inclusive = false; }\n return function (source) {\n return source.lift(new TakeWhileOperator(predicate, inclusive));\n };\n}\nexports.takeWhile = takeWhile;\nvar TakeWhileOperator = (function () {\n function TakeWhileOperator(predicate, inclusive) {\n this.predicate = predicate;\n this.inclusive = inclusive;\n }\n TakeWhileOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new TakeWhileSubscriber(subscriber, this.predicate, this.inclusive));\n };\n return TakeWhileOperator;\n}());\nvar TakeWhileSubscriber = (function (_super) {\n __extends(TakeWhileSubscriber, _super);\n function TakeWhileSubscriber(destination, predicate, inclusive) {\n var _this = _super.call(this, destination) || this;\n _this.predicate = predicate;\n _this.inclusive = inclusive;\n _this.index = 0;\n return _this;\n }\n TakeWhileSubscriber.prototype._next = function (value) {\n var destination = this.destination;\n var result;\n try {\n result = this.predicate(value, this.index++);\n }\n catch (err) {\n destination.error(err);\n return;\n }\n this.nextOrComplete(value, result);\n };\n TakeWhileSubscriber.prototype.nextOrComplete = function (value, predicateResult) {\n var destination = this.destination;\n if (Boolean(predicateResult)) {\n destination.next(value);\n }\n else {\n if (this.inclusive) {\n destination.next(value);\n }\n destination.complete();\n }\n };\n return TakeWhileSubscriber;\n}(Subscriber_1.Subscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nvar noop_1 = require(\"../util/noop\");\nvar isFunction_1 = require(\"../util/isFunction\");\nfunction tap(nextOrObserver, error, complete) {\n return function tapOperatorFunction(source) {\n return source.lift(new DoOperator(nextOrObserver, error, complete));\n };\n}\nexports.tap = tap;\nvar DoOperator = (function () {\n function DoOperator(nextOrObserver, error, complete) {\n this.nextOrObserver = nextOrObserver;\n this.error = error;\n this.complete = complete;\n }\n DoOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new TapSubscriber(subscriber, this.nextOrObserver, this.error, this.complete));\n };\n return DoOperator;\n}());\nvar TapSubscriber = (function (_super) {\n __extends(TapSubscriber, _super);\n function TapSubscriber(destination, observerOrNext, error, complete) {\n var _this = _super.call(this, destination) || this;\n _this._tapNext = noop_1.noop;\n _this._tapError = noop_1.noop;\n _this._tapComplete = noop_1.noop;\n _this._tapError = error || noop_1.noop;\n _this._tapComplete = complete || noop_1.noop;\n if (isFunction_1.isFunction(observerOrNext)) {\n _this._context = _this;\n _this._tapNext = observerOrNext;\n }\n else if (observerOrNext) {\n _this._context = observerOrNext;\n _this._tapNext = observerOrNext.next || noop_1.noop;\n _this._tapError = observerOrNext.error || noop_1.noop;\n _this._tapComplete = observerOrNext.complete || noop_1.noop;\n }\n return _this;\n }\n TapSubscriber.prototype._next = function (value) {\n try {\n this._tapNext.call(this._context, value);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.next(value);\n };\n TapSubscriber.prototype._error = function (err) {\n try {\n this._tapError.call(this._context, err);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.error(err);\n };\n TapSubscriber.prototype._complete = function () {\n try {\n this._tapComplete.call(this._context);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n return this.destination.complete();\n };\n return TapSubscriber;\n}(Subscriber_1.Subscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar innerSubscribe_1 = require(\"../innerSubscribe\");\nexports.defaultThrottleConfig = {\n leading: true,\n trailing: false\n};\nfunction throttle(durationSelector, config) {\n if (config === void 0) { config = exports.defaultThrottleConfig; }\n return function (source) { return source.lift(new ThrottleOperator(durationSelector, !!config.leading, !!config.trailing)); };\n}\nexports.throttle = throttle;\nvar ThrottleOperator = (function () {\n function ThrottleOperator(durationSelector, leading, trailing) {\n this.durationSelector = durationSelector;\n this.leading = leading;\n this.trailing = trailing;\n }\n ThrottleOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new ThrottleSubscriber(subscriber, this.durationSelector, this.leading, this.trailing));\n };\n return ThrottleOperator;\n}());\nvar ThrottleSubscriber = (function (_super) {\n __extends(ThrottleSubscriber, _super);\n function ThrottleSubscriber(destination, durationSelector, _leading, _trailing) {\n var _this = _super.call(this, destination) || this;\n _this.destination = destination;\n _this.durationSelector = durationSelector;\n _this._leading = _leading;\n _this._trailing = _trailing;\n _this._hasValue = false;\n return _this;\n }\n ThrottleSubscriber.prototype._next = function (value) {\n this._hasValue = true;\n this._sendValue = value;\n if (!this._throttled) {\n if (this._leading) {\n this.send();\n }\n else {\n this.throttle(value);\n }\n }\n };\n ThrottleSubscriber.prototype.send = function () {\n var _a = this, _hasValue = _a._hasValue, _sendValue = _a._sendValue;\n if (_hasValue) {\n this.destination.next(_sendValue);\n this.throttle(_sendValue);\n }\n this._hasValue = false;\n this._sendValue = undefined;\n };\n ThrottleSubscriber.prototype.throttle = function (value) {\n var duration = this.tryDurationSelector(value);\n if (!!duration) {\n this.add(this._throttled = innerSubscribe_1.innerSubscribe(duration, new innerSubscribe_1.SimpleInnerSubscriber(this)));\n }\n };\n ThrottleSubscriber.prototype.tryDurationSelector = function (value) {\n try {\n return this.durationSelector(value);\n }\n catch (err) {\n this.destination.error(err);\n return null;\n }\n };\n ThrottleSubscriber.prototype.throttlingDone = function () {\n var _a = this, _throttled = _a._throttled, _trailing = _a._trailing;\n if (_throttled) {\n _throttled.unsubscribe();\n }\n this._throttled = undefined;\n if (_trailing) {\n this.send();\n }\n };\n ThrottleSubscriber.prototype.notifyNext = function () {\n this.throttlingDone();\n };\n ThrottleSubscriber.prototype.notifyComplete = function () {\n this.throttlingDone();\n };\n return ThrottleSubscriber;\n}(innerSubscribe_1.SimpleOuterSubscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nvar async_1 = require(\"../scheduler/async\");\nvar throttle_1 = require(\"./throttle\");\nfunction throttleTime(duration, scheduler, config) {\n if (scheduler === void 0) { scheduler = async_1.async; }\n if (config === void 0) { config = throttle_1.defaultThrottleConfig; }\n return function (source) { return source.lift(new ThrottleTimeOperator(duration, scheduler, config.leading, config.trailing)); };\n}\nexports.throttleTime = throttleTime;\nvar ThrottleTimeOperator = (function () {\n function ThrottleTimeOperator(duration, scheduler, leading, trailing) {\n this.duration = duration;\n this.scheduler = scheduler;\n this.leading = leading;\n this.trailing = trailing;\n }\n ThrottleTimeOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new ThrottleTimeSubscriber(subscriber, this.duration, this.scheduler, this.leading, this.trailing));\n };\n return ThrottleTimeOperator;\n}());\nvar ThrottleTimeSubscriber = (function (_super) {\n __extends(ThrottleTimeSubscriber, _super);\n function ThrottleTimeSubscriber(destination, duration, scheduler, leading, trailing) {\n var _this = _super.call(this, destination) || this;\n _this.duration = duration;\n _this.scheduler = scheduler;\n _this.leading = leading;\n _this.trailing = trailing;\n _this._hasTrailingValue = false;\n _this._trailingValue = null;\n return _this;\n }\n ThrottleTimeSubscriber.prototype._next = function (value) {\n if (this.throttled) {\n if (this.trailing) {\n this._trailingValue = value;\n this._hasTrailingValue = true;\n }\n }\n else {\n this.add(this.throttled = this.scheduler.schedule(dispatchNext, this.duration, { subscriber: this }));\n if (this.leading) {\n this.destination.next(value);\n }\n else if (this.trailing) {\n this._trailingValue = value;\n this._hasTrailingValue = true;\n }\n }\n };\n ThrottleTimeSubscriber.prototype._complete = function () {\n if (this._hasTrailingValue) {\n this.destination.next(this._trailingValue);\n this.destination.complete();\n }\n else {\n this.destination.complete();\n }\n };\n ThrottleTimeSubscriber.prototype.clearThrottle = function () {\n var throttled = this.throttled;\n if (throttled) {\n if (this.trailing && this._hasTrailingValue) {\n this.destination.next(this._trailingValue);\n this._trailingValue = null;\n this._hasTrailingValue = false;\n }\n throttled.unsubscribe();\n this.remove(throttled);\n this.throttled = null;\n }\n };\n return ThrottleTimeSubscriber;\n}(Subscriber_1.Subscriber));\nfunction dispatchNext(arg) {\n var subscriber = arg.subscriber;\n subscriber.clearThrottle();\n}\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar EmptyError_1 = require(\"../util/EmptyError\");\nvar Subscriber_1 = require(\"../Subscriber\");\nfunction throwIfEmpty(errorFactory) {\n if (errorFactory === void 0) { errorFactory = defaultErrorFactory; }\n return function (source) {\n return source.lift(new ThrowIfEmptyOperator(errorFactory));\n };\n}\nexports.throwIfEmpty = throwIfEmpty;\nvar ThrowIfEmptyOperator = (function () {\n function ThrowIfEmptyOperator(errorFactory) {\n this.errorFactory = errorFactory;\n }\n ThrowIfEmptyOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new ThrowIfEmptySubscriber(subscriber, this.errorFactory));\n };\n return ThrowIfEmptyOperator;\n}());\nvar ThrowIfEmptySubscriber = (function (_super) {\n __extends(ThrowIfEmptySubscriber, _super);\n function ThrowIfEmptySubscriber(destination, errorFactory) {\n var _this = _super.call(this, destination) || this;\n _this.errorFactory = errorFactory;\n _this.hasValue = false;\n return _this;\n }\n ThrowIfEmptySubscriber.prototype._next = function (value) {\n this.hasValue = true;\n this.destination.next(value);\n };\n ThrowIfEmptySubscriber.prototype._complete = function () {\n if (!this.hasValue) {\n var err = void 0;\n try {\n err = this.errorFactory();\n }\n catch (e) {\n err = e;\n }\n this.destination.error(err);\n }\n else {\n return this.destination.complete();\n }\n };\n return ThrowIfEmptySubscriber;\n}(Subscriber_1.Subscriber));\nfunction defaultErrorFactory() {\n return new EmptyError_1.EmptyError();\n}\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar async_1 = require(\"../scheduler/async\");\nvar scan_1 = require(\"./scan\");\nvar defer_1 = require(\"../observable/defer\");\nvar map_1 = require(\"./map\");\nfunction timeInterval(scheduler) {\n if (scheduler === void 0) { scheduler = async_1.async; }\n return function (source) { return defer_1.defer(function () {\n return source.pipe(scan_1.scan(function (_a, value) {\n var current = _a.current;\n return ({ value: value, current: scheduler.now(), last: current });\n }, { current: scheduler.now(), value: undefined, last: undefined }), map_1.map(function (_a) {\n var current = _a.current, last = _a.last, value = _a.value;\n return new TimeInterval(value, current - last);\n }));\n }); };\n}\nexports.timeInterval = timeInterval;\nvar TimeInterval = (function () {\n function TimeInterval(value, interval) {\n this.value = value;\n this.interval = interval;\n }\n return TimeInterval;\n}());\nexports.TimeInterval = TimeInterval;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar async_1 = require(\"../scheduler/async\");\nvar TimeoutError_1 = require(\"../util/TimeoutError\");\nvar timeoutWith_1 = require(\"./timeoutWith\");\nvar throwError_1 = require(\"../observable/throwError\");\nfunction timeout(due, scheduler) {\n if (scheduler === void 0) { scheduler = async_1.async; }\n return timeoutWith_1.timeoutWith(due, throwError_1.throwError(new TimeoutError_1.TimeoutError()), scheduler);\n}\nexports.timeout = timeout;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar async_1 = require(\"../scheduler/async\");\nvar isDate_1 = require(\"../util/isDate\");\nvar innerSubscribe_1 = require(\"../innerSubscribe\");\nfunction timeoutWith(due, withObservable, scheduler) {\n if (scheduler === void 0) { scheduler = async_1.async; }\n return function (source) {\n var absoluteTimeout = isDate_1.isDate(due);\n var waitFor = absoluteTimeout ? (+due - scheduler.now()) : Math.abs(due);\n return source.lift(new TimeoutWithOperator(waitFor, absoluteTimeout, withObservable, scheduler));\n };\n}\nexports.timeoutWith = timeoutWith;\nvar TimeoutWithOperator = (function () {\n function TimeoutWithOperator(waitFor, absoluteTimeout, withObservable, scheduler) {\n this.waitFor = waitFor;\n this.absoluteTimeout = absoluteTimeout;\n this.withObservable = withObservable;\n this.scheduler = scheduler;\n }\n TimeoutWithOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new TimeoutWithSubscriber(subscriber, this.absoluteTimeout, this.waitFor, this.withObservable, this.scheduler));\n };\n return TimeoutWithOperator;\n}());\nvar TimeoutWithSubscriber = (function (_super) {\n __extends(TimeoutWithSubscriber, _super);\n function TimeoutWithSubscriber(destination, absoluteTimeout, waitFor, withObservable, scheduler) {\n var _this = _super.call(this, destination) || this;\n _this.absoluteTimeout = absoluteTimeout;\n _this.waitFor = waitFor;\n _this.withObservable = withObservable;\n _this.scheduler = scheduler;\n _this.scheduleTimeout();\n return _this;\n }\n TimeoutWithSubscriber.dispatchTimeout = function (subscriber) {\n var withObservable = subscriber.withObservable;\n subscriber._unsubscribeAndRecycle();\n subscriber.add(innerSubscribe_1.innerSubscribe(withObservable, new innerSubscribe_1.SimpleInnerSubscriber(subscriber)));\n };\n TimeoutWithSubscriber.prototype.scheduleTimeout = function () {\n var action = this.action;\n if (action) {\n this.action = action.schedule(this, this.waitFor);\n }\n else {\n this.add(this.action = this.scheduler.schedule(TimeoutWithSubscriber.dispatchTimeout, this.waitFor, this));\n }\n };\n TimeoutWithSubscriber.prototype._next = function (value) {\n if (!this.absoluteTimeout) {\n this.scheduleTimeout();\n }\n _super.prototype._next.call(this, value);\n };\n TimeoutWithSubscriber.prototype._unsubscribe = function () {\n this.action = undefined;\n this.scheduler = null;\n this.withObservable = null;\n };\n return TimeoutWithSubscriber;\n}(innerSubscribe_1.SimpleOuterSubscriber));\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar async_1 = require(\"../scheduler/async\");\nvar map_1 = require(\"./map\");\nfunction timestamp(scheduler) {\n if (scheduler === void 0) { scheduler = async_1.async; }\n return map_1.map(function (value) { return new Timestamp(value, scheduler.now()); });\n}\nexports.timestamp = timestamp;\nvar Timestamp = (function () {\n function Timestamp(value, timestamp) {\n this.value = value;\n this.timestamp = timestamp;\n }\n return Timestamp;\n}());\nexports.Timestamp = Timestamp;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar reduce_1 = require(\"./reduce\");\nfunction toArrayReducer(arr, item, index) {\n if (index === 0) {\n return [item];\n }\n arr.push(item);\n return arr;\n}\nfunction toArray() {\n return reduce_1.reduce(toArrayReducer, []);\n}\nexports.toArray = toArray;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subject_1 = require(\"../Subject\");\nvar innerSubscribe_1 = require(\"../innerSubscribe\");\nfunction window(windowBoundaries) {\n return function windowOperatorFunction(source) {\n return source.lift(new WindowOperator(windowBoundaries));\n };\n}\nexports.window = window;\nvar WindowOperator = (function () {\n function WindowOperator(windowBoundaries) {\n this.windowBoundaries = windowBoundaries;\n }\n WindowOperator.prototype.call = function (subscriber, source) {\n var windowSubscriber = new WindowSubscriber(subscriber);\n var sourceSubscription = source.subscribe(windowSubscriber);\n if (!sourceSubscription.closed) {\n windowSubscriber.add(innerSubscribe_1.innerSubscribe(this.windowBoundaries, new innerSubscribe_1.SimpleInnerSubscriber(windowSubscriber)));\n }\n return sourceSubscription;\n };\n return WindowOperator;\n}());\nvar WindowSubscriber = (function (_super) {\n __extends(WindowSubscriber, _super);\n function WindowSubscriber(destination) {\n var _this = _super.call(this, destination) || this;\n _this.window = new Subject_1.Subject();\n destination.next(_this.window);\n return _this;\n }\n WindowSubscriber.prototype.notifyNext = function () {\n this.openWindow();\n };\n WindowSubscriber.prototype.notifyError = function (error) {\n this._error(error);\n };\n WindowSubscriber.prototype.notifyComplete = function () {\n this._complete();\n };\n WindowSubscriber.prototype._next = function (value) {\n this.window.next(value);\n };\n WindowSubscriber.prototype._error = function (err) {\n this.window.error(err);\n this.destination.error(err);\n };\n WindowSubscriber.prototype._complete = function () {\n this.window.complete();\n this.destination.complete();\n };\n WindowSubscriber.prototype._unsubscribe = function () {\n this.window = null;\n };\n WindowSubscriber.prototype.openWindow = function () {\n var prevWindow = this.window;\n if (prevWindow) {\n prevWindow.complete();\n }\n var destination = this.destination;\n var newWindow = this.window = new Subject_1.Subject();\n destination.next(newWindow);\n };\n return WindowSubscriber;\n}(innerSubscribe_1.SimpleOuterSubscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nvar Subject_1 = require(\"../Subject\");\nfunction windowCount(windowSize, startWindowEvery) {\n if (startWindowEvery === void 0) { startWindowEvery = 0; }\n return function windowCountOperatorFunction(source) {\n return source.lift(new WindowCountOperator(windowSize, startWindowEvery));\n };\n}\nexports.windowCount = windowCount;\nvar WindowCountOperator = (function () {\n function WindowCountOperator(windowSize, startWindowEvery) {\n this.windowSize = windowSize;\n this.startWindowEvery = startWindowEvery;\n }\n WindowCountOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new WindowCountSubscriber(subscriber, this.windowSize, this.startWindowEvery));\n };\n return WindowCountOperator;\n}());\nvar WindowCountSubscriber = (function (_super) {\n __extends(WindowCountSubscriber, _super);\n function WindowCountSubscriber(destination, windowSize, startWindowEvery) {\n var _this = _super.call(this, destination) || this;\n _this.destination = destination;\n _this.windowSize = windowSize;\n _this.startWindowEvery = startWindowEvery;\n _this.windows = [new Subject_1.Subject()];\n _this.count = 0;\n destination.next(_this.windows[0]);\n return _this;\n }\n WindowCountSubscriber.prototype._next = function (value) {\n var startWindowEvery = (this.startWindowEvery > 0) ? this.startWindowEvery : this.windowSize;\n var destination = this.destination;\n var windowSize = this.windowSize;\n var windows = this.windows;\n var len = windows.length;\n for (var i = 0; i < len && !this.closed; i++) {\n windows[i].next(value);\n }\n var c = this.count - windowSize + 1;\n if (c >= 0 && c % startWindowEvery === 0 && !this.closed) {\n windows.shift().complete();\n }\n if (++this.count % startWindowEvery === 0 && !this.closed) {\n var window_1 = new Subject_1.Subject();\n windows.push(window_1);\n destination.next(window_1);\n }\n };\n WindowCountSubscriber.prototype._error = function (err) {\n var windows = this.windows;\n if (windows) {\n while (windows.length > 0 && !this.closed) {\n windows.shift().error(err);\n }\n }\n this.destination.error(err);\n };\n WindowCountSubscriber.prototype._complete = function () {\n var windows = this.windows;\n if (windows) {\n while (windows.length > 0 && !this.closed) {\n windows.shift().complete();\n }\n }\n this.destination.complete();\n };\n WindowCountSubscriber.prototype._unsubscribe = function () {\n this.count = 0;\n this.windows = null;\n };\n return WindowCountSubscriber;\n}(Subscriber_1.Subscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subject_1 = require(\"../Subject\");\nvar async_1 = require(\"../scheduler/async\");\nvar Subscriber_1 = require(\"../Subscriber\");\nvar isNumeric_1 = require(\"../util/isNumeric\");\nvar isScheduler_1 = require(\"../util/isScheduler\");\nfunction windowTime(windowTimeSpan) {\n var scheduler = async_1.async;\n var windowCreationInterval = null;\n var maxWindowSize = Number.POSITIVE_INFINITY;\n if (isScheduler_1.isScheduler(arguments[3])) {\n scheduler = arguments[3];\n }\n if (isScheduler_1.isScheduler(arguments[2])) {\n scheduler = arguments[2];\n }\n else if (isNumeric_1.isNumeric(arguments[2])) {\n maxWindowSize = Number(arguments[2]);\n }\n if (isScheduler_1.isScheduler(arguments[1])) {\n scheduler = arguments[1];\n }\n else if (isNumeric_1.isNumeric(arguments[1])) {\n windowCreationInterval = Number(arguments[1]);\n }\n return function windowTimeOperatorFunction(source) {\n return source.lift(new WindowTimeOperator(windowTimeSpan, windowCreationInterval, maxWindowSize, scheduler));\n };\n}\nexports.windowTime = windowTime;\nvar WindowTimeOperator = (function () {\n function WindowTimeOperator(windowTimeSpan, windowCreationInterval, maxWindowSize, scheduler) {\n this.windowTimeSpan = windowTimeSpan;\n this.windowCreationInterval = windowCreationInterval;\n this.maxWindowSize = maxWindowSize;\n this.scheduler = scheduler;\n }\n WindowTimeOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new WindowTimeSubscriber(subscriber, this.windowTimeSpan, this.windowCreationInterval, this.maxWindowSize, this.scheduler));\n };\n return WindowTimeOperator;\n}());\nvar CountedSubject = (function (_super) {\n __extends(CountedSubject, _super);\n function CountedSubject() {\n var _this = _super !== null && _super.apply(this, arguments) || this;\n _this._numberOfNextedValues = 0;\n return _this;\n }\n CountedSubject.prototype.next = function (value) {\n this._numberOfNextedValues++;\n _super.prototype.next.call(this, value);\n };\n Object.defineProperty(CountedSubject.prototype, \"numberOfNextedValues\", {\n get: function () {\n return this._numberOfNextedValues;\n },\n enumerable: true,\n configurable: true\n });\n return CountedSubject;\n}(Subject_1.Subject));\nvar WindowTimeSubscriber = (function (_super) {\n __extends(WindowTimeSubscriber, _super);\n function WindowTimeSubscriber(destination, windowTimeSpan, windowCreationInterval, maxWindowSize, scheduler) {\n var _this = _super.call(this, destination) || this;\n _this.destination = destination;\n _this.windowTimeSpan = windowTimeSpan;\n _this.windowCreationInterval = windowCreationInterval;\n _this.maxWindowSize = maxWindowSize;\n _this.scheduler = scheduler;\n _this.windows = [];\n var window = _this.openWindow();\n if (windowCreationInterval !== null && windowCreationInterval >= 0) {\n var closeState = { subscriber: _this, window: window, context: null };\n var creationState = { windowTimeSpan: windowTimeSpan, windowCreationInterval: windowCreationInterval, subscriber: _this, scheduler: scheduler };\n _this.add(scheduler.schedule(dispatchWindowClose, windowTimeSpan, closeState));\n _this.add(scheduler.schedule(dispatchWindowCreation, windowCreationInterval, creationState));\n }\n else {\n var timeSpanOnlyState = { subscriber: _this, window: window, windowTimeSpan: windowTimeSpan };\n _this.add(scheduler.schedule(dispatchWindowTimeSpanOnly, windowTimeSpan, timeSpanOnlyState));\n }\n return _this;\n }\n WindowTimeSubscriber.prototype._next = function (value) {\n var windows = this.windows;\n var len = windows.length;\n for (var i = 0; i < len; i++) {\n var window_1 = windows[i];\n if (!window_1.closed) {\n window_1.next(value);\n if (window_1.numberOfNextedValues >= this.maxWindowSize) {\n this.closeWindow(window_1);\n }\n }\n }\n };\n WindowTimeSubscriber.prototype._error = function (err) {\n var windows = this.windows;\n while (windows.length > 0) {\n windows.shift().error(err);\n }\n this.destination.error(err);\n };\n WindowTimeSubscriber.prototype._complete = function () {\n var windows = this.windows;\n while (windows.length > 0) {\n var window_2 = windows.shift();\n if (!window_2.closed) {\n window_2.complete();\n }\n }\n this.destination.complete();\n };\n WindowTimeSubscriber.prototype.openWindow = function () {\n var window = new CountedSubject();\n this.windows.push(window);\n var destination = this.destination;\n destination.next(window);\n return window;\n };\n WindowTimeSubscriber.prototype.closeWindow = function (window) {\n window.complete();\n var windows = this.windows;\n windows.splice(windows.indexOf(window), 1);\n };\n return WindowTimeSubscriber;\n}(Subscriber_1.Subscriber));\nfunction dispatchWindowTimeSpanOnly(state) {\n var subscriber = state.subscriber, windowTimeSpan = state.windowTimeSpan, window = state.window;\n if (window) {\n subscriber.closeWindow(window);\n }\n state.window = subscriber.openWindow();\n this.schedule(state, windowTimeSpan);\n}\nfunction dispatchWindowCreation(state) {\n var windowTimeSpan = state.windowTimeSpan, subscriber = state.subscriber, scheduler = state.scheduler, windowCreationInterval = state.windowCreationInterval;\n var window = subscriber.openWindow();\n var action = this;\n var context = { action: action, subscription: null };\n var timeSpanState = { subscriber: subscriber, window: window, context: context };\n context.subscription = scheduler.schedule(dispatchWindowClose, windowTimeSpan, timeSpanState);\n action.add(context.subscription);\n action.schedule(state, windowCreationInterval);\n}\nfunction dispatchWindowClose(state) {\n var subscriber = state.subscriber, window = state.window, context = state.context;\n if (context && context.action && context.subscription) {\n context.action.remove(context.subscription);\n }\n subscriber.closeWindow(window);\n}\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subject_1 = require(\"../Subject\");\nvar Subscription_1 = require(\"../Subscription\");\nvar OuterSubscriber_1 = require(\"../OuterSubscriber\");\nvar subscribeToResult_1 = require(\"../util/subscribeToResult\");\nfunction windowToggle(openings, closingSelector) {\n return function (source) { return source.lift(new WindowToggleOperator(openings, closingSelector)); };\n}\nexports.windowToggle = windowToggle;\nvar WindowToggleOperator = (function () {\n function WindowToggleOperator(openings, closingSelector) {\n this.openings = openings;\n this.closingSelector = closingSelector;\n }\n WindowToggleOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new WindowToggleSubscriber(subscriber, this.openings, this.closingSelector));\n };\n return WindowToggleOperator;\n}());\nvar WindowToggleSubscriber = (function (_super) {\n __extends(WindowToggleSubscriber, _super);\n function WindowToggleSubscriber(destination, openings, closingSelector) {\n var _this = _super.call(this, destination) || this;\n _this.openings = openings;\n _this.closingSelector = closingSelector;\n _this.contexts = [];\n _this.add(_this.openSubscription = subscribeToResult_1.subscribeToResult(_this, openings, openings));\n return _this;\n }\n WindowToggleSubscriber.prototype._next = function (value) {\n var contexts = this.contexts;\n if (contexts) {\n var len = contexts.length;\n for (var i = 0; i < len; i++) {\n contexts[i].window.next(value);\n }\n }\n };\n WindowToggleSubscriber.prototype._error = function (err) {\n var contexts = this.contexts;\n this.contexts = null;\n if (contexts) {\n var len = contexts.length;\n var index = -1;\n while (++index < len) {\n var context_1 = contexts[index];\n context_1.window.error(err);\n context_1.subscription.unsubscribe();\n }\n }\n _super.prototype._error.call(this, err);\n };\n WindowToggleSubscriber.prototype._complete = function () {\n var contexts = this.contexts;\n this.contexts = null;\n if (contexts) {\n var len = contexts.length;\n var index = -1;\n while (++index < len) {\n var context_2 = contexts[index];\n context_2.window.complete();\n context_2.subscription.unsubscribe();\n }\n }\n _super.prototype._complete.call(this);\n };\n WindowToggleSubscriber.prototype._unsubscribe = function () {\n var contexts = this.contexts;\n this.contexts = null;\n if (contexts) {\n var len = contexts.length;\n var index = -1;\n while (++index < len) {\n var context_3 = contexts[index];\n context_3.window.unsubscribe();\n context_3.subscription.unsubscribe();\n }\n }\n };\n WindowToggleSubscriber.prototype.notifyNext = function (outerValue, innerValue, outerIndex, innerIndex, innerSub) {\n if (outerValue === this.openings) {\n var closingNotifier = void 0;\n try {\n var closingSelector = this.closingSelector;\n closingNotifier = closingSelector(innerValue);\n }\n catch (e) {\n return this.error(e);\n }\n var window_1 = new Subject_1.Subject();\n var subscription = new Subscription_1.Subscription();\n var context_4 = { window: window_1, subscription: subscription };\n this.contexts.push(context_4);\n var innerSubscription = subscribeToResult_1.subscribeToResult(this, closingNotifier, context_4);\n if (innerSubscription.closed) {\n this.closeWindow(this.contexts.length - 1);\n }\n else {\n innerSubscription.context = context_4;\n subscription.add(innerSubscription);\n }\n this.destination.next(window_1);\n }\n else {\n this.closeWindow(this.contexts.indexOf(outerValue));\n }\n };\n WindowToggleSubscriber.prototype.notifyError = function (err) {\n this.error(err);\n };\n WindowToggleSubscriber.prototype.notifyComplete = function (inner) {\n if (inner !== this.openSubscription) {\n this.closeWindow(this.contexts.indexOf(inner.context));\n }\n };\n WindowToggleSubscriber.prototype.closeWindow = function (index) {\n if (index === -1) {\n return;\n }\n var contexts = this.contexts;\n var context = contexts[index];\n var window = context.window, subscription = context.subscription;\n contexts.splice(index, 1);\n window.complete();\n subscription.unsubscribe();\n };\n return WindowToggleSubscriber;\n}(OuterSubscriber_1.OuterSubscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subject_1 = require(\"../Subject\");\nvar OuterSubscriber_1 = require(\"../OuterSubscriber\");\nvar subscribeToResult_1 = require(\"../util/subscribeToResult\");\nfunction windowWhen(closingSelector) {\n return function windowWhenOperatorFunction(source) {\n return source.lift(new WindowOperator(closingSelector));\n };\n}\nexports.windowWhen = windowWhen;\nvar WindowOperator = (function () {\n function WindowOperator(closingSelector) {\n this.closingSelector = closingSelector;\n }\n WindowOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new WindowSubscriber(subscriber, this.closingSelector));\n };\n return WindowOperator;\n}());\nvar WindowSubscriber = (function (_super) {\n __extends(WindowSubscriber, _super);\n function WindowSubscriber(destination, closingSelector) {\n var _this = _super.call(this, destination) || this;\n _this.destination = destination;\n _this.closingSelector = closingSelector;\n _this.openWindow();\n return _this;\n }\n WindowSubscriber.prototype.notifyNext = function (_outerValue, _innerValue, _outerIndex, _innerIndex, innerSub) {\n this.openWindow(innerSub);\n };\n WindowSubscriber.prototype.notifyError = function (error) {\n this._error(error);\n };\n WindowSubscriber.prototype.notifyComplete = function (innerSub) {\n this.openWindow(innerSub);\n };\n WindowSubscriber.prototype._next = function (value) {\n this.window.next(value);\n };\n WindowSubscriber.prototype._error = function (err) {\n this.window.error(err);\n this.destination.error(err);\n this.unsubscribeClosingNotification();\n };\n WindowSubscriber.prototype._complete = function () {\n this.window.complete();\n this.destination.complete();\n this.unsubscribeClosingNotification();\n };\n WindowSubscriber.prototype.unsubscribeClosingNotification = function () {\n if (this.closingNotification) {\n this.closingNotification.unsubscribe();\n }\n };\n WindowSubscriber.prototype.openWindow = function (innerSub) {\n if (innerSub === void 0) { innerSub = null; }\n if (innerSub) {\n this.remove(innerSub);\n innerSub.unsubscribe();\n }\n var prevWindow = this.window;\n if (prevWindow) {\n prevWindow.complete();\n }\n var window = this.window = new Subject_1.Subject();\n this.destination.next(window);\n var closingNotifier;\n try {\n var closingSelector = this.closingSelector;\n closingNotifier = closingSelector();\n }\n catch (e) {\n this.destination.error(e);\n this.window.error(e);\n return;\n }\n this.add(this.closingNotification = subscribeToResult_1.subscribeToResult(this, closingNotifier));\n };\n return WindowSubscriber;\n}(OuterSubscriber_1.OuterSubscriber));\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar OuterSubscriber_1 = require(\"../OuterSubscriber\");\nvar subscribeToResult_1 = require(\"../util/subscribeToResult\");\nfunction withLatestFrom() {\n var args = [];\n for (var _i = 0; _i < arguments.length; _i++) {\n args[_i] = arguments[_i];\n }\n return function (source) {\n var project;\n if (typeof args[args.length - 1] === 'function') {\n project = args.pop();\n }\n var observables = args;\n return source.lift(new WithLatestFromOperator(observables, project));\n };\n}\nexports.withLatestFrom = withLatestFrom;\nvar WithLatestFromOperator = (function () {\n function WithLatestFromOperator(observables, project) {\n this.observables = observables;\n this.project = project;\n }\n WithLatestFromOperator.prototype.call = function (subscriber, source) {\n return source.subscribe(new WithLatestFromSubscriber(subscriber, this.observables, this.project));\n };\n return WithLatestFromOperator;\n}());\nvar WithLatestFromSubscriber = (function (_super) {\n __extends(WithLatestFromSubscriber, _super);\n function WithLatestFromSubscriber(destination, observables, project) {\n var _this = _super.call(this, destination) || this;\n _this.observables = observables;\n _this.project = project;\n _this.toRespond = [];\n var len = observables.length;\n _this.values = new Array(len);\n for (var i = 0; i < len; i++) {\n _this.toRespond.push(i);\n }\n for (var i = 0; i < len; i++) {\n var observable = observables[i];\n _this.add(subscribeToResult_1.subscribeToResult(_this, observable, undefined, i));\n }\n return _this;\n }\n WithLatestFromSubscriber.prototype.notifyNext = function (_outerValue, innerValue, outerIndex) {\n this.values[outerIndex] = innerValue;\n var toRespond = this.toRespond;\n if (toRespond.length > 0) {\n var found = toRespond.indexOf(outerIndex);\n if (found !== -1) {\n toRespond.splice(found, 1);\n }\n }\n };\n WithLatestFromSubscriber.prototype.notifyComplete = function () {\n };\n WithLatestFromSubscriber.prototype._next = function (value) {\n if (this.toRespond.length === 0) {\n var args = [value].concat(this.values);\n if (this.project) {\n this._tryProject(args);\n }\n else {\n this.destination.next(args);\n }\n }\n };\n WithLatestFromSubscriber.prototype._tryProject = function (args) {\n var result;\n try {\n result = this.project.apply(this, args);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.next(result);\n };\n return WithLatestFromSubscriber;\n}(OuterSubscriber_1.OuterSubscriber));\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar zip_1 = require(\"../observable/zip\");\nfunction zip() {\n var observables = [];\n for (var _i = 0; _i < arguments.length; _i++) {\n observables[_i] = arguments[_i];\n }\n return function zipOperatorFunction(source) {\n return source.lift.call(zip_1.zip.apply(void 0, [source].concat(observables)));\n };\n}\nexports.zip = zip;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar zip_1 = require(\"../observable/zip\");\nfunction zipAll(project) {\n return function (source) { return source.lift(new zip_1.ZipOperator(project)); };\n}\nexports.zipAll = zipAll;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Observable_1 = require(\"../Observable\");\nvar Subscription_1 = require(\"../Subscription\");\nfunction scheduleArray(input, scheduler) {\n return new Observable_1.Observable(function (subscriber) {\n var sub = new Subscription_1.Subscription();\n var i = 0;\n sub.add(scheduler.schedule(function () {\n if (i === input.length) {\n subscriber.complete();\n return;\n }\n subscriber.next(input[i++]);\n if (!subscriber.closed) {\n sub.add(this.schedule());\n }\n }));\n return sub;\n });\n}\nexports.scheduleArray = scheduleArray;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Observable_1 = require(\"../Observable\");\nvar Subscription_1 = require(\"../Subscription\");\nvar iterator_1 = require(\"../symbol/iterator\");\nfunction scheduleIterable(input, scheduler) {\n if (!input) {\n throw new Error('Iterable cannot be null');\n }\n return new Observable_1.Observable(function (subscriber) {\n var sub = new Subscription_1.Subscription();\n var iterator;\n sub.add(function () {\n if (iterator && typeof iterator.return === 'function') {\n iterator.return();\n }\n });\n sub.add(scheduler.schedule(function () {\n iterator = input[iterator_1.iterator]();\n sub.add(scheduler.schedule(function () {\n if (subscriber.closed) {\n return;\n }\n var value;\n var done;\n try {\n var result = iterator.next();\n value = result.value;\n done = result.done;\n }\n catch (err) {\n subscriber.error(err);\n return;\n }\n if (done) {\n subscriber.complete();\n }\n else {\n subscriber.next(value);\n this.schedule();\n }\n }));\n }));\n return sub;\n });\n}\nexports.scheduleIterable = scheduleIterable;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Observable_1 = require(\"../Observable\");\nvar Subscription_1 = require(\"../Subscription\");\nvar observable_1 = require(\"../symbol/observable\");\nfunction scheduleObservable(input, scheduler) {\n return new Observable_1.Observable(function (subscriber) {\n var sub = new Subscription_1.Subscription();\n sub.add(scheduler.schedule(function () {\n var observable = input[observable_1.observable]();\n sub.add(observable.subscribe({\n next: function (value) { sub.add(scheduler.schedule(function () { return subscriber.next(value); })); },\n error: function (err) { sub.add(scheduler.schedule(function () { return subscriber.error(err); })); },\n complete: function () { sub.add(scheduler.schedule(function () { return subscriber.complete(); })); },\n }));\n }));\n return sub;\n });\n}\nexports.scheduleObservable = scheduleObservable;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Observable_1 = require(\"../Observable\");\nvar Subscription_1 = require(\"../Subscription\");\nfunction schedulePromise(input, scheduler) {\n return new Observable_1.Observable(function (subscriber) {\n var sub = new Subscription_1.Subscription();\n sub.add(scheduler.schedule(function () { return input.then(function (value) {\n sub.add(scheduler.schedule(function () {\n subscriber.next(value);\n sub.add(scheduler.schedule(function () { return subscriber.complete(); }));\n }));\n }, function (err) {\n sub.add(scheduler.schedule(function () { return subscriber.error(err); }));\n }); }));\n return sub;\n });\n}\nexports.schedulePromise = schedulePromise;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar scheduleObservable_1 = require(\"./scheduleObservable\");\nvar schedulePromise_1 = require(\"./schedulePromise\");\nvar scheduleArray_1 = require(\"./scheduleArray\");\nvar scheduleIterable_1 = require(\"./scheduleIterable\");\nvar isInteropObservable_1 = require(\"../util/isInteropObservable\");\nvar isPromise_1 = require(\"../util/isPromise\");\nvar isArrayLike_1 = require(\"../util/isArrayLike\");\nvar isIterable_1 = require(\"../util/isIterable\");\nfunction scheduled(input, scheduler) {\n if (input != null) {\n if (isInteropObservable_1.isInteropObservable(input)) {\n return scheduleObservable_1.scheduleObservable(input, scheduler);\n }\n else if (isPromise_1.isPromise(input)) {\n return schedulePromise_1.schedulePromise(input, scheduler);\n }\n else if (isArrayLike_1.isArrayLike(input)) {\n return scheduleArray_1.scheduleArray(input, scheduler);\n }\n else if (isIterable_1.isIterable(input) || typeof input === 'string') {\n return scheduleIterable_1.scheduleIterable(input, scheduler);\n }\n }\n throw new TypeError((input !== null && typeof input || input) + ' is not observable');\n}\nexports.scheduled = scheduled;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscription_1 = require(\"../Subscription\");\nvar Action = (function (_super) {\n __extends(Action, _super);\n function Action(scheduler, work) {\n return _super.call(this) || this;\n }\n Action.prototype.schedule = function (state, delay) {\n if (delay === void 0) { delay = 0; }\n return this;\n };\n return Action;\n}(Subscription_1.Subscription));\nexports.Action = Action;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Immediate_1 = require(\"../util/Immediate\");\nvar AsyncAction_1 = require(\"./AsyncAction\");\nvar AsapAction = (function (_super) {\n __extends(AsapAction, _super);\n function AsapAction(scheduler, work) {\n var _this = _super.call(this, scheduler, work) || this;\n _this.scheduler = scheduler;\n _this.work = work;\n return _this;\n }\n AsapAction.prototype.requestAsyncId = function (scheduler, id, delay) {\n if (delay === void 0) { delay = 0; }\n if (delay !== null && delay > 0) {\n return _super.prototype.requestAsyncId.call(this, scheduler, id, delay);\n }\n scheduler.actions.push(this);\n return scheduler.scheduled || (scheduler.scheduled = Immediate_1.Immediate.setImmediate(scheduler.flush.bind(scheduler, null)));\n };\n AsapAction.prototype.recycleAsyncId = function (scheduler, id, delay) {\n if (delay === void 0) { delay = 0; }\n if ((delay !== null && delay > 0) || (delay === null && this.delay > 0)) {\n return _super.prototype.recycleAsyncId.call(this, scheduler, id, delay);\n }\n if (scheduler.actions.length === 0) {\n Immediate_1.Immediate.clearImmediate(id);\n scheduler.scheduled = undefined;\n }\n return undefined;\n };\n return AsapAction;\n}(AsyncAction_1.AsyncAction));\nexports.AsapAction = AsapAction;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar AsyncScheduler_1 = require(\"./AsyncScheduler\");\nvar AsapScheduler = (function (_super) {\n __extends(AsapScheduler, _super);\n function AsapScheduler() {\n return _super !== null && _super.apply(this, arguments) || this;\n }\n AsapScheduler.prototype.flush = function (action) {\n this.active = true;\n this.scheduled = undefined;\n var actions = this.actions;\n var error;\n var index = -1;\n var count = actions.length;\n action = action || actions.shift();\n do {\n if (error = action.execute(action.state, action.delay)) {\n break;\n }\n } while (++index < count && (action = actions.shift()));\n this.active = false;\n if (error) {\n while (++index < count && (action = actions.shift())) {\n action.unsubscribe();\n }\n throw error;\n }\n };\n return AsapScheduler;\n}(AsyncScheduler_1.AsyncScheduler));\nexports.AsapScheduler = AsapScheduler;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Action_1 = require(\"./Action\");\nvar AsyncAction = (function (_super) {\n __extends(AsyncAction, _super);\n function AsyncAction(scheduler, work) {\n var _this = _super.call(this, scheduler, work) || this;\n _this.scheduler = scheduler;\n _this.work = work;\n _this.pending = false;\n return _this;\n }\n AsyncAction.prototype.schedule = function (state, delay) {\n if (delay === void 0) { delay = 0; }\n if (this.closed) {\n return this;\n }\n this.state = state;\n var id = this.id;\n var scheduler = this.scheduler;\n if (id != null) {\n this.id = this.recycleAsyncId(scheduler, id, delay);\n }\n this.pending = true;\n this.delay = delay;\n this.id = this.id || this.requestAsyncId(scheduler, this.id, delay);\n return this;\n };\n AsyncAction.prototype.requestAsyncId = function (scheduler, id, delay) {\n if (delay === void 0) { delay = 0; }\n return setInterval(scheduler.flush.bind(scheduler, this), delay);\n };\n AsyncAction.prototype.recycleAsyncId = function (scheduler, id, delay) {\n if (delay === void 0) { delay = 0; }\n if (delay !== null && this.delay === delay && this.pending === false) {\n return id;\n }\n clearInterval(id);\n return undefined;\n };\n AsyncAction.prototype.execute = function (state, delay) {\n if (this.closed) {\n return new Error('executing a cancelled action');\n }\n this.pending = false;\n var error = this._execute(state, delay);\n if (error) {\n return error;\n }\n else if (this.pending === false && this.id != null) {\n this.id = this.recycleAsyncId(this.scheduler, this.id, null);\n }\n };\n AsyncAction.prototype._execute = function (state, delay) {\n var errored = false;\n var errorValue = undefined;\n try {\n this.work(state);\n }\n catch (e) {\n errored = true;\n errorValue = !!e && e || new Error(e);\n }\n if (errored) {\n this.unsubscribe();\n return errorValue;\n }\n };\n AsyncAction.prototype._unsubscribe = function () {\n var id = this.id;\n var scheduler = this.scheduler;\n var actions = scheduler.actions;\n var index = actions.indexOf(this);\n this.work = null;\n this.state = null;\n this.pending = false;\n this.scheduler = null;\n if (index !== -1) {\n actions.splice(index, 1);\n }\n if (id != null) {\n this.id = this.recycleAsyncId(scheduler, id, null);\n }\n this.delay = null;\n };\n return AsyncAction;\n}(Action_1.Action));\nexports.AsyncAction = AsyncAction;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Scheduler_1 = require(\"../Scheduler\");\nvar AsyncScheduler = (function (_super) {\n __extends(AsyncScheduler, _super);\n function AsyncScheduler(SchedulerAction, now) {\n if (now === void 0) { now = Scheduler_1.Scheduler.now; }\n var _this = _super.call(this, SchedulerAction, function () {\n if (AsyncScheduler.delegate && AsyncScheduler.delegate !== _this) {\n return AsyncScheduler.delegate.now();\n }\n else {\n return now();\n }\n }) || this;\n _this.actions = [];\n _this.active = false;\n _this.scheduled = undefined;\n return _this;\n }\n AsyncScheduler.prototype.schedule = function (work, delay, state) {\n if (delay === void 0) { delay = 0; }\n if (AsyncScheduler.delegate && AsyncScheduler.delegate !== this) {\n return AsyncScheduler.delegate.schedule(work, delay, state);\n }\n else {\n return _super.prototype.schedule.call(this, work, delay, state);\n }\n };\n AsyncScheduler.prototype.flush = function (action) {\n var actions = this.actions;\n if (this.active) {\n actions.push(action);\n return;\n }\n var error;\n this.active = true;\n do {\n if (error = action.execute(action.state, action.delay)) {\n break;\n }\n } while (action = actions.shift());\n this.active = false;\n if (error) {\n while (action = actions.shift()) {\n action.unsubscribe();\n }\n throw error;\n }\n };\n return AsyncScheduler;\n}(Scheduler_1.Scheduler));\nexports.AsyncScheduler = AsyncScheduler;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar AsyncAction_1 = require(\"./AsyncAction\");\nvar QueueAction = (function (_super) {\n __extends(QueueAction, _super);\n function QueueAction(scheduler, work) {\n var _this = _super.call(this, scheduler, work) || this;\n _this.scheduler = scheduler;\n _this.work = work;\n return _this;\n }\n QueueAction.prototype.schedule = function (state, delay) {\n if (delay === void 0) { delay = 0; }\n if (delay > 0) {\n return _super.prototype.schedule.call(this, state, delay);\n }\n this.delay = delay;\n this.state = state;\n this.scheduler.flush(this);\n return this;\n };\n QueueAction.prototype.execute = function (state, delay) {\n return (delay > 0 || this.closed) ?\n _super.prototype.execute.call(this, state, delay) :\n this._execute(state, delay);\n };\n QueueAction.prototype.requestAsyncId = function (scheduler, id, delay) {\n if (delay === void 0) { delay = 0; }\n if ((delay !== null && delay > 0) || (delay === null && this.delay > 0)) {\n return _super.prototype.requestAsyncId.call(this, scheduler, id, delay);\n }\n return scheduler.flush(this);\n };\n return QueueAction;\n}(AsyncAction_1.AsyncAction));\nexports.QueueAction = QueueAction;\n","\"use strict\";\nvar __extends = (this && this.__extends) || (function () {\n var extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf ||\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\n return extendStatics(d, b);\n }\n return function (d, b) {\n extendStatics(d, b);\n function __() { this.constructor = d; }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n };\n})();\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar AsyncScheduler_1 = require(\"./AsyncScheduler\");\nvar QueueScheduler = (function (_super) {\n __extends(QueueScheduler, _super);\n function QueueScheduler() {\n return _super !== null && _super.apply(this, arguments) || this;\n }\n return QueueScheduler;\n}(AsyncScheduler_1.AsyncScheduler));\nexports.QueueScheduler = QueueScheduler;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar AsapAction_1 = require(\"./AsapAction\");\nvar AsapScheduler_1 = require(\"./AsapScheduler\");\nexports.asapScheduler = new AsapScheduler_1.AsapScheduler(AsapAction_1.AsapAction);\nexports.asap = exports.asapScheduler;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar AsyncAction_1 = require(\"./AsyncAction\");\nvar AsyncScheduler_1 = require(\"./AsyncScheduler\");\nexports.asyncScheduler = new AsyncScheduler_1.AsyncScheduler(AsyncAction_1.AsyncAction);\nexports.async = exports.asyncScheduler;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar QueueAction_1 = require(\"./QueueAction\");\nvar QueueScheduler_1 = require(\"./QueueScheduler\");\nexports.queueScheduler = new QueueScheduler_1.QueueScheduler(QueueAction_1.QueueAction);\nexports.queue = exports.queueScheduler;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nfunction getSymbolIterator() {\n if (typeof Symbol !== 'function' || !Symbol.iterator) {\n return '@@iterator';\n }\n return Symbol.iterator;\n}\nexports.getSymbolIterator = getSymbolIterator;\nexports.iterator = getSymbolIterator();\nexports.$$iterator = exports.iterator;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.observable = (function () { return typeof Symbol === 'function' && Symbol.observable || '@@observable'; })();\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.rxSubscriber = (function () {\n return typeof Symbol === 'function'\n ? Symbol('rxSubscriber')\n : '@@rxSubscriber_' + Math.random();\n})();\nexports.$$rxSubscriber = exports.rxSubscriber;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar ArgumentOutOfRangeErrorImpl = (function () {\n function ArgumentOutOfRangeErrorImpl() {\n Error.call(this);\n this.message = 'argument out of range';\n this.name = 'ArgumentOutOfRangeError';\n return this;\n }\n ArgumentOutOfRangeErrorImpl.prototype = Object.create(Error.prototype);\n return ArgumentOutOfRangeErrorImpl;\n})();\nexports.ArgumentOutOfRangeError = ArgumentOutOfRangeErrorImpl;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar EmptyErrorImpl = (function () {\n function EmptyErrorImpl() {\n Error.call(this);\n this.message = 'no elements in sequence';\n this.name = 'EmptyError';\n return this;\n }\n EmptyErrorImpl.prototype = Object.create(Error.prototype);\n return EmptyErrorImpl;\n})();\nexports.EmptyError = EmptyErrorImpl;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar nextHandle = 1;\nvar RESOLVED = (function () { return Promise.resolve(); })();\nvar activeHandles = {};\nfunction findAndClearHandle(handle) {\n if (handle in activeHandles) {\n delete activeHandles[handle];\n return true;\n }\n return false;\n}\nexports.Immediate = {\n setImmediate: function (cb) {\n var handle = nextHandle++;\n activeHandles[handle] = true;\n RESOLVED.then(function () { return findAndClearHandle(handle) && cb(); });\n return handle;\n },\n clearImmediate: function (handle) {\n findAndClearHandle(handle);\n },\n};\nexports.TestTools = {\n pending: function () {\n return Object.keys(activeHandles).length;\n }\n};\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar ObjectUnsubscribedErrorImpl = (function () {\n function ObjectUnsubscribedErrorImpl() {\n Error.call(this);\n this.message = 'object unsubscribed';\n this.name = 'ObjectUnsubscribedError';\n return this;\n }\n ObjectUnsubscribedErrorImpl.prototype = Object.create(Error.prototype);\n return ObjectUnsubscribedErrorImpl;\n})();\nexports.ObjectUnsubscribedError = ObjectUnsubscribedErrorImpl;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar TimeoutErrorImpl = (function () {\n function TimeoutErrorImpl() {\n Error.call(this);\n this.message = 'Timeout has occurred';\n this.name = 'TimeoutError';\n return this;\n }\n TimeoutErrorImpl.prototype = Object.create(Error.prototype);\n return TimeoutErrorImpl;\n})();\nexports.TimeoutError = TimeoutErrorImpl;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar UnsubscriptionErrorImpl = (function () {\n function UnsubscriptionErrorImpl(errors) {\n Error.call(this);\n this.message = errors ?\n errors.length + \" errors occurred during unsubscription:\\n\" + errors.map(function (err, i) { return i + 1 + \") \" + err.toString(); }).join('\\n ') : '';\n this.name = 'UnsubscriptionError';\n this.errors = errors;\n return this;\n }\n UnsubscriptionErrorImpl.prototype = Object.create(Error.prototype);\n return UnsubscriptionErrorImpl;\n})();\nexports.UnsubscriptionError = UnsubscriptionErrorImpl;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nfunction canReportError(observer) {\n while (observer) {\n var _a = observer, closed_1 = _a.closed, destination = _a.destination, isStopped = _a.isStopped;\n if (closed_1 || isStopped) {\n return false;\n }\n else if (destination && destination instanceof Subscriber_1.Subscriber) {\n observer = destination;\n }\n else {\n observer = null;\n }\n }\n return true;\n}\nexports.canReportError = canReportError;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nfunction hostReportError(err) {\n setTimeout(function () { throw err; }, 0);\n}\nexports.hostReportError = hostReportError;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nfunction identity(x) {\n return x;\n}\nexports.identity = identity;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.isArray = (function () { return Array.isArray || (function (x) { return x && typeof x.length === 'number'; }); })();\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.isArrayLike = (function (x) { return x && typeof x.length === 'number' && typeof x !== 'function'; });\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nfunction isDate(value) {\n return value instanceof Date && !isNaN(+value);\n}\nexports.isDate = isDate;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nfunction isFunction(x) {\n return typeof x === 'function';\n}\nexports.isFunction = isFunction;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar observable_1 = require(\"../symbol/observable\");\nfunction isInteropObservable(input) {\n return input && typeof input[observable_1.observable] === 'function';\n}\nexports.isInteropObservable = isInteropObservable;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar iterator_1 = require(\"../symbol/iterator\");\nfunction isIterable(input) {\n return input && typeof input[iterator_1.iterator] === 'function';\n}\nexports.isIterable = isIterable;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar isArray_1 = require(\"./isArray\");\nfunction isNumeric(val) {\n return !isArray_1.isArray(val) && (val - parseFloat(val) + 1) >= 0;\n}\nexports.isNumeric = isNumeric;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nfunction isObject(x) {\n return x !== null && typeof x === 'object';\n}\nexports.isObject = isObject;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nfunction isPromise(value) {\n return !!value && typeof value.subscribe !== 'function' && typeof value.then === 'function';\n}\nexports.isPromise = isPromise;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nfunction isScheduler(value) {\n return value && typeof value.schedule === 'function';\n}\nexports.isScheduler = isScheduler;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nfunction noop() { }\nexports.noop = noop;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nfunction not(pred, thisArg) {\n function notPred() {\n return !(notPred.pred.apply(notPred.thisArg, arguments));\n }\n notPred.pred = pred;\n notPred.thisArg = thisArg;\n return notPred;\n}\nexports.not = not;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar identity_1 = require(\"./identity\");\nfunction pipe() {\n var fns = [];\n for (var _i = 0; _i < arguments.length; _i++) {\n fns[_i] = arguments[_i];\n }\n return pipeFromArray(fns);\n}\nexports.pipe = pipe;\nfunction pipeFromArray(fns) {\n if (fns.length === 0) {\n return identity_1.identity;\n }\n if (fns.length === 1) {\n return fns[0];\n }\n return function piped(input) {\n return fns.reduce(function (prev, fn) { return fn(prev); }, input);\n };\n}\nexports.pipeFromArray = pipeFromArray;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar subscribeToArray_1 = require(\"./subscribeToArray\");\nvar subscribeToPromise_1 = require(\"./subscribeToPromise\");\nvar subscribeToIterable_1 = require(\"./subscribeToIterable\");\nvar subscribeToObservable_1 = require(\"./subscribeToObservable\");\nvar isArrayLike_1 = require(\"./isArrayLike\");\nvar isPromise_1 = require(\"./isPromise\");\nvar isObject_1 = require(\"./isObject\");\nvar iterator_1 = require(\"../symbol/iterator\");\nvar observable_1 = require(\"../symbol/observable\");\nexports.subscribeTo = function (result) {\n if (!!result && typeof result[observable_1.observable] === 'function') {\n return subscribeToObservable_1.subscribeToObservable(result);\n }\n else if (isArrayLike_1.isArrayLike(result)) {\n return subscribeToArray_1.subscribeToArray(result);\n }\n else if (isPromise_1.isPromise(result)) {\n return subscribeToPromise_1.subscribeToPromise(result);\n }\n else if (!!result && typeof result[iterator_1.iterator] === 'function') {\n return subscribeToIterable_1.subscribeToIterable(result);\n }\n else {\n var value = isObject_1.isObject(result) ? 'an invalid object' : \"'\" + result + \"'\";\n var msg = \"You provided \" + value + \" where a stream was expected.\"\n + ' You can provide an Observable, Promise, Array, or Iterable.';\n throw new TypeError(msg);\n }\n};\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.subscribeToArray = function (array) { return function (subscriber) {\n for (var i = 0, len = array.length; i < len && !subscriber.closed; i++) {\n subscriber.next(array[i]);\n }\n subscriber.complete();\n}; };\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar iterator_1 = require(\"../symbol/iterator\");\nexports.subscribeToIterable = function (iterable) { return function (subscriber) {\n var iterator = iterable[iterator_1.iterator]();\n do {\n var item = void 0;\n try {\n item = iterator.next();\n }\n catch (err) {\n subscriber.error(err);\n return subscriber;\n }\n if (item.done) {\n subscriber.complete();\n break;\n }\n subscriber.next(item.value);\n if (subscriber.closed) {\n break;\n }\n } while (true);\n if (typeof iterator.return === 'function') {\n subscriber.add(function () {\n if (iterator.return) {\n iterator.return();\n }\n });\n }\n return subscriber;\n}; };\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar observable_1 = require(\"../symbol/observable\");\nexports.subscribeToObservable = function (obj) { return function (subscriber) {\n var obs = obj[observable_1.observable]();\n if (typeof obs.subscribe !== 'function') {\n throw new TypeError('Provided object does not correctly implement Symbol.observable');\n }\n else {\n return obs.subscribe(subscriber);\n }\n}; };\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar hostReportError_1 = require(\"./hostReportError\");\nexports.subscribeToPromise = function (promise) { return function (subscriber) {\n promise.then(function (value) {\n if (!subscriber.closed) {\n subscriber.next(value);\n subscriber.complete();\n }\n }, function (err) { return subscriber.error(err); })\n .then(null, hostReportError_1.hostReportError);\n return subscriber;\n}; };\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar InnerSubscriber_1 = require(\"../InnerSubscriber\");\nvar subscribeTo_1 = require(\"./subscribeTo\");\nvar Observable_1 = require(\"../Observable\");\nfunction subscribeToResult(outerSubscriber, result, outerValue, outerIndex, innerSubscriber) {\n if (innerSubscriber === void 0) { innerSubscriber = new InnerSubscriber_1.InnerSubscriber(outerSubscriber, outerValue, outerIndex); }\n if (innerSubscriber.closed) {\n return undefined;\n }\n if (result instanceof Observable_1.Observable) {\n return result.subscribe(innerSubscriber);\n }\n return subscribeTo_1.subscribeTo(result)(innerSubscriber);\n}\nexports.subscribeToResult = subscribeToResult;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar Subscriber_1 = require(\"../Subscriber\");\nvar rxSubscriber_1 = require(\"../symbol/rxSubscriber\");\nvar Observer_1 = require(\"../Observer\");\nfunction toSubscriber(nextOrObserver, error, complete) {\n if (nextOrObserver) {\n if (nextOrObserver instanceof Subscriber_1.Subscriber) {\n return nextOrObserver;\n }\n if (nextOrObserver[rxSubscriber_1.rxSubscriber]) {\n return nextOrObserver[rxSubscriber_1.rxSubscriber]();\n }\n }\n if (!nextOrObserver && !error && !complete) {\n return new Subscriber_1.Subscriber(Observer_1.empty);\n }\n return new Subscriber_1.Subscriber(nextOrObserver, error, complete);\n}\nexports.toSubscriber = toSubscriber;\n","var si = typeof setImmediate === 'function', tick;\nif (si) {\n tick = function (fn) { setImmediate(fn); };\n} else {\n tick = function (fn) { setTimeout(fn, 0); };\n}\n\nmodule.exports = tick;","/*! *****************************************************************************\r\nCopyright (c) Microsoft Corporation.\r\n\r\nPermission to use, copy, modify, and/or distribute this software for any\r\npurpose with or without fee is hereby granted.\r\n\r\nTHE SOFTWARE IS PROVIDED \"AS IS\" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH\r\nREGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY\r\nAND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,\r\nINDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM\r\nLOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR\r\nOTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR\r\nPERFORMANCE OF THIS SOFTWARE.\r\n***************************************************************************** */\r\n/* global Reflect, Promise */\r\n\r\nvar extendStatics = function(d, b) {\r\n extendStatics = Object.setPrototypeOf ||\r\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\r\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\r\n return extendStatics(d, b);\r\n};\r\n\r\nexport function __extends(d, b) {\r\n extendStatics(d, b);\r\n function __() { this.constructor = d; }\r\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\r\n}\r\n\r\nexport var __assign = function() {\r\n __assign = Object.assign || function __assign(t) {\r\n for (var s, i = 1, n = arguments.length; i < n; i++) {\r\n s = arguments[i];\r\n for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p];\r\n }\r\n return t;\r\n }\r\n return __assign.apply(this, arguments);\r\n}\r\n\r\nexport function __rest(s, e) {\r\n var t = {};\r\n for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0)\r\n t[p] = s[p];\r\n if (s != null && typeof Object.getOwnPropertySymbols === \"function\")\r\n for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) {\r\n if (e.indexOf(p[i]) < 0 && Object.prototype.propertyIsEnumerable.call(s, p[i]))\r\n t[p[i]] = s[p[i]];\r\n }\r\n return t;\r\n}\r\n\r\nexport function __decorate(decorators, target, key, desc) {\r\n var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d;\r\n if (typeof Reflect === \"object\" && typeof Reflect.decorate === \"function\") r = Reflect.decorate(decorators, target, key, desc);\r\n else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r;\r\n return c > 3 && r && Object.defineProperty(target, key, r), r;\r\n}\r\n\r\nexport function __param(paramIndex, decorator) {\r\n return function (target, key) { decorator(target, key, paramIndex); }\r\n}\r\n\r\nexport function __metadata(metadataKey, metadataValue) {\r\n if (typeof Reflect === \"object\" && typeof Reflect.metadata === \"function\") return Reflect.metadata(metadataKey, metadataValue);\r\n}\r\n\r\nexport function __awaiter(thisArg, _arguments, P, generator) {\r\n function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); }\r\n return new (P || (P = Promise))(function (resolve, reject) {\r\n function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }\r\n function rejected(value) { try { step(generator[\"throw\"](value)); } catch (e) { reject(e); } }\r\n function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); }\r\n step((generator = generator.apply(thisArg, _arguments || [])).next());\r\n });\r\n}\r\n\r\nexport function __generator(thisArg, body) {\r\n var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g;\r\n return g = { next: verb(0), \"throw\": verb(1), \"return\": verb(2) }, typeof Symbol === \"function\" && (g[Symbol.iterator] = function() { return this; }), g;\r\n function verb(n) { return function (v) { return step([n, v]); }; }\r\n function step(op) {\r\n if (f) throw new TypeError(\"Generator is already executing.\");\r\n while (_) try {\r\n if (f = 1, y && (t = op[0] & 2 ? y[\"return\"] : op[0] ? y[\"throw\"] || ((t = y[\"return\"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t;\r\n if (y = 0, t) op = [op[0] & 2, t.value];\r\n switch (op[0]) {\r\n case 0: case 1: t = op; break;\r\n case 4: _.label++; return { value: op[1], done: false };\r\n case 5: _.label++; y = op[1]; op = [0]; continue;\r\n case 7: op = _.ops.pop(); _.trys.pop(); continue;\r\n default:\r\n if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; }\r\n if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; }\r\n if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; }\r\n if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; }\r\n if (t[2]) _.ops.pop();\r\n _.trys.pop(); continue;\r\n }\r\n op = body.call(thisArg, _);\r\n } catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; }\r\n if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true };\r\n }\r\n}\r\n\r\nexport function __createBinding(o, m, k, k2) {\r\n if (k2 === undefined) k2 = k;\r\n o[k2] = m[k];\r\n}\r\n\r\nexport function __exportStar(m, exports) {\r\n for (var p in m) if (p !== \"default\" && !exports.hasOwnProperty(p)) exports[p] = m[p];\r\n}\r\n\r\nexport function __values(o) {\r\n var s = typeof Symbol === \"function\" && Symbol.iterator, m = s && o[s], i = 0;\r\n if (m) return m.call(o);\r\n if (o && typeof o.length === \"number\") return {\r\n next: function () {\r\n if (o && i >= o.length) o = void 0;\r\n return { value: o && o[i++], done: !o };\r\n }\r\n };\r\n throw new TypeError(s ? \"Object is not iterable.\" : \"Symbol.iterator is not defined.\");\r\n}\r\n\r\nexport function __read(o, n) {\r\n var m = typeof Symbol === \"function\" && o[Symbol.iterator];\r\n if (!m) return o;\r\n var i = m.call(o), r, ar = [], e;\r\n try {\r\n while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value);\r\n }\r\n catch (error) { e = { error: error }; }\r\n finally {\r\n try {\r\n if (r && !r.done && (m = i[\"return\"])) m.call(i);\r\n }\r\n finally { if (e) throw e.error; }\r\n }\r\n return ar;\r\n}\r\n\r\nexport function __spread() {\r\n for (var ar = [], i = 0; i < arguments.length; i++)\r\n ar = ar.concat(__read(arguments[i]));\r\n return ar;\r\n}\r\n\r\nexport function __spreadArrays() {\r\n for (var s = 0, i = 0, il = arguments.length; i < il; i++) s += arguments[i].length;\r\n for (var r = Array(s), k = 0, i = 0; i < il; i++)\r\n for (var a = arguments[i], j = 0, jl = a.length; j < jl; j++, k++)\r\n r[k] = a[j];\r\n return r;\r\n};\r\n\r\nexport function __await(v) {\r\n return this instanceof __await ? (this.v = v, this) : new __await(v);\r\n}\r\n\r\nexport function __asyncGenerator(thisArg, _arguments, generator) {\r\n if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n var g = generator.apply(thisArg, _arguments || []), i, q = [];\r\n return i = {}, verb(\"next\"), verb(\"throw\"), verb(\"return\"), i[Symbol.asyncIterator] = function () { return this; }, i;\r\n function verb(n) { if (g[n]) i[n] = function (v) { return new Promise(function (a, b) { q.push([n, v, a, b]) > 1 || resume(n, v); }); }; }\r\n function resume(n, v) { try { step(g[n](v)); } catch (e) { settle(q[0][3], e); } }\r\n function step(r) { r.value instanceof __await ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); }\r\n function fulfill(value) { resume(\"next\", value); }\r\n function reject(value) { resume(\"throw\", value); }\r\n function settle(f, v) { if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); }\r\n}\r\n\r\nexport function __asyncDelegator(o) {\r\n var i, p;\r\n return i = {}, verb(\"next\"), verb(\"throw\", function (e) { throw e; }), verb(\"return\"), i[Symbol.iterator] = function () { return this; }, i;\r\n function verb(n, f) { i[n] = o[n] ? function (v) { return (p = !p) ? { value: __await(o[n](v)), done: n === \"return\" } : f ? f(v) : v; } : f; }\r\n}\r\n\r\nexport function __asyncValues(o) {\r\n if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n var m = o[Symbol.asyncIterator], i;\r\n return m ? m.call(o) : (o = typeof __values === \"function\" ? __values(o) : o[Symbol.iterator](), i = {}, verb(\"next\"), verb(\"throw\"), verb(\"return\"), i[Symbol.asyncIterator] = function () { return this; }, i);\r\n function verb(n) { i[n] = o[n] && function (v) { return new Promise(function (resolve, reject) { v = o[n](v), settle(resolve, reject, v.done, v.value); }); }; }\r\n function settle(resolve, reject, d, v) { Promise.resolve(v).then(function(v) { resolve({ value: v, done: d }); }, reject); }\r\n}\r\n\r\nexport function __makeTemplateObject(cooked, raw) {\r\n if (Object.defineProperty) { Object.defineProperty(cooked, \"raw\", { value: raw }); } else { cooked.raw = raw; }\r\n return cooked;\r\n};\r\n\r\nexport function __importStar(mod) {\r\n if (mod && mod.__esModule) return mod;\r\n var result = {};\r\n if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k];\r\n result.default = mod;\r\n return result;\r\n}\r\n\r\nexport function __importDefault(mod) {\r\n return (mod && mod.__esModule) ? mod : { default: mod };\r\n}\r\n\r\nexport function __classPrivateFieldGet(receiver, privateMap) {\r\n if (!privateMap.has(receiver)) {\r\n throw new TypeError(\"attempted to get private field on non-instance\");\r\n }\r\n return privateMap.get(receiver);\r\n}\r\n\r\nexport function __classPrivateFieldSet(receiver, privateMap, value) {\r\n if (!privateMap.has(receiver)) {\r\n throw new TypeError(\"attempted to set private field on non-instance\");\r\n }\r\n privateMap.set(receiver, value);\r\n return value;\r\n}\r\n","/******************************************************************************\r\nCopyright (c) Microsoft Corporation.\r\n\r\nPermission to use, copy, modify, and/or distribute this software for any\r\npurpose with or without fee is hereby granted.\r\n\r\nTHE SOFTWARE IS PROVIDED \"AS IS\" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH\r\nREGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY\r\nAND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,\r\nINDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM\r\nLOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR\r\nOTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR\r\nPERFORMANCE OF THIS SOFTWARE.\r\n***************************************************************************** */\r\n/* global Reflect, Promise */\r\n\r\nvar extendStatics = function(d, b) {\r\n extendStatics = Object.setPrototypeOf ||\r\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\r\n function (d, b) { for (var p in b) if (Object.prototype.hasOwnProperty.call(b, p)) d[p] = b[p]; };\r\n return extendStatics(d, b);\r\n};\r\n\r\nexport function __extends(d, b) {\r\n if (typeof b !== \"function\" && b !== null)\r\n throw new TypeError(\"Class extends value \" + String(b) + \" is not a constructor or null\");\r\n extendStatics(d, b);\r\n function __() { this.constructor = d; }\r\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\r\n}\r\n\r\nexport var __assign = function() {\r\n __assign = Object.assign || function __assign(t) {\r\n for (var s, i = 1, n = arguments.length; i < n; i++) {\r\n s = arguments[i];\r\n for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p];\r\n }\r\n return t;\r\n }\r\n return __assign.apply(this, arguments);\r\n}\r\n\r\nexport function __rest(s, e) {\r\n var t = {};\r\n for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0)\r\n t[p] = s[p];\r\n if (s != null && typeof Object.getOwnPropertySymbols === \"function\")\r\n for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) {\r\n if (e.indexOf(p[i]) < 0 && Object.prototype.propertyIsEnumerable.call(s, p[i]))\r\n t[p[i]] = s[p[i]];\r\n }\r\n return t;\r\n}\r\n\r\nexport function __decorate(decorators, target, key, desc) {\r\n var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d;\r\n if (typeof Reflect === \"object\" && typeof Reflect.decorate === \"function\") r = Reflect.decorate(decorators, target, key, desc);\r\n else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r;\r\n return c > 3 && r && Object.defineProperty(target, key, r), r;\r\n}\r\n\r\nexport function __param(paramIndex, decorator) {\r\n return function (target, key) { decorator(target, key, paramIndex); }\r\n}\r\n\r\nexport function __metadata(metadataKey, metadataValue) {\r\n if (typeof Reflect === \"object\" && typeof Reflect.metadata === \"function\") return Reflect.metadata(metadataKey, metadataValue);\r\n}\r\n\r\nexport function __awaiter(thisArg, _arguments, P, generator) {\r\n function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); }\r\n return new (P || (P = Promise))(function (resolve, reject) {\r\n function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }\r\n function rejected(value) { try { step(generator[\"throw\"](value)); } catch (e) { reject(e); } }\r\n function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); }\r\n step((generator = generator.apply(thisArg, _arguments || [])).next());\r\n });\r\n}\r\n\r\nexport function __generator(thisArg, body) {\r\n var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g;\r\n return g = { next: verb(0), \"throw\": verb(1), \"return\": verb(2) }, typeof Symbol === \"function\" && (g[Symbol.iterator] = function() { return this; }), g;\r\n function verb(n) { return function (v) { return step([n, v]); }; }\r\n function step(op) {\r\n if (f) throw new TypeError(\"Generator is already executing.\");\r\n while (_) try {\r\n if (f = 1, y && (t = op[0] & 2 ? y[\"return\"] : op[0] ? y[\"throw\"] || ((t = y[\"return\"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t;\r\n if (y = 0, t) op = [op[0] & 2, t.value];\r\n switch (op[0]) {\r\n case 0: case 1: t = op; break;\r\n case 4: _.label++; return { value: op[1], done: false };\r\n case 5: _.label++; y = op[1]; op = [0]; continue;\r\n case 7: op = _.ops.pop(); _.trys.pop(); continue;\r\n default:\r\n if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; }\r\n if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; }\r\n if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; }\r\n if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; }\r\n if (t[2]) _.ops.pop();\r\n _.trys.pop(); continue;\r\n }\r\n op = body.call(thisArg, _);\r\n } catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; }\r\n if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true };\r\n }\r\n}\r\n\r\nexport var __createBinding = Object.create ? (function(o, m, k, k2) {\r\n if (k2 === undefined) k2 = k;\r\n var desc = Object.getOwnPropertyDescriptor(m, k);\r\n if (!desc || (\"get\" in desc ? !m.__esModule : desc.writable || desc.configurable)) {\r\n desc = { enumerable: true, get: function() { return m[k]; } };\r\n }\r\n Object.defineProperty(o, k2, desc);\r\n}) : (function(o, m, k, k2) {\r\n if (k2 === undefined) k2 = k;\r\n o[k2] = m[k];\r\n});\r\n\r\nexport function __exportStar(m, o) {\r\n for (var p in m) if (p !== \"default\" && !Object.prototype.hasOwnProperty.call(o, p)) __createBinding(o, m, p);\r\n}\r\n\r\nexport function __values(o) {\r\n var s = typeof Symbol === \"function\" && Symbol.iterator, m = s && o[s], i = 0;\r\n if (m) return m.call(o);\r\n if (o && typeof o.length === \"number\") return {\r\n next: function () {\r\n if (o && i >= o.length) o = void 0;\r\n return { value: o && o[i++], done: !o };\r\n }\r\n };\r\n throw new TypeError(s ? \"Object is not iterable.\" : \"Symbol.iterator is not defined.\");\r\n}\r\n\r\nexport function __read(o, n) {\r\n var m = typeof Symbol === \"function\" && o[Symbol.iterator];\r\n if (!m) return o;\r\n var i = m.call(o), r, ar = [], e;\r\n try {\r\n while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value);\r\n }\r\n catch (error) { e = { error: error }; }\r\n finally {\r\n try {\r\n if (r && !r.done && (m = i[\"return\"])) m.call(i);\r\n }\r\n finally { if (e) throw e.error; }\r\n }\r\n return ar;\r\n}\r\n\r\n/** @deprecated */\r\nexport function __spread() {\r\n for (var ar = [], i = 0; i < arguments.length; i++)\r\n ar = ar.concat(__read(arguments[i]));\r\n return ar;\r\n}\r\n\r\n/** @deprecated */\r\nexport function __spreadArrays() {\r\n for (var s = 0, i = 0, il = arguments.length; i < il; i++) s += arguments[i].length;\r\n for (var r = Array(s), k = 0, i = 0; i < il; i++)\r\n for (var a = arguments[i], j = 0, jl = a.length; j < jl; j++, k++)\r\n r[k] = a[j];\r\n return r;\r\n}\r\n\r\nexport function __spreadArray(to, from, pack) {\r\n if (pack || arguments.length === 2) for (var i = 0, l = from.length, ar; i < l; i++) {\r\n if (ar || !(i in from)) {\r\n if (!ar) ar = Array.prototype.slice.call(from, 0, i);\r\n ar[i] = from[i];\r\n }\r\n }\r\n return to.concat(ar || Array.prototype.slice.call(from));\r\n}\r\n\r\nexport function __await(v) {\r\n return this instanceof __await ? (this.v = v, this) : new __await(v);\r\n}\r\n\r\nexport function __asyncGenerator(thisArg, _arguments, generator) {\r\n if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n var g = generator.apply(thisArg, _arguments || []), i, q = [];\r\n return i = {}, verb(\"next\"), verb(\"throw\"), verb(\"return\"), i[Symbol.asyncIterator] = function () { return this; }, i;\r\n function verb(n) { if (g[n]) i[n] = function (v) { return new Promise(function (a, b) { q.push([n, v, a, b]) > 1 || resume(n, v); }); }; }\r\n function resume(n, v) { try { step(g[n](v)); } catch (e) { settle(q[0][3], e); } }\r\n function step(r) { r.value instanceof __await ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); }\r\n function fulfill(value) { resume(\"next\", value); }\r\n function reject(value) { resume(\"throw\", value); }\r\n function settle(f, v) { if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); }\r\n}\r\n\r\nexport function __asyncDelegator(o) {\r\n var i, p;\r\n return i = {}, verb(\"next\"), verb(\"throw\", function (e) { throw e; }), verb(\"return\"), i[Symbol.iterator] = function () { return this; }, i;\r\n function verb(n, f) { i[n] = o[n] ? function (v) { return (p = !p) ? { value: __await(o[n](v)), done: n === \"return\" } : f ? f(v) : v; } : f; }\r\n}\r\n\r\nexport function __asyncValues(o) {\r\n if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n var m = o[Symbol.asyncIterator], i;\r\n return m ? m.call(o) : (o = typeof __values === \"function\" ? __values(o) : o[Symbol.iterator](), i = {}, verb(\"next\"), verb(\"throw\"), verb(\"return\"), i[Symbol.asyncIterator] = function () { return this; }, i);\r\n function verb(n) { i[n] = o[n] && function (v) { return new Promise(function (resolve, reject) { v = o[n](v), settle(resolve, reject, v.done, v.value); }); }; }\r\n function settle(resolve, reject, d, v) { Promise.resolve(v).then(function(v) { resolve({ value: v, done: d }); }, reject); }\r\n}\r\n\r\nexport function __makeTemplateObject(cooked, raw) {\r\n if (Object.defineProperty) { Object.defineProperty(cooked, \"raw\", { value: raw }); } else { cooked.raw = raw; }\r\n return cooked;\r\n};\r\n\r\nvar __setModuleDefault = Object.create ? (function(o, v) {\r\n Object.defineProperty(o, \"default\", { enumerable: true, value: v });\r\n}) : function(o, v) {\r\n o[\"default\"] = v;\r\n};\r\n\r\nexport function __importStar(mod) {\r\n if (mod && mod.__esModule) return mod;\r\n var result = {};\r\n if (mod != null) for (var k in mod) if (k !== \"default\" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k);\r\n __setModuleDefault(result, mod);\r\n return result;\r\n}\r\n\r\nexport function __importDefault(mod) {\r\n return (mod && mod.__esModule) ? mod : { default: mod };\r\n}\r\n\r\nexport function __classPrivateFieldGet(receiver, state, kind, f) {\r\n if (kind === \"a\" && !f) throw new TypeError(\"Private accessor was defined without a getter\");\r\n if (typeof state === \"function\" ? receiver !== state || !f : !state.has(receiver)) throw new TypeError(\"Cannot read private member from an object whose class did not declare it\");\r\n return kind === \"m\" ? f : kind === \"a\" ? f.call(receiver) : f ? f.value : state.get(receiver);\r\n}\r\n\r\nexport function __classPrivateFieldSet(receiver, state, value, kind, f) {\r\n if (kind === \"m\") throw new TypeError(\"Private method is not writable\");\r\n if (kind === \"a\" && !f) throw new TypeError(\"Private accessor was defined without a setter\");\r\n if (typeof state === \"function\" ? receiver !== state || !f : !state.has(receiver)) throw new TypeError(\"Cannot write private member to an object whose class did not declare it\");\r\n return (kind === \"a\" ? f.call(receiver, value) : f ? f.value = value : state.set(receiver, value)), value;\r\n}\r\n\r\nexport function __classPrivateFieldIn(state, receiver) {\r\n if (receiver === null || (typeof receiver !== \"object\" && typeof receiver !== \"function\")) throw new TypeError(\"Cannot use 'in' operator on non-object\");\r\n return typeof state === \"function\" ? receiver === state : state.has(receiver);\r\n}\r\n","/**\n * @license Angular v14.2.0\n * (c) 2010-2022 Google LLC. https://angular.io/\n * License: MIT\n */\n\n/**\n * An injectable service that produces an animation sequence programmatically within an\n * Angular component or directive.\n * Provided by the `BrowserAnimationsModule` or `NoopAnimationsModule`.\n *\n * @usageNotes\n *\n * To use this service, add it to your component or directive as a dependency.\n * The service is instantiated along with your component.\n *\n * Apps do not typically need to create their own animation players, but if you\n * do need to, follow these steps:\n *\n * 1. Use the [AnimationBuilder.build](api/animations/AnimationBuilder#build)()
method\n * to create a programmatic animation. The method returns an `AnimationFactory` instance.\n *\n * 2. Use the factory object to create an `AnimationPlayer` and attach it to a DOM element.\n *\n * 3. Use the player object to control the animation programmatically.\n *\n * For example:\n *\n * ```ts\n * // import the service from BrowserAnimationsModule\n * import {AnimationBuilder} from '@angular/animations';\n * // require the service as a dependency\n * class MyCmp {\n * constructor(private _builder: AnimationBuilder) {}\n *\n * makeAnimation(element: any) {\n * // first define a reusable animation\n * const myAnimation = this._builder.build([\n * style({ width: 0 }),\n * animate(1000, style({ width: '100px' }))\n * ]);\n *\n * // use the returned factory object to create a player\n * const player = myAnimation.create(element);\n *\n * player.play();\n * }\n * }\n * ```\n *\n * @publicApi\n */\nclass AnimationBuilder {\n}\n/**\n * A factory object returned from the\n * [AnimationBuilder.build](api/animations/AnimationBuilder#build)()
\n * method.\n *\n * @publicApi\n */\nclass AnimationFactory {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Specifies automatic styling.\n *\n * @publicApi\n */\nconst AUTO_STYLE = '*';\n/**\n * Creates a named animation trigger, containing a list of [`state()`](api/animations/state)\n * and `transition()` entries to be evaluated when the expression\n * bound to the trigger changes.\n *\n * @param name An identifying string.\n * @param definitions An animation definition object, containing an array of\n * [`state()`](api/animations/state) and `transition()` declarations.\n *\n * @return An object that encapsulates the trigger data.\n *\n * @usageNotes\n * Define an animation trigger in the `animations` section of `@Component` metadata.\n * In the template, reference the trigger by name and bind it to a trigger expression that\n * evaluates to a defined animation state, using the following format:\n *\n * `[@triggerName]=\"expression\"`\n *\n * Animation trigger bindings convert all values to strings, and then match the\n * previous and current values against any linked transitions.\n * Booleans can be specified as `1` or `true` and `0` or `false`.\n *\n * ### Usage Example\n *\n * The following example creates an animation trigger reference based on the provided\n * name value.\n * The provided animation value is expected to be an array consisting of state and\n * transition declarations.\n *\n * ```typescript\n * @Component({\n * selector: \"my-component\",\n * templateUrl: \"my-component-tpl.html\",\n * animations: [\n * trigger(\"myAnimationTrigger\", [\n * state(...),\n * state(...),\n * transition(...),\n * transition(...)\n * ])\n * ]\n * })\n * class MyComponent {\n * myStatusExp = \"something\";\n * }\n * ```\n *\n * The template associated with this component makes use of the defined trigger\n * by binding to an element within its template code.\n *\n * ```html\n * \n * ...
\n * ```\n *\n * ### Using an inline function\n * The `transition` animation method also supports reading an inline function which can decide\n * if its associated animation should be run.\n *\n * ```typescript\n * // this method is run each time the `myAnimationTrigger` trigger value changes.\n * function myInlineMatcherFn(fromState: string, toState: string, element: any, params: {[key:\n string]: any}): boolean {\n * // notice that `element` and `params` are also available here\n * return toState == 'yes-please-animate';\n * }\n *\n * @Component({\n * selector: 'my-component',\n * templateUrl: 'my-component-tpl.html',\n * animations: [\n * trigger('myAnimationTrigger', [\n * transition(myInlineMatcherFn, [\n * // the animation sequence code\n * ]),\n * ])\n * ]\n * })\n * class MyComponent {\n * myStatusExp = \"yes-please-animate\";\n * }\n * ```\n *\n * ### Disabling Animations\n * When true, the special animation control binding `@.disabled` binding prevents\n * all animations from rendering.\n * Place the `@.disabled` binding on an element to disable\n * animations on the element itself, as well as any inner animation triggers\n * within the element.\n *\n * The following example shows how to use this feature:\n *\n * ```typescript\n * @Component({\n * selector: 'my-component',\n * template: `\n * \n * `,\n * animations: [\n * trigger(\"childAnimation\", [\n * // ...\n * ])\n * ]\n * })\n * class MyComponent {\n * isDisabled = true;\n * exp = '...';\n * }\n * ```\n *\n * When `@.disabled` is true, it prevents the `@childAnimation` trigger from animating,\n * along with any inner animations.\n *\n * ### Disable animations application-wide\n * When an area of the template is set to have animations disabled,\n * **all** inner components have their animations disabled as well.\n * This means that you can disable all animations for an app\n * by placing a host binding set on `@.disabled` on the topmost Angular component.\n *\n * ```typescript\n * import {Component, HostBinding} from '@angular/core';\n *\n * @Component({\n * selector: 'app-component',\n * templateUrl: 'app.component.html',\n * })\n * class AppComponent {\n * @HostBinding('@.disabled')\n * public animationsDisabled = true;\n * }\n * ```\n *\n * ### Overriding disablement of inner animations\n * Despite inner animations being disabled, a parent animation can `query()`\n * for inner elements located in disabled areas of the template and still animate\n * them if needed. This is also the case for when a sub animation is\n * queried by a parent and then later animated using `animateChild()`.\n *\n * ### Detecting when an animation is disabled\n * If a region of the DOM (or the entire application) has its animations disabled, the animation\n * trigger callbacks still fire, but for zero seconds. When the callback fires, it provides\n * an instance of an `AnimationEvent`. If animations are disabled,\n * the `.disabled` flag on the event is true.\n *\n * @publicApi\n */\nfunction trigger(name, definitions) {\n return { type: 7 /* AnimationMetadataType.Trigger */, name, definitions, options: {} };\n}\n/**\n * Defines an animation step that combines styling information with timing information.\n *\n * @param timings Sets `AnimateTimings` for the parent animation.\n * A string in the format \"duration [delay] [easing]\".\n * - Duration and delay are expressed as a number and optional time unit,\n * such as \"1s\" or \"10ms\" for one second and 10 milliseconds, respectively.\n * The default unit is milliseconds.\n * - The easing value controls how the animation accelerates and decelerates\n * during its runtime. Value is one of `ease`, `ease-in`, `ease-out`,\n * `ease-in-out`, or a `cubic-bezier()` function call.\n * If not supplied, no easing is applied.\n *\n * For example, the string \"1s 100ms ease-out\" specifies a duration of\n * 1000 milliseconds, and delay of 100 ms, and the \"ease-out\" easing style,\n * which decelerates near the end of the duration.\n * @param styles Sets AnimationStyles for the parent animation.\n * A function call to either `style()` or `keyframes()`\n * that returns a collection of CSS style entries to be applied to the parent animation.\n * When null, uses the styles from the destination state.\n * This is useful when describing an animation step that will complete an animation;\n * see \"Animating to the final state\" in `transitions()`.\n * @returns An object that encapsulates the animation step.\n *\n * @usageNotes\n * Call within an animation `sequence()`, `{@link animations/group group()}`, or\n * `transition()` call to specify an animation step\n * that applies given style data to the parent animation for a given amount of time.\n *\n * ### Syntax Examples\n * **Timing examples**\n *\n * The following examples show various `timings` specifications.\n * - `animate(500)` : Duration is 500 milliseconds.\n * - `animate(\"1s\")` : Duration is 1000 milliseconds.\n * - `animate(\"100ms 0.5s\")` : Duration is 100 milliseconds, delay is 500 milliseconds.\n * - `animate(\"5s ease-in\")` : Duration is 5000 milliseconds, easing in.\n * - `animate(\"5s 10ms cubic-bezier(.17,.67,.88,.1)\")` : Duration is 5000 milliseconds, delay is 10\n * milliseconds, easing according to a bezier curve.\n *\n * **Style examples**\n *\n * The following example calls `style()` to set a single CSS style.\n * ```typescript\n * animate(500, style({ background: \"red\" }))\n * ```\n * The following example calls `keyframes()` to set a CSS style\n * to different values for successive keyframes.\n * ```typescript\n * animate(500, keyframes(\n * [\n * style({ background: \"blue\" }),\n * style({ background: \"red\" })\n * ])\n * ```\n *\n * @publicApi\n */\nfunction animate(timings, styles = null) {\n return { type: 4 /* AnimationMetadataType.Animate */, styles, timings };\n}\n/**\n * @description Defines a list of animation steps to be run in parallel.\n *\n * @param steps An array of animation step objects.\n * - When steps are defined by `style()` or `animate()`\n * function calls, each call within the group is executed instantly.\n * - To specify offset styles to be applied at a later time, define steps with\n * `keyframes()`, or use `animate()` calls with a delay value.\n * For example:\n *\n * ```typescript\n * group([\n * animate(\"1s\", style({ background: \"black\" })),\n * animate(\"2s\", style({ color: \"white\" }))\n * ])\n * ```\n *\n * @param options An options object containing a delay and\n * developer-defined parameters that provide styling defaults and\n * can be overridden on invocation.\n *\n * @return An object that encapsulates the group data.\n *\n * @usageNotes\n * Grouped animations are useful when a series of styles must be\n * animated at different starting times and closed off at different ending times.\n *\n * When called within a `sequence()` or a\n * `transition()` call, does not continue to the next\n * instruction until all of the inner animation steps have completed.\n *\n * @publicApi\n */\nfunction group(steps, options = null) {\n return { type: 3 /* AnimationMetadataType.Group */, steps, options };\n}\n/**\n * Defines a list of animation steps to be run sequentially, one by one.\n *\n * @param steps An array of animation step objects.\n * - Steps defined by `style()` calls apply the styling data immediately.\n * - Steps defined by `animate()` calls apply the styling data over time\n * as specified by the timing data.\n *\n * ```typescript\n * sequence([\n * style({ opacity: 0 }),\n * animate(\"1s\", style({ opacity: 1 }))\n * ])\n * ```\n *\n * @param options An options object containing a delay and\n * developer-defined parameters that provide styling defaults and\n * can be overridden on invocation.\n *\n * @return An object that encapsulates the sequence data.\n *\n * @usageNotes\n * When you pass an array of steps to a\n * `transition()` call, the steps run sequentially by default.\n * Compare this to the `{@link animations/group group()}` call, which runs animation steps in\n *parallel.\n *\n * When a sequence is used within a `{@link animations/group group()}` or a `transition()` call,\n * execution continues to the next instruction only after each of the inner animation\n * steps have completed.\n *\n * @publicApi\n **/\nfunction sequence(steps, options = null) {\n return { type: 2 /* AnimationMetadataType.Sequence */, steps, options };\n}\n/**\n * Declares a key/value object containing CSS properties/styles that\n * can then be used for an animation [`state`](api/animations/state), within an animation\n *`sequence`, or as styling data for calls to `animate()` and `keyframes()`.\n *\n * @param tokens A set of CSS styles or HTML styles associated with an animation state.\n * The value can be any of the following:\n * - A key-value style pair associating a CSS property with a value.\n * - An array of key-value style pairs.\n * - An asterisk (*), to use auto-styling, where styles are derived from the element\n * being animated and applied to the animation when it starts.\n *\n * Auto-styling can be used to define a state that depends on layout or other\n * environmental factors.\n *\n * @return An object that encapsulates the style data.\n *\n * @usageNotes\n * The following examples create animation styles that collect a set of\n * CSS property values:\n *\n * ```typescript\n * // string values for CSS properties\n * style({ background: \"red\", color: \"blue\" })\n *\n * // numerical pixel values\n * style({ width: 100, height: 0 })\n * ```\n *\n * The following example uses auto-styling to allow an element to animate from\n * a height of 0 up to its full height:\n *\n * ```\n * style({ height: 0 }),\n * animate(\"1s\", style({ height: \"*\" }))\n * ```\n *\n * @publicApi\n **/\nfunction style(tokens) {\n return { type: 6 /* AnimationMetadataType.Style */, styles: tokens, offset: null };\n}\n/**\n * Declares an animation state within a trigger attached to an element.\n *\n * @param name One or more names for the defined state in a comma-separated string.\n * The following reserved state names can be supplied to define a style for specific use\n * cases:\n *\n * - `void` You can associate styles with this name to be used when\n * the element is detached from the application. For example, when an `ngIf` evaluates\n * to false, the state of the associated element is void.\n * - `*` (asterisk) Indicates the default state. You can associate styles with this name\n * to be used as the fallback when the state that is being animated is not declared\n * within the trigger.\n *\n * @param styles A set of CSS styles associated with this state, created using the\n * `style()` function.\n * This set of styles persists on the element once the state has been reached.\n * @param options Parameters that can be passed to the state when it is invoked.\n * 0 or more key-value pairs.\n * @return An object that encapsulates the new state data.\n *\n * @usageNotes\n * Use the `trigger()` function to register states to an animation trigger.\n * Use the `transition()` function to animate between states.\n * When a state is active within a component, its associated styles persist on the element,\n * even when the animation ends.\n *\n * @publicApi\n **/\nfunction state(name, styles, options) {\n return { type: 0 /* AnimationMetadataType.State */, name, styles, options };\n}\n/**\n * Defines a set of animation styles, associating each style with an optional `offset` value.\n *\n * @param steps A set of animation styles with optional offset data.\n * The optional `offset` value for a style specifies a percentage of the total animation\n * time at which that style is applied.\n * @returns An object that encapsulates the keyframes data.\n *\n * @usageNotes\n * Use with the `animate()` call. Instead of applying animations\n * from the current state\n * to the destination state, keyframes describe how each style entry is applied and at what point\n * within the animation arc.\n * Compare [CSS Keyframe Animations](https://www.w3schools.com/css/css3_animations.asp).\n *\n * ### Usage\n *\n * In the following example, the offset values describe\n * when each `backgroundColor` value is applied. The color is red at the start, and changes to\n * blue when 20% of the total time has elapsed.\n *\n * ```typescript\n * // the provided offset values\n * animate(\"5s\", keyframes([\n * style({ backgroundColor: \"red\", offset: 0 }),\n * style({ backgroundColor: \"blue\", offset: 0.2 }),\n * style({ backgroundColor: \"orange\", offset: 0.3 }),\n * style({ backgroundColor: \"black\", offset: 1 })\n * ]))\n * ```\n *\n * If there are no `offset` values specified in the style entries, the offsets\n * are calculated automatically.\n *\n * ```typescript\n * animate(\"5s\", keyframes([\n * style({ backgroundColor: \"red\" }) // offset = 0\n * style({ backgroundColor: \"blue\" }) // offset = 0.33\n * style({ backgroundColor: \"orange\" }) // offset = 0.66\n * style({ backgroundColor: \"black\" }) // offset = 1\n * ]))\n *```\n\n * @publicApi\n */\nfunction keyframes(steps) {\n return { type: 5 /* AnimationMetadataType.Keyframes */, steps };\n}\n/**\n * Declares an animation transition which is played when a certain specified condition is met.\n *\n * @param stateChangeExpr A string with a specific format or a function that specifies when the\n * animation transition should occur (see [State Change Expression](#state-change-expression)).\n *\n * @param steps One or more animation objects that represent the animation's instructions.\n *\n * @param options An options object that can be used to specify a delay for the animation or provide\n * custom parameters for it.\n *\n * @returns An object that encapsulates the transition data.\n *\n * @usageNotes\n *\n * ### State Change Expression\n *\n * The State Change Expression instructs Angular when to run the transition's animations, it can\n *either be\n * - a string with a specific syntax\n * - or a function that compares the previous and current state (value of the expression bound to\n * the element's trigger) and returns `true` if the transition should occur or `false` otherwise\n *\n * The string format can be:\n * - `fromState => toState`, which indicates that the transition's animations should occur then the\n * expression bound to the trigger's element goes from `fromState` to `toState`\n *\n * _Example:_\n * ```typescript\n * transition('open => closed', animate('.5s ease-out', style({ height: 0 }) ))\n * ```\n *\n * - `fromState <=> toState`, which indicates that the transition's animations should occur then\n * the expression bound to the trigger's element goes from `fromState` to `toState` or vice versa\n *\n * _Example:_\n * ```typescript\n * transition('enabled <=> disabled', animate('1s cubic-bezier(0.8,0.3,0,1)'))\n * ```\n *\n * - `:enter`/`:leave`, which indicates that the transition's animations should occur when the\n * element enters or exists the DOM\n *\n * _Example:_\n * ```typescript\n * transition(':enter', [\n * style({ opacity: 0 }),\n * animate('500ms', style({ opacity: 1 }))\n * ])\n * ```\n *\n * - `:increment`/`:decrement`, which indicates that the transition's animations should occur when\n * the numerical expression bound to the trigger's element has increased in value or decreased\n *\n * _Example:_\n * ```typescript\n * transition(':increment', query('@counter', animateChild()))\n * ```\n *\n * - a sequence of any of the above divided by commas, which indicates that transition's animations\n * should occur whenever one of the state change expressions matches\n *\n * _Example:_\n * ```typescript\n * transition(':increment, * => enabled, :enter', animate('1s ease', keyframes([\n * style({ transform: 'scale(1)', offset: 0}),\n * style({ transform: 'scale(1.1)', offset: 0.7}),\n * style({ transform: 'scale(1)', offset: 1})\n * ]))),\n * ```\n *\n * Also note that in such context:\n * - `void` can be used to indicate the absence of the element\n * - asterisks can be used as wildcards that match any state\n * - (as a consequence of the above, `void => *` is equivalent to `:enter` and `* => void` is\n * equivalent to `:leave`)\n * - `true` and `false` also match expression values of `1` and `0` respectively (but do not match\n * _truthy_ and _falsy_ values)\n *\n * \n *\n * Be careful about entering end leaving elements as their transitions present a common\n * pitfall for developers.\n *\n * Note that when an element with a trigger enters the DOM its `:enter` transition always\n * gets executed, but its `:leave` transition will not be executed if the element is removed\n * alongside its parent (as it will be removed \"without warning\" before its transition has\n * a chance to be executed, the only way that such transition can occur is if the element\n * is exiting the DOM on its own).\n *\n *\n *
\n *\n * ### Animating to a Final State\n *\n * If the final step in a transition is a call to `animate()` that uses a timing value\n * with no `style` data, that step is automatically considered the final animation arc,\n * for the element to reach the final state, in such case Angular automatically adds or removes\n * CSS styles to ensure that the element is in the correct final state.\n *\n *\n * ### Usage Examples\n *\n * - Transition animations applied based on\n * the trigger's expression value\n *\n * ```HTML\n * \n * ...\n *
\n * ```\n *\n * ```typescript\n * trigger(\"myAnimationTrigger\", [\n * ..., // states\n * transition(\"on => off, open => closed\", animate(500)),\n * transition(\"* <=> error\", query('.indicator', animateChild()))\n * ])\n * ```\n *\n * - Transition animations applied based on custom logic dependent\n * on the trigger's expression value and provided parameters\n *\n * ```HTML\n * \n * ...\n *
\n * ```\n *\n * ```typescript\n * trigger(\"myAnimationTrigger\", [\n * ..., // states\n * transition(\n * (fromState, toState, _element, params) =>\n * ['firststep', 'laststep'].includes(fromState.toLowerCase())\n * && toState === params?.['target'],\n * animate('1s')\n * )\n * ])\n * ```\n *\n * @publicApi\n **/\nfunction transition(stateChangeExpr, steps, options = null) {\n return { type: 1 /* AnimationMetadataType.Transition */, expr: stateChangeExpr, animation: steps, options };\n}\n/**\n * Produces a reusable animation that can be invoked in another animation or sequence,\n * by calling the `useAnimation()` function.\n *\n * @param steps One or more animation objects, as returned by the `animate()`\n * or `sequence()` function, that form a transformation from one state to another.\n * A sequence is used by default when you pass an array.\n * @param options An options object that can contain a delay value for the start of the\n * animation, and additional developer-defined parameters.\n * Provided values for additional parameters are used as defaults,\n * and override values can be passed to the caller on invocation.\n * @returns An object that encapsulates the animation data.\n *\n * @usageNotes\n * The following example defines a reusable animation, providing some default parameter\n * values.\n *\n * ```typescript\n * var fadeAnimation = animation([\n * style({ opacity: '{{ start }}' }),\n * animate('{{ time }}',\n * style({ opacity: '{{ end }}'}))\n * ],\n * { params: { time: '1000ms', start: 0, end: 1 }});\n * ```\n *\n * The following invokes the defined animation with a call to `useAnimation()`,\n * passing in override parameter values.\n *\n * ```js\n * useAnimation(fadeAnimation, {\n * params: {\n * time: '2s',\n * start: 1,\n * end: 0\n * }\n * })\n * ```\n *\n * If any of the passed-in parameter values are missing from this call,\n * the default values are used. If one or more parameter values are missing before a step is\n * animated, `useAnimation()` throws an error.\n *\n * @publicApi\n */\nfunction animation(steps, options = null) {\n return { type: 8 /* AnimationMetadataType.Reference */, animation: steps, options };\n}\n/**\n * Executes a queried inner animation element within an animation sequence.\n *\n * @param options An options object that can contain a delay value for the start of the\n * animation, and additional override values for developer-defined parameters.\n * @return An object that encapsulates the child animation data.\n *\n * @usageNotes\n * Each time an animation is triggered in Angular, the parent animation\n * has priority and any child animations are blocked. In order\n * for a child animation to run, the parent animation must query each of the elements\n * containing child animations, and run them using this function.\n *\n * Note that this feature is designed to be used with `query()` and it will only work\n * with animations that are assigned using the Angular animation library. CSS keyframes\n * and transitions are not handled by this API.\n *\n * @publicApi\n */\nfunction animateChild(options = null) {\n return { type: 9 /* AnimationMetadataType.AnimateChild */, options };\n}\n/**\n * Starts a reusable animation that is created using the `animation()` function.\n *\n * @param animation The reusable animation to start.\n * @param options An options object that can contain a delay value for the start of\n * the animation, and additional override values for developer-defined parameters.\n * @return An object that contains the animation parameters.\n *\n * @publicApi\n */\nfunction useAnimation(animation, options = null) {\n return { type: 10 /* AnimationMetadataType.AnimateRef */, animation, options };\n}\n/**\n * Finds one or more inner elements within the current element that is\n * being animated within a sequence. Use with `animate()`.\n *\n * @param selector The element to query, or a set of elements that contain Angular-specific\n * characteristics, specified with one or more of the following tokens.\n * - `query(\":enter\")` or `query(\":leave\")` : Query for newly inserted/removed elements (not\n * all elements can be queried via these tokens, see\n * [Entering and Leaving Elements](#entering-and-leaving-elements))\n * - `query(\":animating\")` : Query all currently animating elements.\n * - `query(\"@triggerName\")` : Query elements that contain an animation trigger.\n * - `query(\"@*\")` : Query all elements that contain an animation triggers.\n * - `query(\":self\")` : Include the current element into the animation sequence.\n *\n * @param animation One or more animation steps to apply to the queried element or elements.\n * An array is treated as an animation sequence.\n * @param options An options object. Use the 'limit' field to limit the total number of\n * items to collect.\n * @return An object that encapsulates the query data.\n *\n * @usageNotes\n *\n * ### Multiple Tokens\n *\n * Tokens can be merged into a combined query selector string. For example:\n *\n * ```typescript\n * query(':self, .record:enter, .record:leave, @subTrigger', [...])\n * ```\n *\n * The `query()` function collects multiple elements and works internally by using\n * `element.querySelectorAll`. Use the `limit` field of an options object to limit\n * the total number of items to be collected. For example:\n *\n * ```js\n * query('div', [\n * animate(...),\n * animate(...)\n * ], { limit: 1 })\n * ```\n *\n * By default, throws an error when zero items are found. Set the\n * `optional` flag to ignore this error. For example:\n *\n * ```js\n * query('.some-element-that-may-not-be-there', [\n * animate(...),\n * animate(...)\n * ], { optional: true })\n * ```\n *\n * ### Entering and Leaving Elements\n *\n * Not all elements can be queried via the `:enter` and `:leave` tokens, the only ones\n * that can are those that Angular assumes can enter/leave based on their own logic\n * (if their insertion/removal is simply a consequence of that of their parent they\n * should be queried via a different token in their parent's `:enter`/`:leave` transitions).\n *\n * The only elements Angular assumes can enter/leave based on their own logic (thus the only\n * ones that can be queried via the `:enter` and `:leave` tokens) are:\n * - Those inserted dynamically (via `ViewContainerRef`)\n * - Those that have a structural directive (which, under the hood, are a subset of the above ones)\n *\n * \n *\n * Note that elements will be successfully queried via `:enter`/`:leave` even if their\n * insertion/removal is not done manually via `ViewContainerRef`or caused by their structural\n * directive (e.g. they enter/exit alongside their parent).\n *\n *
\n *\n * \n *\n * There is an exception to what previously mentioned, besides elements entering/leaving based on\n * their own logic, elements with an animation trigger can always be queried via `:leave` when\n * their parent is also leaving.\n *\n *
\n *\n * ### Usage Example\n *\n * The following example queries for inner elements and animates them\n * individually using `animate()`.\n *\n * ```typescript\n * @Component({\n * selector: 'inner',\n * template: `\n * \n *
Title \n *
\n * Blah blah blah\n *
\n *
\n * `,\n * animations: [\n * trigger('queryAnimation', [\n * transition('* => goAnimate', [\n * // hide the inner elements\n * query('h1', style({ opacity: 0 })),\n * query('.content', style({ opacity: 0 })),\n *\n * // animate the inner elements in, one by one\n * query('h1', animate(1000, style({ opacity: 1 }))),\n * query('.content', animate(1000, style({ opacity: 1 }))),\n * ])\n * ])\n * ]\n * })\n * class Cmp {\n * exp = '';\n *\n * goAnimate() {\n * this.exp = 'goAnimate';\n * }\n * }\n * ```\n *\n * @publicApi\n */\nfunction query(selector, animation, options = null) {\n return { type: 11 /* AnimationMetadataType.Query */, selector, animation, options };\n}\n/**\n * Use within an animation `query()` call to issue a timing gap after\n * each queried item is animated.\n *\n * @param timings A delay value.\n * @param animation One ore more animation steps.\n * @returns An object that encapsulates the stagger data.\n *\n * @usageNotes\n * In the following example, a container element wraps a list of items stamped out\n * by an `ngFor`. The container element contains an animation trigger that will later be set\n * to query for each of the inner items.\n *\n * Each time items are added, the opacity fade-in animation runs,\n * and each removed item is faded out.\n * When either of these animations occur, the stagger effect is\n * applied after each item's animation is started.\n *\n * ```html\n * \n * Show / Hide Items \n * \n * \n *
\n * {{ item }}\n *
\n *
\n * ```\n *\n * Here is the component code:\n *\n * ```typescript\n * import {trigger, transition, style, animate, query, stagger} from '@angular/animations';\n * @Component({\n * templateUrl: 'list.component.html',\n * animations: [\n * trigger('listAnimation', [\n * ...\n * ])\n * ]\n * })\n * class ListComponent {\n * items = [];\n *\n * showItems() {\n * this.items = [0,1,2,3,4];\n * }\n *\n * hideItems() {\n * this.items = [];\n * }\n *\n * toggle() {\n * this.items.length ? this.hideItems() : this.showItems();\n * }\n * }\n * ```\n *\n * Here is the animation trigger code:\n *\n * ```typescript\n * trigger('listAnimation', [\n * transition('* => *', [ // each time the binding value changes\n * query(':leave', [\n * stagger(100, [\n * animate('0.5s', style({ opacity: 0 }))\n * ])\n * ]),\n * query(':enter', [\n * style({ opacity: 0 }),\n * stagger(100, [\n * animate('0.5s', style({ opacity: 1 }))\n * ])\n * ])\n * ])\n * ])\n * ```\n *\n * @publicApi\n */\nfunction stagger(timings, animation) {\n return { type: 12 /* AnimationMetadataType.Stagger */, timings, animation };\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction scheduleMicroTask(cb) {\n Promise.resolve(null).then(cb);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * An empty programmatic controller for reusable animations.\n * Used internally when animations are disabled, to avoid\n * checking for the null case when an animation player is expected.\n *\n * @see `animate()`\n * @see `AnimationPlayer`\n * @see `GroupPlayer`\n *\n * @publicApi\n */\nclass NoopAnimationPlayer {\n constructor(duration = 0, delay = 0) {\n this._onDoneFns = [];\n this._onStartFns = [];\n this._onDestroyFns = [];\n this._originalOnDoneFns = [];\n this._originalOnStartFns = [];\n this._started = false;\n this._destroyed = false;\n this._finished = false;\n this._position = 0;\n this.parentPlayer = null;\n this.totalTime = duration + delay;\n }\n _onFinish() {\n if (!this._finished) {\n this._finished = true;\n this._onDoneFns.forEach(fn => fn());\n this._onDoneFns = [];\n }\n }\n onStart(fn) {\n this._originalOnStartFns.push(fn);\n this._onStartFns.push(fn);\n }\n onDone(fn) {\n this._originalOnDoneFns.push(fn);\n this._onDoneFns.push(fn);\n }\n onDestroy(fn) {\n this._onDestroyFns.push(fn);\n }\n hasStarted() {\n return this._started;\n }\n init() { }\n play() {\n if (!this.hasStarted()) {\n this._onStart();\n this.triggerMicrotask();\n }\n this._started = true;\n }\n /** @internal */\n triggerMicrotask() {\n scheduleMicroTask(() => this._onFinish());\n }\n _onStart() {\n this._onStartFns.forEach(fn => fn());\n this._onStartFns = [];\n }\n pause() { }\n restart() { }\n finish() {\n this._onFinish();\n }\n destroy() {\n if (!this._destroyed) {\n this._destroyed = true;\n if (!this.hasStarted()) {\n this._onStart();\n }\n this.finish();\n this._onDestroyFns.forEach(fn => fn());\n this._onDestroyFns = [];\n }\n }\n reset() {\n this._started = false;\n this._finished = false;\n this._onStartFns = this._originalOnStartFns;\n this._onDoneFns = this._originalOnDoneFns;\n }\n setPosition(position) {\n this._position = this.totalTime ? position * this.totalTime : 1;\n }\n getPosition() {\n return this.totalTime ? this._position / this.totalTime : 1;\n }\n /** @internal */\n triggerCallback(phaseName) {\n const methods = phaseName == 'start' ? this._onStartFns : this._onDoneFns;\n methods.forEach(fn => fn());\n methods.length = 0;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A programmatic controller for a group of reusable animations.\n * Used internally to control animations.\n *\n * @see `AnimationPlayer`\n * @see `{@link animations/group group()}`\n *\n */\nclass AnimationGroupPlayer {\n constructor(_players) {\n this._onDoneFns = [];\n this._onStartFns = [];\n this._finished = false;\n this._started = false;\n this._destroyed = false;\n this._onDestroyFns = [];\n this.parentPlayer = null;\n this.totalTime = 0;\n this.players = _players;\n let doneCount = 0;\n let destroyCount = 0;\n let startCount = 0;\n const total = this.players.length;\n if (total == 0) {\n scheduleMicroTask(() => this._onFinish());\n }\n else {\n this.players.forEach(player => {\n player.onDone(() => {\n if (++doneCount == total) {\n this._onFinish();\n }\n });\n player.onDestroy(() => {\n if (++destroyCount == total) {\n this._onDestroy();\n }\n });\n player.onStart(() => {\n if (++startCount == total) {\n this._onStart();\n }\n });\n });\n }\n this.totalTime = this.players.reduce((time, player) => Math.max(time, player.totalTime), 0);\n }\n _onFinish() {\n if (!this._finished) {\n this._finished = true;\n this._onDoneFns.forEach(fn => fn());\n this._onDoneFns = [];\n }\n }\n init() {\n this.players.forEach(player => player.init());\n }\n onStart(fn) {\n this._onStartFns.push(fn);\n }\n _onStart() {\n if (!this.hasStarted()) {\n this._started = true;\n this._onStartFns.forEach(fn => fn());\n this._onStartFns = [];\n }\n }\n onDone(fn) {\n this._onDoneFns.push(fn);\n }\n onDestroy(fn) {\n this._onDestroyFns.push(fn);\n }\n hasStarted() {\n return this._started;\n }\n play() {\n if (!this.parentPlayer) {\n this.init();\n }\n this._onStart();\n this.players.forEach(player => player.play());\n }\n pause() {\n this.players.forEach(player => player.pause());\n }\n restart() {\n this.players.forEach(player => player.restart());\n }\n finish() {\n this._onFinish();\n this.players.forEach(player => player.finish());\n }\n destroy() {\n this._onDestroy();\n }\n _onDestroy() {\n if (!this._destroyed) {\n this._destroyed = true;\n this._onFinish();\n this.players.forEach(player => player.destroy());\n this._onDestroyFns.forEach(fn => fn());\n this._onDestroyFns = [];\n }\n }\n reset() {\n this.players.forEach(player => player.reset());\n this._destroyed = false;\n this._finished = false;\n this._started = false;\n }\n setPosition(p) {\n const timeAtPosition = p * this.totalTime;\n this.players.forEach(player => {\n const position = player.totalTime ? Math.min(1, timeAtPosition / player.totalTime) : 1;\n player.setPosition(position);\n });\n }\n getPosition() {\n const longestPlayer = this.players.reduce((longestSoFar, player) => {\n const newPlayerIsLongest = longestSoFar === null || player.totalTime > longestSoFar.totalTime;\n return newPlayerIsLongest ? player : longestSoFar;\n }, null);\n return longestPlayer != null ? longestPlayer.getPosition() : 0;\n }\n beforeDestroy() {\n this.players.forEach(player => {\n if (player.beforeDestroy) {\n player.beforeDestroy();\n }\n });\n }\n /** @internal */\n triggerCallback(phaseName) {\n const methods = phaseName == 'start' ? this._onStartFns : this._onDoneFns;\n methods.forEach(fn => fn());\n methods.length = 0;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst ɵPRE_STYLE = '!';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { AUTO_STYLE, AnimationBuilder, AnimationFactory, NoopAnimationPlayer, animate, animateChild, animation, group, keyframes, query, sequence, stagger, state, style, transition, trigger, useAnimation, AnimationGroupPlayer as ɵAnimationGroupPlayer, ɵPRE_STYLE };\n","/**\n * @license Angular v14.2.0\n * (c) 2010-2022 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport { ɵAnimationGroupPlayer, NoopAnimationPlayer, AUTO_STYLE, ɵPRE_STYLE, sequence, style } from '@angular/animations';\nimport * as i0 from '@angular/core';\nimport { ɵRuntimeError, Injectable } from '@angular/core';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst LINE_START = '\\n - ';\nfunction invalidTimingValue(exp) {\n return new ɵRuntimeError(3000 /* RuntimeErrorCode.INVALID_TIMING_VALUE */, ngDevMode && `The provided timing value \"${exp}\" is invalid.`);\n}\nfunction negativeStepValue() {\n return new ɵRuntimeError(3100 /* RuntimeErrorCode.NEGATIVE_STEP_VALUE */, ngDevMode && 'Duration values below 0 are not allowed for this animation step.');\n}\nfunction negativeDelayValue() {\n return new ɵRuntimeError(3101 /* RuntimeErrorCode.NEGATIVE_DELAY_VALUE */, ngDevMode && 'Delay values below 0 are not allowed for this animation step.');\n}\nfunction invalidStyleParams(varName) {\n return new ɵRuntimeError(3001 /* RuntimeErrorCode.INVALID_STYLE_PARAMS */, ngDevMode &&\n `Unable to resolve the local animation param ${varName} in the given list of values`);\n}\nfunction invalidParamValue(varName) {\n return new ɵRuntimeError(3003 /* RuntimeErrorCode.INVALID_PARAM_VALUE */, ngDevMode && `Please provide a value for the animation param ${varName}`);\n}\nfunction invalidNodeType(nodeType) {\n return new ɵRuntimeError(3004 /* RuntimeErrorCode.INVALID_NODE_TYPE */, ngDevMode && `Unable to resolve animation metadata node #${nodeType}`);\n}\nfunction invalidCssUnitValue(userProvidedProperty, value) {\n return new ɵRuntimeError(3005 /* RuntimeErrorCode.INVALID_CSS_UNIT_VALUE */, ngDevMode && `Please provide a CSS unit value for ${userProvidedProperty}:${value}`);\n}\nfunction invalidTrigger() {\n return new ɵRuntimeError(3006 /* RuntimeErrorCode.INVALID_TRIGGER */, ngDevMode &&\n 'animation triggers cannot be prefixed with an `@` sign (e.g. trigger(\\'@foo\\', [...]))');\n}\nfunction invalidDefinition() {\n return new ɵRuntimeError(3007 /* RuntimeErrorCode.INVALID_DEFINITION */, ngDevMode && 'only state() and transition() definitions can sit inside of a trigger()');\n}\nfunction invalidState(metadataName, missingSubs) {\n return new ɵRuntimeError(3008 /* RuntimeErrorCode.INVALID_STATE */, ngDevMode &&\n `state(\"${metadataName}\", ...) must define default values for all the following style substitutions: ${missingSubs.join(', ')}`);\n}\nfunction invalidStyleValue(value) {\n return new ɵRuntimeError(3002 /* RuntimeErrorCode.INVALID_STYLE_VALUE */, ngDevMode && `The provided style string value ${value} is not allowed.`);\n}\nfunction invalidProperty(prop) {\n return new ɵRuntimeError(3009 /* RuntimeErrorCode.INVALID_PROPERTY */, ngDevMode &&\n `The provided animation property \"${prop}\" is not a supported CSS property for animations`);\n}\nfunction invalidParallelAnimation(prop, firstStart, firstEnd, secondStart, secondEnd) {\n return new ɵRuntimeError(3010 /* RuntimeErrorCode.INVALID_PARALLEL_ANIMATION */, ngDevMode &&\n `The CSS property \"${prop}\" that exists between the times of \"${firstStart}ms\" and \"${firstEnd}ms\" is also being animated in a parallel animation between the times of \"${secondStart}ms\" and \"${secondEnd}ms\"`);\n}\nfunction invalidKeyframes() {\n return new ɵRuntimeError(3011 /* RuntimeErrorCode.INVALID_KEYFRAMES */, ngDevMode && `keyframes() must be placed inside of a call to animate()`);\n}\nfunction invalidOffset() {\n return new ɵRuntimeError(3012 /* RuntimeErrorCode.INVALID_OFFSET */, ngDevMode && `Please ensure that all keyframe offsets are between 0 and 1`);\n}\nfunction keyframeOffsetsOutOfOrder() {\n return new ɵRuntimeError(3200 /* RuntimeErrorCode.KEYFRAME_OFFSETS_OUT_OF_ORDER */, ngDevMode && `Please ensure that all keyframe offsets are in order`);\n}\nfunction keyframesMissingOffsets() {\n return new ɵRuntimeError(3202 /* RuntimeErrorCode.KEYFRAMES_MISSING_OFFSETS */, ngDevMode && `Not all style() steps within the declared keyframes() contain offsets`);\n}\nfunction invalidStagger() {\n return new ɵRuntimeError(3013 /* RuntimeErrorCode.INVALID_STAGGER */, ngDevMode && `stagger() can only be used inside of query()`);\n}\nfunction invalidQuery(selector) {\n return new ɵRuntimeError(3014 /* RuntimeErrorCode.INVALID_QUERY */, ngDevMode &&\n `\\`query(\"${selector}\")\\` returned zero elements. (Use \\`query(\"${selector}\", { optional: true })\\` if you wish to allow this.)`);\n}\nfunction invalidExpression(expr) {\n return new ɵRuntimeError(3015 /* RuntimeErrorCode.INVALID_EXPRESSION */, ngDevMode && `The provided transition expression \"${expr}\" is not supported`);\n}\nfunction invalidTransitionAlias(alias) {\n return new ɵRuntimeError(3016 /* RuntimeErrorCode.INVALID_TRANSITION_ALIAS */, ngDevMode && `The transition alias value \"${alias}\" is not supported`);\n}\nfunction validationFailed(errors) {\n return new ɵRuntimeError(3500 /* RuntimeErrorCode.VALIDATION_FAILED */, ngDevMode && `animation validation failed:\\n${errors.map(err => err.message).join('\\n')}`);\n}\nfunction buildingFailed(errors) {\n return new ɵRuntimeError(3501 /* RuntimeErrorCode.BUILDING_FAILED */, ngDevMode && `animation building failed:\\n${errors.map(err => err.message).join('\\n')}`);\n}\nfunction triggerBuildFailed(name, errors) {\n return new ɵRuntimeError(3404 /* RuntimeErrorCode.TRIGGER_BUILD_FAILED */, ngDevMode &&\n `The animation trigger \"${name}\" has failed to build due to the following errors:\\n - ${errors.map(err => err.message).join('\\n - ')}`);\n}\nfunction animationFailed(errors) {\n return new ɵRuntimeError(3502 /* RuntimeErrorCode.ANIMATION_FAILED */, ngDevMode &&\n `Unable to animate due to the following errors:${LINE_START}${errors.map(err => err.message).join(LINE_START)}`);\n}\nfunction registerFailed(errors) {\n return new ɵRuntimeError(3503 /* RuntimeErrorCode.REGISTRATION_FAILED */, ngDevMode &&\n `Unable to build the animation due to the following errors: ${errors.map(err => err.message).join('\\n')}`);\n}\nfunction missingOrDestroyedAnimation() {\n return new ɵRuntimeError(3300 /* RuntimeErrorCode.MISSING_OR_DESTROYED_ANIMATION */, ngDevMode && 'The requested animation doesn\\'t exist or has already been destroyed');\n}\nfunction createAnimationFailed(errors) {\n return new ɵRuntimeError(3504 /* RuntimeErrorCode.CREATE_ANIMATION_FAILED */, ngDevMode &&\n `Unable to create the animation due to the following errors:${errors.map(err => err.message).join('\\n')}`);\n}\nfunction missingPlayer(id) {\n return new ɵRuntimeError(3301 /* RuntimeErrorCode.MISSING_PLAYER */, ngDevMode && `Unable to find the timeline player referenced by ${id}`);\n}\nfunction missingTrigger(phase, name) {\n return new ɵRuntimeError(3302 /* RuntimeErrorCode.MISSING_TRIGGER */, ngDevMode &&\n `Unable to listen on the animation trigger event \"${phase}\" because the animation trigger \"${name}\" doesn\\'t exist!`);\n}\nfunction missingEvent(name) {\n return new ɵRuntimeError(3303 /* RuntimeErrorCode.MISSING_EVENT */, ngDevMode &&\n `Unable to listen on the animation trigger \"${name}\" because the provided event is undefined!`);\n}\nfunction unsupportedTriggerEvent(phase, name) {\n return new ɵRuntimeError(3400 /* RuntimeErrorCode.UNSUPPORTED_TRIGGER_EVENT */, ngDevMode &&\n `The provided animation trigger event \"${phase}\" for the animation trigger \"${name}\" is not supported!`);\n}\nfunction unregisteredTrigger(name) {\n return new ɵRuntimeError(3401 /* RuntimeErrorCode.UNREGISTERED_TRIGGER */, ngDevMode && `The provided animation trigger \"${name}\" has not been registered!`);\n}\nfunction triggerTransitionsFailed(errors) {\n return new ɵRuntimeError(3402 /* RuntimeErrorCode.TRIGGER_TRANSITIONS_FAILED */, ngDevMode &&\n `Unable to process animations due to the following failed trigger transitions\\n ${errors.map(err => err.message).join('\\n')}`);\n}\nfunction triggerParsingFailed(name, errors) {\n return new ɵRuntimeError(3403 /* RuntimeErrorCode.TRIGGER_PARSING_FAILED */, ngDevMode &&\n `Animation parsing for the ${name} trigger have failed:${LINE_START}${errors.map(err => err.message).join(LINE_START)}`);\n}\nfunction transitionFailed(name, errors) {\n return new ɵRuntimeError(3505 /* RuntimeErrorCode.TRANSITION_FAILED */, ngDevMode && `@${name} has failed due to:\\n ${errors.map(err => err.message).join('\\n- ')}`);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Set of all animatable CSS properties\n *\n * @see https://developer.mozilla.org/en-US/docs/Web/CSS/CSS_animated_properties\n */\nconst ANIMATABLE_PROP_SET = new Set([\n '-moz-outline-radius',\n '-moz-outline-radius-bottomleft',\n '-moz-outline-radius-bottomright',\n '-moz-outline-radius-topleft',\n '-moz-outline-radius-topright',\n '-ms-grid-columns',\n '-ms-grid-rows',\n '-webkit-line-clamp',\n '-webkit-text-fill-color',\n '-webkit-text-stroke',\n '-webkit-text-stroke-color',\n 'accent-color',\n 'all',\n 'backdrop-filter',\n 'background',\n 'background-color',\n 'background-position',\n 'background-size',\n 'block-size',\n 'border',\n 'border-block-end',\n 'border-block-end-color',\n 'border-block-end-width',\n 'border-block-start',\n 'border-block-start-color',\n 'border-block-start-width',\n 'border-bottom',\n 'border-bottom-color',\n 'border-bottom-left-radius',\n 'border-bottom-right-radius',\n 'border-bottom-width',\n 'border-color',\n 'border-end-end-radius',\n 'border-end-start-radius',\n 'border-image-outset',\n 'border-image-slice',\n 'border-image-width',\n 'border-inline-end',\n 'border-inline-end-color',\n 'border-inline-end-width',\n 'border-inline-start',\n 'border-inline-start-color',\n 'border-inline-start-width',\n 'border-left',\n 'border-left-color',\n 'border-left-width',\n 'border-radius',\n 'border-right',\n 'border-right-color',\n 'border-right-width',\n 'border-start-end-radius',\n 'border-start-start-radius',\n 'border-top',\n 'border-top-color',\n 'border-top-left-radius',\n 'border-top-right-radius',\n 'border-top-width',\n 'border-width',\n 'bottom',\n 'box-shadow',\n 'caret-color',\n 'clip',\n 'clip-path',\n 'color',\n 'column-count',\n 'column-gap',\n 'column-rule',\n 'column-rule-color',\n 'column-rule-width',\n 'column-width',\n 'columns',\n 'filter',\n 'flex',\n 'flex-basis',\n 'flex-grow',\n 'flex-shrink',\n 'font',\n 'font-size',\n 'font-size-adjust',\n 'font-stretch',\n 'font-variation-settings',\n 'font-weight',\n 'gap',\n 'grid-column-gap',\n 'grid-gap',\n 'grid-row-gap',\n 'grid-template-columns',\n 'grid-template-rows',\n 'height',\n 'inline-size',\n 'input-security',\n 'inset',\n 'inset-block',\n 'inset-block-end',\n 'inset-block-start',\n 'inset-inline',\n 'inset-inline-end',\n 'inset-inline-start',\n 'left',\n 'letter-spacing',\n 'line-clamp',\n 'line-height',\n 'margin',\n 'margin-block-end',\n 'margin-block-start',\n 'margin-bottom',\n 'margin-inline-end',\n 'margin-inline-start',\n 'margin-left',\n 'margin-right',\n 'margin-top',\n 'mask',\n 'mask-border',\n 'mask-position',\n 'mask-size',\n 'max-block-size',\n 'max-height',\n 'max-inline-size',\n 'max-lines',\n 'max-width',\n 'min-block-size',\n 'min-height',\n 'min-inline-size',\n 'min-width',\n 'object-position',\n 'offset',\n 'offset-anchor',\n 'offset-distance',\n 'offset-path',\n 'offset-position',\n 'offset-rotate',\n 'opacity',\n 'order',\n 'outline',\n 'outline-color',\n 'outline-offset',\n 'outline-width',\n 'padding',\n 'padding-block-end',\n 'padding-block-start',\n 'padding-bottom',\n 'padding-inline-end',\n 'padding-inline-start',\n 'padding-left',\n 'padding-right',\n 'padding-top',\n 'perspective',\n 'perspective-origin',\n 'right',\n 'rotate',\n 'row-gap',\n 'scale',\n 'scroll-margin',\n 'scroll-margin-block',\n 'scroll-margin-block-end',\n 'scroll-margin-block-start',\n 'scroll-margin-bottom',\n 'scroll-margin-inline',\n 'scroll-margin-inline-end',\n 'scroll-margin-inline-start',\n 'scroll-margin-left',\n 'scroll-margin-right',\n 'scroll-margin-top',\n 'scroll-padding',\n 'scroll-padding-block',\n 'scroll-padding-block-end',\n 'scroll-padding-block-start',\n 'scroll-padding-bottom',\n 'scroll-padding-inline',\n 'scroll-padding-inline-end',\n 'scroll-padding-inline-start',\n 'scroll-padding-left',\n 'scroll-padding-right',\n 'scroll-padding-top',\n 'scroll-snap-coordinate',\n 'scroll-snap-destination',\n 'scrollbar-color',\n 'shape-image-threshold',\n 'shape-margin',\n 'shape-outside',\n 'tab-size',\n 'text-decoration',\n 'text-decoration-color',\n 'text-decoration-thickness',\n 'text-emphasis',\n 'text-emphasis-color',\n 'text-indent',\n 'text-shadow',\n 'text-underline-offset',\n 'top',\n 'transform',\n 'transform-origin',\n 'translate',\n 'vertical-align',\n 'visibility',\n 'width',\n 'word-spacing',\n 'z-index',\n 'zoom',\n]);\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction isBrowser() {\n return (typeof window !== 'undefined' && typeof window.document !== 'undefined');\n}\nfunction isNode() {\n // Checking only for `process` isn't enough to identify whether or not we're in a Node\n // environment, because Webpack by default will polyfill the `process`. While we can discern\n // that Webpack polyfilled it by looking at `process.browser`, it's very Webpack-specific and\n // might not be future-proof. Instead we look at the stringified version of `process` which\n // is `[object process]` in Node and `[object Object]` when polyfilled.\n return typeof process !== 'undefined' && {}.toString.call(process) === '[object process]';\n}\nfunction optimizeGroupPlayer(players) {\n switch (players.length) {\n case 0:\n return new NoopAnimationPlayer();\n case 1:\n return players[0];\n default:\n return new ɵAnimationGroupPlayer(players);\n }\n}\nfunction normalizeKeyframes$1(driver, normalizer, element, keyframes, preStyles = new Map(), postStyles = new Map()) {\n const errors = [];\n const normalizedKeyframes = [];\n let previousOffset = -1;\n let previousKeyframe = null;\n keyframes.forEach(kf => {\n const offset = kf.get('offset');\n const isSameOffset = offset == previousOffset;\n const normalizedKeyframe = (isSameOffset && previousKeyframe) || new Map();\n kf.forEach((val, prop) => {\n let normalizedProp = prop;\n let normalizedValue = val;\n if (prop !== 'offset') {\n normalizedProp = normalizer.normalizePropertyName(normalizedProp, errors);\n switch (normalizedValue) {\n case ɵPRE_STYLE:\n normalizedValue = preStyles.get(prop);\n break;\n case AUTO_STYLE:\n normalizedValue = postStyles.get(prop);\n break;\n default:\n normalizedValue =\n normalizer.normalizeStyleValue(prop, normalizedProp, normalizedValue, errors);\n break;\n }\n }\n normalizedKeyframe.set(normalizedProp, normalizedValue);\n });\n if (!isSameOffset) {\n normalizedKeyframes.push(normalizedKeyframe);\n }\n previousKeyframe = normalizedKeyframe;\n previousOffset = offset;\n });\n if (errors.length) {\n throw animationFailed(errors);\n }\n return normalizedKeyframes;\n}\nfunction listenOnPlayer(player, eventName, event, callback) {\n switch (eventName) {\n case 'start':\n player.onStart(() => callback(event && copyAnimationEvent(event, 'start', player)));\n break;\n case 'done':\n player.onDone(() => callback(event && copyAnimationEvent(event, 'done', player)));\n break;\n case 'destroy':\n player.onDestroy(() => callback(event && copyAnimationEvent(event, 'destroy', player)));\n break;\n }\n}\nfunction copyAnimationEvent(e, phaseName, player) {\n const totalTime = player.totalTime;\n const disabled = player.disabled ? true : false;\n const event = makeAnimationEvent(e.element, e.triggerName, e.fromState, e.toState, phaseName || e.phaseName, totalTime == undefined ? e.totalTime : totalTime, disabled);\n const data = e['_data'];\n if (data != null) {\n event['_data'] = data;\n }\n return event;\n}\nfunction makeAnimationEvent(element, triggerName, fromState, toState, phaseName = '', totalTime = 0, disabled) {\n return { element, triggerName, fromState, toState, phaseName, totalTime, disabled: !!disabled };\n}\nfunction getOrSetDefaultValue(map, key, defaultValue) {\n let value = map.get(key);\n if (!value) {\n map.set(key, value = defaultValue);\n }\n return value;\n}\nfunction parseTimelineCommand(command) {\n const separatorPos = command.indexOf(':');\n const id = command.substring(1, separatorPos);\n const action = command.slice(separatorPos + 1);\n return [id, action];\n}\nlet _contains = (elm1, elm2) => false;\nlet _query = (element, selector, multi) => {\n return [];\n};\nlet _documentElement = null;\nfunction getParentElement(element) {\n const parent = element.parentNode || element.host; // consider host to support shadow DOM\n if (parent === _documentElement) {\n return null;\n }\n return parent;\n}\n// Define utility methods for browsers and platform-server(domino) where Element\n// and utility methods exist.\nconst _isNode = isNode();\nif (_isNode || typeof Element !== 'undefined') {\n if (!isBrowser()) {\n _contains = (elm1, elm2) => elm1.contains(elm2);\n }\n else {\n // Read the document element in an IIFE that's been marked pure to avoid a top-level property\n // read that may prevent tree-shaking.\n _documentElement = /* @__PURE__ */ (() => document.documentElement)();\n _contains = (elm1, elm2) => {\n while (elm2) {\n if (elm2 === elm1) {\n return true;\n }\n elm2 = getParentElement(elm2);\n }\n return false;\n };\n }\n _query = (element, selector, multi) => {\n if (multi) {\n return Array.from(element.querySelectorAll(selector));\n }\n const elem = element.querySelector(selector);\n return elem ? [elem] : [];\n };\n}\nfunction containsVendorPrefix(prop) {\n // Webkit is the only real popular vendor prefix nowadays\n // cc: http://shouldiprefix.com/\n return prop.substring(1, 6) == 'ebkit'; // webkit or Webkit\n}\nlet _CACHED_BODY = null;\nlet _IS_WEBKIT = false;\nfunction validateStyleProperty(prop) {\n if (!_CACHED_BODY) {\n _CACHED_BODY = getBodyNode() || {};\n _IS_WEBKIT = _CACHED_BODY.style ? ('WebkitAppearance' in _CACHED_BODY.style) : false;\n }\n let result = true;\n if (_CACHED_BODY.style && !containsVendorPrefix(prop)) {\n result = prop in _CACHED_BODY.style;\n if (!result && _IS_WEBKIT) {\n const camelProp = 'Webkit' + prop.charAt(0).toUpperCase() + prop.slice(1);\n result = camelProp in _CACHED_BODY.style;\n }\n }\n return result;\n}\nfunction validateWebAnimatableStyleProperty(prop) {\n return ANIMATABLE_PROP_SET.has(prop);\n}\nfunction getBodyNode() {\n if (typeof document != 'undefined') {\n return document.body;\n }\n return null;\n}\nconst containsElement = _contains;\nconst invokeQuery = _query;\nfunction hypenatePropsKeys(original) {\n const newMap = new Map();\n original.forEach((val, prop) => {\n const newProp = prop.replace(/([a-z])([A-Z])/g, '$1-$2');\n newMap.set(newProp, val);\n });\n return newMap;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @publicApi\n */\nclass NoopAnimationDriver {\n validateStyleProperty(prop) {\n return validateStyleProperty(prop);\n }\n matchesElement(_element, _selector) {\n // This method is deprecated and no longer in use so we return false.\n return false;\n }\n containsElement(elm1, elm2) {\n return containsElement(elm1, elm2);\n }\n getParentElement(element) {\n return getParentElement(element);\n }\n query(element, selector, multi) {\n return invokeQuery(element, selector, multi);\n }\n computeStyle(element, prop, defaultValue) {\n return defaultValue || '';\n }\n animate(element, keyframes, duration, delay, easing, previousPlayers = [], scrubberAccessRequested) {\n return new NoopAnimationPlayer(duration, delay);\n }\n}\nNoopAnimationDriver.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NoopAnimationDriver, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nNoopAnimationDriver.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NoopAnimationDriver });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NoopAnimationDriver, decorators: [{\n type: Injectable\n }] });\n/**\n * @publicApi\n */\nclass AnimationDriver {\n}\nAnimationDriver.NOOP = ( /* @__PURE__ */new NoopAnimationDriver());\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst ONE_SECOND = 1000;\nconst SUBSTITUTION_EXPR_START = '{{';\nconst SUBSTITUTION_EXPR_END = '}}';\nconst ENTER_CLASSNAME = 'ng-enter';\nconst LEAVE_CLASSNAME = 'ng-leave';\nconst NG_TRIGGER_CLASSNAME = 'ng-trigger';\nconst NG_TRIGGER_SELECTOR = '.ng-trigger';\nconst NG_ANIMATING_CLASSNAME = 'ng-animating';\nconst NG_ANIMATING_SELECTOR = '.ng-animating';\nfunction resolveTimingValue(value) {\n if (typeof value == 'number')\n return value;\n const matches = value.match(/^(-?[\\.\\d]+)(m?s)/);\n if (!matches || matches.length < 2)\n return 0;\n return _convertTimeValueToMS(parseFloat(matches[1]), matches[2]);\n}\nfunction _convertTimeValueToMS(value, unit) {\n switch (unit) {\n case 's':\n return value * ONE_SECOND;\n default: // ms or something else\n return value;\n }\n}\nfunction resolveTiming(timings, errors, allowNegativeValues) {\n return timings.hasOwnProperty('duration') ?\n timings :\n parseTimeExpression(timings, errors, allowNegativeValues);\n}\nfunction parseTimeExpression(exp, errors, allowNegativeValues) {\n const regex = /^(-?[\\.\\d]+)(m?s)(?:\\s+(-?[\\.\\d]+)(m?s))?(?:\\s+([-a-z]+(?:\\(.+?\\))?))?$/i;\n let duration;\n let delay = 0;\n let easing = '';\n if (typeof exp === 'string') {\n const matches = exp.match(regex);\n if (matches === null) {\n errors.push(invalidTimingValue(exp));\n return { duration: 0, delay: 0, easing: '' };\n }\n duration = _convertTimeValueToMS(parseFloat(matches[1]), matches[2]);\n const delayMatch = matches[3];\n if (delayMatch != null) {\n delay = _convertTimeValueToMS(parseFloat(delayMatch), matches[4]);\n }\n const easingVal = matches[5];\n if (easingVal) {\n easing = easingVal;\n }\n }\n else {\n duration = exp;\n }\n if (!allowNegativeValues) {\n let containsErrors = false;\n let startIndex = errors.length;\n if (duration < 0) {\n errors.push(negativeStepValue());\n containsErrors = true;\n }\n if (delay < 0) {\n errors.push(negativeDelayValue());\n containsErrors = true;\n }\n if (containsErrors) {\n errors.splice(startIndex, 0, invalidTimingValue(exp));\n }\n }\n return { duration, delay, easing };\n}\nfunction copyObj(obj, destination = {}) {\n Object.keys(obj).forEach(prop => {\n destination[prop] = obj[prop];\n });\n return destination;\n}\nfunction convertToMap(obj) {\n const styleMap = new Map();\n Object.keys(obj).forEach(prop => {\n const val = obj[prop];\n styleMap.set(prop, val);\n });\n return styleMap;\n}\nfunction normalizeKeyframes(keyframes) {\n if (!keyframes.length) {\n return [];\n }\n if (keyframes[0] instanceof Map) {\n return keyframes;\n }\n return keyframes.map(kf => convertToMap(kf));\n}\nfunction normalizeStyles(styles) {\n const normalizedStyles = new Map();\n if (Array.isArray(styles)) {\n styles.forEach(data => copyStyles(data, normalizedStyles));\n }\n else {\n copyStyles(styles, normalizedStyles);\n }\n return normalizedStyles;\n}\nfunction copyStyles(styles, destination = new Map(), backfill) {\n if (backfill) {\n for (let [prop, val] of backfill) {\n destination.set(prop, val);\n }\n }\n for (let [prop, val] of styles) {\n destination.set(prop, val);\n }\n return destination;\n}\nfunction getStyleAttributeString(element, key, value) {\n // Return the key-value pair string to be added to the style attribute for the\n // given CSS style key.\n if (value) {\n return key + ':' + value + ';';\n }\n else {\n return '';\n }\n}\nfunction writeStyleAttribute(element) {\n // Read the style property of the element and manually reflect it to the\n // style attribute. This is needed because Domino on platform-server doesn't\n // understand the full set of allowed CSS properties and doesn't reflect some\n // of them automatically.\n let styleAttrValue = '';\n for (let i = 0; i < element.style.length; i++) {\n const key = element.style.item(i);\n styleAttrValue += getStyleAttributeString(element, key, element.style.getPropertyValue(key));\n }\n for (const key in element.style) {\n // Skip internal Domino properties that don't need to be reflected.\n if (!element.style.hasOwnProperty(key) || key.startsWith('_')) {\n continue;\n }\n const dashKey = camelCaseToDashCase(key);\n styleAttrValue += getStyleAttributeString(element, dashKey, element.style[key]);\n }\n element.setAttribute('style', styleAttrValue);\n}\nfunction setStyles(element, styles, formerStyles) {\n if (element['style']) {\n styles.forEach((val, prop) => {\n const camelProp = dashCaseToCamelCase(prop);\n if (formerStyles && !formerStyles.has(prop)) {\n formerStyles.set(prop, element.style[camelProp]);\n }\n element.style[camelProp] = val;\n });\n // On the server set the 'style' attribute since it's not automatically reflected.\n if (isNode()) {\n writeStyleAttribute(element);\n }\n }\n}\nfunction eraseStyles(element, styles) {\n if (element['style']) {\n styles.forEach((_, prop) => {\n const camelProp = dashCaseToCamelCase(prop);\n element.style[camelProp] = '';\n });\n // On the server set the 'style' attribute since it's not automatically reflected.\n if (isNode()) {\n writeStyleAttribute(element);\n }\n }\n}\nfunction normalizeAnimationEntry(steps) {\n if (Array.isArray(steps)) {\n if (steps.length == 1)\n return steps[0];\n return sequence(steps);\n }\n return steps;\n}\nfunction validateStyleParams(value, options, errors) {\n const params = options.params || {};\n const matches = extractStyleParams(value);\n if (matches.length) {\n matches.forEach(varName => {\n if (!params.hasOwnProperty(varName)) {\n errors.push(invalidStyleParams(varName));\n }\n });\n }\n}\nconst PARAM_REGEX = new RegExp(`${SUBSTITUTION_EXPR_START}\\\\s*(.+?)\\\\s*${SUBSTITUTION_EXPR_END}`, 'g');\nfunction extractStyleParams(value) {\n let params = [];\n if (typeof value === 'string') {\n let match;\n while (match = PARAM_REGEX.exec(value)) {\n params.push(match[1]);\n }\n PARAM_REGEX.lastIndex = 0;\n }\n return params;\n}\nfunction interpolateParams(value, params, errors) {\n const original = value.toString();\n const str = original.replace(PARAM_REGEX, (_, varName) => {\n let localVal = params[varName];\n // this means that the value was never overridden by the data passed in by the user\n if (localVal == null) {\n errors.push(invalidParamValue(varName));\n localVal = '';\n }\n return localVal.toString();\n });\n // we do this to assert that numeric values stay as they are\n return str == original ? value : str;\n}\nfunction iteratorToArray(iterator) {\n const arr = [];\n let item = iterator.next();\n while (!item.done) {\n arr.push(item.value);\n item = iterator.next();\n }\n return arr;\n}\nconst DASH_CASE_REGEXP = /-+([a-z0-9])/g;\nfunction dashCaseToCamelCase(input) {\n return input.replace(DASH_CASE_REGEXP, (...m) => m[1].toUpperCase());\n}\nfunction camelCaseToDashCase(input) {\n return input.replace(/([a-z])([A-Z])/g, '$1-$2').toLowerCase();\n}\nfunction allowPreviousPlayerStylesMerge(duration, delay) {\n return duration === 0 || delay === 0;\n}\nfunction balancePreviousStylesIntoKeyframes(element, keyframes, previousStyles) {\n if (previousStyles.size && keyframes.length) {\n let startingKeyframe = keyframes[0];\n let missingStyleProps = [];\n previousStyles.forEach((val, prop) => {\n if (!startingKeyframe.has(prop)) {\n missingStyleProps.push(prop);\n }\n startingKeyframe.set(prop, val);\n });\n if (missingStyleProps.length) {\n for (let i = 1; i < keyframes.length; i++) {\n let kf = keyframes[i];\n missingStyleProps.forEach(prop => kf.set(prop, computeStyle(element, prop)));\n }\n }\n }\n return keyframes;\n}\nfunction visitDslNode(visitor, node, context) {\n switch (node.type) {\n case 7 /* AnimationMetadataType.Trigger */:\n return visitor.visitTrigger(node, context);\n case 0 /* AnimationMetadataType.State */:\n return visitor.visitState(node, context);\n case 1 /* AnimationMetadataType.Transition */:\n return visitor.visitTransition(node, context);\n case 2 /* AnimationMetadataType.Sequence */:\n return visitor.visitSequence(node, context);\n case 3 /* AnimationMetadataType.Group */:\n return visitor.visitGroup(node, context);\n case 4 /* AnimationMetadataType.Animate */:\n return visitor.visitAnimate(node, context);\n case 5 /* AnimationMetadataType.Keyframes */:\n return visitor.visitKeyframes(node, context);\n case 6 /* AnimationMetadataType.Style */:\n return visitor.visitStyle(node, context);\n case 8 /* AnimationMetadataType.Reference */:\n return visitor.visitReference(node, context);\n case 9 /* AnimationMetadataType.AnimateChild */:\n return visitor.visitAnimateChild(node, context);\n case 10 /* AnimationMetadataType.AnimateRef */:\n return visitor.visitAnimateRef(node, context);\n case 11 /* AnimationMetadataType.Query */:\n return visitor.visitQuery(node, context);\n case 12 /* AnimationMetadataType.Stagger */:\n return visitor.visitStagger(node, context);\n default:\n throw invalidNodeType(node.type);\n }\n}\nfunction computeStyle(element, prop) {\n return window.getComputedStyle(element)[prop];\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst NG_DEV_MODE = typeof ngDevMode === 'undefined' || !!ngDevMode;\nfunction createListOfWarnings(warnings) {\n const LINE_START = '\\n - ';\n return `${LINE_START}${warnings.filter(Boolean).map(warning => warning).join(LINE_START)}`;\n}\nfunction warnValidation(warnings) {\n NG_DEV_MODE && console.warn(`animation validation warnings:${createListOfWarnings(warnings)}`);\n}\nfunction warnTriggerBuild(name, warnings) {\n NG_DEV_MODE &&\n console.warn(`The animation trigger \"${name}\" has built with the following warnings:${createListOfWarnings(warnings)}`);\n}\nfunction warnRegister(warnings) {\n NG_DEV_MODE &&\n console.warn(`Animation built with the following warnings:${createListOfWarnings(warnings)}`);\n}\nfunction triggerParsingWarnings(name, warnings) {\n NG_DEV_MODE &&\n console.warn(`Animation parsing for the ${name} trigger presents the following warnings:${createListOfWarnings(warnings)}`);\n}\nfunction pushUnrecognizedPropertiesWarning(warnings, props) {\n if (props.length) {\n warnings.push(`The following provided properties are not recognized: ${props.join(', ')}`);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst ANY_STATE = '*';\nfunction parseTransitionExpr(transitionValue, errors) {\n const expressions = [];\n if (typeof transitionValue == 'string') {\n transitionValue.split(/\\s*,\\s*/).forEach(str => parseInnerTransitionStr(str, expressions, errors));\n }\n else {\n expressions.push(transitionValue);\n }\n return expressions;\n}\nfunction parseInnerTransitionStr(eventStr, expressions, errors) {\n if (eventStr[0] == ':') {\n const result = parseAnimationAlias(eventStr, errors);\n if (typeof result == 'function') {\n expressions.push(result);\n return;\n }\n eventStr = result;\n }\n const match = eventStr.match(/^(\\*|[-\\w]+)\\s*([=-]>)\\s*(\\*|[-\\w]+)$/);\n if (match == null || match.length < 4) {\n errors.push(invalidExpression(eventStr));\n return expressions;\n }\n const fromState = match[1];\n const separator = match[2];\n const toState = match[3];\n expressions.push(makeLambdaFromStates(fromState, toState));\n const isFullAnyStateExpr = fromState == ANY_STATE && toState == ANY_STATE;\n if (separator[0] == '<' && !isFullAnyStateExpr) {\n expressions.push(makeLambdaFromStates(toState, fromState));\n }\n}\nfunction parseAnimationAlias(alias, errors) {\n switch (alias) {\n case ':enter':\n return 'void => *';\n case ':leave':\n return '* => void';\n case ':increment':\n return (fromState, toState) => parseFloat(toState) > parseFloat(fromState);\n case ':decrement':\n return (fromState, toState) => parseFloat(toState) < parseFloat(fromState);\n default:\n errors.push(invalidTransitionAlias(alias));\n return '* => *';\n }\n}\n// DO NOT REFACTOR ... keep the follow set instantiations\n// with the values intact (closure compiler for some reason\n// removes follow-up lines that add the values outside of\n// the constructor...\nconst TRUE_BOOLEAN_VALUES = new Set(['true', '1']);\nconst FALSE_BOOLEAN_VALUES = new Set(['false', '0']);\nfunction makeLambdaFromStates(lhs, rhs) {\n const LHS_MATCH_BOOLEAN = TRUE_BOOLEAN_VALUES.has(lhs) || FALSE_BOOLEAN_VALUES.has(lhs);\n const RHS_MATCH_BOOLEAN = TRUE_BOOLEAN_VALUES.has(rhs) || FALSE_BOOLEAN_VALUES.has(rhs);\n return (fromState, toState) => {\n let lhsMatch = lhs == ANY_STATE || lhs == fromState;\n let rhsMatch = rhs == ANY_STATE || rhs == toState;\n if (!lhsMatch && LHS_MATCH_BOOLEAN && typeof fromState === 'boolean') {\n lhsMatch = fromState ? TRUE_BOOLEAN_VALUES.has(lhs) : FALSE_BOOLEAN_VALUES.has(lhs);\n }\n if (!rhsMatch && RHS_MATCH_BOOLEAN && typeof toState === 'boolean') {\n rhsMatch = toState ? TRUE_BOOLEAN_VALUES.has(rhs) : FALSE_BOOLEAN_VALUES.has(rhs);\n }\n return lhsMatch && rhsMatch;\n };\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst SELF_TOKEN = ':self';\nconst SELF_TOKEN_REGEX = new RegExp(`\\s*${SELF_TOKEN}\\s*,?`, 'g');\n/*\n * [Validation]\n * The visitor code below will traverse the animation AST generated by the animation verb functions\n * (the output is a tree of objects) and attempt to perform a series of validations on the data. The\n * following corner-cases will be validated:\n *\n * 1. Overlap of animations\n * Given that a CSS property cannot be animated in more than one place at the same time, it's\n * important that this behavior is detected and validated. The way in which this occurs is that\n * each time a style property is examined, a string-map containing the property will be updated with\n * the start and end times for when the property is used within an animation step.\n *\n * If there are two or more parallel animations that are currently running (these are invoked by the\n * group()) on the same element then the validator will throw an error. Since the start/end timing\n * values are collected for each property then if the current animation step is animating the same\n * property and its timing values fall anywhere into the window of time that the property is\n * currently being animated within then this is what causes an error.\n *\n * 2. Timing values\n * The validator will validate to see if a timing value of `duration delay easing` or\n * `durationNumber` is valid or not.\n *\n * (note that upon validation the code below will replace the timing data with an object containing\n * {duration,delay,easing}.\n *\n * 3. Offset Validation\n * Each of the style() calls are allowed to have an offset value when placed inside of keyframes().\n * Offsets within keyframes() are considered valid when:\n *\n * - No offsets are used at all\n * - Each style() entry contains an offset value\n * - Each offset is between 0 and 1\n * - Each offset is greater to or equal than the previous one\n *\n * Otherwise an error will be thrown.\n */\nfunction buildAnimationAst(driver, metadata, errors, warnings) {\n return new AnimationAstBuilderVisitor(driver).build(metadata, errors, warnings);\n}\nconst ROOT_SELECTOR = '';\nclass AnimationAstBuilderVisitor {\n constructor(_driver) {\n this._driver = _driver;\n }\n build(metadata, errors, warnings) {\n const context = new AnimationAstBuilderContext(errors);\n this._resetContextStyleTimingState(context);\n const ast = visitDslNode(this, normalizeAnimationEntry(metadata), context);\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n if (context.unsupportedCSSPropertiesFound.size) {\n pushUnrecognizedPropertiesWarning(warnings, [...context.unsupportedCSSPropertiesFound.keys()]);\n }\n }\n return ast;\n }\n _resetContextStyleTimingState(context) {\n context.currentQuerySelector = ROOT_SELECTOR;\n context.collectedStyles = new Map();\n context.collectedStyles.set(ROOT_SELECTOR, new Map());\n context.currentTime = 0;\n }\n visitTrigger(metadata, context) {\n let queryCount = context.queryCount = 0;\n let depCount = context.depCount = 0;\n const states = [];\n const transitions = [];\n if (metadata.name.charAt(0) == '@') {\n context.errors.push(invalidTrigger());\n }\n metadata.definitions.forEach(def => {\n this._resetContextStyleTimingState(context);\n if (def.type == 0 /* AnimationMetadataType.State */) {\n const stateDef = def;\n const name = stateDef.name;\n name.toString().split(/\\s*,\\s*/).forEach(n => {\n stateDef.name = n;\n states.push(this.visitState(stateDef, context));\n });\n stateDef.name = name;\n }\n else if (def.type == 1 /* AnimationMetadataType.Transition */) {\n const transition = this.visitTransition(def, context);\n queryCount += transition.queryCount;\n depCount += transition.depCount;\n transitions.push(transition);\n }\n else {\n context.errors.push(invalidDefinition());\n }\n });\n return {\n type: 7 /* AnimationMetadataType.Trigger */,\n name: metadata.name,\n states,\n transitions,\n queryCount,\n depCount,\n options: null\n };\n }\n visitState(metadata, context) {\n const styleAst = this.visitStyle(metadata.styles, context);\n const astParams = (metadata.options && metadata.options.params) || null;\n if (styleAst.containsDynamicStyles) {\n const missingSubs = new Set();\n const params = astParams || {};\n styleAst.styles.forEach(style => {\n if (style instanceof Map) {\n style.forEach(value => {\n extractStyleParams(value).forEach(sub => {\n if (!params.hasOwnProperty(sub)) {\n missingSubs.add(sub);\n }\n });\n });\n }\n });\n if (missingSubs.size) {\n const missingSubsArr = iteratorToArray(missingSubs.values());\n context.errors.push(invalidState(metadata.name, missingSubsArr));\n }\n }\n return {\n type: 0 /* AnimationMetadataType.State */,\n name: metadata.name,\n style: styleAst,\n options: astParams ? { params: astParams } : null\n };\n }\n visitTransition(metadata, context) {\n context.queryCount = 0;\n context.depCount = 0;\n const animation = visitDslNode(this, normalizeAnimationEntry(metadata.animation), context);\n const matchers = parseTransitionExpr(metadata.expr, context.errors);\n return {\n type: 1 /* AnimationMetadataType.Transition */,\n matchers,\n animation,\n queryCount: context.queryCount,\n depCount: context.depCount,\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitSequence(metadata, context) {\n return {\n type: 2 /* AnimationMetadataType.Sequence */,\n steps: metadata.steps.map(s => visitDslNode(this, s, context)),\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitGroup(metadata, context) {\n const currentTime = context.currentTime;\n let furthestTime = 0;\n const steps = metadata.steps.map(step => {\n context.currentTime = currentTime;\n const innerAst = visitDslNode(this, step, context);\n furthestTime = Math.max(furthestTime, context.currentTime);\n return innerAst;\n });\n context.currentTime = furthestTime;\n return {\n type: 3 /* AnimationMetadataType.Group */,\n steps,\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitAnimate(metadata, context) {\n const timingAst = constructTimingAst(metadata.timings, context.errors);\n context.currentAnimateTimings = timingAst;\n let styleAst;\n let styleMetadata = metadata.styles ? metadata.styles : style({});\n if (styleMetadata.type == 5 /* AnimationMetadataType.Keyframes */) {\n styleAst = this.visitKeyframes(styleMetadata, context);\n }\n else {\n let styleMetadata = metadata.styles;\n let isEmpty = false;\n if (!styleMetadata) {\n isEmpty = true;\n const newStyleData = {};\n if (timingAst.easing) {\n newStyleData['easing'] = timingAst.easing;\n }\n styleMetadata = style(newStyleData);\n }\n context.currentTime += timingAst.duration + timingAst.delay;\n const _styleAst = this.visitStyle(styleMetadata, context);\n _styleAst.isEmptyStep = isEmpty;\n styleAst = _styleAst;\n }\n context.currentAnimateTimings = null;\n return {\n type: 4 /* AnimationMetadataType.Animate */,\n timings: timingAst,\n style: styleAst,\n options: null\n };\n }\n visitStyle(metadata, context) {\n const ast = this._makeStyleAst(metadata, context);\n this._validateStyleAst(ast, context);\n return ast;\n }\n _makeStyleAst(metadata, context) {\n const styles = [];\n const metadataStyles = Array.isArray(metadata.styles) ? metadata.styles : [metadata.styles];\n for (let styleTuple of metadataStyles) {\n if (typeof styleTuple === 'string') {\n if (styleTuple === AUTO_STYLE) {\n styles.push(styleTuple);\n }\n else {\n context.errors.push(invalidStyleValue(styleTuple));\n }\n }\n else {\n styles.push(convertToMap(styleTuple));\n }\n }\n let containsDynamicStyles = false;\n let collectedEasing = null;\n styles.forEach(styleData => {\n if (styleData instanceof Map) {\n if (styleData.has('easing')) {\n collectedEasing = styleData.get('easing');\n styleData.delete('easing');\n }\n if (!containsDynamicStyles) {\n for (let value of styleData.values()) {\n if (value.toString().indexOf(SUBSTITUTION_EXPR_START) >= 0) {\n containsDynamicStyles = true;\n break;\n }\n }\n }\n }\n });\n return {\n type: 6 /* AnimationMetadataType.Style */,\n styles,\n easing: collectedEasing,\n offset: metadata.offset,\n containsDynamicStyles,\n options: null\n };\n }\n _validateStyleAst(ast, context) {\n const timings = context.currentAnimateTimings;\n let endTime = context.currentTime;\n let startTime = context.currentTime;\n if (timings && startTime > 0) {\n startTime -= timings.duration + timings.delay;\n }\n ast.styles.forEach(tuple => {\n if (typeof tuple === 'string')\n return;\n tuple.forEach((value, prop) => {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n if (!this._driver.validateStyleProperty(prop)) {\n tuple.delete(prop);\n context.unsupportedCSSPropertiesFound.add(prop);\n return;\n }\n }\n // This is guaranteed to have a defined Map at this querySelector location making it\n // safe to add the assertion here. It is set as a default empty map in prior methods.\n const collectedStyles = context.collectedStyles.get(context.currentQuerySelector);\n const collectedEntry = collectedStyles.get(prop);\n let updateCollectedStyle = true;\n if (collectedEntry) {\n if (startTime != endTime && startTime >= collectedEntry.startTime &&\n endTime <= collectedEntry.endTime) {\n context.errors.push(invalidParallelAnimation(prop, collectedEntry.startTime, collectedEntry.endTime, startTime, endTime));\n updateCollectedStyle = false;\n }\n // we always choose the smaller start time value since we\n // want to have a record of the entire animation window where\n // the style property is being animated in between\n startTime = collectedEntry.startTime;\n }\n if (updateCollectedStyle) {\n collectedStyles.set(prop, { startTime, endTime });\n }\n if (context.options) {\n validateStyleParams(value, context.options, context.errors);\n }\n });\n });\n }\n visitKeyframes(metadata, context) {\n const ast = { type: 5 /* AnimationMetadataType.Keyframes */, styles: [], options: null };\n if (!context.currentAnimateTimings) {\n context.errors.push(invalidKeyframes());\n return ast;\n }\n const MAX_KEYFRAME_OFFSET = 1;\n let totalKeyframesWithOffsets = 0;\n const offsets = [];\n let offsetsOutOfOrder = false;\n let keyframesOutOfRange = false;\n let previousOffset = 0;\n const keyframes = metadata.steps.map(styles => {\n const style = this._makeStyleAst(styles, context);\n let offsetVal = style.offset != null ? style.offset : consumeOffset(style.styles);\n let offset = 0;\n if (offsetVal != null) {\n totalKeyframesWithOffsets++;\n offset = style.offset = offsetVal;\n }\n keyframesOutOfRange = keyframesOutOfRange || offset < 0 || offset > 1;\n offsetsOutOfOrder = offsetsOutOfOrder || offset < previousOffset;\n previousOffset = offset;\n offsets.push(offset);\n return style;\n });\n if (keyframesOutOfRange) {\n context.errors.push(invalidOffset());\n }\n if (offsetsOutOfOrder) {\n context.errors.push(keyframeOffsetsOutOfOrder());\n }\n const length = metadata.steps.length;\n let generatedOffset = 0;\n if (totalKeyframesWithOffsets > 0 && totalKeyframesWithOffsets < length) {\n context.errors.push(keyframesMissingOffsets());\n }\n else if (totalKeyframesWithOffsets == 0) {\n generatedOffset = MAX_KEYFRAME_OFFSET / (length - 1);\n }\n const limit = length - 1;\n const currentTime = context.currentTime;\n const currentAnimateTimings = context.currentAnimateTimings;\n const animateDuration = currentAnimateTimings.duration;\n keyframes.forEach((kf, i) => {\n const offset = generatedOffset > 0 ? (i == limit ? 1 : (generatedOffset * i)) : offsets[i];\n const durationUpToThisFrame = offset * animateDuration;\n context.currentTime = currentTime + currentAnimateTimings.delay + durationUpToThisFrame;\n currentAnimateTimings.duration = durationUpToThisFrame;\n this._validateStyleAst(kf, context);\n kf.offset = offset;\n ast.styles.push(kf);\n });\n return ast;\n }\n visitReference(metadata, context) {\n return {\n type: 8 /* AnimationMetadataType.Reference */,\n animation: visitDslNode(this, normalizeAnimationEntry(metadata.animation), context),\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitAnimateChild(metadata, context) {\n context.depCount++;\n return {\n type: 9 /* AnimationMetadataType.AnimateChild */,\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitAnimateRef(metadata, context) {\n return {\n type: 10 /* AnimationMetadataType.AnimateRef */,\n animation: this.visitReference(metadata.animation, context),\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitQuery(metadata, context) {\n const parentSelector = context.currentQuerySelector;\n const options = (metadata.options || {});\n context.queryCount++;\n context.currentQuery = metadata;\n const [selector, includeSelf] = normalizeSelector(metadata.selector);\n context.currentQuerySelector =\n parentSelector.length ? (parentSelector + ' ' + selector) : selector;\n getOrSetDefaultValue(context.collectedStyles, context.currentQuerySelector, new Map());\n const animation = visitDslNode(this, normalizeAnimationEntry(metadata.animation), context);\n context.currentQuery = null;\n context.currentQuerySelector = parentSelector;\n return {\n type: 11 /* AnimationMetadataType.Query */,\n selector,\n limit: options.limit || 0,\n optional: !!options.optional,\n includeSelf,\n animation,\n originalSelector: metadata.selector,\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitStagger(metadata, context) {\n if (!context.currentQuery) {\n context.errors.push(invalidStagger());\n }\n const timings = metadata.timings === 'full' ?\n { duration: 0, delay: 0, easing: 'full' } :\n resolveTiming(metadata.timings, context.errors, true);\n return {\n type: 12 /* AnimationMetadataType.Stagger */,\n animation: visitDslNode(this, normalizeAnimationEntry(metadata.animation), context),\n timings,\n options: null\n };\n }\n}\nfunction normalizeSelector(selector) {\n const hasAmpersand = selector.split(/\\s*,\\s*/).find(token => token == SELF_TOKEN) ? true : false;\n if (hasAmpersand) {\n selector = selector.replace(SELF_TOKEN_REGEX, '');\n }\n // Note: the :enter and :leave aren't normalized here since those\n // selectors are filled in at runtime during timeline building\n selector = selector.replace(/@\\*/g, NG_TRIGGER_SELECTOR)\n .replace(/@\\w+/g, match => NG_TRIGGER_SELECTOR + '-' + match.slice(1))\n .replace(/:animating/g, NG_ANIMATING_SELECTOR);\n return [selector, hasAmpersand];\n}\nfunction normalizeParams(obj) {\n return obj ? copyObj(obj) : null;\n}\nclass AnimationAstBuilderContext {\n constructor(errors) {\n this.errors = errors;\n this.queryCount = 0;\n this.depCount = 0;\n this.currentTransition = null;\n this.currentQuery = null;\n this.currentQuerySelector = null;\n this.currentAnimateTimings = null;\n this.currentTime = 0;\n this.collectedStyles = new Map();\n this.options = null;\n this.unsupportedCSSPropertiesFound = new Set();\n }\n}\nfunction consumeOffset(styles) {\n if (typeof styles == 'string')\n return null;\n let offset = null;\n if (Array.isArray(styles)) {\n styles.forEach(styleTuple => {\n if (styleTuple instanceof Map && styleTuple.has('offset')) {\n const obj = styleTuple;\n offset = parseFloat(obj.get('offset'));\n obj.delete('offset');\n }\n });\n }\n else if (styles instanceof Map && styles.has('offset')) {\n const obj = styles;\n offset = parseFloat(obj.get('offset'));\n obj.delete('offset');\n }\n return offset;\n}\nfunction constructTimingAst(value, errors) {\n if (value.hasOwnProperty('duration')) {\n return value;\n }\n if (typeof value == 'number') {\n const duration = resolveTiming(value, errors).duration;\n return makeTimingAst(duration, 0, '');\n }\n const strValue = value;\n const isDynamic = strValue.split(/\\s+/).some(v => v.charAt(0) == '{' && v.charAt(1) == '{');\n if (isDynamic) {\n const ast = makeTimingAst(0, 0, '');\n ast.dynamic = true;\n ast.strValue = strValue;\n return ast;\n }\n const timings = resolveTiming(strValue, errors);\n return makeTimingAst(timings.duration, timings.delay, timings.easing);\n}\nfunction normalizeAnimationOptions(options) {\n if (options) {\n options = copyObj(options);\n if (options['params']) {\n options['params'] = normalizeParams(options['params']);\n }\n }\n else {\n options = {};\n }\n return options;\n}\nfunction makeTimingAst(duration, delay, easing) {\n return { duration, delay, easing };\n}\n\nfunction createTimelineInstruction(element, keyframes, preStyleProps, postStyleProps, duration, delay, easing = null, subTimeline = false) {\n return {\n type: 1 /* AnimationTransitionInstructionType.TimelineAnimation */,\n element,\n keyframes,\n preStyleProps,\n postStyleProps,\n duration,\n delay,\n totalTime: duration + delay,\n easing,\n subTimeline\n };\n}\n\nclass ElementInstructionMap {\n constructor() {\n this._map = new Map();\n }\n get(element) {\n return this._map.get(element) || [];\n }\n append(element, instructions) {\n let existingInstructions = this._map.get(element);\n if (!existingInstructions) {\n this._map.set(element, existingInstructions = []);\n }\n existingInstructions.push(...instructions);\n }\n has(element) {\n return this._map.has(element);\n }\n clear() {\n this._map.clear();\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst ONE_FRAME_IN_MILLISECONDS = 1;\nconst ENTER_TOKEN = ':enter';\nconst ENTER_TOKEN_REGEX = new RegExp(ENTER_TOKEN, 'g');\nconst LEAVE_TOKEN = ':leave';\nconst LEAVE_TOKEN_REGEX = new RegExp(LEAVE_TOKEN, 'g');\n/*\n * The code within this file aims to generate web-animations-compatible keyframes from Angular's\n * animation DSL code.\n *\n * The code below will be converted from:\n *\n * ```\n * sequence([\n * style({ opacity: 0 }),\n * animate(1000, style({ opacity: 0 }))\n * ])\n * ```\n *\n * To:\n * ```\n * keyframes = [{ opacity: 0, offset: 0 }, { opacity: 1, offset: 1 }]\n * duration = 1000\n * delay = 0\n * easing = ''\n * ```\n *\n * For this operation to cover the combination of animation verbs (style, animate, group, etc...) a\n * combination of AST traversal and merge-sort-like algorithms are used.\n *\n * [AST Traversal]\n * Each of the animation verbs, when executed, will return an string-map object representing what\n * type of action it is (style, animate, group, etc...) and the data associated with it. This means\n * that when functional composition mix of these functions is evaluated (like in the example above)\n * then it will end up producing a tree of objects representing the animation itself.\n *\n * When this animation object tree is processed by the visitor code below it will visit each of the\n * verb statements within the visitor. And during each visit it will build the context of the\n * animation keyframes by interacting with the `TimelineBuilder`.\n *\n * [TimelineBuilder]\n * This class is responsible for tracking the styles and building a series of keyframe objects for a\n * timeline between a start and end time. The builder starts off with an initial timeline and each\n * time the AST comes across a `group()`, `keyframes()` or a combination of the two within a\n * `sequence()` then it will generate a sub timeline for each step as well as a new one after\n * they are complete.\n *\n * As the AST is traversed, the timing state on each of the timelines will be incremented. If a sub\n * timeline was created (based on one of the cases above) then the parent timeline will attempt to\n * merge the styles used within the sub timelines into itself (only with group() this will happen).\n * This happens with a merge operation (much like how the merge works in mergeSort) and it will only\n * copy the most recently used styles from the sub timelines into the parent timeline. This ensures\n * that if the styles are used later on in another phase of the animation then they will be the most\n * up-to-date values.\n *\n * [How Missing Styles Are Updated]\n * Each timeline has a `backFill` property which is responsible for filling in new styles into\n * already processed keyframes if a new style shows up later within the animation sequence.\n *\n * ```\n * sequence([\n * style({ width: 0 }),\n * animate(1000, style({ width: 100 })),\n * animate(1000, style({ width: 200 })),\n * animate(1000, style({ width: 300 }))\n * animate(1000, style({ width: 400, height: 400 })) // notice how `height` doesn't exist anywhere\n * else\n * ])\n * ```\n *\n * What is happening here is that the `height` value is added later in the sequence, but is missing\n * from all previous animation steps. Therefore when a keyframe is created it would also be missing\n * from all previous keyframes up until where it is first used. For the timeline keyframe generation\n * to properly fill in the style it will place the previous value (the value from the parent\n * timeline) or a default value of `*` into the backFill map. The `copyStyles` method in util.ts\n * handles propagating that backfill map to the styles object.\n *\n * When a sub-timeline is created it will have its own backFill property. This is done so that\n * styles present within the sub-timeline do not accidentally seep into the previous/future timeline\n * keyframes\n *\n * [Validation]\n * The code in this file is not responsible for validation. That functionality happens with within\n * the `AnimationValidatorVisitor` code.\n */\nfunction buildAnimationTimelines(driver, rootElement, ast, enterClassName, leaveClassName, startingStyles = new Map(), finalStyles = new Map(), options, subInstructions, errors = []) {\n return new AnimationTimelineBuilderVisitor().buildKeyframes(driver, rootElement, ast, enterClassName, leaveClassName, startingStyles, finalStyles, options, subInstructions, errors);\n}\nclass AnimationTimelineBuilderVisitor {\n buildKeyframes(driver, rootElement, ast, enterClassName, leaveClassName, startingStyles, finalStyles, options, subInstructions, errors = []) {\n subInstructions = subInstructions || new ElementInstructionMap();\n const context = new AnimationTimelineContext(driver, rootElement, subInstructions, enterClassName, leaveClassName, errors, []);\n context.options = options;\n const delay = options.delay ? resolveTimingValue(options.delay) : 0;\n context.currentTimeline.delayNextStep(delay);\n context.currentTimeline.setStyles([startingStyles], null, context.errors, options);\n visitDslNode(this, ast, context);\n // this checks to see if an actual animation happened\n const timelines = context.timelines.filter(timeline => timeline.containsAnimation());\n // note: we just want to apply the final styles for the rootElement, so we do not\n // just apply the styles to the last timeline but the last timeline which\n // element is the root one (basically `*`-styles are replaced with the actual\n // state style values only for the root element)\n if (timelines.length && finalStyles.size) {\n let lastRootTimeline;\n for (let i = timelines.length - 1; i >= 0; i--) {\n const timeline = timelines[i];\n if (timeline.element === rootElement) {\n lastRootTimeline = timeline;\n break;\n }\n }\n if (lastRootTimeline && !lastRootTimeline.allowOnlyTimelineStyles()) {\n lastRootTimeline.setStyles([finalStyles], null, context.errors, options);\n }\n }\n return timelines.length ?\n timelines.map(timeline => timeline.buildKeyframes()) :\n [createTimelineInstruction(rootElement, [], [], [], 0, delay, '', false)];\n }\n visitTrigger(ast, context) {\n // these values are not visited in this AST\n }\n visitState(ast, context) {\n // these values are not visited in this AST\n }\n visitTransition(ast, context) {\n // these values are not visited in this AST\n }\n visitAnimateChild(ast, context) {\n const elementInstructions = context.subInstructions.get(context.element);\n if (elementInstructions) {\n const innerContext = context.createSubContext(ast.options);\n const startTime = context.currentTimeline.currentTime;\n const endTime = this._visitSubInstructions(elementInstructions, innerContext, innerContext.options);\n if (startTime != endTime) {\n // we do this on the upper context because we created a sub context for\n // the sub child animations\n context.transformIntoNewTimeline(endTime);\n }\n }\n context.previousNode = ast;\n }\n visitAnimateRef(ast, context) {\n const innerContext = context.createSubContext(ast.options);\n innerContext.transformIntoNewTimeline();\n this.visitReference(ast.animation, innerContext);\n context.transformIntoNewTimeline(innerContext.currentTimeline.currentTime);\n context.previousNode = ast;\n }\n _visitSubInstructions(instructions, context, options) {\n const startTime = context.currentTimeline.currentTime;\n let furthestTime = startTime;\n // this is a special-case for when a user wants to skip a sub\n // animation from being fired entirely.\n const duration = options.duration != null ? resolveTimingValue(options.duration) : null;\n const delay = options.delay != null ? resolveTimingValue(options.delay) : null;\n if (duration !== 0) {\n instructions.forEach(instruction => {\n const instructionTimings = context.appendInstructionToTimeline(instruction, duration, delay);\n furthestTime =\n Math.max(furthestTime, instructionTimings.duration + instructionTimings.delay);\n });\n }\n return furthestTime;\n }\n visitReference(ast, context) {\n context.updateOptions(ast.options, true);\n visitDslNode(this, ast.animation, context);\n context.previousNode = ast;\n }\n visitSequence(ast, context) {\n const subContextCount = context.subContextCount;\n let ctx = context;\n const options = ast.options;\n if (options && (options.params || options.delay)) {\n ctx = context.createSubContext(options);\n ctx.transformIntoNewTimeline();\n if (options.delay != null) {\n if (ctx.previousNode.type == 6 /* AnimationMetadataType.Style */) {\n ctx.currentTimeline.snapshotCurrentStyles();\n ctx.previousNode = DEFAULT_NOOP_PREVIOUS_NODE;\n }\n const delay = resolveTimingValue(options.delay);\n ctx.delayNextStep(delay);\n }\n }\n if (ast.steps.length) {\n ast.steps.forEach(s => visitDslNode(this, s, ctx));\n // this is here just in case the inner steps only contain or end with a style() call\n ctx.currentTimeline.applyStylesToKeyframe();\n // this means that some animation function within the sequence\n // ended up creating a sub timeline (which means the current\n // timeline cannot overlap with the contents of the sequence)\n if (ctx.subContextCount > subContextCount) {\n ctx.transformIntoNewTimeline();\n }\n }\n context.previousNode = ast;\n }\n visitGroup(ast, context) {\n const innerTimelines = [];\n let furthestTime = context.currentTimeline.currentTime;\n const delay = ast.options && ast.options.delay ? resolveTimingValue(ast.options.delay) : 0;\n ast.steps.forEach(s => {\n const innerContext = context.createSubContext(ast.options);\n if (delay) {\n innerContext.delayNextStep(delay);\n }\n visitDslNode(this, s, innerContext);\n furthestTime = Math.max(furthestTime, innerContext.currentTimeline.currentTime);\n innerTimelines.push(innerContext.currentTimeline);\n });\n // this operation is run after the AST loop because otherwise\n // if the parent timeline's collected styles were updated then\n // it would pass in invalid data into the new-to-be forked items\n innerTimelines.forEach(timeline => context.currentTimeline.mergeTimelineCollectedStyles(timeline));\n context.transformIntoNewTimeline(furthestTime);\n context.previousNode = ast;\n }\n _visitTiming(ast, context) {\n if (ast.dynamic) {\n const strValue = ast.strValue;\n const timingValue = context.params ? interpolateParams(strValue, context.params, context.errors) : strValue;\n return resolveTiming(timingValue, context.errors);\n }\n else {\n return { duration: ast.duration, delay: ast.delay, easing: ast.easing };\n }\n }\n visitAnimate(ast, context) {\n const timings = context.currentAnimateTimings = this._visitTiming(ast.timings, context);\n const timeline = context.currentTimeline;\n if (timings.delay) {\n context.incrementTime(timings.delay);\n timeline.snapshotCurrentStyles();\n }\n const style = ast.style;\n if (style.type == 5 /* AnimationMetadataType.Keyframes */) {\n this.visitKeyframes(style, context);\n }\n else {\n context.incrementTime(timings.duration);\n this.visitStyle(style, context);\n timeline.applyStylesToKeyframe();\n }\n context.currentAnimateTimings = null;\n context.previousNode = ast;\n }\n visitStyle(ast, context) {\n const timeline = context.currentTimeline;\n const timings = context.currentAnimateTimings;\n // this is a special case for when a style() call\n // directly follows an animate() call (but not inside of an animate() call)\n if (!timings && timeline.hasCurrentStyleProperties()) {\n timeline.forwardFrame();\n }\n const easing = (timings && timings.easing) || ast.easing;\n if (ast.isEmptyStep) {\n timeline.applyEmptyStep(easing);\n }\n else {\n timeline.setStyles(ast.styles, easing, context.errors, context.options);\n }\n context.previousNode = ast;\n }\n visitKeyframes(ast, context) {\n const currentAnimateTimings = context.currentAnimateTimings;\n const startTime = (context.currentTimeline).duration;\n const duration = currentAnimateTimings.duration;\n const innerContext = context.createSubContext();\n const innerTimeline = innerContext.currentTimeline;\n innerTimeline.easing = currentAnimateTimings.easing;\n ast.styles.forEach(step => {\n const offset = step.offset || 0;\n innerTimeline.forwardTime(offset * duration);\n innerTimeline.setStyles(step.styles, step.easing, context.errors, context.options);\n innerTimeline.applyStylesToKeyframe();\n });\n // this will ensure that the parent timeline gets all the styles from\n // the child even if the new timeline below is not used\n context.currentTimeline.mergeTimelineCollectedStyles(innerTimeline);\n // we do this because the window between this timeline and the sub timeline\n // should ensure that the styles within are exactly the same as they were before\n context.transformIntoNewTimeline(startTime + duration);\n context.previousNode = ast;\n }\n visitQuery(ast, context) {\n // in the event that the first step before this is a style step we need\n // to ensure the styles are applied before the children are animated\n const startTime = context.currentTimeline.currentTime;\n const options = (ast.options || {});\n const delay = options.delay ? resolveTimingValue(options.delay) : 0;\n if (delay &&\n (context.previousNode.type === 6 /* AnimationMetadataType.Style */ ||\n (startTime == 0 && context.currentTimeline.hasCurrentStyleProperties()))) {\n context.currentTimeline.snapshotCurrentStyles();\n context.previousNode = DEFAULT_NOOP_PREVIOUS_NODE;\n }\n let furthestTime = startTime;\n const elms = context.invokeQuery(ast.selector, ast.originalSelector, ast.limit, ast.includeSelf, options.optional ? true : false, context.errors);\n context.currentQueryTotal = elms.length;\n let sameElementTimeline = null;\n elms.forEach((element, i) => {\n context.currentQueryIndex = i;\n const innerContext = context.createSubContext(ast.options, element);\n if (delay) {\n innerContext.delayNextStep(delay);\n }\n if (element === context.element) {\n sameElementTimeline = innerContext.currentTimeline;\n }\n visitDslNode(this, ast.animation, innerContext);\n // this is here just incase the inner steps only contain or end\n // with a style() call (which is here to signal that this is a preparatory\n // call to style an element before it is animated again)\n innerContext.currentTimeline.applyStylesToKeyframe();\n const endTime = innerContext.currentTimeline.currentTime;\n furthestTime = Math.max(furthestTime, endTime);\n });\n context.currentQueryIndex = 0;\n context.currentQueryTotal = 0;\n context.transformIntoNewTimeline(furthestTime);\n if (sameElementTimeline) {\n context.currentTimeline.mergeTimelineCollectedStyles(sameElementTimeline);\n context.currentTimeline.snapshotCurrentStyles();\n }\n context.previousNode = ast;\n }\n visitStagger(ast, context) {\n const parentContext = context.parentContext;\n const tl = context.currentTimeline;\n const timings = ast.timings;\n const duration = Math.abs(timings.duration);\n const maxTime = duration * (context.currentQueryTotal - 1);\n let delay = duration * context.currentQueryIndex;\n let staggerTransformer = timings.duration < 0 ? 'reverse' : timings.easing;\n switch (staggerTransformer) {\n case 'reverse':\n delay = maxTime - delay;\n break;\n case 'full':\n delay = parentContext.currentStaggerTime;\n break;\n }\n const timeline = context.currentTimeline;\n if (delay) {\n timeline.delayNextStep(delay);\n }\n const startingTime = timeline.currentTime;\n visitDslNode(this, ast.animation, context);\n context.previousNode = ast;\n // time = duration + delay\n // the reason why this computation is so complex is because\n // the inner timeline may either have a delay value or a stretched\n // keyframe depending on if a subtimeline is not used or is used.\n parentContext.currentStaggerTime =\n (tl.currentTime - startingTime) + (tl.startTime - parentContext.currentTimeline.startTime);\n }\n}\nconst DEFAULT_NOOP_PREVIOUS_NODE = {};\nclass AnimationTimelineContext {\n constructor(_driver, element, subInstructions, _enterClassName, _leaveClassName, errors, timelines, initialTimeline) {\n this._driver = _driver;\n this.element = element;\n this.subInstructions = subInstructions;\n this._enterClassName = _enterClassName;\n this._leaveClassName = _leaveClassName;\n this.errors = errors;\n this.timelines = timelines;\n this.parentContext = null;\n this.currentAnimateTimings = null;\n this.previousNode = DEFAULT_NOOP_PREVIOUS_NODE;\n this.subContextCount = 0;\n this.options = {};\n this.currentQueryIndex = 0;\n this.currentQueryTotal = 0;\n this.currentStaggerTime = 0;\n this.currentTimeline = initialTimeline || new TimelineBuilder(this._driver, element, 0);\n timelines.push(this.currentTimeline);\n }\n get params() {\n return this.options.params;\n }\n updateOptions(options, skipIfExists) {\n if (!options)\n return;\n const newOptions = options;\n let optionsToUpdate = this.options;\n // NOTE: this will get patched up when other animation methods support duration overrides\n if (newOptions.duration != null) {\n optionsToUpdate.duration = resolveTimingValue(newOptions.duration);\n }\n if (newOptions.delay != null) {\n optionsToUpdate.delay = resolveTimingValue(newOptions.delay);\n }\n const newParams = newOptions.params;\n if (newParams) {\n let paramsToUpdate = optionsToUpdate.params;\n if (!paramsToUpdate) {\n paramsToUpdate = this.options.params = {};\n }\n Object.keys(newParams).forEach(name => {\n if (!skipIfExists || !paramsToUpdate.hasOwnProperty(name)) {\n paramsToUpdate[name] = interpolateParams(newParams[name], paramsToUpdate, this.errors);\n }\n });\n }\n }\n _copyOptions() {\n const options = {};\n if (this.options) {\n const oldParams = this.options.params;\n if (oldParams) {\n const params = options['params'] = {};\n Object.keys(oldParams).forEach(name => {\n params[name] = oldParams[name];\n });\n }\n }\n return options;\n }\n createSubContext(options = null, element, newTime) {\n const target = element || this.element;\n const context = new AnimationTimelineContext(this._driver, target, this.subInstructions, this._enterClassName, this._leaveClassName, this.errors, this.timelines, this.currentTimeline.fork(target, newTime || 0));\n context.previousNode = this.previousNode;\n context.currentAnimateTimings = this.currentAnimateTimings;\n context.options = this._copyOptions();\n context.updateOptions(options);\n context.currentQueryIndex = this.currentQueryIndex;\n context.currentQueryTotal = this.currentQueryTotal;\n context.parentContext = this;\n this.subContextCount++;\n return context;\n }\n transformIntoNewTimeline(newTime) {\n this.previousNode = DEFAULT_NOOP_PREVIOUS_NODE;\n this.currentTimeline = this.currentTimeline.fork(this.element, newTime);\n this.timelines.push(this.currentTimeline);\n return this.currentTimeline;\n }\n appendInstructionToTimeline(instruction, duration, delay) {\n const updatedTimings = {\n duration: duration != null ? duration : instruction.duration,\n delay: this.currentTimeline.currentTime + (delay != null ? delay : 0) + instruction.delay,\n easing: ''\n };\n const builder = new SubTimelineBuilder(this._driver, instruction.element, instruction.keyframes, instruction.preStyleProps, instruction.postStyleProps, updatedTimings, instruction.stretchStartingKeyframe);\n this.timelines.push(builder);\n return updatedTimings;\n }\n incrementTime(time) {\n this.currentTimeline.forwardTime(this.currentTimeline.duration + time);\n }\n delayNextStep(delay) {\n // negative delays are not yet supported\n if (delay > 0) {\n this.currentTimeline.delayNextStep(delay);\n }\n }\n invokeQuery(selector, originalSelector, limit, includeSelf, optional, errors) {\n let results = [];\n if (includeSelf) {\n results.push(this.element);\n }\n if (selector.length > 0) { // only if :self is used then the selector can be empty\n selector = selector.replace(ENTER_TOKEN_REGEX, '.' + this._enterClassName);\n selector = selector.replace(LEAVE_TOKEN_REGEX, '.' + this._leaveClassName);\n const multi = limit != 1;\n let elements = this._driver.query(this.element, selector, multi);\n if (limit !== 0) {\n elements = limit < 0 ? elements.slice(elements.length + limit, elements.length) :\n elements.slice(0, limit);\n }\n results.push(...elements);\n }\n if (!optional && results.length == 0) {\n errors.push(invalidQuery(originalSelector));\n }\n return results;\n }\n}\nclass TimelineBuilder {\n constructor(_driver, element, startTime, _elementTimelineStylesLookup) {\n this._driver = _driver;\n this.element = element;\n this.startTime = startTime;\n this._elementTimelineStylesLookup = _elementTimelineStylesLookup;\n this.duration = 0;\n this._previousKeyframe = new Map();\n this._currentKeyframe = new Map();\n this._keyframes = new Map();\n this._styleSummary = new Map();\n this._localTimelineStyles = new Map();\n this._pendingStyles = new Map();\n this._backFill = new Map();\n this._currentEmptyStepKeyframe = null;\n if (!this._elementTimelineStylesLookup) {\n this._elementTimelineStylesLookup = new Map();\n }\n this._globalTimelineStyles = this._elementTimelineStylesLookup.get(element);\n if (!this._globalTimelineStyles) {\n this._globalTimelineStyles = this._localTimelineStyles;\n this._elementTimelineStylesLookup.set(element, this._localTimelineStyles);\n }\n this._loadKeyframe();\n }\n containsAnimation() {\n switch (this._keyframes.size) {\n case 0:\n return false;\n case 1:\n return this.hasCurrentStyleProperties();\n default:\n return true;\n }\n }\n hasCurrentStyleProperties() {\n return this._currentKeyframe.size > 0;\n }\n get currentTime() {\n return this.startTime + this.duration;\n }\n delayNextStep(delay) {\n // in the event that a style() step is placed right before a stagger()\n // and that style() step is the very first style() value in the animation\n // then we need to make a copy of the keyframe [0, copy, 1] so that the delay\n // properly applies the style() values to work with the stagger...\n const hasPreStyleStep = this._keyframes.size === 1 && this._pendingStyles.size;\n if (this.duration || hasPreStyleStep) {\n this.forwardTime(this.currentTime + delay);\n if (hasPreStyleStep) {\n this.snapshotCurrentStyles();\n }\n }\n else {\n this.startTime += delay;\n }\n }\n fork(element, currentTime) {\n this.applyStylesToKeyframe();\n return new TimelineBuilder(this._driver, element, currentTime || this.currentTime, this._elementTimelineStylesLookup);\n }\n _loadKeyframe() {\n if (this._currentKeyframe) {\n this._previousKeyframe = this._currentKeyframe;\n }\n this._currentKeyframe = this._keyframes.get(this.duration);\n if (!this._currentKeyframe) {\n this._currentKeyframe = new Map();\n this._keyframes.set(this.duration, this._currentKeyframe);\n }\n }\n forwardFrame() {\n this.duration += ONE_FRAME_IN_MILLISECONDS;\n this._loadKeyframe();\n }\n forwardTime(time) {\n this.applyStylesToKeyframe();\n this.duration = time;\n this._loadKeyframe();\n }\n _updateStyle(prop, value) {\n this._localTimelineStyles.set(prop, value);\n this._globalTimelineStyles.set(prop, value);\n this._styleSummary.set(prop, { time: this.currentTime, value });\n }\n allowOnlyTimelineStyles() {\n return this._currentEmptyStepKeyframe !== this._currentKeyframe;\n }\n applyEmptyStep(easing) {\n if (easing) {\n this._previousKeyframe.set('easing', easing);\n }\n // special case for animate(duration):\n // all missing styles are filled with a `*` value then\n // if any destination styles are filled in later on the same\n // keyframe then they will override the overridden styles\n // We use `_globalTimelineStyles` here because there may be\n // styles in previous keyframes that are not present in this timeline\n for (let [prop, value] of this._globalTimelineStyles) {\n this._backFill.set(prop, value || AUTO_STYLE);\n this._currentKeyframe.set(prop, AUTO_STYLE);\n }\n this._currentEmptyStepKeyframe = this._currentKeyframe;\n }\n setStyles(input, easing, errors, options) {\n var _a;\n if (easing) {\n this._previousKeyframe.set('easing', easing);\n }\n const params = (options && options.params) || {};\n const styles = flattenStyles(input, this._globalTimelineStyles);\n for (let [prop, value] of styles) {\n const val = interpolateParams(value, params, errors);\n this._pendingStyles.set(prop, val);\n if (!this._localTimelineStyles.has(prop)) {\n this._backFill.set(prop, (_a = this._globalTimelineStyles.get(prop)) !== null && _a !== void 0 ? _a : AUTO_STYLE);\n }\n this._updateStyle(prop, val);\n }\n }\n applyStylesToKeyframe() {\n if (this._pendingStyles.size == 0)\n return;\n this._pendingStyles.forEach((val, prop) => {\n this._currentKeyframe.set(prop, val);\n });\n this._pendingStyles.clear();\n this._localTimelineStyles.forEach((val, prop) => {\n if (!this._currentKeyframe.has(prop)) {\n this._currentKeyframe.set(prop, val);\n }\n });\n }\n snapshotCurrentStyles() {\n for (let [prop, val] of this._localTimelineStyles) {\n this._pendingStyles.set(prop, val);\n this._updateStyle(prop, val);\n }\n }\n getFinalKeyframe() {\n return this._keyframes.get(this.duration);\n }\n get properties() {\n const properties = [];\n for (let prop in this._currentKeyframe) {\n properties.push(prop);\n }\n return properties;\n }\n mergeTimelineCollectedStyles(timeline) {\n timeline._styleSummary.forEach((details1, prop) => {\n const details0 = this._styleSummary.get(prop);\n if (!details0 || details1.time > details0.time) {\n this._updateStyle(prop, details1.value);\n }\n });\n }\n buildKeyframes() {\n this.applyStylesToKeyframe();\n const preStyleProps = new Set();\n const postStyleProps = new Set();\n const isEmpty = this._keyframes.size === 1 && this.duration === 0;\n let finalKeyframes = [];\n this._keyframes.forEach((keyframe, time) => {\n const finalKeyframe = copyStyles(keyframe, new Map(), this._backFill);\n finalKeyframe.forEach((value, prop) => {\n if (value === ɵPRE_STYLE) {\n preStyleProps.add(prop);\n }\n else if (value === AUTO_STYLE) {\n postStyleProps.add(prop);\n }\n });\n if (!isEmpty) {\n finalKeyframe.set('offset', time / this.duration);\n }\n finalKeyframes.push(finalKeyframe);\n });\n const preProps = preStyleProps.size ? iteratorToArray(preStyleProps.values()) : [];\n const postProps = postStyleProps.size ? iteratorToArray(postStyleProps.values()) : [];\n // special case for a 0-second animation (which is designed just to place styles onscreen)\n if (isEmpty) {\n const kf0 = finalKeyframes[0];\n const kf1 = new Map(kf0);\n kf0.set('offset', 0);\n kf1.set('offset', 1);\n finalKeyframes = [kf0, kf1];\n }\n return createTimelineInstruction(this.element, finalKeyframes, preProps, postProps, this.duration, this.startTime, this.easing, false);\n }\n}\nclass SubTimelineBuilder extends TimelineBuilder {\n constructor(driver, element, keyframes, preStyleProps, postStyleProps, timings, _stretchStartingKeyframe = false) {\n super(driver, element, timings.delay);\n this.keyframes = keyframes;\n this.preStyleProps = preStyleProps;\n this.postStyleProps = postStyleProps;\n this._stretchStartingKeyframe = _stretchStartingKeyframe;\n this.timings = { duration: timings.duration, delay: timings.delay, easing: timings.easing };\n }\n containsAnimation() {\n return this.keyframes.length > 1;\n }\n buildKeyframes() {\n let keyframes = this.keyframes;\n let { delay, duration, easing } = this.timings;\n if (this._stretchStartingKeyframe && delay) {\n const newKeyframes = [];\n const totalTime = duration + delay;\n const startingGap = delay / totalTime;\n // the original starting keyframe now starts once the delay is done\n const newFirstKeyframe = copyStyles(keyframes[0]);\n newFirstKeyframe.set('offset', 0);\n newKeyframes.push(newFirstKeyframe);\n const oldFirstKeyframe = copyStyles(keyframes[0]);\n oldFirstKeyframe.set('offset', roundOffset(startingGap));\n newKeyframes.push(oldFirstKeyframe);\n /*\n When the keyframe is stretched then it means that the delay before the animation\n starts is gone. Instead the first keyframe is placed at the start of the animation\n and it is then copied to where it starts when the original delay is over. This basically\n means nothing animates during that delay, but the styles are still rendered. For this\n to work the original offset values that exist in the original keyframes must be \"warped\"\n so that they can take the new keyframe + delay into account.\n \n delay=1000, duration=1000, keyframes = 0 .5 1\n \n turns into\n \n delay=0, duration=2000, keyframes = 0 .33 .66 1\n */\n // offsets between 1 ... n -1 are all warped by the keyframe stretch\n const limit = keyframes.length - 1;\n for (let i = 1; i <= limit; i++) {\n let kf = copyStyles(keyframes[i]);\n const oldOffset = kf.get('offset');\n const timeAtKeyframe = delay + oldOffset * duration;\n kf.set('offset', roundOffset(timeAtKeyframe / totalTime));\n newKeyframes.push(kf);\n }\n // the new starting keyframe should be added at the start\n duration = totalTime;\n delay = 0;\n easing = '';\n keyframes = newKeyframes;\n }\n return createTimelineInstruction(this.element, keyframes, this.preStyleProps, this.postStyleProps, duration, delay, easing, true);\n }\n}\nfunction roundOffset(offset, decimalPoints = 3) {\n const mult = Math.pow(10, decimalPoints - 1);\n return Math.round(offset * mult) / mult;\n}\nfunction flattenStyles(input, allStyles) {\n const styles = new Map();\n let allProperties;\n input.forEach(token => {\n if (token === '*') {\n allProperties = allProperties || allStyles.keys();\n for (let prop of allProperties) {\n styles.set(prop, AUTO_STYLE);\n }\n }\n else {\n copyStyles(token, styles);\n }\n });\n return styles;\n}\n\nclass Animation {\n constructor(_driver, input) {\n this._driver = _driver;\n const errors = [];\n const warnings = [];\n const ast = buildAnimationAst(_driver, input, errors, warnings);\n if (errors.length) {\n throw validationFailed(errors);\n }\n if (warnings.length) {\n warnValidation(warnings);\n }\n this._animationAst = ast;\n }\n buildTimelines(element, startingStyles, destinationStyles, options, subInstructions) {\n const start = Array.isArray(startingStyles) ? normalizeStyles(startingStyles) :\n startingStyles;\n const dest = Array.isArray(destinationStyles) ? normalizeStyles(destinationStyles) :\n destinationStyles;\n const errors = [];\n subInstructions = subInstructions || new ElementInstructionMap();\n const result = buildAnimationTimelines(this._driver, element, this._animationAst, ENTER_CLASSNAME, LEAVE_CLASSNAME, start, dest, options, subInstructions, errors);\n if (errors.length) {\n throw buildingFailed(errors);\n }\n return result;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @publicApi\n */\nclass AnimationStyleNormalizer {\n}\n/**\n * @publicApi\n */\nclass NoopAnimationStyleNormalizer {\n normalizePropertyName(propertyName, errors) {\n return propertyName;\n }\n normalizeStyleValue(userProvidedProperty, normalizedProperty, value, errors) {\n return value;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst DIMENSIONAL_PROP_SET = new Set([\n 'width',\n 'height',\n 'minWidth',\n 'minHeight',\n 'maxWidth',\n 'maxHeight',\n 'left',\n 'top',\n 'bottom',\n 'right',\n 'fontSize',\n 'outlineWidth',\n 'outlineOffset',\n 'paddingTop',\n 'paddingLeft',\n 'paddingBottom',\n 'paddingRight',\n 'marginTop',\n 'marginLeft',\n 'marginBottom',\n 'marginRight',\n 'borderRadius',\n 'borderWidth',\n 'borderTopWidth',\n 'borderLeftWidth',\n 'borderRightWidth',\n 'borderBottomWidth',\n 'textIndent',\n 'perspective'\n]);\nclass WebAnimationsStyleNormalizer extends AnimationStyleNormalizer {\n normalizePropertyName(propertyName, errors) {\n return dashCaseToCamelCase(propertyName);\n }\n normalizeStyleValue(userProvidedProperty, normalizedProperty, value, errors) {\n let unit = '';\n const strVal = value.toString().trim();\n if (DIMENSIONAL_PROP_SET.has(normalizedProperty) && value !== 0 && value !== '0') {\n if (typeof value === 'number') {\n unit = 'px';\n }\n else {\n const valAndSuffixMatch = value.match(/^[+-]?[\\d\\.]+([a-z]*)$/);\n if (valAndSuffixMatch && valAndSuffixMatch[1].length == 0) {\n errors.push(invalidCssUnitValue(userProvidedProperty, value));\n }\n }\n }\n return strVal + unit;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction createTransitionInstruction(element, triggerName, fromState, toState, isRemovalTransition, fromStyles, toStyles, timelines, queriedElements, preStyleProps, postStyleProps, totalTime, errors) {\n return {\n type: 0 /* AnimationTransitionInstructionType.TransitionAnimation */,\n element,\n triggerName,\n isRemovalTransition,\n fromState,\n fromStyles,\n toState,\n toStyles,\n timelines,\n queriedElements,\n preStyleProps,\n postStyleProps,\n totalTime,\n errors\n };\n}\n\nconst EMPTY_OBJECT = {};\nclass AnimationTransitionFactory {\n constructor(_triggerName, ast, _stateStyles) {\n this._triggerName = _triggerName;\n this.ast = ast;\n this._stateStyles = _stateStyles;\n }\n match(currentState, nextState, element, params) {\n return oneOrMoreTransitionsMatch(this.ast.matchers, currentState, nextState, element, params);\n }\n buildStyles(stateName, params, errors) {\n let styler = this._stateStyles.get('*');\n if (stateName !== undefined) {\n styler = this._stateStyles.get(stateName === null || stateName === void 0 ? void 0 : stateName.toString()) || styler;\n }\n return styler ? styler.buildStyles(params, errors) : new Map();\n }\n build(driver, element, currentState, nextState, enterClassName, leaveClassName, currentOptions, nextOptions, subInstructions, skipAstBuild) {\n var _a;\n const errors = [];\n const transitionAnimationParams = this.ast.options && this.ast.options.params || EMPTY_OBJECT;\n const currentAnimationParams = currentOptions && currentOptions.params || EMPTY_OBJECT;\n const currentStateStyles = this.buildStyles(currentState, currentAnimationParams, errors);\n const nextAnimationParams = nextOptions && nextOptions.params || EMPTY_OBJECT;\n const nextStateStyles = this.buildStyles(nextState, nextAnimationParams, errors);\n const queriedElements = new Set();\n const preStyleMap = new Map();\n const postStyleMap = new Map();\n const isRemoval = nextState === 'void';\n const animationOptions = {\n params: applyParamDefaults(nextAnimationParams, transitionAnimationParams),\n delay: (_a = this.ast.options) === null || _a === void 0 ? void 0 : _a.delay,\n };\n const timelines = skipAstBuild ?\n [] :\n buildAnimationTimelines(driver, element, this.ast.animation, enterClassName, leaveClassName, currentStateStyles, nextStateStyles, animationOptions, subInstructions, errors);\n let totalTime = 0;\n timelines.forEach(tl => {\n totalTime = Math.max(tl.duration + tl.delay, totalTime);\n });\n if (errors.length) {\n return createTransitionInstruction(element, this._triggerName, currentState, nextState, isRemoval, currentStateStyles, nextStateStyles, [], [], preStyleMap, postStyleMap, totalTime, errors);\n }\n timelines.forEach(tl => {\n const elm = tl.element;\n const preProps = getOrSetDefaultValue(preStyleMap, elm, new Set());\n tl.preStyleProps.forEach(prop => preProps.add(prop));\n const postProps = getOrSetDefaultValue(postStyleMap, elm, new Set());\n tl.postStyleProps.forEach(prop => postProps.add(prop));\n if (elm !== element) {\n queriedElements.add(elm);\n }\n });\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n checkNonAnimatableInTimelines(timelines, this._triggerName, driver);\n }\n const queriedElementsList = iteratorToArray(queriedElements.values());\n return createTransitionInstruction(element, this._triggerName, currentState, nextState, isRemoval, currentStateStyles, nextStateStyles, timelines, queriedElementsList, preStyleMap, postStyleMap, totalTime);\n }\n}\n/**\n * Checks inside a set of timelines if they try to animate a css property which is not considered\n * animatable, in that case it prints a warning on the console.\n * Besides that the function doesn't have any other effect.\n *\n * Note: this check is done here after the timelines are built instead of doing on a lower level so\n * that we can make sure that the warning appears only once per instruction (we can aggregate here\n * all the issues instead of finding them separately).\n *\n * @param timelines The built timelines for the current instruction.\n * @param triggerName The name of the trigger for the current instruction.\n * @param driver Animation driver used to perform the check.\n *\n */\nfunction checkNonAnimatableInTimelines(timelines, triggerName, driver) {\n if (!driver.validateAnimatableStyleProperty) {\n return;\n }\n const invalidNonAnimatableProps = new Set();\n timelines.forEach(({ keyframes }) => {\n const nonAnimatablePropsInitialValues = new Map();\n keyframes.forEach(keyframe => {\n for (const [prop, value] of keyframe.entries()) {\n if (!driver.validateAnimatableStyleProperty(prop)) {\n if (nonAnimatablePropsInitialValues.has(prop) && !invalidNonAnimatableProps.has(prop)) {\n const propInitialValue = nonAnimatablePropsInitialValues.get(prop);\n if (propInitialValue !== value) {\n invalidNonAnimatableProps.add(prop);\n }\n }\n else {\n nonAnimatablePropsInitialValues.set(prop, value);\n }\n }\n }\n });\n });\n if (invalidNonAnimatableProps.size > 0) {\n console.warn(`Warning: The animation trigger \"${triggerName}\" is attempting to animate the following` +\n ' not animatable properties: ' + Array.from(invalidNonAnimatableProps).join(', ') + '\\n' +\n '(to check the list of all animatable properties visit https://developer.mozilla.org/en-US/docs/Web/CSS/CSS_animated_properties)');\n }\n}\nfunction oneOrMoreTransitionsMatch(matchFns, currentState, nextState, element, params) {\n return matchFns.some(fn => fn(currentState, nextState, element, params));\n}\nfunction applyParamDefaults(userParams, defaults) {\n const result = copyObj(defaults);\n for (const key in userParams) {\n if (userParams.hasOwnProperty(key) && userParams[key] != null) {\n result[key] = userParams[key];\n }\n }\n return result;\n}\nclass AnimationStateStyles {\n constructor(styles, defaultParams, normalizer) {\n this.styles = styles;\n this.defaultParams = defaultParams;\n this.normalizer = normalizer;\n }\n buildStyles(params, errors) {\n const finalStyles = new Map();\n const combinedParams = copyObj(this.defaultParams);\n Object.keys(params).forEach(key => {\n const value = params[key];\n if (value !== null) {\n combinedParams[key] = value;\n }\n });\n this.styles.styles.forEach(value => {\n if (typeof value !== 'string') {\n value.forEach((val, prop) => {\n if (val) {\n val = interpolateParams(val, combinedParams, errors);\n }\n const normalizedProp = this.normalizer.normalizePropertyName(prop, errors);\n val = this.normalizer.normalizeStyleValue(prop, normalizedProp, val, errors);\n finalStyles.set(normalizedProp, val);\n });\n }\n });\n return finalStyles;\n }\n}\n\nfunction buildTrigger(name, ast, normalizer) {\n return new AnimationTrigger(name, ast, normalizer);\n}\nclass AnimationTrigger {\n constructor(name, ast, _normalizer) {\n this.name = name;\n this.ast = ast;\n this._normalizer = _normalizer;\n this.transitionFactories = [];\n this.states = new Map();\n ast.states.forEach(ast => {\n const defaultParams = (ast.options && ast.options.params) || {};\n this.states.set(ast.name, new AnimationStateStyles(ast.style, defaultParams, _normalizer));\n });\n balanceProperties(this.states, 'true', '1');\n balanceProperties(this.states, 'false', '0');\n ast.transitions.forEach(ast => {\n this.transitionFactories.push(new AnimationTransitionFactory(name, ast, this.states));\n });\n this.fallbackTransition = createFallbackTransition(name, this.states, this._normalizer);\n }\n get containsQueries() {\n return this.ast.queryCount > 0;\n }\n matchTransition(currentState, nextState, element, params) {\n const entry = this.transitionFactories.find(f => f.match(currentState, nextState, element, params));\n return entry || null;\n }\n matchStyles(currentState, params, errors) {\n return this.fallbackTransition.buildStyles(currentState, params, errors);\n }\n}\nfunction createFallbackTransition(triggerName, states, normalizer) {\n const matchers = [(fromState, toState) => true];\n const animation = { type: 2 /* AnimationMetadataType.Sequence */, steps: [], options: null };\n const transition = {\n type: 1 /* AnimationMetadataType.Transition */,\n animation,\n matchers,\n options: null,\n queryCount: 0,\n depCount: 0\n };\n return new AnimationTransitionFactory(triggerName, transition, states);\n}\nfunction balanceProperties(stateMap, key1, key2) {\n if (stateMap.has(key1)) {\n if (!stateMap.has(key2)) {\n stateMap.set(key2, stateMap.get(key1));\n }\n }\n else if (stateMap.has(key2)) {\n stateMap.set(key1, stateMap.get(key2));\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst EMPTY_INSTRUCTION_MAP = new ElementInstructionMap();\nclass TimelineAnimationEngine {\n constructor(bodyNode, _driver, _normalizer) {\n this.bodyNode = bodyNode;\n this._driver = _driver;\n this._normalizer = _normalizer;\n this._animations = new Map();\n this._playersById = new Map();\n this.players = [];\n }\n register(id, metadata) {\n const errors = [];\n const warnings = [];\n const ast = buildAnimationAst(this._driver, metadata, errors, warnings);\n if (errors.length) {\n throw registerFailed(errors);\n }\n else {\n if (warnings.length) {\n warnRegister(warnings);\n }\n this._animations.set(id, ast);\n }\n }\n _buildPlayer(i, preStyles, postStyles) {\n const element = i.element;\n const keyframes = normalizeKeyframes$1(this._driver, this._normalizer, element, i.keyframes, preStyles, postStyles);\n return this._driver.animate(element, keyframes, i.duration, i.delay, i.easing, [], true);\n }\n create(id, element, options = {}) {\n const errors = [];\n const ast = this._animations.get(id);\n let instructions;\n const autoStylesMap = new Map();\n if (ast) {\n instructions = buildAnimationTimelines(this._driver, element, ast, ENTER_CLASSNAME, LEAVE_CLASSNAME, new Map(), new Map(), options, EMPTY_INSTRUCTION_MAP, errors);\n instructions.forEach(inst => {\n const styles = getOrSetDefaultValue(autoStylesMap, inst.element, new Map());\n inst.postStyleProps.forEach(prop => styles.set(prop, null));\n });\n }\n else {\n errors.push(missingOrDestroyedAnimation());\n instructions = [];\n }\n if (errors.length) {\n throw createAnimationFailed(errors);\n }\n autoStylesMap.forEach((styles, element) => {\n styles.forEach((_, prop) => {\n styles.set(prop, this._driver.computeStyle(element, prop, AUTO_STYLE));\n });\n });\n const players = instructions.map(i => {\n const styles = autoStylesMap.get(i.element);\n return this._buildPlayer(i, new Map(), styles);\n });\n const player = optimizeGroupPlayer(players);\n this._playersById.set(id, player);\n player.onDestroy(() => this.destroy(id));\n this.players.push(player);\n return player;\n }\n destroy(id) {\n const player = this._getPlayer(id);\n player.destroy();\n this._playersById.delete(id);\n const index = this.players.indexOf(player);\n if (index >= 0) {\n this.players.splice(index, 1);\n }\n }\n _getPlayer(id) {\n const player = this._playersById.get(id);\n if (!player) {\n throw missingPlayer(id);\n }\n return player;\n }\n listen(id, element, eventName, callback) {\n // triggerName, fromState, toState are all ignored for timeline animations\n const baseEvent = makeAnimationEvent(element, '', '', '');\n listenOnPlayer(this._getPlayer(id), eventName, baseEvent, callback);\n return () => { };\n }\n command(id, element, command, args) {\n if (command == 'register') {\n this.register(id, args[0]);\n return;\n }\n if (command == 'create') {\n const options = (args[0] || {});\n this.create(id, element, options);\n return;\n }\n const player = this._getPlayer(id);\n switch (command) {\n case 'play':\n player.play();\n break;\n case 'pause':\n player.pause();\n break;\n case 'reset':\n player.reset();\n break;\n case 'restart':\n player.restart();\n break;\n case 'finish':\n player.finish();\n break;\n case 'init':\n player.init();\n break;\n case 'setPosition':\n player.setPosition(parseFloat(args[0]));\n break;\n case 'destroy':\n this.destroy(id);\n break;\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst QUEUED_CLASSNAME = 'ng-animate-queued';\nconst QUEUED_SELECTOR = '.ng-animate-queued';\nconst DISABLED_CLASSNAME = 'ng-animate-disabled';\nconst DISABLED_SELECTOR = '.ng-animate-disabled';\nconst STAR_CLASSNAME = 'ng-star-inserted';\nconst STAR_SELECTOR = '.ng-star-inserted';\nconst EMPTY_PLAYER_ARRAY = [];\nconst NULL_REMOVAL_STATE = {\n namespaceId: '',\n setForRemoval: false,\n setForMove: false,\n hasAnimation: false,\n removedBeforeQueried: false\n};\nconst NULL_REMOVED_QUERIED_STATE = {\n namespaceId: '',\n setForMove: false,\n setForRemoval: false,\n hasAnimation: false,\n removedBeforeQueried: true\n};\nconst REMOVAL_FLAG = '__ng_removed';\nclass StateValue {\n constructor(input, namespaceId = '') {\n this.namespaceId = namespaceId;\n const isObj = input && input.hasOwnProperty('value');\n const value = isObj ? input['value'] : input;\n this.value = normalizeTriggerValue(value);\n if (isObj) {\n const options = copyObj(input);\n delete options['value'];\n this.options = options;\n }\n else {\n this.options = {};\n }\n if (!this.options.params) {\n this.options.params = {};\n }\n }\n get params() {\n return this.options.params;\n }\n absorbOptions(options) {\n const newParams = options.params;\n if (newParams) {\n const oldParams = this.options.params;\n Object.keys(newParams).forEach(prop => {\n if (oldParams[prop] == null) {\n oldParams[prop] = newParams[prop];\n }\n });\n }\n }\n}\nconst VOID_VALUE = 'void';\nconst DEFAULT_STATE_VALUE = new StateValue(VOID_VALUE);\nclass AnimationTransitionNamespace {\n constructor(id, hostElement, _engine) {\n this.id = id;\n this.hostElement = hostElement;\n this._engine = _engine;\n this.players = [];\n this._triggers = new Map();\n this._queue = [];\n this._elementListeners = new Map();\n this._hostClassName = 'ng-tns-' + id;\n addClass(hostElement, this._hostClassName);\n }\n listen(element, name, phase, callback) {\n if (!this._triggers.has(name)) {\n throw missingTrigger(phase, name);\n }\n if (phase == null || phase.length == 0) {\n throw missingEvent(name);\n }\n if (!isTriggerEventValid(phase)) {\n throw unsupportedTriggerEvent(phase, name);\n }\n const listeners = getOrSetDefaultValue(this._elementListeners, element, []);\n const data = { name, phase, callback };\n listeners.push(data);\n const triggersWithStates = getOrSetDefaultValue(this._engine.statesByElement, element, new Map());\n if (!triggersWithStates.has(name)) {\n addClass(element, NG_TRIGGER_CLASSNAME);\n addClass(element, NG_TRIGGER_CLASSNAME + '-' + name);\n triggersWithStates.set(name, DEFAULT_STATE_VALUE);\n }\n return () => {\n // the event listener is removed AFTER the flush has occurred such\n // that leave animations callbacks can fire (otherwise if the node\n // is removed in between then the listeners would be deregistered)\n this._engine.afterFlush(() => {\n const index = listeners.indexOf(data);\n if (index >= 0) {\n listeners.splice(index, 1);\n }\n if (!this._triggers.has(name)) {\n triggersWithStates.delete(name);\n }\n });\n };\n }\n register(name, ast) {\n if (this._triggers.has(name)) {\n // throw\n return false;\n }\n else {\n this._triggers.set(name, ast);\n return true;\n }\n }\n _getTrigger(name) {\n const trigger = this._triggers.get(name);\n if (!trigger) {\n throw unregisteredTrigger(name);\n }\n return trigger;\n }\n trigger(element, triggerName, value, defaultToFallback = true) {\n const trigger = this._getTrigger(triggerName);\n const player = new TransitionAnimationPlayer(this.id, triggerName, element);\n let triggersWithStates = this._engine.statesByElement.get(element);\n if (!triggersWithStates) {\n addClass(element, NG_TRIGGER_CLASSNAME);\n addClass(element, NG_TRIGGER_CLASSNAME + '-' + triggerName);\n this._engine.statesByElement.set(element, triggersWithStates = new Map());\n }\n let fromState = triggersWithStates.get(triggerName);\n const toState = new StateValue(value, this.id);\n const isObj = value && value.hasOwnProperty('value');\n if (!isObj && fromState) {\n toState.absorbOptions(fromState.options);\n }\n triggersWithStates.set(triggerName, toState);\n if (!fromState) {\n fromState = DEFAULT_STATE_VALUE;\n }\n const isRemoval = toState.value === VOID_VALUE;\n // normally this isn't reached by here, however, if an object expression\n // is passed in then it may be a new object each time. Comparing the value\n // is important since that will stay the same despite there being a new object.\n // The removal arc here is special cased because the same element is triggered\n // twice in the event that it contains animations on the outer/inner portions\n // of the host container\n if (!isRemoval && fromState.value === toState.value) {\n // this means that despite the value not changing, some inner params\n // have changed which means that the animation final styles need to be applied\n if (!objEquals(fromState.params, toState.params)) {\n const errors = [];\n const fromStyles = trigger.matchStyles(fromState.value, fromState.params, errors);\n const toStyles = trigger.matchStyles(toState.value, toState.params, errors);\n if (errors.length) {\n this._engine.reportError(errors);\n }\n else {\n this._engine.afterFlush(() => {\n eraseStyles(element, fromStyles);\n setStyles(element, toStyles);\n });\n }\n }\n return;\n }\n const playersOnElement = getOrSetDefaultValue(this._engine.playersByElement, element, []);\n playersOnElement.forEach(player => {\n // only remove the player if it is queued on the EXACT same trigger/namespace\n // we only also deal with queued players here because if the animation has\n // started then we want to keep the player alive until the flush happens\n // (which is where the previousPlayers are passed into the new player)\n if (player.namespaceId == this.id && player.triggerName == triggerName && player.queued) {\n player.destroy();\n }\n });\n let transition = trigger.matchTransition(fromState.value, toState.value, element, toState.params);\n let isFallbackTransition = false;\n if (!transition) {\n if (!defaultToFallback)\n return;\n transition = trigger.fallbackTransition;\n isFallbackTransition = true;\n }\n this._engine.totalQueuedPlayers++;\n this._queue.push({ element, triggerName, transition, fromState, toState, player, isFallbackTransition });\n if (!isFallbackTransition) {\n addClass(element, QUEUED_CLASSNAME);\n player.onStart(() => {\n removeClass(element, QUEUED_CLASSNAME);\n });\n }\n player.onDone(() => {\n let index = this.players.indexOf(player);\n if (index >= 0) {\n this.players.splice(index, 1);\n }\n const players = this._engine.playersByElement.get(element);\n if (players) {\n let index = players.indexOf(player);\n if (index >= 0) {\n players.splice(index, 1);\n }\n }\n });\n this.players.push(player);\n playersOnElement.push(player);\n return player;\n }\n deregister(name) {\n this._triggers.delete(name);\n this._engine.statesByElement.forEach(stateMap => stateMap.delete(name));\n this._elementListeners.forEach((listeners, element) => {\n this._elementListeners.set(element, listeners.filter(entry => {\n return entry.name != name;\n }));\n });\n }\n clearElementCache(element) {\n this._engine.statesByElement.delete(element);\n this._elementListeners.delete(element);\n const elementPlayers = this._engine.playersByElement.get(element);\n if (elementPlayers) {\n elementPlayers.forEach(player => player.destroy());\n this._engine.playersByElement.delete(element);\n }\n }\n _signalRemovalForInnerTriggers(rootElement, context) {\n const elements = this._engine.driver.query(rootElement, NG_TRIGGER_SELECTOR, true);\n // emulate a leave animation for all inner nodes within this node.\n // If there are no animations found for any of the nodes then clear the cache\n // for the element.\n elements.forEach(elm => {\n // this means that an inner remove() operation has already kicked off\n // the animation on this element...\n if (elm[REMOVAL_FLAG])\n return;\n const namespaces = this._engine.fetchNamespacesByElement(elm);\n if (namespaces.size) {\n namespaces.forEach(ns => ns.triggerLeaveAnimation(elm, context, false, true));\n }\n else {\n this.clearElementCache(elm);\n }\n });\n // If the child elements were removed along with the parent, their animations might not\n // have completed. Clear all the elements from the cache so we don't end up with a memory leak.\n this._engine.afterFlushAnimationsDone(() => elements.forEach(elm => this.clearElementCache(elm)));\n }\n triggerLeaveAnimation(element, context, destroyAfterComplete, defaultToFallback) {\n const triggerStates = this._engine.statesByElement.get(element);\n const previousTriggersValues = new Map();\n if (triggerStates) {\n const players = [];\n triggerStates.forEach((state, triggerName) => {\n previousTriggersValues.set(triggerName, state.value);\n // this check is here in the event that an element is removed\n // twice (both on the host level and the component level)\n if (this._triggers.has(triggerName)) {\n const player = this.trigger(element, triggerName, VOID_VALUE, defaultToFallback);\n if (player) {\n players.push(player);\n }\n }\n });\n if (players.length) {\n this._engine.markElementAsRemoved(this.id, element, true, context, previousTriggersValues);\n if (destroyAfterComplete) {\n optimizeGroupPlayer(players).onDone(() => this._engine.processLeaveNode(element));\n }\n return true;\n }\n }\n return false;\n }\n prepareLeaveAnimationListeners(element) {\n const listeners = this._elementListeners.get(element);\n const elementStates = this._engine.statesByElement.get(element);\n // if this statement fails then it means that the element was picked up\n // by an earlier flush (or there are no listeners at all to track the leave).\n if (listeners && elementStates) {\n const visitedTriggers = new Set();\n listeners.forEach(listener => {\n const triggerName = listener.name;\n if (visitedTriggers.has(triggerName))\n return;\n visitedTriggers.add(triggerName);\n const trigger = this._triggers.get(triggerName);\n const transition = trigger.fallbackTransition;\n const fromState = elementStates.get(triggerName) || DEFAULT_STATE_VALUE;\n const toState = new StateValue(VOID_VALUE);\n const player = new TransitionAnimationPlayer(this.id, triggerName, element);\n this._engine.totalQueuedPlayers++;\n this._queue.push({\n element,\n triggerName,\n transition,\n fromState,\n toState,\n player,\n isFallbackTransition: true\n });\n });\n }\n }\n removeNode(element, context) {\n const engine = this._engine;\n if (element.childElementCount) {\n this._signalRemovalForInnerTriggers(element, context);\n }\n // this means that a * => VOID animation was detected and kicked off\n if (this.triggerLeaveAnimation(element, context, true))\n return;\n // find the player that is animating and make sure that the\n // removal is delayed until that player has completed\n let containsPotentialParentTransition = false;\n if (engine.totalAnimations) {\n const currentPlayers = engine.players.length ? engine.playersByQueriedElement.get(element) : [];\n // when this `if statement` does not continue forward it means that\n // a previous animation query has selected the current element and\n // is animating it. In this situation want to continue forwards and\n // allow the element to be queued up for animation later.\n if (currentPlayers && currentPlayers.length) {\n containsPotentialParentTransition = true;\n }\n else {\n let parent = element;\n while (parent = parent.parentNode) {\n const triggers = engine.statesByElement.get(parent);\n if (triggers) {\n containsPotentialParentTransition = true;\n break;\n }\n }\n }\n }\n // at this stage we know that the element will either get removed\n // during flush or will be picked up by a parent query. Either way\n // we need to fire the listeners for this element when it DOES get\n // removed (once the query parent animation is done or after flush)\n this.prepareLeaveAnimationListeners(element);\n // whether or not a parent has an animation we need to delay the deferral of the leave\n // operation until we have more information (which we do after flush() has been called)\n if (containsPotentialParentTransition) {\n engine.markElementAsRemoved(this.id, element, false, context);\n }\n else {\n const removalFlag = element[REMOVAL_FLAG];\n if (!removalFlag || removalFlag === NULL_REMOVAL_STATE) {\n // we do this after the flush has occurred such\n // that the callbacks can be fired\n engine.afterFlush(() => this.clearElementCache(element));\n engine.destroyInnerAnimations(element);\n engine._onRemovalComplete(element, context);\n }\n }\n }\n insertNode(element, parent) {\n addClass(element, this._hostClassName);\n }\n drainQueuedTransitions(microtaskId) {\n const instructions = [];\n this._queue.forEach(entry => {\n const player = entry.player;\n if (player.destroyed)\n return;\n const element = entry.element;\n const listeners = this._elementListeners.get(element);\n if (listeners) {\n listeners.forEach((listener) => {\n if (listener.name == entry.triggerName) {\n const baseEvent = makeAnimationEvent(element, entry.triggerName, entry.fromState.value, entry.toState.value);\n baseEvent['_data'] = microtaskId;\n listenOnPlayer(entry.player, listener.phase, baseEvent, listener.callback);\n }\n });\n }\n if (player.markedForDestroy) {\n this._engine.afterFlush(() => {\n // now we can destroy the element properly since the event listeners have\n // been bound to the player\n player.destroy();\n });\n }\n else {\n instructions.push(entry);\n }\n });\n this._queue = [];\n return instructions.sort((a, b) => {\n // if depCount == 0 them move to front\n // otherwise if a contains b then move back\n const d0 = a.transition.ast.depCount;\n const d1 = b.transition.ast.depCount;\n if (d0 == 0 || d1 == 0) {\n return d0 - d1;\n }\n return this._engine.driver.containsElement(a.element, b.element) ? 1 : -1;\n });\n }\n destroy(context) {\n this.players.forEach(p => p.destroy());\n this._signalRemovalForInnerTriggers(this.hostElement, context);\n }\n elementContainsData(element) {\n let containsData = false;\n if (this._elementListeners.has(element))\n containsData = true;\n containsData =\n (this._queue.find(entry => entry.element === element) ? true : false) || containsData;\n return containsData;\n }\n}\nclass TransitionAnimationEngine {\n constructor(bodyNode, driver, _normalizer) {\n this.bodyNode = bodyNode;\n this.driver = driver;\n this._normalizer = _normalizer;\n this.players = [];\n this.newHostElements = new Map();\n this.playersByElement = new Map();\n this.playersByQueriedElement = new Map();\n this.statesByElement = new Map();\n this.disabledNodes = new Set();\n this.totalAnimations = 0;\n this.totalQueuedPlayers = 0;\n this._namespaceLookup = {};\n this._namespaceList = [];\n this._flushFns = [];\n this._whenQuietFns = [];\n this.namespacesByHostElement = new Map();\n this.collectedEnterElements = [];\n this.collectedLeaveElements = [];\n // this method is designed to be overridden by the code that uses this engine\n this.onRemovalComplete = (element, context) => { };\n }\n /** @internal */\n _onRemovalComplete(element, context) {\n this.onRemovalComplete(element, context);\n }\n get queuedPlayers() {\n const players = [];\n this._namespaceList.forEach(ns => {\n ns.players.forEach(player => {\n if (player.queued) {\n players.push(player);\n }\n });\n });\n return players;\n }\n createNamespace(namespaceId, hostElement) {\n const ns = new AnimationTransitionNamespace(namespaceId, hostElement, this);\n if (this.bodyNode && this.driver.containsElement(this.bodyNode, hostElement)) {\n this._balanceNamespaceList(ns, hostElement);\n }\n else {\n // defer this later until flush during when the host element has\n // been inserted so that we know exactly where to place it in\n // the namespace list\n this.newHostElements.set(hostElement, ns);\n // given that this host element is a part of the animation code, it\n // may or may not be inserted by a parent node that is of an\n // animation renderer type. If this happens then we can still have\n // access to this item when we query for :enter nodes. If the parent\n // is a renderer then the set data-structure will normalize the entry\n this.collectEnterElement(hostElement);\n }\n return this._namespaceLookup[namespaceId] = ns;\n }\n _balanceNamespaceList(ns, hostElement) {\n const namespaceList = this._namespaceList;\n const namespacesByHostElement = this.namespacesByHostElement;\n const limit = namespaceList.length - 1;\n if (limit >= 0) {\n let found = false;\n // Find the closest ancestor with an existing namespace so we can then insert `ns` after it,\n // establishing a top-down ordering of namespaces in `this._namespaceList`.\n let ancestor = this.driver.getParentElement(hostElement);\n while (ancestor) {\n const ancestorNs = namespacesByHostElement.get(ancestor);\n if (ancestorNs) {\n // An animation namespace has been registered for this ancestor, so we insert `ns`\n // right after it to establish top-down ordering of animation namespaces.\n const index = namespaceList.indexOf(ancestorNs);\n namespaceList.splice(index + 1, 0, ns);\n found = true;\n break;\n }\n ancestor = this.driver.getParentElement(ancestor);\n }\n if (!found) {\n // No namespace exists that is an ancestor of `ns`, so `ns` is inserted at the front to\n // ensure that any existing descendants are ordered after `ns`, retaining the desired\n // top-down ordering.\n namespaceList.unshift(ns);\n }\n }\n else {\n namespaceList.push(ns);\n }\n namespacesByHostElement.set(hostElement, ns);\n return ns;\n }\n register(namespaceId, hostElement) {\n let ns = this._namespaceLookup[namespaceId];\n if (!ns) {\n ns = this.createNamespace(namespaceId, hostElement);\n }\n return ns;\n }\n registerTrigger(namespaceId, name, trigger) {\n let ns = this._namespaceLookup[namespaceId];\n if (ns && ns.register(name, trigger)) {\n this.totalAnimations++;\n }\n }\n destroy(namespaceId, context) {\n if (!namespaceId)\n return;\n const ns = this._fetchNamespace(namespaceId);\n this.afterFlush(() => {\n this.namespacesByHostElement.delete(ns.hostElement);\n delete this._namespaceLookup[namespaceId];\n const index = this._namespaceList.indexOf(ns);\n if (index >= 0) {\n this._namespaceList.splice(index, 1);\n }\n });\n this.afterFlushAnimationsDone(() => ns.destroy(context));\n }\n _fetchNamespace(id) {\n return this._namespaceLookup[id];\n }\n fetchNamespacesByElement(element) {\n // normally there should only be one namespace per element, however\n // if @triggers are placed on both the component element and then\n // its host element (within the component code) then there will be\n // two namespaces returned. We use a set here to simply deduplicate\n // the namespaces in case (for the reason described above) there are multiple triggers\n const namespaces = new Set();\n const elementStates = this.statesByElement.get(element);\n if (elementStates) {\n for (let stateValue of elementStates.values()) {\n if (stateValue.namespaceId) {\n const ns = this._fetchNamespace(stateValue.namespaceId);\n if (ns) {\n namespaces.add(ns);\n }\n }\n }\n }\n return namespaces;\n }\n trigger(namespaceId, element, name, value) {\n if (isElementNode(element)) {\n const ns = this._fetchNamespace(namespaceId);\n if (ns) {\n ns.trigger(element, name, value);\n return true;\n }\n }\n return false;\n }\n insertNode(namespaceId, element, parent, insertBefore) {\n if (!isElementNode(element))\n return;\n // special case for when an element is removed and reinserted (move operation)\n // when this occurs we do not want to use the element for deletion later\n const details = element[REMOVAL_FLAG];\n if (details && details.setForRemoval) {\n details.setForRemoval = false;\n details.setForMove = true;\n const index = this.collectedLeaveElements.indexOf(element);\n if (index >= 0) {\n this.collectedLeaveElements.splice(index, 1);\n }\n }\n // in the event that the namespaceId is blank then the caller\n // code does not contain any animation code in it, but it is\n // just being called so that the node is marked as being inserted\n if (namespaceId) {\n const ns = this._fetchNamespace(namespaceId);\n // This if-statement is a workaround for router issue #21947.\n // The router sometimes hits a race condition where while a route\n // is being instantiated a new navigation arrives, triggering leave\n // animation of DOM that has not been fully initialized, until this\n // is resolved, we need to handle the scenario when DOM is not in a\n // consistent state during the animation.\n if (ns) {\n ns.insertNode(element, parent);\n }\n }\n // only *directives and host elements are inserted before\n if (insertBefore) {\n this.collectEnterElement(element);\n }\n }\n collectEnterElement(element) {\n this.collectedEnterElements.push(element);\n }\n markElementAsDisabled(element, value) {\n if (value) {\n if (!this.disabledNodes.has(element)) {\n this.disabledNodes.add(element);\n addClass(element, DISABLED_CLASSNAME);\n }\n }\n else if (this.disabledNodes.has(element)) {\n this.disabledNodes.delete(element);\n removeClass(element, DISABLED_CLASSNAME);\n }\n }\n removeNode(namespaceId, element, isHostElement, context) {\n if (isElementNode(element)) {\n const ns = namespaceId ? this._fetchNamespace(namespaceId) : null;\n if (ns) {\n ns.removeNode(element, context);\n }\n else {\n this.markElementAsRemoved(namespaceId, element, false, context);\n }\n if (isHostElement) {\n const hostNS = this.namespacesByHostElement.get(element);\n if (hostNS && hostNS.id !== namespaceId) {\n hostNS.removeNode(element, context);\n }\n }\n }\n else {\n this._onRemovalComplete(element, context);\n }\n }\n markElementAsRemoved(namespaceId, element, hasAnimation, context, previousTriggersValues) {\n this.collectedLeaveElements.push(element);\n element[REMOVAL_FLAG] = {\n namespaceId,\n setForRemoval: context,\n hasAnimation,\n removedBeforeQueried: false,\n previousTriggersValues\n };\n }\n listen(namespaceId, element, name, phase, callback) {\n if (isElementNode(element)) {\n return this._fetchNamespace(namespaceId).listen(element, name, phase, callback);\n }\n return () => { };\n }\n _buildInstruction(entry, subTimelines, enterClassName, leaveClassName, skipBuildAst) {\n return entry.transition.build(this.driver, entry.element, entry.fromState.value, entry.toState.value, enterClassName, leaveClassName, entry.fromState.options, entry.toState.options, subTimelines, skipBuildAst);\n }\n destroyInnerAnimations(containerElement) {\n let elements = this.driver.query(containerElement, NG_TRIGGER_SELECTOR, true);\n elements.forEach(element => this.destroyActiveAnimationsForElement(element));\n if (this.playersByQueriedElement.size == 0)\n return;\n elements = this.driver.query(containerElement, NG_ANIMATING_SELECTOR, true);\n elements.forEach(element => this.finishActiveQueriedAnimationOnElement(element));\n }\n destroyActiveAnimationsForElement(element) {\n const players = this.playersByElement.get(element);\n if (players) {\n players.forEach(player => {\n // special case for when an element is set for destruction, but hasn't started.\n // in this situation we want to delay the destruction until the flush occurs\n // so that any event listeners attached to the player are triggered.\n if (player.queued) {\n player.markedForDestroy = true;\n }\n else {\n player.destroy();\n }\n });\n }\n }\n finishActiveQueriedAnimationOnElement(element) {\n const players = this.playersByQueriedElement.get(element);\n if (players) {\n players.forEach(player => player.finish());\n }\n }\n whenRenderingDone() {\n return new Promise(resolve => {\n if (this.players.length) {\n return optimizeGroupPlayer(this.players).onDone(() => resolve());\n }\n else {\n resolve();\n }\n });\n }\n processLeaveNode(element) {\n var _a;\n const details = element[REMOVAL_FLAG];\n if (details && details.setForRemoval) {\n // this will prevent it from removing it twice\n element[REMOVAL_FLAG] = NULL_REMOVAL_STATE;\n if (details.namespaceId) {\n this.destroyInnerAnimations(element);\n const ns = this._fetchNamespace(details.namespaceId);\n if (ns) {\n ns.clearElementCache(element);\n }\n }\n this._onRemovalComplete(element, details.setForRemoval);\n }\n if ((_a = element.classList) === null || _a === void 0 ? void 0 : _a.contains(DISABLED_CLASSNAME)) {\n this.markElementAsDisabled(element, false);\n }\n this.driver.query(element, DISABLED_SELECTOR, true).forEach(node => {\n this.markElementAsDisabled(node, false);\n });\n }\n flush(microtaskId = -1) {\n let players = [];\n if (this.newHostElements.size) {\n this.newHostElements.forEach((ns, element) => this._balanceNamespaceList(ns, element));\n this.newHostElements.clear();\n }\n if (this.totalAnimations && this.collectedEnterElements.length) {\n for (let i = 0; i < this.collectedEnterElements.length; i++) {\n const elm = this.collectedEnterElements[i];\n addClass(elm, STAR_CLASSNAME);\n }\n }\n if (this._namespaceList.length &&\n (this.totalQueuedPlayers || this.collectedLeaveElements.length)) {\n const cleanupFns = [];\n try {\n players = this._flushAnimations(cleanupFns, microtaskId);\n }\n finally {\n for (let i = 0; i < cleanupFns.length; i++) {\n cleanupFns[i]();\n }\n }\n }\n else {\n for (let i = 0; i < this.collectedLeaveElements.length; i++) {\n const element = this.collectedLeaveElements[i];\n this.processLeaveNode(element);\n }\n }\n this.totalQueuedPlayers = 0;\n this.collectedEnterElements.length = 0;\n this.collectedLeaveElements.length = 0;\n this._flushFns.forEach(fn => fn());\n this._flushFns = [];\n if (this._whenQuietFns.length) {\n // we move these over to a variable so that\n // if any new callbacks are registered in another\n // flush they do not populate the existing set\n const quietFns = this._whenQuietFns;\n this._whenQuietFns = [];\n if (players.length) {\n optimizeGroupPlayer(players).onDone(() => {\n quietFns.forEach(fn => fn());\n });\n }\n else {\n quietFns.forEach(fn => fn());\n }\n }\n }\n reportError(errors) {\n throw triggerTransitionsFailed(errors);\n }\n _flushAnimations(cleanupFns, microtaskId) {\n const subTimelines = new ElementInstructionMap();\n const skippedPlayers = [];\n const skippedPlayersMap = new Map();\n const queuedInstructions = [];\n const queriedElements = new Map();\n const allPreStyleElements = new Map();\n const allPostStyleElements = new Map();\n const disabledElementsSet = new Set();\n this.disabledNodes.forEach(node => {\n disabledElementsSet.add(node);\n const nodesThatAreDisabled = this.driver.query(node, QUEUED_SELECTOR, true);\n for (let i = 0; i < nodesThatAreDisabled.length; i++) {\n disabledElementsSet.add(nodesThatAreDisabled[i]);\n }\n });\n const bodyNode = this.bodyNode;\n const allTriggerElements = Array.from(this.statesByElement.keys());\n const enterNodeMap = buildRootMap(allTriggerElements, this.collectedEnterElements);\n // this must occur before the instructions are built below such that\n // the :enter queries match the elements (since the timeline queries\n // are fired during instruction building).\n const enterNodeMapIds = new Map();\n let i = 0;\n enterNodeMap.forEach((nodes, root) => {\n const className = ENTER_CLASSNAME + i++;\n enterNodeMapIds.set(root, className);\n nodes.forEach(node => addClass(node, className));\n });\n const allLeaveNodes = [];\n const mergedLeaveNodes = new Set();\n const leaveNodesWithoutAnimations = new Set();\n for (let i = 0; i < this.collectedLeaveElements.length; i++) {\n const element = this.collectedLeaveElements[i];\n const details = element[REMOVAL_FLAG];\n if (details && details.setForRemoval) {\n allLeaveNodes.push(element);\n mergedLeaveNodes.add(element);\n if (details.hasAnimation) {\n this.driver.query(element, STAR_SELECTOR, true).forEach(elm => mergedLeaveNodes.add(elm));\n }\n else {\n leaveNodesWithoutAnimations.add(element);\n }\n }\n }\n const leaveNodeMapIds = new Map();\n const leaveNodeMap = buildRootMap(allTriggerElements, Array.from(mergedLeaveNodes));\n leaveNodeMap.forEach((nodes, root) => {\n const className = LEAVE_CLASSNAME + i++;\n leaveNodeMapIds.set(root, className);\n nodes.forEach(node => addClass(node, className));\n });\n cleanupFns.push(() => {\n enterNodeMap.forEach((nodes, root) => {\n const className = enterNodeMapIds.get(root);\n nodes.forEach(node => removeClass(node, className));\n });\n leaveNodeMap.forEach((nodes, root) => {\n const className = leaveNodeMapIds.get(root);\n nodes.forEach(node => removeClass(node, className));\n });\n allLeaveNodes.forEach(element => {\n this.processLeaveNode(element);\n });\n });\n const allPlayers = [];\n const erroneousTransitions = [];\n for (let i = this._namespaceList.length - 1; i >= 0; i--) {\n const ns = this._namespaceList[i];\n ns.drainQueuedTransitions(microtaskId).forEach(entry => {\n const player = entry.player;\n const element = entry.element;\n allPlayers.push(player);\n if (this.collectedEnterElements.length) {\n const details = element[REMOVAL_FLAG];\n // animations for move operations (elements being removed and reinserted,\n // e.g. when the order of an *ngFor list changes) are currently not supported\n if (details && details.setForMove) {\n if (details.previousTriggersValues &&\n details.previousTriggersValues.has(entry.triggerName)) {\n const previousValue = details.previousTriggersValues.get(entry.triggerName);\n // we need to restore the previous trigger value since the element has\n // only been moved and hasn't actually left the DOM\n const triggersWithStates = this.statesByElement.get(entry.element);\n if (triggersWithStates && triggersWithStates.has(entry.triggerName)) {\n const state = triggersWithStates.get(entry.triggerName);\n state.value = previousValue;\n triggersWithStates.set(entry.triggerName, state);\n }\n }\n player.destroy();\n return;\n }\n }\n const nodeIsOrphaned = !bodyNode || !this.driver.containsElement(bodyNode, element);\n const leaveClassName = leaveNodeMapIds.get(element);\n const enterClassName = enterNodeMapIds.get(element);\n const instruction = this._buildInstruction(entry, subTimelines, enterClassName, leaveClassName, nodeIsOrphaned);\n if (instruction.errors && instruction.errors.length) {\n erroneousTransitions.push(instruction);\n return;\n }\n // even though the element may not be in the DOM, it may still\n // be added at a later point (due to the mechanics of content\n // projection and/or dynamic component insertion) therefore it's\n // important to still style the element.\n if (nodeIsOrphaned) {\n player.onStart(() => eraseStyles(element, instruction.fromStyles));\n player.onDestroy(() => setStyles(element, instruction.toStyles));\n skippedPlayers.push(player);\n return;\n }\n // if an unmatched transition is queued and ready to go\n // then it SHOULD NOT render an animation and cancel the\n // previously running animations.\n if (entry.isFallbackTransition) {\n player.onStart(() => eraseStyles(element, instruction.fromStyles));\n player.onDestroy(() => setStyles(element, instruction.toStyles));\n skippedPlayers.push(player);\n return;\n }\n // this means that if a parent animation uses this animation as a sub-trigger\n // then it will instruct the timeline builder not to add a player delay, but\n // instead stretch the first keyframe gap until the animation starts. This is\n // important in order to prevent extra initialization styles from being\n // required by the user for the animation.\n const timelines = [];\n instruction.timelines.forEach(tl => {\n tl.stretchStartingKeyframe = true;\n if (!this.disabledNodes.has(tl.element)) {\n timelines.push(tl);\n }\n });\n instruction.timelines = timelines;\n subTimelines.append(element, instruction.timelines);\n const tuple = { instruction, player, element };\n queuedInstructions.push(tuple);\n instruction.queriedElements.forEach(element => getOrSetDefaultValue(queriedElements, element, []).push(player));\n instruction.preStyleProps.forEach((stringMap, element) => {\n if (stringMap.size) {\n let setVal = allPreStyleElements.get(element);\n if (!setVal) {\n allPreStyleElements.set(element, setVal = new Set());\n }\n stringMap.forEach((_, prop) => setVal.add(prop));\n }\n });\n instruction.postStyleProps.forEach((stringMap, element) => {\n let setVal = allPostStyleElements.get(element);\n if (!setVal) {\n allPostStyleElements.set(element, setVal = new Set());\n }\n stringMap.forEach((_, prop) => setVal.add(prop));\n });\n });\n }\n if (erroneousTransitions.length) {\n const errors = [];\n erroneousTransitions.forEach(instruction => {\n errors.push(transitionFailed(instruction.triggerName, instruction.errors));\n });\n allPlayers.forEach(player => player.destroy());\n this.reportError(errors);\n }\n const allPreviousPlayersMap = new Map();\n // this map tells us which element in the DOM tree is contained by\n // which animation. Further down this map will get populated once\n // the players are built and in doing so we can use it to efficiently\n // figure out if a sub player is skipped due to a parent player having priority.\n const animationElementMap = new Map();\n queuedInstructions.forEach(entry => {\n const element = entry.element;\n if (subTimelines.has(element)) {\n animationElementMap.set(element, element);\n this._beforeAnimationBuild(entry.player.namespaceId, entry.instruction, allPreviousPlayersMap);\n }\n });\n skippedPlayers.forEach(player => {\n const element = player.element;\n const previousPlayers = this._getPreviousPlayers(element, false, player.namespaceId, player.triggerName, null);\n previousPlayers.forEach(prevPlayer => {\n getOrSetDefaultValue(allPreviousPlayersMap, element, []).push(prevPlayer);\n prevPlayer.destroy();\n });\n });\n // this is a special case for nodes that will be removed either by\n // having their own leave animations or by being queried in a container\n // that will be removed once a parent animation is complete. The idea\n // here is that * styles must be identical to ! styles because of\n // backwards compatibility (* is also filled in by default in many places).\n // Otherwise * styles will return an empty value or \"auto\" since the element\n // passed to getComputedStyle will not be visible (since * === destination)\n const replaceNodes = allLeaveNodes.filter(node => {\n return replacePostStylesAsPre(node, allPreStyleElements, allPostStyleElements);\n });\n // POST STAGE: fill the * styles\n const postStylesMap = new Map();\n const allLeaveQueriedNodes = cloakAndComputeStyles(postStylesMap, this.driver, leaveNodesWithoutAnimations, allPostStyleElements, AUTO_STYLE);\n allLeaveQueriedNodes.forEach(node => {\n if (replacePostStylesAsPre(node, allPreStyleElements, allPostStyleElements)) {\n replaceNodes.push(node);\n }\n });\n // PRE STAGE: fill the ! styles\n const preStylesMap = new Map();\n enterNodeMap.forEach((nodes, root) => {\n cloakAndComputeStyles(preStylesMap, this.driver, new Set(nodes), allPreStyleElements, ɵPRE_STYLE);\n });\n replaceNodes.forEach(node => {\n var _a, _b;\n const post = postStylesMap.get(node);\n const pre = preStylesMap.get(node);\n postStylesMap.set(node, new Map([...Array.from((_a = post === null || post === void 0 ? void 0 : post.entries()) !== null && _a !== void 0 ? _a : []), ...Array.from((_b = pre === null || pre === void 0 ? void 0 : pre.entries()) !== null && _b !== void 0 ? _b : [])]));\n });\n const rootPlayers = [];\n const subPlayers = [];\n const NO_PARENT_ANIMATION_ELEMENT_DETECTED = {};\n queuedInstructions.forEach(entry => {\n const { element, player, instruction } = entry;\n // this means that it was never consumed by a parent animation which\n // means that it is independent and therefore should be set for animation\n if (subTimelines.has(element)) {\n if (disabledElementsSet.has(element)) {\n player.onDestroy(() => setStyles(element, instruction.toStyles));\n player.disabled = true;\n player.overrideTotalTime(instruction.totalTime);\n skippedPlayers.push(player);\n return;\n }\n // this will flow up the DOM and query the map to figure out\n // if a parent animation has priority over it. In the situation\n // that a parent is detected then it will cancel the loop. If\n // nothing is detected, or it takes a few hops to find a parent,\n // then it will fill in the missing nodes and signal them as having\n // a detected parent (or a NO_PARENT value via a special constant).\n let parentWithAnimation = NO_PARENT_ANIMATION_ELEMENT_DETECTED;\n if (animationElementMap.size > 1) {\n let elm = element;\n const parentsToAdd = [];\n while (elm = elm.parentNode) {\n const detectedParent = animationElementMap.get(elm);\n if (detectedParent) {\n parentWithAnimation = detectedParent;\n break;\n }\n parentsToAdd.push(elm);\n }\n parentsToAdd.forEach(parent => animationElementMap.set(parent, parentWithAnimation));\n }\n const innerPlayer = this._buildAnimation(player.namespaceId, instruction, allPreviousPlayersMap, skippedPlayersMap, preStylesMap, postStylesMap);\n player.setRealPlayer(innerPlayer);\n if (parentWithAnimation === NO_PARENT_ANIMATION_ELEMENT_DETECTED) {\n rootPlayers.push(player);\n }\n else {\n const parentPlayers = this.playersByElement.get(parentWithAnimation);\n if (parentPlayers && parentPlayers.length) {\n player.parentPlayer = optimizeGroupPlayer(parentPlayers);\n }\n skippedPlayers.push(player);\n }\n }\n else {\n eraseStyles(element, instruction.fromStyles);\n player.onDestroy(() => setStyles(element, instruction.toStyles));\n // there still might be a ancestor player animating this\n // element therefore we will still add it as a sub player\n // even if its animation may be disabled\n subPlayers.push(player);\n if (disabledElementsSet.has(element)) {\n skippedPlayers.push(player);\n }\n }\n });\n // find all of the sub players' corresponding inner animation players\n subPlayers.forEach(player => {\n // even if no players are found for a sub animation it\n // will still complete itself after the next tick since it's Noop\n const playersForElement = skippedPlayersMap.get(player.element);\n if (playersForElement && playersForElement.length) {\n const innerPlayer = optimizeGroupPlayer(playersForElement);\n player.setRealPlayer(innerPlayer);\n }\n });\n // the reason why we don't actually play the animation is\n // because all that a skipped player is designed to do is to\n // fire the start/done transition callback events\n skippedPlayers.forEach(player => {\n if (player.parentPlayer) {\n player.syncPlayerEvents(player.parentPlayer);\n }\n else {\n player.destroy();\n }\n });\n // run through all of the queued removals and see if they\n // were picked up by a query. If not then perform the removal\n // operation right away unless a parent animation is ongoing.\n for (let i = 0; i < allLeaveNodes.length; i++) {\n const element = allLeaveNodes[i];\n const details = element[REMOVAL_FLAG];\n removeClass(element, LEAVE_CLASSNAME);\n // this means the element has a removal animation that is being\n // taken care of and therefore the inner elements will hang around\n // until that animation is over (or the parent queried animation)\n if (details && details.hasAnimation)\n continue;\n let players = [];\n // if this element is queried or if it contains queried children\n // then we want for the element not to be removed from the page\n // until the queried animations have finished\n if (queriedElements.size) {\n let queriedPlayerResults = queriedElements.get(element);\n if (queriedPlayerResults && queriedPlayerResults.length) {\n players.push(...queriedPlayerResults);\n }\n let queriedInnerElements = this.driver.query(element, NG_ANIMATING_SELECTOR, true);\n for (let j = 0; j < queriedInnerElements.length; j++) {\n let queriedPlayers = queriedElements.get(queriedInnerElements[j]);\n if (queriedPlayers && queriedPlayers.length) {\n players.push(...queriedPlayers);\n }\n }\n }\n const activePlayers = players.filter(p => !p.destroyed);\n if (activePlayers.length) {\n removeNodesAfterAnimationDone(this, element, activePlayers);\n }\n else {\n this.processLeaveNode(element);\n }\n }\n // this is required so the cleanup method doesn't remove them\n allLeaveNodes.length = 0;\n rootPlayers.forEach(player => {\n this.players.push(player);\n player.onDone(() => {\n player.destroy();\n const index = this.players.indexOf(player);\n this.players.splice(index, 1);\n });\n player.play();\n });\n return rootPlayers;\n }\n elementContainsData(namespaceId, element) {\n let containsData = false;\n const details = element[REMOVAL_FLAG];\n if (details && details.setForRemoval)\n containsData = true;\n if (this.playersByElement.has(element))\n containsData = true;\n if (this.playersByQueriedElement.has(element))\n containsData = true;\n if (this.statesByElement.has(element))\n containsData = true;\n return this._fetchNamespace(namespaceId).elementContainsData(element) || containsData;\n }\n afterFlush(callback) {\n this._flushFns.push(callback);\n }\n afterFlushAnimationsDone(callback) {\n this._whenQuietFns.push(callback);\n }\n _getPreviousPlayers(element, isQueriedElement, namespaceId, triggerName, toStateValue) {\n let players = [];\n if (isQueriedElement) {\n const queriedElementPlayers = this.playersByQueriedElement.get(element);\n if (queriedElementPlayers) {\n players = queriedElementPlayers;\n }\n }\n else {\n const elementPlayers = this.playersByElement.get(element);\n if (elementPlayers) {\n const isRemovalAnimation = !toStateValue || toStateValue == VOID_VALUE;\n elementPlayers.forEach(player => {\n if (player.queued)\n return;\n if (!isRemovalAnimation && player.triggerName != triggerName)\n return;\n players.push(player);\n });\n }\n }\n if (namespaceId || triggerName) {\n players = players.filter(player => {\n if (namespaceId && namespaceId != player.namespaceId)\n return false;\n if (triggerName && triggerName != player.triggerName)\n return false;\n return true;\n });\n }\n return players;\n }\n _beforeAnimationBuild(namespaceId, instruction, allPreviousPlayersMap) {\n const triggerName = instruction.triggerName;\n const rootElement = instruction.element;\n // when a removal animation occurs, ALL previous players are collected\n // and destroyed (even if they are outside of the current namespace)\n const targetNameSpaceId = instruction.isRemovalTransition ? undefined : namespaceId;\n const targetTriggerName = instruction.isRemovalTransition ? undefined : triggerName;\n for (const timelineInstruction of instruction.timelines) {\n const element = timelineInstruction.element;\n const isQueriedElement = element !== rootElement;\n const players = getOrSetDefaultValue(allPreviousPlayersMap, element, []);\n const previousPlayers = this._getPreviousPlayers(element, isQueriedElement, targetNameSpaceId, targetTriggerName, instruction.toState);\n previousPlayers.forEach(player => {\n const realPlayer = player.getRealPlayer();\n if (realPlayer.beforeDestroy) {\n realPlayer.beforeDestroy();\n }\n player.destroy();\n players.push(player);\n });\n }\n // this needs to be done so that the PRE/POST styles can be\n // computed properly without interfering with the previous animation\n eraseStyles(rootElement, instruction.fromStyles);\n }\n _buildAnimation(namespaceId, instruction, allPreviousPlayersMap, skippedPlayersMap, preStylesMap, postStylesMap) {\n const triggerName = instruction.triggerName;\n const rootElement = instruction.element;\n // we first run this so that the previous animation player\n // data can be passed into the successive animation players\n const allQueriedPlayers = [];\n const allConsumedElements = new Set();\n const allSubElements = new Set();\n const allNewPlayers = instruction.timelines.map(timelineInstruction => {\n const element = timelineInstruction.element;\n allConsumedElements.add(element);\n // FIXME (matsko): make sure to-be-removed animations are removed properly\n const details = element[REMOVAL_FLAG];\n if (details && details.removedBeforeQueried)\n return new NoopAnimationPlayer(timelineInstruction.duration, timelineInstruction.delay);\n const isQueriedElement = element !== rootElement;\n const previousPlayers = flattenGroupPlayers((allPreviousPlayersMap.get(element) || EMPTY_PLAYER_ARRAY)\n .map(p => p.getRealPlayer()))\n .filter(p => {\n // the `element` is not apart of the AnimationPlayer definition, but\n // Mock/WebAnimations\n // use the element within their implementation. This will be added in Angular5 to\n // AnimationPlayer\n const pp = p;\n return pp.element ? pp.element === element : false;\n });\n const preStyles = preStylesMap.get(element);\n const postStyles = postStylesMap.get(element);\n const keyframes = normalizeKeyframes$1(this.driver, this._normalizer, element, timelineInstruction.keyframes, preStyles, postStyles);\n const player = this._buildPlayer(timelineInstruction, keyframes, previousPlayers);\n // this means that this particular player belongs to a sub trigger. It is\n // important that we match this player up with the corresponding (@trigger.listener)\n if (timelineInstruction.subTimeline && skippedPlayersMap) {\n allSubElements.add(element);\n }\n if (isQueriedElement) {\n const wrappedPlayer = new TransitionAnimationPlayer(namespaceId, triggerName, element);\n wrappedPlayer.setRealPlayer(player);\n allQueriedPlayers.push(wrappedPlayer);\n }\n return player;\n });\n allQueriedPlayers.forEach(player => {\n getOrSetDefaultValue(this.playersByQueriedElement, player.element, []).push(player);\n player.onDone(() => deleteOrUnsetInMap(this.playersByQueriedElement, player.element, player));\n });\n allConsumedElements.forEach(element => addClass(element, NG_ANIMATING_CLASSNAME));\n const player = optimizeGroupPlayer(allNewPlayers);\n player.onDestroy(() => {\n allConsumedElements.forEach(element => removeClass(element, NG_ANIMATING_CLASSNAME));\n setStyles(rootElement, instruction.toStyles);\n });\n // this basically makes all of the callbacks for sub element animations\n // be dependent on the upper players for when they finish\n allSubElements.forEach(element => {\n getOrSetDefaultValue(skippedPlayersMap, element, []).push(player);\n });\n return player;\n }\n _buildPlayer(instruction, keyframes, previousPlayers) {\n if (keyframes.length > 0) {\n return this.driver.animate(instruction.element, keyframes, instruction.duration, instruction.delay, instruction.easing, previousPlayers);\n }\n // special case for when an empty transition|definition is provided\n // ... there is no point in rendering an empty animation\n return new NoopAnimationPlayer(instruction.duration, instruction.delay);\n }\n}\nclass TransitionAnimationPlayer {\n constructor(namespaceId, triggerName, element) {\n this.namespaceId = namespaceId;\n this.triggerName = triggerName;\n this.element = element;\n this._player = new NoopAnimationPlayer();\n this._containsRealPlayer = false;\n this._queuedCallbacks = new Map();\n this.destroyed = false;\n this.markedForDestroy = false;\n this.disabled = false;\n this.queued = true;\n this.totalTime = 0;\n }\n setRealPlayer(player) {\n if (this._containsRealPlayer)\n return;\n this._player = player;\n this._queuedCallbacks.forEach((callbacks, phase) => {\n callbacks.forEach(callback => listenOnPlayer(player, phase, undefined, callback));\n });\n this._queuedCallbacks.clear();\n this._containsRealPlayer = true;\n this.overrideTotalTime(player.totalTime);\n this.queued = false;\n }\n getRealPlayer() {\n return this._player;\n }\n overrideTotalTime(totalTime) {\n this.totalTime = totalTime;\n }\n syncPlayerEvents(player) {\n const p = this._player;\n if (p.triggerCallback) {\n player.onStart(() => p.triggerCallback('start'));\n }\n player.onDone(() => this.finish());\n player.onDestroy(() => this.destroy());\n }\n _queueEvent(name, callback) {\n getOrSetDefaultValue(this._queuedCallbacks, name, []).push(callback);\n }\n onDone(fn) {\n if (this.queued) {\n this._queueEvent('done', fn);\n }\n this._player.onDone(fn);\n }\n onStart(fn) {\n if (this.queued) {\n this._queueEvent('start', fn);\n }\n this._player.onStart(fn);\n }\n onDestroy(fn) {\n if (this.queued) {\n this._queueEvent('destroy', fn);\n }\n this._player.onDestroy(fn);\n }\n init() {\n this._player.init();\n }\n hasStarted() {\n return this.queued ? false : this._player.hasStarted();\n }\n play() {\n !this.queued && this._player.play();\n }\n pause() {\n !this.queued && this._player.pause();\n }\n restart() {\n !this.queued && this._player.restart();\n }\n finish() {\n this._player.finish();\n }\n destroy() {\n this.destroyed = true;\n this._player.destroy();\n }\n reset() {\n !this.queued && this._player.reset();\n }\n setPosition(p) {\n if (!this.queued) {\n this._player.setPosition(p);\n }\n }\n getPosition() {\n return this.queued ? 0 : this._player.getPosition();\n }\n /** @internal */\n triggerCallback(phaseName) {\n const p = this._player;\n if (p.triggerCallback) {\n p.triggerCallback(phaseName);\n }\n }\n}\nfunction deleteOrUnsetInMap(map, key, value) {\n let currentValues = map.get(key);\n if (currentValues) {\n if (currentValues.length) {\n const index = currentValues.indexOf(value);\n currentValues.splice(index, 1);\n }\n if (currentValues.length == 0) {\n map.delete(key);\n }\n }\n return currentValues;\n}\nfunction normalizeTriggerValue(value) {\n // we use `!= null` here because it's the most simple\n // way to test against a \"falsy\" value without mixing\n // in empty strings or a zero value. DO NOT OPTIMIZE.\n return value != null ? value : null;\n}\nfunction isElementNode(node) {\n return node && node['nodeType'] === 1;\n}\nfunction isTriggerEventValid(eventName) {\n return eventName == 'start' || eventName == 'done';\n}\nfunction cloakElement(element, value) {\n const oldValue = element.style.display;\n element.style.display = value != null ? value : 'none';\n return oldValue;\n}\nfunction cloakAndComputeStyles(valuesMap, driver, elements, elementPropsMap, defaultStyle) {\n const cloakVals = [];\n elements.forEach(element => cloakVals.push(cloakElement(element)));\n const failedElements = [];\n elementPropsMap.forEach((props, element) => {\n const styles = new Map();\n props.forEach(prop => {\n const value = driver.computeStyle(element, prop, defaultStyle);\n styles.set(prop, value);\n // there is no easy way to detect this because a sub element could be removed\n // by a parent animation element being detached.\n if (!value || value.length == 0) {\n element[REMOVAL_FLAG] = NULL_REMOVED_QUERIED_STATE;\n failedElements.push(element);\n }\n });\n valuesMap.set(element, styles);\n });\n // we use a index variable here since Set.forEach(a, i) does not return\n // an index value for the closure (but instead just the value)\n let i = 0;\n elements.forEach(element => cloakElement(element, cloakVals[i++]));\n return failedElements;\n}\n/*\nSince the Angular renderer code will return a collection of inserted\nnodes in all areas of a DOM tree, it's up to this algorithm to figure\nout which nodes are roots for each animation @trigger.\n\nBy placing each inserted node into a Set and traversing upwards, it\nis possible to find the @trigger elements and well any direct *star\ninsertion nodes, if a @trigger root is found then the enter element\nis placed into the Map[@trigger] spot.\n */\nfunction buildRootMap(roots, nodes) {\n const rootMap = new Map();\n roots.forEach(root => rootMap.set(root, []));\n if (nodes.length == 0)\n return rootMap;\n const NULL_NODE = 1;\n const nodeSet = new Set(nodes);\n const localRootMap = new Map();\n function getRoot(node) {\n if (!node)\n return NULL_NODE;\n let root = localRootMap.get(node);\n if (root)\n return root;\n const parent = node.parentNode;\n if (rootMap.has(parent)) { // ngIf inside @trigger\n root = parent;\n }\n else if (nodeSet.has(parent)) { // ngIf inside ngIf\n root = NULL_NODE;\n }\n else { // recurse upwards\n root = getRoot(parent);\n }\n localRootMap.set(node, root);\n return root;\n }\n nodes.forEach(node => {\n const root = getRoot(node);\n if (root !== NULL_NODE) {\n rootMap.get(root).push(node);\n }\n });\n return rootMap;\n}\nfunction addClass(element, className) {\n var _a;\n (_a = element.classList) === null || _a === void 0 ? void 0 : _a.add(className);\n}\nfunction removeClass(element, className) {\n var _a;\n (_a = element.classList) === null || _a === void 0 ? void 0 : _a.remove(className);\n}\nfunction removeNodesAfterAnimationDone(engine, element, players) {\n optimizeGroupPlayer(players).onDone(() => engine.processLeaveNode(element));\n}\nfunction flattenGroupPlayers(players) {\n const finalPlayers = [];\n _flattenGroupPlayersRecur(players, finalPlayers);\n return finalPlayers;\n}\nfunction _flattenGroupPlayersRecur(players, finalPlayers) {\n for (let i = 0; i < players.length; i++) {\n const player = players[i];\n if (player instanceof ɵAnimationGroupPlayer) {\n _flattenGroupPlayersRecur(player.players, finalPlayers);\n }\n else {\n finalPlayers.push(player);\n }\n }\n}\nfunction objEquals(a, b) {\n const k1 = Object.keys(a);\n const k2 = Object.keys(b);\n if (k1.length != k2.length)\n return false;\n for (let i = 0; i < k1.length; i++) {\n const prop = k1[i];\n if (!b.hasOwnProperty(prop) || a[prop] !== b[prop])\n return false;\n }\n return true;\n}\nfunction replacePostStylesAsPre(element, allPreStyleElements, allPostStyleElements) {\n const postEntry = allPostStyleElements.get(element);\n if (!postEntry)\n return false;\n let preEntry = allPreStyleElements.get(element);\n if (preEntry) {\n postEntry.forEach(data => preEntry.add(data));\n }\n else {\n allPreStyleElements.set(element, postEntry);\n }\n allPostStyleElements.delete(element);\n return true;\n}\n\nclass AnimationEngine {\n constructor(bodyNode, _driver, _normalizer) {\n this.bodyNode = bodyNode;\n this._driver = _driver;\n this._normalizer = _normalizer;\n this._triggerCache = {};\n // this method is designed to be overridden by the code that uses this engine\n this.onRemovalComplete = (element, context) => { };\n this._transitionEngine = new TransitionAnimationEngine(bodyNode, _driver, _normalizer);\n this._timelineEngine = new TimelineAnimationEngine(bodyNode, _driver, _normalizer);\n this._transitionEngine.onRemovalComplete = (element, context) => this.onRemovalComplete(element, context);\n }\n registerTrigger(componentId, namespaceId, hostElement, name, metadata) {\n const cacheKey = componentId + '-' + name;\n let trigger = this._triggerCache[cacheKey];\n if (!trigger) {\n const errors = [];\n const warnings = [];\n const ast = buildAnimationAst(this._driver, metadata, errors, warnings);\n if (errors.length) {\n throw triggerBuildFailed(name, errors);\n }\n if (warnings.length) {\n warnTriggerBuild(name, warnings);\n }\n trigger = buildTrigger(name, ast, this._normalizer);\n this._triggerCache[cacheKey] = trigger;\n }\n this._transitionEngine.registerTrigger(namespaceId, name, trigger);\n }\n register(namespaceId, hostElement) {\n this._transitionEngine.register(namespaceId, hostElement);\n }\n destroy(namespaceId, context) {\n this._transitionEngine.destroy(namespaceId, context);\n }\n onInsert(namespaceId, element, parent, insertBefore) {\n this._transitionEngine.insertNode(namespaceId, element, parent, insertBefore);\n }\n onRemove(namespaceId, element, context, isHostElement) {\n this._transitionEngine.removeNode(namespaceId, element, isHostElement || false, context);\n }\n disableAnimations(element, disable) {\n this._transitionEngine.markElementAsDisabled(element, disable);\n }\n process(namespaceId, element, property, value) {\n if (property.charAt(0) == '@') {\n const [id, action] = parseTimelineCommand(property);\n const args = value;\n this._timelineEngine.command(id, element, action, args);\n }\n else {\n this._transitionEngine.trigger(namespaceId, element, property, value);\n }\n }\n listen(namespaceId, element, eventName, eventPhase, callback) {\n // @@listen\n if (eventName.charAt(0) == '@') {\n const [id, action] = parseTimelineCommand(eventName);\n return this._timelineEngine.listen(id, element, action, callback);\n }\n return this._transitionEngine.listen(namespaceId, element, eventName, eventPhase, callback);\n }\n flush(microtaskId = -1) {\n this._transitionEngine.flush(microtaskId);\n }\n get players() {\n return this._transitionEngine.players\n .concat(this._timelineEngine.players);\n }\n whenRenderingDone() {\n return this._transitionEngine.whenRenderingDone();\n }\n}\n\n/**\n * Returns an instance of `SpecialCasedStyles` if and when any special (non animateable) styles are\n * detected.\n *\n * In CSS there exist properties that cannot be animated within a keyframe animation\n * (whether it be via CSS keyframes or web-animations) and the animation implementation\n * will ignore them. This function is designed to detect those special cased styles and\n * return a container that will be executed at the start and end of the animation.\n *\n * @returns an instance of `SpecialCasedStyles` if any special styles are detected otherwise `null`\n */\nfunction packageNonAnimatableStyles(element, styles) {\n let startStyles = null;\n let endStyles = null;\n if (Array.isArray(styles) && styles.length) {\n startStyles = filterNonAnimatableStyles(styles[0]);\n if (styles.length > 1) {\n endStyles = filterNonAnimatableStyles(styles[styles.length - 1]);\n }\n }\n else if (styles instanceof Map) {\n startStyles = filterNonAnimatableStyles(styles);\n }\n return (startStyles || endStyles) ? new SpecialCasedStyles(element, startStyles, endStyles) :\n null;\n}\n/**\n * Designed to be executed during a keyframe-based animation to apply any special-cased styles.\n *\n * When started (when the `start()` method is run) then the provided `startStyles`\n * will be applied. When finished (when the `finish()` method is called) the\n * `endStyles` will be applied as well any any starting styles. Finally when\n * `destroy()` is called then all styles will be removed.\n */\nclass SpecialCasedStyles {\n constructor(_element, _startStyles, _endStyles) {\n this._element = _element;\n this._startStyles = _startStyles;\n this._endStyles = _endStyles;\n this._state = 0 /* SpecialCasedStylesState.Pending */;\n let initialStyles = SpecialCasedStyles.initialStylesByElement.get(_element);\n if (!initialStyles) {\n SpecialCasedStyles.initialStylesByElement.set(_element, initialStyles = new Map());\n }\n this._initialStyles = initialStyles;\n }\n start() {\n if (this._state < 1 /* SpecialCasedStylesState.Started */) {\n if (this._startStyles) {\n setStyles(this._element, this._startStyles, this._initialStyles);\n }\n this._state = 1 /* SpecialCasedStylesState.Started */;\n }\n }\n finish() {\n this.start();\n if (this._state < 2 /* SpecialCasedStylesState.Finished */) {\n setStyles(this._element, this._initialStyles);\n if (this._endStyles) {\n setStyles(this._element, this._endStyles);\n this._endStyles = null;\n }\n this._state = 1 /* SpecialCasedStylesState.Started */;\n }\n }\n destroy() {\n this.finish();\n if (this._state < 3 /* SpecialCasedStylesState.Destroyed */) {\n SpecialCasedStyles.initialStylesByElement.delete(this._element);\n if (this._startStyles) {\n eraseStyles(this._element, this._startStyles);\n this._endStyles = null;\n }\n if (this._endStyles) {\n eraseStyles(this._element, this._endStyles);\n this._endStyles = null;\n }\n setStyles(this._element, this._initialStyles);\n this._state = 3 /* SpecialCasedStylesState.Destroyed */;\n }\n }\n}\nSpecialCasedStyles.initialStylesByElement = ( /* @__PURE__ */new WeakMap());\nfunction filterNonAnimatableStyles(styles) {\n let result = null;\n styles.forEach((val, prop) => {\n if (isNonAnimatableStyle(prop)) {\n result = result || new Map();\n result.set(prop, val);\n }\n });\n return result;\n}\nfunction isNonAnimatableStyle(prop) {\n return prop === 'display' || prop === 'position';\n}\n\nclass WebAnimationsPlayer {\n constructor(element, keyframes, options, _specialStyles) {\n this.element = element;\n this.keyframes = keyframes;\n this.options = options;\n this._specialStyles = _specialStyles;\n this._onDoneFns = [];\n this._onStartFns = [];\n this._onDestroyFns = [];\n this._initialized = false;\n this._finished = false;\n this._started = false;\n this._destroyed = false;\n // the following original fns are persistent copies of the _onStartFns and _onDoneFns\n // and are used to reset the fns to their original values upon reset()\n // (since the _onStartFns and _onDoneFns get deleted after they are called)\n this._originalOnDoneFns = [];\n this._originalOnStartFns = [];\n this.time = 0;\n this.parentPlayer = null;\n this.currentSnapshot = new Map();\n this._duration = options['duration'];\n this._delay = options['delay'] || 0;\n this.time = this._duration + this._delay;\n }\n _onFinish() {\n if (!this._finished) {\n this._finished = true;\n this._onDoneFns.forEach(fn => fn());\n this._onDoneFns = [];\n }\n }\n init() {\n this._buildPlayer();\n this._preparePlayerBeforeStart();\n }\n _buildPlayer() {\n if (this._initialized)\n return;\n this._initialized = true;\n const keyframes = this.keyframes;\n this.domPlayer =\n this._triggerWebAnimation(this.element, keyframes, this.options);\n this._finalKeyframe = keyframes.length ? keyframes[keyframes.length - 1] : new Map();\n this.domPlayer.addEventListener('finish', () => this._onFinish());\n }\n _preparePlayerBeforeStart() {\n // this is required so that the player doesn't start to animate right away\n if (this._delay) {\n this._resetDomPlayerState();\n }\n else {\n this.domPlayer.pause();\n }\n }\n _convertKeyframesToObject(keyframes) {\n const kfs = [];\n keyframes.forEach(frame => {\n kfs.push(Object.fromEntries(frame));\n });\n return kfs;\n }\n /** @internal */\n _triggerWebAnimation(element, keyframes, options) {\n // jscompiler doesn't seem to know animate is a native property because it's not fully\n // supported yet across common browsers (we polyfill it for Edge/Safari) [CL #143630929]\n return element['animate'](this._convertKeyframesToObject(keyframes), options);\n }\n onStart(fn) {\n this._originalOnStartFns.push(fn);\n this._onStartFns.push(fn);\n }\n onDone(fn) {\n this._originalOnDoneFns.push(fn);\n this._onDoneFns.push(fn);\n }\n onDestroy(fn) {\n this._onDestroyFns.push(fn);\n }\n play() {\n this._buildPlayer();\n if (!this.hasStarted()) {\n this._onStartFns.forEach(fn => fn());\n this._onStartFns = [];\n this._started = true;\n if (this._specialStyles) {\n this._specialStyles.start();\n }\n }\n this.domPlayer.play();\n }\n pause() {\n this.init();\n this.domPlayer.pause();\n }\n finish() {\n this.init();\n if (this._specialStyles) {\n this._specialStyles.finish();\n }\n this._onFinish();\n this.domPlayer.finish();\n }\n reset() {\n this._resetDomPlayerState();\n this._destroyed = false;\n this._finished = false;\n this._started = false;\n this._onStartFns = this._originalOnStartFns;\n this._onDoneFns = this._originalOnDoneFns;\n }\n _resetDomPlayerState() {\n if (this.domPlayer) {\n this.domPlayer.cancel();\n }\n }\n restart() {\n this.reset();\n this.play();\n }\n hasStarted() {\n return this._started;\n }\n destroy() {\n if (!this._destroyed) {\n this._destroyed = true;\n this._resetDomPlayerState();\n this._onFinish();\n if (this._specialStyles) {\n this._specialStyles.destroy();\n }\n this._onDestroyFns.forEach(fn => fn());\n this._onDestroyFns = [];\n }\n }\n setPosition(p) {\n if (this.domPlayer === undefined) {\n this.init();\n }\n this.domPlayer.currentTime = p * this.time;\n }\n getPosition() {\n return this.domPlayer.currentTime / this.time;\n }\n get totalTime() {\n return this._delay + this._duration;\n }\n beforeDestroy() {\n const styles = new Map();\n if (this.hasStarted()) {\n // note: this code is invoked only when the `play` function was called prior to this\n // (thus `hasStarted` returns true), this implies that the code that initializes\n // `_finalKeyframe` has also been executed and the non-null assertion can be safely used here\n const finalKeyframe = this._finalKeyframe;\n finalKeyframe.forEach((val, prop) => {\n if (prop !== 'offset') {\n styles.set(prop, this._finished ? val : computeStyle(this.element, prop));\n }\n });\n }\n this.currentSnapshot = styles;\n }\n /** @internal */\n triggerCallback(phaseName) {\n const methods = phaseName === 'start' ? this._onStartFns : this._onDoneFns;\n methods.forEach(fn => fn());\n methods.length = 0;\n }\n}\n\nclass WebAnimationsDriver {\n validateStyleProperty(prop) {\n // Perform actual validation in dev mode only, in prod mode this check is a noop.\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n return validateStyleProperty(prop);\n }\n return true;\n }\n validateAnimatableStyleProperty(prop) {\n // Perform actual validation in dev mode only, in prod mode this check is a noop.\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n const cssProp = camelCaseToDashCase(prop);\n return validateWebAnimatableStyleProperty(cssProp);\n }\n return true;\n }\n matchesElement(_element, _selector) {\n // This method is deprecated and no longer in use so we return false.\n return false;\n }\n containsElement(elm1, elm2) {\n return containsElement(elm1, elm2);\n }\n getParentElement(element) {\n return getParentElement(element);\n }\n query(element, selector, multi) {\n return invokeQuery(element, selector, multi);\n }\n computeStyle(element, prop, defaultValue) {\n return window.getComputedStyle(element)[prop];\n }\n animate(element, keyframes, duration, delay, easing, previousPlayers = []) {\n const fill = delay == 0 ? 'both' : 'forwards';\n const playerOptions = { duration, delay, fill };\n // we check for this to avoid having a null|undefined value be present\n // for the easing (which results in an error for certain browsers #9752)\n if (easing) {\n playerOptions['easing'] = easing;\n }\n const previousStyles = new Map();\n const previousWebAnimationPlayers = previousPlayers.filter(player => player instanceof WebAnimationsPlayer);\n if (allowPreviousPlayerStylesMerge(duration, delay)) {\n previousWebAnimationPlayers.forEach(player => {\n player.currentSnapshot.forEach((val, prop) => previousStyles.set(prop, val));\n });\n }\n let _keyframes = normalizeKeyframes(keyframes).map(styles => copyStyles(styles));\n _keyframes = balancePreviousStylesIntoKeyframes(element, _keyframes, previousStyles);\n const specialStyles = packageNonAnimatableStyles(element, _keyframes);\n return new WebAnimationsPlayer(element, _keyframes, playerOptions, specialStyles);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { AnimationDriver, Animation as ɵAnimation, AnimationEngine as ɵAnimationEngine, AnimationStyleNormalizer as ɵAnimationStyleNormalizer, NoopAnimationDriver as ɵNoopAnimationDriver, NoopAnimationStyleNormalizer as ɵNoopAnimationStyleNormalizer, WebAnimationsDriver as ɵWebAnimationsDriver, WebAnimationsPlayer as ɵWebAnimationsPlayer, WebAnimationsStyleNormalizer as ɵWebAnimationsStyleNormalizer, allowPreviousPlayerStylesMerge as ɵallowPreviousPlayerStylesMerge, containsElement as ɵcontainsElement, getParentElement as ɵgetParentElement, invokeQuery as ɵinvokeQuery, normalizeKeyframes as ɵnormalizeKeyframes, validateStyleProperty as ɵvalidateStyleProperty };\n","/**\n * @license Angular v14.2.0\n * (c) 2010-2022 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport * as i0 from '@angular/core';\nimport { InjectionToken, Injectable, ɵɵinject, Inject, inject, Optional, EventEmitter, ɵfindLocaleData, ɵLocaleDataIndex, ɵgetLocaleCurrencyCode, ɵgetLocalePluralCase, LOCALE_ID, ɵregisterLocaleData, ɵisListLikeIterable, ɵstringify, Directive, Input, createNgModule, NgModuleRef, ɵRuntimeError, Host, Attribute, RendererStyleFlags2, ɵisPromise, ɵisSubscribable, Pipe, DEFAULT_CURRENCY_CODE, NgModule, Version, ɵɵdefineInjectable, ɵformatRuntimeError, Renderer2, ElementRef, Injector, NgZone } from '@angular/core';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nlet _DOM = null;\nfunction getDOM() {\n return _DOM;\n}\nfunction setDOM(adapter) {\n _DOM = adapter;\n}\nfunction setRootDomAdapter(adapter) {\n if (!_DOM) {\n _DOM = adapter;\n }\n}\n/* tslint:disable:requireParameterType */\n/**\n * Provides DOM operations in an environment-agnostic way.\n *\n * @security Tread carefully! Interacting with the DOM directly is dangerous and\n * can introduce XSS risks.\n */\nclass DomAdapter {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A DI Token representing the main rendering context. In a browser this is the DOM Document.\n *\n * Note: Document might not be available in the Application Context when Application and Rendering\n * Contexts are not the same (e.g. when running the application in a Web Worker).\n *\n * @publicApi\n */\nconst DOCUMENT = new InjectionToken('DocumentToken');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * This class should not be used directly by an application developer. Instead, use\n * {@link Location}.\n *\n * `PlatformLocation` encapsulates all calls to DOM APIs, which allows the Router to be\n * platform-agnostic.\n * This means that we can have different implementation of `PlatformLocation` for the different\n * platforms that Angular supports. For example, `@angular/platform-browser` provides an\n * implementation specific to the browser environment, while `@angular/platform-server` provides\n * one suitable for use with server-side rendering.\n *\n * The `PlatformLocation` class is used directly by all implementations of {@link LocationStrategy}\n * when they need to interact with the DOM APIs like pushState, popState, etc.\n *\n * {@link LocationStrategy} in turn is used by the {@link Location} service which is used directly\n * by the {@link Router} in order to navigate between routes. Since all interactions between {@link\n * Router} /\n * {@link Location} / {@link LocationStrategy} and DOM APIs flow through the `PlatformLocation`\n * class, they are all platform-agnostic.\n *\n * @publicApi\n */\nclass PlatformLocation {\n historyGo(relativePosition) {\n throw new Error('Not implemented');\n }\n}\nPlatformLocation.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: PlatformLocation, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nPlatformLocation.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: PlatformLocation, providedIn: 'platform', useFactory: useBrowserPlatformLocation });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: PlatformLocation, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'platform',\n // See #23917\n useFactory: useBrowserPlatformLocation\n }]\n }] });\nfunction useBrowserPlatformLocation() {\n return ɵɵinject(BrowserPlatformLocation);\n}\n/**\n * @description\n * Indicates when a location is initialized.\n *\n * @publicApi\n */\nconst LOCATION_INITIALIZED = new InjectionToken('Location Initialized');\n/**\n * `PlatformLocation` encapsulates all of the direct calls to platform APIs.\n * This class should not be used directly by an application developer. Instead, use\n * {@link Location}.\n */\nclass BrowserPlatformLocation extends PlatformLocation {\n constructor(_doc) {\n super();\n this._doc = _doc;\n this._init();\n }\n // This is moved to its own method so that `MockPlatformLocationStrategy` can overwrite it\n /** @internal */\n _init() {\n this.location = window.location;\n this._history = window.history;\n }\n getBaseHrefFromDOM() {\n return getDOM().getBaseHref(this._doc);\n }\n onPopState(fn) {\n const window = getDOM().getGlobalEventTarget(this._doc, 'window');\n window.addEventListener('popstate', fn, false);\n return () => window.removeEventListener('popstate', fn);\n }\n onHashChange(fn) {\n const window = getDOM().getGlobalEventTarget(this._doc, 'window');\n window.addEventListener('hashchange', fn, false);\n return () => window.removeEventListener('hashchange', fn);\n }\n get href() {\n return this.location.href;\n }\n get protocol() {\n return this.location.protocol;\n }\n get hostname() {\n return this.location.hostname;\n }\n get port() {\n return this.location.port;\n }\n get pathname() {\n return this.location.pathname;\n }\n get search() {\n return this.location.search;\n }\n get hash() {\n return this.location.hash;\n }\n set pathname(newPath) {\n this.location.pathname = newPath;\n }\n pushState(state, title, url) {\n if (supportsState()) {\n this._history.pushState(state, title, url);\n }\n else {\n this.location.hash = url;\n }\n }\n replaceState(state, title, url) {\n if (supportsState()) {\n this._history.replaceState(state, title, url);\n }\n else {\n this.location.hash = url;\n }\n }\n forward() {\n this._history.forward();\n }\n back() {\n this._history.back();\n }\n historyGo(relativePosition = 0) {\n this._history.go(relativePosition);\n }\n getState() {\n return this._history.state;\n }\n}\nBrowserPlatformLocation.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: BrowserPlatformLocation, deps: [{ token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable });\nBrowserPlatformLocation.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: BrowserPlatformLocation, providedIn: 'platform', useFactory: createBrowserPlatformLocation });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: BrowserPlatformLocation, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'platform',\n // See #23917\n useFactory: createBrowserPlatformLocation,\n }]\n }], ctorParameters: function () {\n return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }];\n } });\nfunction supportsState() {\n return !!window.history.pushState;\n}\nfunction createBrowserPlatformLocation() {\n return new BrowserPlatformLocation(ɵɵinject(DOCUMENT));\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Joins two parts of a URL with a slash if needed.\n *\n * @param start URL string\n * @param end URL string\n *\n *\n * @returns The joined URL string.\n */\nfunction joinWithSlash(start, end) {\n if (start.length == 0) {\n return end;\n }\n if (end.length == 0) {\n return start;\n }\n let slashes = 0;\n if (start.endsWith('/')) {\n slashes++;\n }\n if (end.startsWith('/')) {\n slashes++;\n }\n if (slashes == 2) {\n return start + end.substring(1);\n }\n if (slashes == 1) {\n return start + end;\n }\n return start + '/' + end;\n}\n/**\n * Removes a trailing slash from a URL string if needed.\n * Looks for the first occurrence of either `#`, `?`, or the end of the\n * line as `/` characters and removes the trailing slash if one exists.\n *\n * @param url URL string.\n *\n * @returns The URL string, modified if needed.\n */\nfunction stripTrailingSlash(url) {\n const match = url.match(/#|\\?|$/);\n const pathEndIdx = match && match.index || url.length;\n const droppedSlashIdx = pathEndIdx - (url[pathEndIdx - 1] === '/' ? 1 : 0);\n return url.slice(0, droppedSlashIdx) + url.slice(pathEndIdx);\n}\n/**\n * Normalizes URL parameters by prepending with `?` if needed.\n *\n * @param params String of URL parameters.\n *\n * @returns The normalized URL parameters string.\n */\nfunction normalizeQueryParams(params) {\n return params && params[0] !== '?' ? '?' + params : params;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Enables the `Location` service to read route state from the browser's URL.\n * Angular provides two strategies:\n * `HashLocationStrategy` and `PathLocationStrategy`.\n *\n * Applications should use the `Router` or `Location` services to\n * interact with application route state.\n *\n * For instance, `HashLocationStrategy` produces URLs like\n * http://example.com#/foo
,\n * and `PathLocationStrategy` produces\n * http://example.com/foo
as an equivalent URL.\n *\n * See these two classes for more.\n *\n * @publicApi\n */\nclass LocationStrategy {\n historyGo(relativePosition) {\n throw new Error('Not implemented');\n }\n}\nLocationStrategy.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: LocationStrategy, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nLocationStrategy.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: LocationStrategy, providedIn: 'root', useFactory: () => inject(PathLocationStrategy) });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: LocationStrategy, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root', useFactory: () => inject(PathLocationStrategy) }]\n }] });\n/**\n * A predefined [DI token](guide/glossary#di-token) for the base href\n * to be used with the `PathLocationStrategy`.\n * The base href is the URL prefix that should be preserved when generating\n * and recognizing URLs.\n *\n * @usageNotes\n *\n * The following example shows how to use this token to configure the root app injector\n * with a base href value, so that the DI framework can supply the dependency anywhere in the app.\n *\n * ```typescript\n * import {Component, NgModule} from '@angular/core';\n * import {APP_BASE_HREF} from '@angular/common';\n *\n * @NgModule({\n * providers: [{provide: APP_BASE_HREF, useValue: '/my/app'}]\n * })\n * class AppModule {}\n * ```\n *\n * @publicApi\n */\nconst APP_BASE_HREF = new InjectionToken('appBaseHref');\n/**\n * @description\n * A {@link LocationStrategy} used to configure the {@link Location} service to\n * represent its state in the\n * [path](https://en.wikipedia.org/wiki/Uniform_Resource_Locator#Syntax) of the\n * browser's URL.\n *\n * If you're using `PathLocationStrategy`, you may provide a {@link APP_BASE_HREF}\n * or add a ` ` element to the document to override the default.\n *\n * For instance, if you provide an `APP_BASE_HREF` of `'/my/app/'` and call\n * `location.go('/foo')`, the browser's URL will become\n * `example.com/my/app/foo`. To ensure all relative URIs resolve correctly,\n * the ` ` and/or `APP_BASE_HREF` should end with a `/`.\n *\n * Similarly, if you add ` ` to the document and call\n * `location.go('/foo')`, the browser's URL will become\n * `example.com/my/app/foo`.\n *\n * Note that when using `PathLocationStrategy`, neither the query nor\n * the fragment in the ` ` will be preserved, as outlined\n * by the [RFC](https://tools.ietf.org/html/rfc3986#section-5.2.2).\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/location/ts/path_location_component.ts region='LocationComponent'}\n *\n * @publicApi\n */\nclass PathLocationStrategy extends LocationStrategy {\n constructor(_platformLocation, href) {\n var _a, _b, _c;\n super();\n this._platformLocation = _platformLocation;\n this._removeListenerFns = [];\n this._baseHref = (_c = (_a = href !== null && href !== void 0 ? href : this._platformLocation.getBaseHrefFromDOM()) !== null && _a !== void 0 ? _a : (_b = inject(DOCUMENT).location) === null || _b === void 0 ? void 0 : _b.origin) !== null && _c !== void 0 ? _c : '';\n }\n /** @nodoc */\n ngOnDestroy() {\n while (this._removeListenerFns.length) {\n this._removeListenerFns.pop()();\n }\n }\n onPopState(fn) {\n this._removeListenerFns.push(this._platformLocation.onPopState(fn), this._platformLocation.onHashChange(fn));\n }\n getBaseHref() {\n return this._baseHref;\n }\n prepareExternalUrl(internal) {\n return joinWithSlash(this._baseHref, internal);\n }\n path(includeHash = false) {\n const pathname = this._platformLocation.pathname + normalizeQueryParams(this._platformLocation.search);\n const hash = this._platformLocation.hash;\n return hash && includeHash ? `${pathname}${hash}` : pathname;\n }\n pushState(state, title, url, queryParams) {\n const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams));\n this._platformLocation.pushState(state, title, externalUrl);\n }\n replaceState(state, title, url, queryParams) {\n const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams));\n this._platformLocation.replaceState(state, title, externalUrl);\n }\n forward() {\n this._platformLocation.forward();\n }\n back() {\n this._platformLocation.back();\n }\n getState() {\n return this._platformLocation.getState();\n }\n historyGo(relativePosition = 0) {\n var _a, _b;\n (_b = (_a = this._platformLocation).historyGo) === null || _b === void 0 ? void 0 : _b.call(_a, relativePosition);\n }\n}\nPathLocationStrategy.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: PathLocationStrategy, deps: [{ token: PlatformLocation }, { token: APP_BASE_HREF, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nPathLocationStrategy.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: PathLocationStrategy, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: PathLocationStrategy, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () {\n return [{ type: PlatformLocation }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [APP_BASE_HREF]\n }] }];\n } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @description\n * A {@link LocationStrategy} used to configure the {@link Location} service to\n * represent its state in the\n * [hash fragment](https://en.wikipedia.org/wiki/Uniform_Resource_Locator#Syntax)\n * of the browser's URL.\n *\n * For instance, if you call `location.go('/foo')`, the browser's URL will become\n * `example.com#/foo`.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/location/ts/hash_location_component.ts region='LocationComponent'}\n *\n * @publicApi\n */\nclass HashLocationStrategy extends LocationStrategy {\n constructor(_platformLocation, _baseHref) {\n super();\n this._platformLocation = _platformLocation;\n this._baseHref = '';\n this._removeListenerFns = [];\n if (_baseHref != null) {\n this._baseHref = _baseHref;\n }\n }\n /** @nodoc */\n ngOnDestroy() {\n while (this._removeListenerFns.length) {\n this._removeListenerFns.pop()();\n }\n }\n onPopState(fn) {\n this._removeListenerFns.push(this._platformLocation.onPopState(fn), this._platformLocation.onHashChange(fn));\n }\n getBaseHref() {\n return this._baseHref;\n }\n path(includeHash = false) {\n // the hash value is always prefixed with a `#`\n // and if it is empty then it will stay empty\n let path = this._platformLocation.hash;\n if (path == null)\n path = '#';\n return path.length > 0 ? path.substring(1) : path;\n }\n prepareExternalUrl(internal) {\n const url = joinWithSlash(this._baseHref, internal);\n return url.length > 0 ? ('#' + url) : url;\n }\n pushState(state, title, path, queryParams) {\n let url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams));\n if (url.length == 0) {\n url = this._platformLocation.pathname;\n }\n this._platformLocation.pushState(state, title, url);\n }\n replaceState(state, title, path, queryParams) {\n let url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams));\n if (url.length == 0) {\n url = this._platformLocation.pathname;\n }\n this._platformLocation.replaceState(state, title, url);\n }\n forward() {\n this._platformLocation.forward();\n }\n back() {\n this._platformLocation.back();\n }\n getState() {\n return this._platformLocation.getState();\n }\n historyGo(relativePosition = 0) {\n var _a, _b;\n (_b = (_a = this._platformLocation).historyGo) === null || _b === void 0 ? void 0 : _b.call(_a, relativePosition);\n }\n}\nHashLocationStrategy.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: HashLocationStrategy, deps: [{ token: PlatformLocation }, { token: APP_BASE_HREF, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nHashLocationStrategy.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: HashLocationStrategy });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: HashLocationStrategy, decorators: [{\n type: Injectable\n }], ctorParameters: function () {\n return [{ type: PlatformLocation }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [APP_BASE_HREF]\n }] }];\n } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @description\n *\n * A service that applications can use to interact with a browser's URL.\n *\n * Depending on the `LocationStrategy` used, `Location` persists\n * to the URL's path or the URL's hash segment.\n *\n * @usageNotes\n *\n * It's better to use the `Router.navigate()` service to trigger route changes. Use\n * `Location` only if you need to interact with or create normalized URLs outside of\n * routing.\n *\n * `Location` is responsible for normalizing the URL against the application's base href.\n * A normalized URL is absolute from the URL host, includes the application's base href, and has no\n * trailing slash:\n * - `/my/app/user/123` is normalized\n * - `my/app/user/123` **is not** normalized\n * - `/my/app/user/123/` **is not** normalized\n *\n * ### Example\n *\n * \n *\n * @publicApi\n */\nclass Location {\n constructor(locationStrategy) {\n /** @internal */\n this._subject = new EventEmitter();\n /** @internal */\n this._urlChangeListeners = [];\n /** @internal */\n this._urlChangeSubscription = null;\n this._locationStrategy = locationStrategy;\n const browserBaseHref = this._locationStrategy.getBaseHref();\n this._baseHref = stripTrailingSlash(_stripIndexHtml(browserBaseHref));\n this._locationStrategy.onPopState((ev) => {\n this._subject.emit({\n 'url': this.path(true),\n 'pop': true,\n 'state': ev.state,\n 'type': ev.type,\n });\n });\n }\n /** @nodoc */\n ngOnDestroy() {\n var _a;\n (_a = this._urlChangeSubscription) === null || _a === void 0 ? void 0 : _a.unsubscribe();\n this._urlChangeListeners = [];\n }\n /**\n * Normalizes the URL path for this location.\n *\n * @param includeHash True to include an anchor fragment in the path.\n *\n * @returns The normalized URL path.\n */\n // TODO: vsavkin. Remove the boolean flag and always include hash once the deprecated router is\n // removed.\n path(includeHash = false) {\n return this.normalize(this._locationStrategy.path(includeHash));\n }\n /**\n * Reports the current state of the location history.\n * @returns The current value of the `history.state` object.\n */\n getState() {\n return this._locationStrategy.getState();\n }\n /**\n * Normalizes the given path and compares to the current normalized path.\n *\n * @param path The given URL path.\n * @param query Query parameters.\n *\n * @returns True if the given URL path is equal to the current normalized path, false\n * otherwise.\n */\n isCurrentPathEqualTo(path, query = '') {\n return this.path() == this.normalize(path + normalizeQueryParams(query));\n }\n /**\n * Normalizes a URL path by stripping any trailing slashes.\n *\n * @param url String representing a URL.\n *\n * @returns The normalized URL string.\n */\n normalize(url) {\n return Location.stripTrailingSlash(_stripBaseHref(this._baseHref, _stripIndexHtml(url)));\n }\n /**\n * Normalizes an external URL path.\n * If the given URL doesn't begin with a leading slash (`'/'`), adds one\n * before normalizing. Adds a hash if `HashLocationStrategy` is\n * in use, or the `APP_BASE_HREF` if the `PathLocationStrategy` is in use.\n *\n * @param url String representing a URL.\n *\n * @returns A normalized platform-specific URL.\n */\n prepareExternalUrl(url) {\n if (url && url[0] !== '/') {\n url = '/' + url;\n }\n return this._locationStrategy.prepareExternalUrl(url);\n }\n // TODO: rename this method to pushState\n /**\n * Changes the browser's URL to a normalized version of a given URL, and pushes a\n * new item onto the platform's history.\n *\n * @param path URL path to normalize.\n * @param query Query parameters.\n * @param state Location history state.\n *\n */\n go(path, query = '', state = null) {\n this._locationStrategy.pushState(state, '', path, query);\n this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state);\n }\n /**\n * Changes the browser's URL to a normalized version of the given URL, and replaces\n * the top item on the platform's history stack.\n *\n * @param path URL path to normalize.\n * @param query Query parameters.\n * @param state Location history state.\n */\n replaceState(path, query = '', state = null) {\n this._locationStrategy.replaceState(state, '', path, query);\n this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state);\n }\n /**\n * Navigates forward in the platform's history.\n */\n forward() {\n this._locationStrategy.forward();\n }\n /**\n * Navigates back in the platform's history.\n */\n back() {\n this._locationStrategy.back();\n }\n /**\n * Navigate to a specific page from session history, identified by its relative position to the\n * current page.\n *\n * @param relativePosition Position of the target page in the history relative to the current\n * page.\n * A negative value moves backwards, a positive value moves forwards, e.g. `location.historyGo(2)`\n * moves forward two pages and `location.historyGo(-2)` moves back two pages. When we try to go\n * beyond what's stored in the history session, we stay in the current page. Same behaviour occurs\n * when `relativePosition` equals 0.\n * @see https://developer.mozilla.org/en-US/docs/Web/API/History_API#Moving_to_a_specific_point_in_history\n */\n historyGo(relativePosition = 0) {\n var _a, _b;\n (_b = (_a = this._locationStrategy).historyGo) === null || _b === void 0 ? void 0 : _b.call(_a, relativePosition);\n }\n /**\n * Registers a URL change listener. Use to catch updates performed by the Angular\n * framework that are not detectible through \"popstate\" or \"hashchange\" events.\n *\n * @param fn The change handler function, which take a URL and a location history state.\n * @returns A function that, when executed, unregisters a URL change listener.\n */\n onUrlChange(fn) {\n this._urlChangeListeners.push(fn);\n if (!this._urlChangeSubscription) {\n this._urlChangeSubscription = this.subscribe(v => {\n this._notifyUrlChangeListeners(v.url, v.state);\n });\n }\n return () => {\n var _a;\n const fnIndex = this._urlChangeListeners.indexOf(fn);\n this._urlChangeListeners.splice(fnIndex, 1);\n if (this._urlChangeListeners.length === 0) {\n (_a = this._urlChangeSubscription) === null || _a === void 0 ? void 0 : _a.unsubscribe();\n this._urlChangeSubscription = null;\n }\n };\n }\n /** @internal */\n _notifyUrlChangeListeners(url = '', state) {\n this._urlChangeListeners.forEach(fn => fn(url, state));\n }\n /**\n * Subscribes to the platform's `popState` events.\n *\n * Note: `Location.go()` does not trigger the `popState` event in the browser. Use\n * `Location.onUrlChange()` to subscribe to URL changes instead.\n *\n * @param value Event that is triggered when the state history changes.\n * @param exception The exception to throw.\n *\n * @see [onpopstate](https://developer.mozilla.org/en-US/docs/Web/API/WindowEventHandlers/onpopstate)\n *\n * @returns Subscribed events.\n */\n subscribe(onNext, onThrow, onReturn) {\n return this._subject.subscribe({ next: onNext, error: onThrow, complete: onReturn });\n }\n}\n/**\n * Normalizes URL parameters by prepending with `?` if needed.\n *\n * @param params String of URL parameters.\n *\n * @returns The normalized URL parameters string.\n */\nLocation.normalizeQueryParams = normalizeQueryParams;\n/**\n * Joins two parts of a URL with a slash if needed.\n *\n * @param start URL string\n * @param end URL string\n *\n *\n * @returns The joined URL string.\n */\nLocation.joinWithSlash = joinWithSlash;\n/**\n * Removes a trailing slash from a URL string if needed.\n * Looks for the first occurrence of either `#`, `?`, or the end of the\n * line as `/` characters and removes the trailing slash if one exists.\n *\n * @param url URL string.\n *\n * @returns The URL string, modified if needed.\n */\nLocation.stripTrailingSlash = stripTrailingSlash;\nLocation.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: Location, deps: [{ token: LocationStrategy }], target: i0.ɵɵFactoryTarget.Injectable });\nLocation.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: Location, providedIn: 'root', useFactory: createLocation });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: Location, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'root',\n // See #23917\n useFactory: createLocation,\n }]\n }], ctorParameters: function () { return [{ type: LocationStrategy }]; } });\nfunction createLocation() {\n return new Location(ɵɵinject(LocationStrategy));\n}\nfunction _stripBaseHref(baseHref, url) {\n return baseHref && url.startsWith(baseHref) ? url.substring(baseHref.length) : url;\n}\nfunction _stripIndexHtml(url) {\n return url.replace(/\\/index.html$/, '');\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** @internal */\nconst CURRENCIES_EN = { \"ADP\": [undefined, undefined, 0], \"AFN\": [undefined, \"؋\", 0], \"ALL\": [undefined, undefined, 0], \"AMD\": [undefined, \"֏\", 2], \"AOA\": [undefined, \"Kz\"], \"ARS\": [undefined, \"$\"], \"AUD\": [\"A$\", \"$\"], \"AZN\": [undefined, \"₼\"], \"BAM\": [undefined, \"KM\"], \"BBD\": [undefined, \"$\"], \"BDT\": [undefined, \"৳\"], \"BHD\": [undefined, undefined, 3], \"BIF\": [undefined, undefined, 0], \"BMD\": [undefined, \"$\"], \"BND\": [undefined, \"$\"], \"BOB\": [undefined, \"Bs\"], \"BRL\": [\"R$\"], \"BSD\": [undefined, \"$\"], \"BWP\": [undefined, \"P\"], \"BYN\": [undefined, undefined, 2], \"BYR\": [undefined, undefined, 0], \"BZD\": [undefined, \"$\"], \"CAD\": [\"CA$\", \"$\", 2], \"CHF\": [undefined, undefined, 2], \"CLF\": [undefined, undefined, 4], \"CLP\": [undefined, \"$\", 0], \"CNY\": [\"CN¥\", \"¥\"], \"COP\": [undefined, \"$\", 2], \"CRC\": [undefined, \"₡\", 2], \"CUC\": [undefined, \"$\"], \"CUP\": [undefined, \"$\"], \"CZK\": [undefined, \"Kč\", 2], \"DJF\": [undefined, undefined, 0], \"DKK\": [undefined, \"kr\", 2], \"DOP\": [undefined, \"$\"], \"EGP\": [undefined, \"E£\"], \"ESP\": [undefined, \"₧\", 0], \"EUR\": [\"€\"], \"FJD\": [undefined, \"$\"], \"FKP\": [undefined, \"£\"], \"GBP\": [\"£\"], \"GEL\": [undefined, \"₾\"], \"GHS\": [undefined, \"GH₵\"], \"GIP\": [undefined, \"£\"], \"GNF\": [undefined, \"FG\", 0], \"GTQ\": [undefined, \"Q\"], \"GYD\": [undefined, \"$\", 2], \"HKD\": [\"HK$\", \"$\"], \"HNL\": [undefined, \"L\"], \"HRK\": [undefined, \"kn\"], \"HUF\": [undefined, \"Ft\", 2], \"IDR\": [undefined, \"Rp\", 2], \"ILS\": [\"₪\"], \"INR\": [\"₹\"], \"IQD\": [undefined, undefined, 0], \"IRR\": [undefined, undefined, 0], \"ISK\": [undefined, \"kr\", 0], \"ITL\": [undefined, undefined, 0], \"JMD\": [undefined, \"$\"], \"JOD\": [undefined, undefined, 3], \"JPY\": [\"¥\", undefined, 0], \"KHR\": [undefined, \"៛\"], \"KMF\": [undefined, \"CF\", 0], \"KPW\": [undefined, \"₩\", 0], \"KRW\": [\"₩\", undefined, 0], \"KWD\": [undefined, undefined, 3], \"KYD\": [undefined, \"$\"], \"KZT\": [undefined, \"₸\"], \"LAK\": [undefined, \"₭\", 0], \"LBP\": [undefined, \"L£\", 0], \"LKR\": [undefined, \"Rs\"], \"LRD\": [undefined, \"$\"], \"LTL\": [undefined, \"Lt\"], \"LUF\": [undefined, undefined, 0], \"LVL\": [undefined, \"Ls\"], \"LYD\": [undefined, undefined, 3], \"MGA\": [undefined, \"Ar\", 0], \"MGF\": [undefined, undefined, 0], \"MMK\": [undefined, \"K\", 0], \"MNT\": [undefined, \"₮\", 2], \"MRO\": [undefined, undefined, 0], \"MUR\": [undefined, \"Rs\", 2], \"MXN\": [\"MX$\", \"$\"], \"MYR\": [undefined, \"RM\"], \"NAD\": [undefined, \"$\"], \"NGN\": [undefined, \"₦\"], \"NIO\": [undefined, \"C$\"], \"NOK\": [undefined, \"kr\", 2], \"NPR\": [undefined, \"Rs\"], \"NZD\": [\"NZ$\", \"$\"], \"OMR\": [undefined, undefined, 3], \"PHP\": [\"₱\"], \"PKR\": [undefined, \"Rs\", 2], \"PLN\": [undefined, \"zł\"], \"PYG\": [undefined, \"₲\", 0], \"RON\": [undefined, \"lei\"], \"RSD\": [undefined, undefined, 0], \"RUB\": [undefined, \"₽\"], \"RWF\": [undefined, \"RF\", 0], \"SBD\": [undefined, \"$\"], \"SEK\": [undefined, \"kr\", 2], \"SGD\": [undefined, \"$\"], \"SHP\": [undefined, \"£\"], \"SLE\": [undefined, undefined, 2], \"SLL\": [undefined, undefined, 0], \"SOS\": [undefined, undefined, 0], \"SRD\": [undefined, \"$\"], \"SSP\": [undefined, \"£\"], \"STD\": [undefined, undefined, 0], \"STN\": [undefined, \"Db\"], \"SYP\": [undefined, \"£\", 0], \"THB\": [undefined, \"฿\"], \"TMM\": [undefined, undefined, 0], \"TND\": [undefined, undefined, 3], \"TOP\": [undefined, \"T$\"], \"TRL\": [undefined, undefined, 0], \"TRY\": [undefined, \"₺\"], \"TTD\": [undefined, \"$\"], \"TWD\": [\"NT$\", \"$\", 2], \"TZS\": [undefined, undefined, 2], \"UAH\": [undefined, \"₴\"], \"UGX\": [undefined, undefined, 0], \"USD\": [\"$\"], \"UYI\": [undefined, undefined, 0], \"UYU\": [undefined, \"$\"], \"UYW\": [undefined, undefined, 4], \"UZS\": [undefined, undefined, 2], \"VEF\": [undefined, \"Bs\", 2], \"VND\": [\"₫\", undefined, 0], \"VUV\": [undefined, undefined, 0], \"XAF\": [\"FCFA\", undefined, 0], \"XCD\": [\"EC$\", \"$\"], \"XOF\": [\"F CFA\", undefined, 0], \"XPF\": [\"CFPF\", undefined, 0], \"XXX\": [\"¤\"], \"YER\": [undefined, undefined, 0], \"ZAR\": [undefined, \"R\"], \"ZMK\": [undefined, undefined, 0], \"ZMW\": [undefined, \"ZK\"], \"ZWD\": [undefined, undefined, 0] };\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Format styles that can be used to represent numbers.\n * @see `getLocaleNumberFormat()`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nvar NumberFormatStyle;\n(function (NumberFormatStyle) {\n NumberFormatStyle[NumberFormatStyle[\"Decimal\"] = 0] = \"Decimal\";\n NumberFormatStyle[NumberFormatStyle[\"Percent\"] = 1] = \"Percent\";\n NumberFormatStyle[NumberFormatStyle[\"Currency\"] = 2] = \"Currency\";\n NumberFormatStyle[NumberFormatStyle[\"Scientific\"] = 3] = \"Scientific\";\n})(NumberFormatStyle || (NumberFormatStyle = {}));\n/**\n * Plurality cases used for translating plurals to different languages.\n *\n * @see `NgPlural`\n * @see `NgPluralCase`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nvar Plural;\n(function (Plural) {\n Plural[Plural[\"Zero\"] = 0] = \"Zero\";\n Plural[Plural[\"One\"] = 1] = \"One\";\n Plural[Plural[\"Two\"] = 2] = \"Two\";\n Plural[Plural[\"Few\"] = 3] = \"Few\";\n Plural[Plural[\"Many\"] = 4] = \"Many\";\n Plural[Plural[\"Other\"] = 5] = \"Other\";\n})(Plural || (Plural = {}));\n/**\n * Context-dependant translation forms for strings.\n * Typically the standalone version is for the nominative form of the word,\n * and the format version is used for the genitive case.\n * @see [CLDR website](http://cldr.unicode.org/translation/date-time-1/date-time#TOC-Standalone-vs.-Format-Styles)\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nvar FormStyle;\n(function (FormStyle) {\n FormStyle[FormStyle[\"Format\"] = 0] = \"Format\";\n FormStyle[FormStyle[\"Standalone\"] = 1] = \"Standalone\";\n})(FormStyle || (FormStyle = {}));\n/**\n * String widths available for translations.\n * The specific character widths are locale-specific.\n * Examples are given for the word \"Sunday\" in English.\n *\n * @publicApi\n */\nvar TranslationWidth;\n(function (TranslationWidth) {\n /** 1 character for `en-US`. For example: 'S' */\n TranslationWidth[TranslationWidth[\"Narrow\"] = 0] = \"Narrow\";\n /** 3 characters for `en-US`. For example: 'Sun' */\n TranslationWidth[TranslationWidth[\"Abbreviated\"] = 1] = \"Abbreviated\";\n /** Full length for `en-US`. For example: \"Sunday\" */\n TranslationWidth[TranslationWidth[\"Wide\"] = 2] = \"Wide\";\n /** 2 characters for `en-US`, For example: \"Su\" */\n TranslationWidth[TranslationWidth[\"Short\"] = 3] = \"Short\";\n})(TranslationWidth || (TranslationWidth = {}));\n/**\n * String widths available for date-time formats.\n * The specific character widths are locale-specific.\n * Examples are given for `en-US`.\n *\n * @see `getLocaleDateFormat()`\n * @see `getLocaleTimeFormat()`\n * @see `getLocaleDateTimeFormat()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n * @publicApi\n */\nvar FormatWidth;\n(function (FormatWidth) {\n /**\n * For `en-US`, 'M/d/yy, h:mm a'`\n * (Example: `6/15/15, 9:03 AM`)\n */\n FormatWidth[FormatWidth[\"Short\"] = 0] = \"Short\";\n /**\n * For `en-US`, `'MMM d, y, h:mm:ss a'`\n * (Example: `Jun 15, 2015, 9:03:01 AM`)\n */\n FormatWidth[FormatWidth[\"Medium\"] = 1] = \"Medium\";\n /**\n * For `en-US`, `'MMMM d, y, h:mm:ss a z'`\n * (Example: `June 15, 2015 at 9:03:01 AM GMT+1`)\n */\n FormatWidth[FormatWidth[\"Long\"] = 2] = \"Long\";\n /**\n * For `en-US`, `'EEEE, MMMM d, y, h:mm:ss a zzzz'`\n * (Example: `Monday, June 15, 2015 at 9:03:01 AM GMT+01:00`)\n */\n FormatWidth[FormatWidth[\"Full\"] = 3] = \"Full\";\n})(FormatWidth || (FormatWidth = {}));\n/**\n * Symbols that can be used to replace placeholders in number patterns.\n * Examples are based on `en-US` values.\n *\n * @see `getLocaleNumberSymbol()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nvar NumberSymbol;\n(function (NumberSymbol) {\n /**\n * Decimal separator.\n * For `en-US`, the dot character.\n * Example: 2,345`.`67\n */\n NumberSymbol[NumberSymbol[\"Decimal\"] = 0] = \"Decimal\";\n /**\n * Grouping separator, typically for thousands.\n * For `en-US`, the comma character.\n * Example: 2`,`345.67\n */\n NumberSymbol[NumberSymbol[\"Group\"] = 1] = \"Group\";\n /**\n * List-item separator.\n * Example: \"one, two, and three\"\n */\n NumberSymbol[NumberSymbol[\"List\"] = 2] = \"List\";\n /**\n * Sign for percentage (out of 100).\n * Example: 23.4%\n */\n NumberSymbol[NumberSymbol[\"PercentSign\"] = 3] = \"PercentSign\";\n /**\n * Sign for positive numbers.\n * Example: +23\n */\n NumberSymbol[NumberSymbol[\"PlusSign\"] = 4] = \"PlusSign\";\n /**\n * Sign for negative numbers.\n * Example: -23\n */\n NumberSymbol[NumberSymbol[\"MinusSign\"] = 5] = \"MinusSign\";\n /**\n * Computer notation for exponential value (n times a power of 10).\n * Example: 1.2E3\n */\n NumberSymbol[NumberSymbol[\"Exponential\"] = 6] = \"Exponential\";\n /**\n * Human-readable format of exponential.\n * Example: 1.2x103\n */\n NumberSymbol[NumberSymbol[\"SuperscriptingExponent\"] = 7] = \"SuperscriptingExponent\";\n /**\n * Sign for permille (out of 1000).\n * Example: 23.4‰\n */\n NumberSymbol[NumberSymbol[\"PerMille\"] = 8] = \"PerMille\";\n /**\n * Infinity, can be used with plus and minus.\n * Example: ∞, +∞, -∞\n */\n NumberSymbol[NumberSymbol[\"Infinity\"] = 9] = \"Infinity\";\n /**\n * Not a number.\n * Example: NaN\n */\n NumberSymbol[NumberSymbol[\"NaN\"] = 10] = \"NaN\";\n /**\n * Symbol used between time units.\n * Example: 10:52\n */\n NumberSymbol[NumberSymbol[\"TimeSeparator\"] = 11] = \"TimeSeparator\";\n /**\n * Decimal separator for currency values (fallback to `Decimal`).\n * Example: $2,345.67\n */\n NumberSymbol[NumberSymbol[\"CurrencyDecimal\"] = 12] = \"CurrencyDecimal\";\n /**\n * Group separator for currency values (fallback to `Group`).\n * Example: $2,345.67\n */\n NumberSymbol[NumberSymbol[\"CurrencyGroup\"] = 13] = \"CurrencyGroup\";\n})(NumberSymbol || (NumberSymbol = {}));\n/**\n * The value for each day of the week, based on the `en-US` locale\n *\n * @publicApi\n */\nvar WeekDay;\n(function (WeekDay) {\n WeekDay[WeekDay[\"Sunday\"] = 0] = \"Sunday\";\n WeekDay[WeekDay[\"Monday\"] = 1] = \"Monday\";\n WeekDay[WeekDay[\"Tuesday\"] = 2] = \"Tuesday\";\n WeekDay[WeekDay[\"Wednesday\"] = 3] = \"Wednesday\";\n WeekDay[WeekDay[\"Thursday\"] = 4] = \"Thursday\";\n WeekDay[WeekDay[\"Friday\"] = 5] = \"Friday\";\n WeekDay[WeekDay[\"Saturday\"] = 6] = \"Saturday\";\n})(WeekDay || (WeekDay = {}));\n/**\n * Retrieves the locale ID from the currently loaded locale.\n * The loaded locale could be, for example, a global one rather than a regional one.\n * @param locale A locale code, such as `fr-FR`.\n * @returns The locale code. For example, `fr`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleId(locale) {\n return ɵfindLocaleData(locale)[ɵLocaleDataIndex.LocaleId];\n}\n/**\n * Retrieves day period strings for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized period strings. For example, `[AM, PM]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDayPeriods(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const amPmData = [\n data[ɵLocaleDataIndex.DayPeriodsFormat], data[ɵLocaleDataIndex.DayPeriodsStandalone]\n ];\n const amPm = getLastDefinedValue(amPmData, formStyle);\n return getLastDefinedValue(amPm, width);\n}\n/**\n * Retrieves days of the week for the given locale, using the Gregorian calendar.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized name strings.\n * For example,`[Sunday, Monday, ... Saturday]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDayNames(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const daysData = [data[ɵLocaleDataIndex.DaysFormat], data[ɵLocaleDataIndex.DaysStandalone]];\n const days = getLastDefinedValue(daysData, formStyle);\n return getLastDefinedValue(days, width);\n}\n/**\n * Retrieves months of the year for the given locale, using the Gregorian calendar.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized name strings.\n * For example, `[January, February, ...]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleMonthNames(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const monthsData = [data[ɵLocaleDataIndex.MonthsFormat], data[ɵLocaleDataIndex.MonthsStandalone]];\n const months = getLastDefinedValue(monthsData, formStyle);\n return getLastDefinedValue(months, width);\n}\n/**\n * Retrieves Gregorian-calendar eras for the given locale.\n * @param locale A locale code for the locale format rules to use.\n * @param width The required character width.\n\n * @returns An array of localized era strings.\n * For example, `[AD, BC]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleEraNames(locale, width) {\n const data = ɵfindLocaleData(locale);\n const erasData = data[ɵLocaleDataIndex.Eras];\n return getLastDefinedValue(erasData, width);\n}\n/**\n * Retrieves the first day of the week for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns A day index number, using the 0-based week-day index for `en-US`\n * (Sunday = 0, Monday = 1, ...).\n * For example, for `fr-FR`, returns 1 to indicate that the first day is Monday.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleFirstDayOfWeek(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.FirstDayOfWeek];\n}\n/**\n * Range of week days that are considered the week-end for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The range of day values, `[startDay, endDay]`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleWeekEndRange(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.WeekendRange];\n}\n/**\n * Retrieves a localized date-value formatting string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formatting string.\n * @see `FormatWidth`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDateFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n return getLastDefinedValue(data[ɵLocaleDataIndex.DateFormat], width);\n}\n/**\n * Retrieves a localized time-value formatting string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formatting string.\n * @see `FormatWidth`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n\n * @publicApi\n */\nfunction getLocaleTimeFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n return getLastDefinedValue(data[ɵLocaleDataIndex.TimeFormat], width);\n}\n/**\n * Retrieves a localized date-time formatting string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formatting string.\n * @see `FormatWidth`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDateTimeFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n const dateTimeFormatData = data[ɵLocaleDataIndex.DateTimeFormat];\n return getLastDefinedValue(dateTimeFormatData, width);\n}\n/**\n * Retrieves a localized number symbol that can be used to replace placeholders in number formats.\n * @param locale The locale code.\n * @param symbol The symbol to localize.\n * @returns The character for the localized symbol.\n * @see `NumberSymbol`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleNumberSymbol(locale, symbol) {\n const data = ɵfindLocaleData(locale);\n const res = data[ɵLocaleDataIndex.NumberSymbols][symbol];\n if (typeof res === 'undefined') {\n if (symbol === NumberSymbol.CurrencyDecimal) {\n return data[ɵLocaleDataIndex.NumberSymbols][NumberSymbol.Decimal];\n }\n else if (symbol === NumberSymbol.CurrencyGroup) {\n return data[ɵLocaleDataIndex.NumberSymbols][NumberSymbol.Group];\n }\n }\n return res;\n}\n/**\n * Retrieves a number format for a given locale.\n *\n * Numbers are formatted using patterns, like `#,###.00`. For example, the pattern `#,###.00`\n * when used to format the number 12345.678 could result in \"12'345,678\". That would happen if the\n * grouping separator for your language is an apostrophe, and the decimal separator is a comma.\n *\n * Important: The characters `.` `,` `0` `#` (and others below) are special placeholders\n * that stand for the decimal separator, and so on, and are NOT real characters.\n * You must NOT \"translate\" the placeholders. For example, don't change `.` to `,` even though in\n * your language the decimal point is written with a comma. The symbols should be replaced by the\n * local equivalents, using the appropriate `NumberSymbol` for your language.\n *\n * Here are the special characters used in number patterns:\n *\n * | Symbol | Meaning |\n * |--------|---------|\n * | . | Replaced automatically by the character used for the decimal point. |\n * | , | Replaced by the \"grouping\" (thousands) separator. |\n * | 0 | Replaced by a digit (or zero if there aren't enough digits). |\n * | # | Replaced by a digit (or nothing if there aren't enough). |\n * | ¤ | Replaced by a currency symbol, such as $ or USD. |\n * | % | Marks a percent format. The % symbol may change position, but must be retained. |\n * | E | Marks a scientific format. The E symbol may change position, but must be retained. |\n * | ' | Special characters used as literal characters are quoted with ASCII single quotes. |\n *\n * @param locale A locale code for the locale format rules to use.\n * @param type The type of numeric value to be formatted (such as `Decimal` or `Currency`.)\n * @returns The localized format string.\n * @see `NumberFormatStyle`\n * @see [CLDR website](http://cldr.unicode.org/translation/number-patterns)\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleNumberFormat(locale, type) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.NumberFormats][type];\n}\n/**\n * Retrieves the symbol used to represent the currency for the main country\n * corresponding to a given locale. For example, '$' for `en-US`.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The localized symbol character,\n * or `null` if the main country cannot be determined.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleCurrencySymbol(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.CurrencySymbol] || null;\n}\n/**\n * Retrieves the name of the currency for the main country corresponding\n * to a given locale. For example, 'US Dollar' for `en-US`.\n * @param locale A locale code for the locale format rules to use.\n * @returns The currency name,\n * or `null` if the main country cannot be determined.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleCurrencyName(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.CurrencyName] || null;\n}\n/**\n * Retrieves the default currency code for the given locale.\n *\n * The default is defined as the first currency which is still in use.\n *\n * @param locale The code of the locale whose currency code we want.\n * @returns The code of the default currency for the given locale.\n *\n * @publicApi\n */\nfunction getLocaleCurrencyCode(locale) {\n return ɵgetLocaleCurrencyCode(locale);\n}\n/**\n * Retrieves the currency values for a given locale.\n * @param locale A locale code for the locale format rules to use.\n * @returns The currency values.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n */\nfunction getLocaleCurrencies(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.Currencies];\n}\n/**\n * @alias core/ɵgetLocalePluralCase\n * @publicApi\n */\nconst getLocalePluralCase = ɵgetLocalePluralCase;\nfunction checkFullData(data) {\n if (!data[ɵLocaleDataIndex.ExtraData]) {\n throw new Error(`Missing extra locale data for the locale \"${data[ɵLocaleDataIndex\n .LocaleId]}\". Use \"registerLocaleData\" to load new data. See the \"I18n guide\" on angular.io to know more.`);\n }\n}\n/**\n * Retrieves locale-specific rules used to determine which day period to use\n * when more than one period is defined for a locale.\n *\n * There is a rule for each defined day period. The\n * first rule is applied to the first day period and so on.\n * Fall back to AM/PM when no rules are available.\n *\n * A rule can specify a period as time range, or as a single time value.\n *\n * This functionality is only available when you have loaded the full locale data.\n * See the [\"I18n guide\"](guide/i18n-common-format-data-locale).\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The rules for the locale, a single time value or array of *from-time, to-time*,\n * or null if no periods are available.\n *\n * @see `getLocaleExtraDayPeriods()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleExtraDayPeriodRules(locale) {\n const data = ɵfindLocaleData(locale);\n checkFullData(data);\n const rules = data[ɵLocaleDataIndex.ExtraData][2 /* ɵExtraLocaleDataIndex.ExtraDayPeriodsRules */] || [];\n return rules.map((rule) => {\n if (typeof rule === 'string') {\n return extractTime(rule);\n }\n return [extractTime(rule[0]), extractTime(rule[1])];\n });\n}\n/**\n * Retrieves locale-specific day periods, which indicate roughly how a day is broken up\n * in different languages.\n * For example, for `en-US`, periods are morning, noon, afternoon, evening, and midnight.\n *\n * This functionality is only available when you have loaded the full locale data.\n * See the [\"I18n guide\"](guide/i18n-common-format-data-locale).\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns The translated day-period strings.\n * @see `getLocaleExtraDayPeriodRules()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleExtraDayPeriods(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n checkFullData(data);\n const dayPeriodsData = [\n data[ɵLocaleDataIndex.ExtraData][0 /* ɵExtraLocaleDataIndex.ExtraDayPeriodFormats */],\n data[ɵLocaleDataIndex.ExtraData][1 /* ɵExtraLocaleDataIndex.ExtraDayPeriodStandalone */]\n ];\n const dayPeriods = getLastDefinedValue(dayPeriodsData, formStyle) || [];\n return getLastDefinedValue(dayPeriods, width) || [];\n}\n/**\n * Retrieves the writing direction of a specified locale\n * @param locale A locale code for the locale format rules to use.\n * @publicApi\n * @returns 'rtl' or 'ltr'\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n */\nfunction getLocaleDirection(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.Directionality];\n}\n/**\n * Retrieves the first value that is defined in an array, going backwards from an index position.\n *\n * To avoid repeating the same data (as when the \"format\" and \"standalone\" forms are the same)\n * add the first value to the locale data arrays, and add other values only if they are different.\n *\n * @param data The data array to retrieve from.\n * @param index A 0-based index into the array to start from.\n * @returns The value immediately before the given index position.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLastDefinedValue(data, index) {\n for (let i = index; i > -1; i--) {\n if (typeof data[i] !== 'undefined') {\n return data[i];\n }\n }\n throw new Error('Locale data API: locale data undefined');\n}\n/**\n * Extracts the hours and minutes from a string like \"15:45\"\n */\nfunction extractTime(time) {\n const [h, m] = time.split(':');\n return { hours: +h, minutes: +m };\n}\n/**\n * Retrieves the currency symbol for a given currency code.\n *\n * For example, for the default `en-US` locale, the code `USD` can\n * be represented by the narrow symbol `$` or the wide symbol `US$`.\n *\n * @param code The currency code.\n * @param format The format, `wide` or `narrow`.\n * @param locale A locale code for the locale format rules to use.\n *\n * @returns The symbol, or the currency code if no symbol is available.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getCurrencySymbol(code, format, locale = 'en') {\n const currency = getLocaleCurrencies(locale)[code] || CURRENCIES_EN[code] || [];\n const symbolNarrow = currency[1 /* ɵCurrencyIndex.SymbolNarrow */];\n if (format === 'narrow' && typeof symbolNarrow === 'string') {\n return symbolNarrow;\n }\n return currency[0 /* ɵCurrencyIndex.Symbol */] || code;\n}\n// Most currencies have cents, that's why the default is 2\nconst DEFAULT_NB_OF_CURRENCY_DIGITS = 2;\n/**\n * Reports the number of decimal digits for a given currency.\n * The value depends upon the presence of cents in that particular currency.\n *\n * @param code The currency code.\n * @returns The number of decimal digits, typically 0 or 2.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getNumberOfCurrencyDigits(code) {\n let digits;\n const currency = CURRENCIES_EN[code];\n if (currency) {\n digits = currency[2 /* ɵCurrencyIndex.NbOfDigits */];\n }\n return typeof digits === 'number' ? digits : DEFAULT_NB_OF_CURRENCY_DIGITS;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst ISO8601_DATE_REGEX = /^(\\d{4,})-?(\\d\\d)-?(\\d\\d)(?:T(\\d\\d)(?::?(\\d\\d)(?::?(\\d\\d)(?:\\.(\\d+))?)?)?(Z|([+-])(\\d\\d):?(\\d\\d))?)?$/;\n// 1 2 3 4 5 6 7 8 9 10 11\nconst NAMED_FORMATS = {};\nconst DATE_FORMATS_SPLIT = /((?:[^BEGHLMOSWYZabcdhmswyz']+)|(?:'(?:[^']|'')*')|(?:G{1,5}|y{1,4}|Y{1,4}|M{1,5}|L{1,5}|w{1,2}|W{1}|d{1,2}|E{1,6}|c{1,6}|a{1,5}|b{1,5}|B{1,5}|h{1,2}|H{1,2}|m{1,2}|s{1,2}|S{1,3}|z{1,4}|Z{1,5}|O{1,4}))([\\s\\S]*)/;\nvar ZoneWidth;\n(function (ZoneWidth) {\n ZoneWidth[ZoneWidth[\"Short\"] = 0] = \"Short\";\n ZoneWidth[ZoneWidth[\"ShortGMT\"] = 1] = \"ShortGMT\";\n ZoneWidth[ZoneWidth[\"Long\"] = 2] = \"Long\";\n ZoneWidth[ZoneWidth[\"Extended\"] = 3] = \"Extended\";\n})(ZoneWidth || (ZoneWidth = {}));\nvar DateType;\n(function (DateType) {\n DateType[DateType[\"FullYear\"] = 0] = \"FullYear\";\n DateType[DateType[\"Month\"] = 1] = \"Month\";\n DateType[DateType[\"Date\"] = 2] = \"Date\";\n DateType[DateType[\"Hours\"] = 3] = \"Hours\";\n DateType[DateType[\"Minutes\"] = 4] = \"Minutes\";\n DateType[DateType[\"Seconds\"] = 5] = \"Seconds\";\n DateType[DateType[\"FractionalSeconds\"] = 6] = \"FractionalSeconds\";\n DateType[DateType[\"Day\"] = 7] = \"Day\";\n})(DateType || (DateType = {}));\nvar TranslationType;\n(function (TranslationType) {\n TranslationType[TranslationType[\"DayPeriods\"] = 0] = \"DayPeriods\";\n TranslationType[TranslationType[\"Days\"] = 1] = \"Days\";\n TranslationType[TranslationType[\"Months\"] = 2] = \"Months\";\n TranslationType[TranslationType[\"Eras\"] = 3] = \"Eras\";\n})(TranslationType || (TranslationType = {}));\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a date according to locale rules.\n *\n * @param value The date to format, as a Date, or a number (milliseconds since UTC epoch)\n * or an [ISO date-time string](https://www.w3.org/TR/NOTE-datetime).\n * @param format The date-time components to include. See `DatePipe` for details.\n * @param locale A locale code for the locale format rules to use.\n * @param timezone The time zone. A time zone offset from GMT (such as `'+0430'`),\n * or a standard UTC/GMT or continental US time zone abbreviation.\n * If not specified, uses host system settings.\n *\n * @returns The formatted date string.\n *\n * @see `DatePipe`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction formatDate(value, format, locale, timezone) {\n let date = toDate(value);\n const namedFormat = getNamedFormat(locale, format);\n format = namedFormat || format;\n let parts = [];\n let match;\n while (format) {\n match = DATE_FORMATS_SPLIT.exec(format);\n if (match) {\n parts = parts.concat(match.slice(1));\n const part = parts.pop();\n if (!part) {\n break;\n }\n format = part;\n }\n else {\n parts.push(format);\n break;\n }\n }\n let dateTimezoneOffset = date.getTimezoneOffset();\n if (timezone) {\n dateTimezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);\n date = convertTimezoneToLocal(date, timezone, true);\n }\n let text = '';\n parts.forEach(value => {\n const dateFormatter = getDateFormatter(value);\n text += dateFormatter ? dateFormatter(date, locale, dateTimezoneOffset) :\n value === '\\'\\'' ? '\\'' :\n value.replace(/(^'|'$)/g, '').replace(/''/g, '\\'');\n });\n return text;\n}\n/**\n * Create a new Date object with the given date value, and the time set to midnight.\n *\n * We cannot use `new Date(year, month, date)` because it maps years between 0 and 99 to 1900-1999.\n * See: https://github.com/angular/angular/issues/40377\n *\n * Note that this function returns a Date object whose time is midnight in the current locale's\n * timezone. In the future we might want to change this to be midnight in UTC, but this would be a\n * considerable breaking change.\n */\nfunction createDate(year, month, date) {\n // The `newDate` is set to midnight (UTC) on January 1st 1970.\n // - In PST this will be December 31st 1969 at 4pm.\n // - In GMT this will be January 1st 1970 at 1am.\n // Note that they even have different years, dates and months!\n const newDate = new Date(0);\n // `setFullYear()` allows years like 0001 to be set correctly. This function does not\n // change the internal time of the date.\n // Consider calling `setFullYear(2019, 8, 20)` (September 20, 2019).\n // - In PST this will now be September 20, 2019 at 4pm\n // - In GMT this will now be September 20, 2019 at 1am\n newDate.setFullYear(year, month, date);\n // We want the final date to be at local midnight, so we reset the time.\n // - In PST this will now be September 20, 2019 at 12am\n // - In GMT this will now be September 20, 2019 at 12am\n newDate.setHours(0, 0, 0);\n return newDate;\n}\nfunction getNamedFormat(locale, format) {\n const localeId = getLocaleId(locale);\n NAMED_FORMATS[localeId] = NAMED_FORMATS[localeId] || {};\n if (NAMED_FORMATS[localeId][format]) {\n return NAMED_FORMATS[localeId][format];\n }\n let formatValue = '';\n switch (format) {\n case 'shortDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Short);\n break;\n case 'mediumDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Medium);\n break;\n case 'longDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Long);\n break;\n case 'fullDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Full);\n break;\n case 'shortTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Short);\n break;\n case 'mediumTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Medium);\n break;\n case 'longTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Long);\n break;\n case 'fullTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Full);\n break;\n case 'short':\n const shortTime = getNamedFormat(locale, 'shortTime');\n const shortDate = getNamedFormat(locale, 'shortDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Short), [shortTime, shortDate]);\n break;\n case 'medium':\n const mediumTime = getNamedFormat(locale, 'mediumTime');\n const mediumDate = getNamedFormat(locale, 'mediumDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Medium), [mediumTime, mediumDate]);\n break;\n case 'long':\n const longTime = getNamedFormat(locale, 'longTime');\n const longDate = getNamedFormat(locale, 'longDate');\n formatValue =\n formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Long), [longTime, longDate]);\n break;\n case 'full':\n const fullTime = getNamedFormat(locale, 'fullTime');\n const fullDate = getNamedFormat(locale, 'fullDate');\n formatValue =\n formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Full), [fullTime, fullDate]);\n break;\n }\n if (formatValue) {\n NAMED_FORMATS[localeId][format] = formatValue;\n }\n return formatValue;\n}\nfunction formatDateTime(str, opt_values) {\n if (opt_values) {\n str = str.replace(/\\{([^}]+)}/g, function (match, key) {\n return (opt_values != null && key in opt_values) ? opt_values[key] : match;\n });\n }\n return str;\n}\nfunction padNumber(num, digits, minusSign = '-', trim, negWrap) {\n let neg = '';\n if (num < 0 || (negWrap && num <= 0)) {\n if (negWrap) {\n num = -num + 1;\n }\n else {\n num = -num;\n neg = minusSign;\n }\n }\n let strNum = String(num);\n while (strNum.length < digits) {\n strNum = '0' + strNum;\n }\n if (trim) {\n strNum = strNum.slice(strNum.length - digits);\n }\n return neg + strNum;\n}\nfunction formatFractionalSeconds(milliseconds, digits) {\n const strMs = padNumber(milliseconds, 3);\n return strMs.substring(0, digits);\n}\n/**\n * Returns a date formatter that transforms a date into its locale digit representation\n */\nfunction dateGetter(name, size, offset = 0, trim = false, negWrap = false) {\n return function (date, locale) {\n let part = getDatePart(name, date);\n if (offset > 0 || part > -offset) {\n part += offset;\n }\n if (name === DateType.Hours) {\n if (part === 0 && offset === -12) {\n part = 12;\n }\n }\n else if (name === DateType.FractionalSeconds) {\n return formatFractionalSeconds(part, size);\n }\n const localeMinus = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);\n return padNumber(part, size, localeMinus, trim, negWrap);\n };\n}\nfunction getDatePart(part, date) {\n switch (part) {\n case DateType.FullYear:\n return date.getFullYear();\n case DateType.Month:\n return date.getMonth();\n case DateType.Date:\n return date.getDate();\n case DateType.Hours:\n return date.getHours();\n case DateType.Minutes:\n return date.getMinutes();\n case DateType.Seconds:\n return date.getSeconds();\n case DateType.FractionalSeconds:\n return date.getMilliseconds();\n case DateType.Day:\n return date.getDay();\n default:\n throw new Error(`Unknown DateType value \"${part}\".`);\n }\n}\n/**\n * Returns a date formatter that transforms a date into its locale string representation\n */\nfunction dateStrGetter(name, width, form = FormStyle.Format, extended = false) {\n return function (date, locale) {\n return getDateTranslation(date, locale, name, width, form, extended);\n };\n}\n/**\n * Returns the locale translation of a date for a given form, type and width\n */\nfunction getDateTranslation(date, locale, name, width, form, extended) {\n switch (name) {\n case TranslationType.Months:\n return getLocaleMonthNames(locale, form, width)[date.getMonth()];\n case TranslationType.Days:\n return getLocaleDayNames(locale, form, width)[date.getDay()];\n case TranslationType.DayPeriods:\n const currentHours = date.getHours();\n const currentMinutes = date.getMinutes();\n if (extended) {\n const rules = getLocaleExtraDayPeriodRules(locale);\n const dayPeriods = getLocaleExtraDayPeriods(locale, form, width);\n const index = rules.findIndex(rule => {\n if (Array.isArray(rule)) {\n // morning, afternoon, evening, night\n const [from, to] = rule;\n const afterFrom = currentHours >= from.hours && currentMinutes >= from.minutes;\n const beforeTo = (currentHours < to.hours ||\n (currentHours === to.hours && currentMinutes < to.minutes));\n // We must account for normal rules that span a period during the day (e.g. 6am-9am)\n // where `from` is less (earlier) than `to`. But also rules that span midnight (e.g.\n // 10pm - 5am) where `from` is greater (later!) than `to`.\n //\n // In the first case the current time must be BOTH after `from` AND before `to`\n // (e.g. 8am is after 6am AND before 10am).\n //\n // In the second case the current time must be EITHER after `from` OR before `to`\n // (e.g. 4am is before 5am but not after 10pm; and 11pm is not before 5am but it is\n // after 10pm).\n if (from.hours < to.hours) {\n if (afterFrom && beforeTo) {\n return true;\n }\n }\n else if (afterFrom || beforeTo) {\n return true;\n }\n }\n else { // noon or midnight\n if (rule.hours === currentHours && rule.minutes === currentMinutes) {\n return true;\n }\n }\n return false;\n });\n if (index !== -1) {\n return dayPeriods[index];\n }\n }\n // if no rules for the day periods, we use am/pm by default\n return getLocaleDayPeriods(locale, form, width)[currentHours < 12 ? 0 : 1];\n case TranslationType.Eras:\n return getLocaleEraNames(locale, width)[date.getFullYear() <= 0 ? 0 : 1];\n default:\n // This default case is not needed by TypeScript compiler, as the switch is exhaustive.\n // However Closure Compiler does not understand that and reports an error in typed mode.\n // The `throw new Error` below works around the problem, and the unexpected: never variable\n // makes sure tsc still checks this code is unreachable.\n const unexpected = name;\n throw new Error(`unexpected translation type ${unexpected}`);\n }\n}\n/**\n * Returns a date formatter that transforms a date and an offset into a timezone with ISO8601 or\n * GMT format depending on the width (eg: short = +0430, short:GMT = GMT+4, long = GMT+04:30,\n * extended = +04:30)\n */\nfunction timeZoneGetter(width) {\n return function (date, locale, offset) {\n const zone = -1 * offset;\n const minusSign = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);\n const hours = zone > 0 ? Math.floor(zone / 60) : Math.ceil(zone / 60);\n switch (width) {\n case ZoneWidth.Short:\n return ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) +\n padNumber(Math.abs(zone % 60), 2, minusSign);\n case ZoneWidth.ShortGMT:\n return 'GMT' + ((zone >= 0) ? '+' : '') + padNumber(hours, 1, minusSign);\n case ZoneWidth.Long:\n return 'GMT' + ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) + ':' +\n padNumber(Math.abs(zone % 60), 2, minusSign);\n case ZoneWidth.Extended:\n if (offset === 0) {\n return 'Z';\n }\n else {\n return ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) + ':' +\n padNumber(Math.abs(zone % 60), 2, minusSign);\n }\n default:\n throw new Error(`Unknown zone width \"${width}\"`);\n }\n };\n}\nconst JANUARY = 0;\nconst THURSDAY = 4;\nfunction getFirstThursdayOfYear(year) {\n const firstDayOfYear = createDate(year, JANUARY, 1).getDay();\n return createDate(year, 0, 1 + ((firstDayOfYear <= THURSDAY) ? THURSDAY : THURSDAY + 7) - firstDayOfYear);\n}\nfunction getThursdayThisWeek(datetime) {\n return createDate(datetime.getFullYear(), datetime.getMonth(), datetime.getDate() + (THURSDAY - datetime.getDay()));\n}\nfunction weekGetter(size, monthBased = false) {\n return function (date, locale) {\n let result;\n if (monthBased) {\n const nbDaysBefore1stDayOfMonth = new Date(date.getFullYear(), date.getMonth(), 1).getDay() - 1;\n const today = date.getDate();\n result = 1 + Math.floor((today + nbDaysBefore1stDayOfMonth) / 7);\n }\n else {\n const thisThurs = getThursdayThisWeek(date);\n // Some days of a year are part of next year according to ISO 8601.\n // Compute the firstThurs from the year of this week's Thursday\n const firstThurs = getFirstThursdayOfYear(thisThurs.getFullYear());\n const diff = thisThurs.getTime() - firstThurs.getTime();\n result = 1 + Math.round(diff / 6.048e8); // 6.048e8 ms per week\n }\n return padNumber(result, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n };\n}\n/**\n * Returns a date formatter that provides the week-numbering year for the input date.\n */\nfunction weekNumberingYearGetter(size, trim = false) {\n return function (date, locale) {\n const thisThurs = getThursdayThisWeek(date);\n const weekNumberingYear = thisThurs.getFullYear();\n return padNumber(weekNumberingYear, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign), trim);\n };\n}\nconst DATE_FORMATS = {};\n// Based on CLDR formats:\n// See complete list: http://www.unicode.org/reports/tr35/tr35-dates.html#Date_Field_Symbol_Table\n// See also explanations: http://cldr.unicode.org/translation/date-time\n// TODO(ocombe): support all missing cldr formats: U, Q, D, F, e, j, J, C, A, v, V, X, x\nfunction getDateFormatter(format) {\n if (DATE_FORMATS[format]) {\n return DATE_FORMATS[format];\n }\n let formatter;\n switch (format) {\n // Era name (AD/BC)\n case 'G':\n case 'GG':\n case 'GGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Abbreviated);\n break;\n case 'GGGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Wide);\n break;\n case 'GGGGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Narrow);\n break;\n // 1 digit representation of the year, e.g. (AD 1 => 1, AD 199 => 199)\n case 'y':\n formatter = dateGetter(DateType.FullYear, 1, 0, false, true);\n break;\n // 2 digit representation of the year, padded (00-99). (e.g. AD 2001 => 01, AD 2010 => 10)\n case 'yy':\n formatter = dateGetter(DateType.FullYear, 2, 0, true, true);\n break;\n // 3 digit representation of the year, padded (000-999). (e.g. AD 2001 => 01, AD 2010 => 10)\n case 'yyy':\n formatter = dateGetter(DateType.FullYear, 3, 0, false, true);\n break;\n // 4 digit representation of the year (e.g. AD 1 => 0001, AD 2010 => 2010)\n case 'yyyy':\n formatter = dateGetter(DateType.FullYear, 4, 0, false, true);\n break;\n // 1 digit representation of the week-numbering year, e.g. (AD 1 => 1, AD 199 => 199)\n case 'Y':\n formatter = weekNumberingYearGetter(1);\n break;\n // 2 digit representation of the week-numbering year, padded (00-99). (e.g. AD 2001 => 01, AD\n // 2010 => 10)\n case 'YY':\n formatter = weekNumberingYearGetter(2, true);\n break;\n // 3 digit representation of the week-numbering year, padded (000-999). (e.g. AD 1 => 001, AD\n // 2010 => 2010)\n case 'YYY':\n formatter = weekNumberingYearGetter(3);\n break;\n // 4 digit representation of the week-numbering year (e.g. AD 1 => 0001, AD 2010 => 2010)\n case 'YYYY':\n formatter = weekNumberingYearGetter(4);\n break;\n // Month of the year (1-12), numeric\n case 'M':\n case 'L':\n formatter = dateGetter(DateType.Month, 1, 1);\n break;\n case 'MM':\n case 'LL':\n formatter = dateGetter(DateType.Month, 2, 1);\n break;\n // Month of the year (January, ...), string, format\n case 'MMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Abbreviated);\n break;\n case 'MMMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Wide);\n break;\n case 'MMMMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Narrow);\n break;\n // Month of the year (January, ...), string, standalone\n case 'LLL':\n formatter =\n dateStrGetter(TranslationType.Months, TranslationWidth.Abbreviated, FormStyle.Standalone);\n break;\n case 'LLLL':\n formatter =\n dateStrGetter(TranslationType.Months, TranslationWidth.Wide, FormStyle.Standalone);\n break;\n case 'LLLLL':\n formatter =\n dateStrGetter(TranslationType.Months, TranslationWidth.Narrow, FormStyle.Standalone);\n break;\n // Week of the year (1, ... 52)\n case 'w':\n formatter = weekGetter(1);\n break;\n case 'ww':\n formatter = weekGetter(2);\n break;\n // Week of the month (1, ...)\n case 'W':\n formatter = weekGetter(1, true);\n break;\n // Day of the month (1-31)\n case 'd':\n formatter = dateGetter(DateType.Date, 1);\n break;\n case 'dd':\n formatter = dateGetter(DateType.Date, 2);\n break;\n // Day of the Week StandAlone (1, 1, Mon, Monday, M, Mo)\n case 'c':\n case 'cc':\n formatter = dateGetter(DateType.Day, 1);\n break;\n case 'ccc':\n formatter =\n dateStrGetter(TranslationType.Days, TranslationWidth.Abbreviated, FormStyle.Standalone);\n break;\n case 'cccc':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Wide, FormStyle.Standalone);\n break;\n case 'ccccc':\n formatter =\n dateStrGetter(TranslationType.Days, TranslationWidth.Narrow, FormStyle.Standalone);\n break;\n case 'cccccc':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Short, FormStyle.Standalone);\n break;\n // Day of the Week\n case 'E':\n case 'EE':\n case 'EEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Abbreviated);\n break;\n case 'EEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Wide);\n break;\n case 'EEEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Narrow);\n break;\n case 'EEEEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Short);\n break;\n // Generic period of the day (am-pm)\n case 'a':\n case 'aa':\n case 'aaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated);\n break;\n case 'aaaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide);\n break;\n case 'aaaaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow);\n break;\n // Extended period of the day (midnight, at night, ...), standalone\n case 'b':\n case 'bb':\n case 'bbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated, FormStyle.Standalone, true);\n break;\n case 'bbbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide, FormStyle.Standalone, true);\n break;\n case 'bbbbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow, FormStyle.Standalone, true);\n break;\n // Extended period of the day (midnight, night, ...), standalone\n case 'B':\n case 'BB':\n case 'BBB':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated, FormStyle.Format, true);\n break;\n case 'BBBB':\n formatter =\n dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide, FormStyle.Format, true);\n break;\n case 'BBBBB':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow, FormStyle.Format, true);\n break;\n // Hour in AM/PM, (1-12)\n case 'h':\n formatter = dateGetter(DateType.Hours, 1, -12);\n break;\n case 'hh':\n formatter = dateGetter(DateType.Hours, 2, -12);\n break;\n // Hour of the day (0-23)\n case 'H':\n formatter = dateGetter(DateType.Hours, 1);\n break;\n // Hour in day, padded (00-23)\n case 'HH':\n formatter = dateGetter(DateType.Hours, 2);\n break;\n // Minute of the hour (0-59)\n case 'm':\n formatter = dateGetter(DateType.Minutes, 1);\n break;\n case 'mm':\n formatter = dateGetter(DateType.Minutes, 2);\n break;\n // Second of the minute (0-59)\n case 's':\n formatter = dateGetter(DateType.Seconds, 1);\n break;\n case 'ss':\n formatter = dateGetter(DateType.Seconds, 2);\n break;\n // Fractional second\n case 'S':\n formatter = dateGetter(DateType.FractionalSeconds, 1);\n break;\n case 'SS':\n formatter = dateGetter(DateType.FractionalSeconds, 2);\n break;\n case 'SSS':\n formatter = dateGetter(DateType.FractionalSeconds, 3);\n break;\n // Timezone ISO8601 short format (-0430)\n case 'Z':\n case 'ZZ':\n case 'ZZZ':\n formatter = timeZoneGetter(ZoneWidth.Short);\n break;\n // Timezone ISO8601 extended format (-04:30)\n case 'ZZZZZ':\n formatter = timeZoneGetter(ZoneWidth.Extended);\n break;\n // Timezone GMT short format (GMT+4)\n case 'O':\n case 'OO':\n case 'OOO':\n // Should be location, but fallback to format O instead because we don't have the data yet\n case 'z':\n case 'zz':\n case 'zzz':\n formatter = timeZoneGetter(ZoneWidth.ShortGMT);\n break;\n // Timezone GMT long format (GMT+0430)\n case 'OOOO':\n case 'ZZZZ':\n // Should be location, but fallback to format O instead because we don't have the data yet\n case 'zzzz':\n formatter = timeZoneGetter(ZoneWidth.Long);\n break;\n default:\n return null;\n }\n DATE_FORMATS[format] = formatter;\n return formatter;\n}\nfunction timezoneToOffset(timezone, fallback) {\n // Support: IE 11 only, Edge 13-15+\n // IE/Edge do not \"understand\" colon (`:`) in timezone\n timezone = timezone.replace(/:/g, '');\n const requestedTimezoneOffset = Date.parse('Jan 01, 1970 00:00:00 ' + timezone) / 60000;\n return isNaN(requestedTimezoneOffset) ? fallback : requestedTimezoneOffset;\n}\nfunction addDateMinutes(date, minutes) {\n date = new Date(date.getTime());\n date.setMinutes(date.getMinutes() + minutes);\n return date;\n}\nfunction convertTimezoneToLocal(date, timezone, reverse) {\n const reverseValue = reverse ? -1 : 1;\n const dateTimezoneOffset = date.getTimezoneOffset();\n const timezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);\n return addDateMinutes(date, reverseValue * (timezoneOffset - dateTimezoneOffset));\n}\n/**\n * Converts a value to date.\n *\n * Supported input formats:\n * - `Date`\n * - number: timestamp\n * - string: numeric (e.g. \"1234\"), ISO and date strings in a format supported by\n * [Date.parse()](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Date/parse).\n * Note: ISO strings without time return a date without timeoffset.\n *\n * Throws if unable to convert to a date.\n */\nfunction toDate(value) {\n if (isDate(value)) {\n return value;\n }\n if (typeof value === 'number' && !isNaN(value)) {\n return new Date(value);\n }\n if (typeof value === 'string') {\n value = value.trim();\n if (/^(\\d{4}(-\\d{1,2}(-\\d{1,2})?)?)$/.test(value)) {\n /* For ISO Strings without time the day, month and year must be extracted from the ISO String\n before Date creation to avoid time offset and errors in the new Date.\n If we only replace '-' with ',' in the ISO String (\"2015,01,01\"), and try to create a new\n date, some browsers (e.g. IE 9) will throw an invalid Date error.\n If we leave the '-' (\"2015-01-01\") and try to create a new Date(\"2015-01-01\") the timeoffset\n is applied.\n Note: ISO months are 0 for January, 1 for February, ... */\n const [y, m = 1, d = 1] = value.split('-').map((val) => +val);\n return createDate(y, m - 1, d);\n }\n const parsedNb = parseFloat(value);\n // any string that only contains numbers, like \"1234\" but not like \"1234hello\"\n if (!isNaN(value - parsedNb)) {\n return new Date(parsedNb);\n }\n let match;\n if (match = value.match(ISO8601_DATE_REGEX)) {\n return isoStringToDate(match);\n }\n }\n const date = new Date(value);\n if (!isDate(date)) {\n throw new Error(`Unable to convert \"${value}\" into a date`);\n }\n return date;\n}\n/**\n * Converts a date in ISO8601 to a Date.\n * Used instead of `Date.parse` because of browser discrepancies.\n */\nfunction isoStringToDate(match) {\n const date = new Date(0);\n let tzHour = 0;\n let tzMin = 0;\n // match[8] means that the string contains \"Z\" (UTC) or a timezone like \"+01:00\" or \"+0100\"\n const dateSetter = match[8] ? date.setUTCFullYear : date.setFullYear;\n const timeSetter = match[8] ? date.setUTCHours : date.setHours;\n // if there is a timezone defined like \"+01:00\" or \"+0100\"\n if (match[9]) {\n tzHour = Number(match[9] + match[10]);\n tzMin = Number(match[9] + match[11]);\n }\n dateSetter.call(date, Number(match[1]), Number(match[2]) - 1, Number(match[3]));\n const h = Number(match[4] || 0) - tzHour;\n const m = Number(match[5] || 0) - tzMin;\n const s = Number(match[6] || 0);\n // The ECMAScript specification (https://www.ecma-international.org/ecma-262/5.1/#sec-15.9.1.11)\n // defines that `DateTime` milliseconds should always be rounded down, so that `999.9ms`\n // becomes `999ms`.\n const ms = Math.floor(parseFloat('0.' + (match[7] || 0)) * 1000);\n timeSetter.call(date, h, m, s, ms);\n return date;\n}\nfunction isDate(value) {\n return value instanceof Date && !isNaN(value.valueOf());\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst NUMBER_FORMAT_REGEXP = /^(\\d+)?\\.((\\d+)(-(\\d+))?)?$/;\nconst MAX_DIGITS = 22;\nconst DECIMAL_SEP = '.';\nconst ZERO_CHAR = '0';\nconst PATTERN_SEP = ';';\nconst GROUP_SEP = ',';\nconst DIGIT_CHAR = '#';\nconst CURRENCY_CHAR = '¤';\nconst PERCENT_CHAR = '%';\n/**\n * Transforms a number to a locale string based on a style and a format.\n */\nfunction formatNumberToLocaleString(value, pattern, locale, groupSymbol, decimalSymbol, digitsInfo, isPercent = false) {\n let formattedText = '';\n let isZero = false;\n if (!isFinite(value)) {\n formattedText = getLocaleNumberSymbol(locale, NumberSymbol.Infinity);\n }\n else {\n let parsedNumber = parseNumber(value);\n if (isPercent) {\n parsedNumber = toPercent(parsedNumber);\n }\n let minInt = pattern.minInt;\n let minFraction = pattern.minFrac;\n let maxFraction = pattern.maxFrac;\n if (digitsInfo) {\n const parts = digitsInfo.match(NUMBER_FORMAT_REGEXP);\n if (parts === null) {\n throw new Error(`${digitsInfo} is not a valid digit info`);\n }\n const minIntPart = parts[1];\n const minFractionPart = parts[3];\n const maxFractionPart = parts[5];\n if (minIntPart != null) {\n minInt = parseIntAutoRadix(minIntPart);\n }\n if (minFractionPart != null) {\n minFraction = parseIntAutoRadix(minFractionPart);\n }\n if (maxFractionPart != null) {\n maxFraction = parseIntAutoRadix(maxFractionPart);\n }\n else if (minFractionPart != null && minFraction > maxFraction) {\n maxFraction = minFraction;\n }\n }\n roundNumber(parsedNumber, minFraction, maxFraction);\n let digits = parsedNumber.digits;\n let integerLen = parsedNumber.integerLen;\n const exponent = parsedNumber.exponent;\n let decimals = [];\n isZero = digits.every(d => !d);\n // pad zeros for small numbers\n for (; integerLen < minInt; integerLen++) {\n digits.unshift(0);\n }\n // pad zeros for small numbers\n for (; integerLen < 0; integerLen++) {\n digits.unshift(0);\n }\n // extract decimals digits\n if (integerLen > 0) {\n decimals = digits.splice(integerLen, digits.length);\n }\n else {\n decimals = digits;\n digits = [0];\n }\n // format the integer digits with grouping separators\n const groups = [];\n if (digits.length >= pattern.lgSize) {\n groups.unshift(digits.splice(-pattern.lgSize, digits.length).join(''));\n }\n while (digits.length > pattern.gSize) {\n groups.unshift(digits.splice(-pattern.gSize, digits.length).join(''));\n }\n if (digits.length) {\n groups.unshift(digits.join(''));\n }\n formattedText = groups.join(getLocaleNumberSymbol(locale, groupSymbol));\n // append the decimal digits\n if (decimals.length) {\n formattedText += getLocaleNumberSymbol(locale, decimalSymbol) + decimals.join('');\n }\n if (exponent) {\n formattedText += getLocaleNumberSymbol(locale, NumberSymbol.Exponential) + '+' + exponent;\n }\n }\n if (value < 0 && !isZero) {\n formattedText = pattern.negPre + formattedText + pattern.negSuf;\n }\n else {\n formattedText = pattern.posPre + formattedText + pattern.posSuf;\n }\n return formattedText;\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as currency using locale rules.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param currency A string containing the currency symbol or its name,\n * such as \"$\" or \"Canadian Dollar\". Used in output string, but does not affect the operation\n * of the function.\n * @param currencyCode The [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217)\n * currency code, such as `USD` for the US dollar and `EUR` for the euro.\n * Used to determine the number of digits in the decimal part.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted currency value.\n *\n * @see `formatNumber()`\n * @see `DecimalPipe`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction formatCurrency(value, locale, currency, currencyCode, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Currency);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n pattern.minFrac = getNumberOfCurrencyDigits(currencyCode);\n pattern.maxFrac = pattern.minFrac;\n const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.CurrencyGroup, NumberSymbol.CurrencyDecimal, digitsInfo);\n return res\n .replace(CURRENCY_CHAR, currency)\n // if we have 2 time the currency character, the second one is ignored\n .replace(CURRENCY_CHAR, '')\n // If there is a spacing between currency character and the value and\n // the currency character is suppressed by passing an empty string, the\n // spacing character would remain as part of the string. Then we\n // should remove it.\n .trim();\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as a percentage according to locale rules.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted percentage value.\n *\n * @see `formatNumber()`\n * @see `DecimalPipe`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n * @publicApi\n *\n */\nfunction formatPercent(value, locale, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Percent);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo, true);\n return res.replace(new RegExp(PERCENT_CHAR, 'g'), getLocaleNumberSymbol(locale, NumberSymbol.PercentSign));\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as text, with group sizing, separator, and other\n * parameters based on the locale.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted text string.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction formatNumber(value, locale, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Decimal);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n return formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo);\n}\nfunction parseNumberFormat(format, minusSign = '-') {\n const p = {\n minInt: 1,\n minFrac: 0,\n maxFrac: 0,\n posPre: '',\n posSuf: '',\n negPre: '',\n negSuf: '',\n gSize: 0,\n lgSize: 0\n };\n const patternParts = format.split(PATTERN_SEP);\n const positive = patternParts[0];\n const negative = patternParts[1];\n const positiveParts = positive.indexOf(DECIMAL_SEP) !== -1 ?\n positive.split(DECIMAL_SEP) :\n [\n positive.substring(0, positive.lastIndexOf(ZERO_CHAR) + 1),\n positive.substring(positive.lastIndexOf(ZERO_CHAR) + 1)\n ], integer = positiveParts[0], fraction = positiveParts[1] || '';\n p.posPre = integer.substring(0, integer.indexOf(DIGIT_CHAR));\n for (let i = 0; i < fraction.length; i++) {\n const ch = fraction.charAt(i);\n if (ch === ZERO_CHAR) {\n p.minFrac = p.maxFrac = i + 1;\n }\n else if (ch === DIGIT_CHAR) {\n p.maxFrac = i + 1;\n }\n else {\n p.posSuf += ch;\n }\n }\n const groups = integer.split(GROUP_SEP);\n p.gSize = groups[1] ? groups[1].length : 0;\n p.lgSize = (groups[2] || groups[1]) ? (groups[2] || groups[1]).length : 0;\n if (negative) {\n const trunkLen = positive.length - p.posPre.length - p.posSuf.length, pos = negative.indexOf(DIGIT_CHAR);\n p.negPre = negative.substring(0, pos).replace(/'/g, '');\n p.negSuf = negative.slice(pos + trunkLen).replace(/'/g, '');\n }\n else {\n p.negPre = minusSign + p.posPre;\n p.negSuf = p.posSuf;\n }\n return p;\n}\n// Transforms a parsed number into a percentage by multiplying it by 100\nfunction toPercent(parsedNumber) {\n // if the number is 0, don't do anything\n if (parsedNumber.digits[0] === 0) {\n return parsedNumber;\n }\n // Getting the current number of decimals\n const fractionLen = parsedNumber.digits.length - parsedNumber.integerLen;\n if (parsedNumber.exponent) {\n parsedNumber.exponent += 2;\n }\n else {\n if (fractionLen === 0) {\n parsedNumber.digits.push(0, 0);\n }\n else if (fractionLen === 1) {\n parsedNumber.digits.push(0);\n }\n parsedNumber.integerLen += 2;\n }\n return parsedNumber;\n}\n/**\n * Parses a number.\n * Significant bits of this parse algorithm came from https://github.com/MikeMcl/big.js/\n */\nfunction parseNumber(num) {\n let numStr = Math.abs(num) + '';\n let exponent = 0, digits, integerLen;\n let i, j, zeros;\n // Decimal point?\n if ((integerLen = numStr.indexOf(DECIMAL_SEP)) > -1) {\n numStr = numStr.replace(DECIMAL_SEP, '');\n }\n // Exponential form?\n if ((i = numStr.search(/e/i)) > 0) {\n // Work out the exponent.\n if (integerLen < 0)\n integerLen = i;\n integerLen += +numStr.slice(i + 1);\n numStr = numStr.substring(0, i);\n }\n else if (integerLen < 0) {\n // There was no decimal point or exponent so it is an integer.\n integerLen = numStr.length;\n }\n // Count the number of leading zeros.\n for (i = 0; numStr.charAt(i) === ZERO_CHAR; i++) { /* empty */\n }\n if (i === (zeros = numStr.length)) {\n // The digits are all zero.\n digits = [0];\n integerLen = 1;\n }\n else {\n // Count the number of trailing zeros\n zeros--;\n while (numStr.charAt(zeros) === ZERO_CHAR)\n zeros--;\n // Trailing zeros are insignificant so ignore them\n integerLen -= i;\n digits = [];\n // Convert string to array of digits without leading/trailing zeros.\n for (j = 0; i <= zeros; i++, j++) {\n digits[j] = Number(numStr.charAt(i));\n }\n }\n // If the number overflows the maximum allowed digits then use an exponent.\n if (integerLen > MAX_DIGITS) {\n digits = digits.splice(0, MAX_DIGITS - 1);\n exponent = integerLen - 1;\n integerLen = 1;\n }\n return { digits, exponent, integerLen };\n}\n/**\n * Round the parsed number to the specified number of decimal places\n * This function changes the parsedNumber in-place\n */\nfunction roundNumber(parsedNumber, minFrac, maxFrac) {\n if (minFrac > maxFrac) {\n throw new Error(`The minimum number of digits after fraction (${minFrac}) is higher than the maximum (${maxFrac}).`);\n }\n let digits = parsedNumber.digits;\n let fractionLen = digits.length - parsedNumber.integerLen;\n const fractionSize = Math.min(Math.max(minFrac, fractionLen), maxFrac);\n // The index of the digit to where rounding is to occur\n let roundAt = fractionSize + parsedNumber.integerLen;\n let digit = digits[roundAt];\n if (roundAt > 0) {\n // Drop fractional digits beyond `roundAt`\n digits.splice(Math.max(parsedNumber.integerLen, roundAt));\n // Set non-fractional digits beyond `roundAt` to 0\n for (let j = roundAt; j < digits.length; j++) {\n digits[j] = 0;\n }\n }\n else {\n // We rounded to zero so reset the parsedNumber\n fractionLen = Math.max(0, fractionLen);\n parsedNumber.integerLen = 1;\n digits.length = Math.max(1, roundAt = fractionSize + 1);\n digits[0] = 0;\n for (let i = 1; i < roundAt; i++)\n digits[i] = 0;\n }\n if (digit >= 5) {\n if (roundAt - 1 < 0) {\n for (let k = 0; k > roundAt; k--) {\n digits.unshift(0);\n parsedNumber.integerLen++;\n }\n digits.unshift(1);\n parsedNumber.integerLen++;\n }\n else {\n digits[roundAt - 1]++;\n }\n }\n // Pad out with zeros to get the required fraction length\n for (; fractionLen < Math.max(0, fractionSize); fractionLen++)\n digits.push(0);\n let dropTrailingZeros = fractionSize !== 0;\n // Minimal length = nb of decimals required + current nb of integers\n // Any number besides that is optional and can be removed if it's a trailing 0\n const minLen = minFrac + parsedNumber.integerLen;\n // Do any carrying, e.g. a digit was rounded up to 10\n const carry = digits.reduceRight(function (carry, d, i, digits) {\n d = d + carry;\n digits[i] = d < 10 ? d : d - 10; // d % 10\n if (dropTrailingZeros) {\n // Do not keep meaningless fractional trailing zeros (e.g. 15.52000 --> 15.52)\n if (digits[i] === 0 && i >= minLen) {\n digits.pop();\n }\n else {\n dropTrailingZeros = false;\n }\n }\n return d >= 10 ? 1 : 0; // Math.floor(d / 10);\n }, 0);\n if (carry) {\n digits.unshift(carry);\n parsedNumber.integerLen++;\n }\n}\nfunction parseIntAutoRadix(text) {\n const result = parseInt(text);\n if (isNaN(result)) {\n throw new Error('Invalid integer literal when parsing ' + text);\n }\n return result;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @publicApi\n */\nclass NgLocalization {\n}\nNgLocalization.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NgLocalization, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nNgLocalization.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NgLocalization, providedIn: 'root', useFactory: (locale) => new NgLocaleLocalization(locale), deps: [{ token: LOCALE_ID }] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NgLocalization, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'root',\n useFactory: (locale) => new NgLocaleLocalization(locale),\n deps: [LOCALE_ID],\n }]\n }] });\n/**\n * Returns the plural category for a given value.\n * - \"=value\" when the case exists,\n * - the plural category otherwise\n */\nfunction getPluralCategory(value, cases, ngLocalization, locale) {\n let key = `=${value}`;\n if (cases.indexOf(key) > -1) {\n return key;\n }\n key = ngLocalization.getPluralCategory(value, locale);\n if (cases.indexOf(key) > -1) {\n return key;\n }\n if (cases.indexOf('other') > -1) {\n return 'other';\n }\n throw new Error(`No plural message found for value \"${value}\"`);\n}\n/**\n * Returns the plural case based on the locale\n *\n * @publicApi\n */\nclass NgLocaleLocalization extends NgLocalization {\n constructor(locale) {\n super();\n this.locale = locale;\n }\n getPluralCategory(value, locale) {\n const plural = getLocalePluralCase(locale || this.locale)(value);\n switch (plural) {\n case Plural.Zero:\n return 'zero';\n case Plural.One:\n return 'one';\n case Plural.Two:\n return 'two';\n case Plural.Few:\n return 'few';\n case Plural.Many:\n return 'many';\n default:\n return 'other';\n }\n }\n}\nNgLocaleLocalization.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NgLocaleLocalization, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Injectable });\nNgLocaleLocalization.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NgLocaleLocalization });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NgLocaleLocalization, decorators: [{\n type: Injectable\n }], ctorParameters: function () {\n return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }];\n } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Register global data to be used internally by Angular. See the\n * [\"I18n guide\"](guide/i18n-common-format-data-locale) to know how to import additional locale\n * data.\n *\n * The signature registerLocaleData(data: any, extraData?: any) is deprecated since v5.1\n *\n * @publicApi\n */\nfunction registerLocaleData(data, localeId, extraData) {\n return ɵregisterLocaleData(data, localeId, extraData);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction parseCookieValue(cookieStr, name) {\n name = encodeURIComponent(name);\n for (const cookie of cookieStr.split(';')) {\n const eqIndex = cookie.indexOf('=');\n const [cookieName, cookieValue] = eqIndex == -1 ? [cookie, ''] : [cookie.slice(0, eqIndex), cookie.slice(eqIndex + 1)];\n if (cookieName.trim() === name) {\n return decodeURIComponent(cookieValue);\n }\n }\n return null;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n * ```\n * ... \n *\n * ... \n *\n * ... \n *\n * ... \n *\n * ... \n * ```\n *\n * @description\n *\n * Adds and removes CSS classes on an HTML element.\n *\n * The CSS classes are updated as follows, depending on the type of the expression evaluation:\n * - `string` - the CSS classes listed in the string (space delimited) are added,\n * - `Array` - the CSS classes declared as Array elements are added,\n * - `Object` - keys are CSS classes that get added when the expression given in the value\n * evaluates to a truthy value, otherwise they are removed.\n *\n * @publicApi\n */\nclass NgClass {\n constructor(_iterableDiffers, _keyValueDiffers, _ngEl, _renderer) {\n this._iterableDiffers = _iterableDiffers;\n this._keyValueDiffers = _keyValueDiffers;\n this._ngEl = _ngEl;\n this._renderer = _renderer;\n this._iterableDiffer = null;\n this._keyValueDiffer = null;\n this._initialClasses = [];\n this._rawClass = null;\n }\n set klass(value) {\n this._removeClasses(this._initialClasses);\n this._initialClasses = typeof value === 'string' ? value.split(/\\s+/) : [];\n this._applyClasses(this._initialClasses);\n this._applyClasses(this._rawClass);\n }\n set ngClass(value) {\n this._removeClasses(this._rawClass);\n this._applyClasses(this._initialClasses);\n this._iterableDiffer = null;\n this._keyValueDiffer = null;\n this._rawClass = typeof value === 'string' ? value.split(/\\s+/) : value;\n if (this._rawClass) {\n if (ɵisListLikeIterable(this._rawClass)) {\n this._iterableDiffer = this._iterableDiffers.find(this._rawClass).create();\n }\n else {\n this._keyValueDiffer = this._keyValueDiffers.find(this._rawClass).create();\n }\n }\n }\n ngDoCheck() {\n if (this._iterableDiffer) {\n const iterableChanges = this._iterableDiffer.diff(this._rawClass);\n if (iterableChanges) {\n this._applyIterableChanges(iterableChanges);\n }\n }\n else if (this._keyValueDiffer) {\n const keyValueChanges = this._keyValueDiffer.diff(this._rawClass);\n if (keyValueChanges) {\n this._applyKeyValueChanges(keyValueChanges);\n }\n }\n }\n _applyKeyValueChanges(changes) {\n changes.forEachAddedItem((record) => this._toggleClass(record.key, record.currentValue));\n changes.forEachChangedItem((record) => this._toggleClass(record.key, record.currentValue));\n changes.forEachRemovedItem((record) => {\n if (record.previousValue) {\n this._toggleClass(record.key, false);\n }\n });\n }\n _applyIterableChanges(changes) {\n changes.forEachAddedItem((record) => {\n if (typeof record.item === 'string') {\n this._toggleClass(record.item, true);\n }\n else {\n throw new Error(`NgClass can only toggle CSS classes expressed as strings, got ${ɵstringify(record.item)}`);\n }\n });\n changes.forEachRemovedItem((record) => this._toggleClass(record.item, false));\n }\n /**\n * Applies a collection of CSS classes to the DOM element.\n *\n * For argument of type Set and Array CSS class names contained in those collections are always\n * added.\n * For argument of type Map CSS class name in the map's key is toggled based on the value (added\n * for truthy and removed for falsy).\n */\n _applyClasses(rawClassVal) {\n if (rawClassVal) {\n if (Array.isArray(rawClassVal) || rawClassVal instanceof Set) {\n rawClassVal.forEach((klass) => this._toggleClass(klass, true));\n }\n else {\n Object.keys(rawClassVal).forEach(klass => this._toggleClass(klass, !!rawClassVal[klass]));\n }\n }\n }\n /**\n * Removes a collection of CSS classes from the DOM element. This is mostly useful for cleanup\n * purposes.\n */\n _removeClasses(rawClassVal) {\n if (rawClassVal) {\n if (Array.isArray(rawClassVal) || rawClassVal instanceof Set) {\n rawClassVal.forEach((klass) => this._toggleClass(klass, false));\n }\n else {\n Object.keys(rawClassVal).forEach(klass => this._toggleClass(klass, false));\n }\n }\n }\n _toggleClass(klass, enabled) {\n klass = klass.trim();\n if (klass) {\n klass.split(/\\s+/g).forEach(klass => {\n if (enabled) {\n this._renderer.addClass(this._ngEl.nativeElement, klass);\n }\n else {\n this._renderer.removeClass(this._ngEl.nativeElement, klass);\n }\n });\n }\n }\n}\nNgClass.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NgClass, deps: [{ token: i0.IterableDiffers }, { token: i0.KeyValueDiffers }, { token: i0.ElementRef }, { token: i0.Renderer2 }], target: i0.ɵɵFactoryTarget.Directive });\nNgClass.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"14.2.0\", type: NgClass, isStandalone: true, selector: \"[ngClass]\", inputs: { klass: [\"class\", \"klass\"], ngClass: \"ngClass\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NgClass, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngClass]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.IterableDiffers }, { type: i0.KeyValueDiffers }, { type: i0.ElementRef }, { type: i0.Renderer2 }]; }, propDecorators: { klass: [{\n type: Input,\n args: ['class']\n }], ngClass: [{\n type: Input,\n args: ['ngClass']\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Instantiates a {@link Component} type and inserts its Host View into the current View.\n * `NgComponentOutlet` provides a declarative approach for dynamic component creation.\n *\n * `NgComponentOutlet` requires a component type, if a falsy value is set the view will clear and\n * any existing component will be destroyed.\n *\n * @usageNotes\n *\n * ### Fine tune control\n *\n * You can control the component creation process by using the following optional attributes:\n *\n * * `ngComponentOutletInjector`: Optional custom {@link Injector} that will be used as parent for\n * the Component. Defaults to the injector of the current view container.\n *\n * * `ngComponentOutletContent`: Optional list of projectable nodes to insert into the content\n * section of the component, if it exists.\n *\n * * `ngComponentOutletNgModule`: Optional NgModule class reference to allow loading another\n * module dynamically, then loading a component from that module.\n *\n * * `ngComponentOutletNgModuleFactory`: Deprecated config option that allows providing optional\n * NgModule factory to allow loading another module dynamically, then loading a component from that\n * module. Use `ngComponentOutletNgModule` instead.\n *\n * ### Syntax\n *\n * Simple\n * ```\n * \n * ```\n *\n * Customized injector/content\n * ```\n * \n * \n * ```\n *\n * Customized NgModule reference\n * ```\n * \n * \n * ```\n *\n * ### A simple example\n *\n * {@example common/ngComponentOutlet/ts/module.ts region='SimpleExample'}\n *\n * A more complete example with additional options:\n *\n * {@example common/ngComponentOutlet/ts/module.ts region='CompleteExample'}\n *\n * @publicApi\n * @ngModule CommonModule\n */\nclass NgComponentOutlet {\n constructor(_viewContainerRef) {\n this._viewContainerRef = _viewContainerRef;\n this.ngComponentOutlet = null;\n }\n /** @nodoc */\n ngOnChanges(changes) {\n const { _viewContainerRef: viewContainerRef, ngComponentOutletNgModule: ngModule, ngComponentOutletNgModuleFactory: ngModuleFactory, } = this;\n viewContainerRef.clear();\n this._componentRef = undefined;\n if (this.ngComponentOutlet) {\n const injector = this.ngComponentOutletInjector || viewContainerRef.parentInjector;\n if (changes['ngComponentOutletNgModule'] || changes['ngComponentOutletNgModuleFactory']) {\n if (this._moduleRef)\n this._moduleRef.destroy();\n if (ngModule) {\n this._moduleRef = createNgModule(ngModule, getParentInjector(injector));\n }\n else if (ngModuleFactory) {\n this._moduleRef = ngModuleFactory.create(getParentInjector(injector));\n }\n else {\n this._moduleRef = undefined;\n }\n }\n this._componentRef = viewContainerRef.createComponent(this.ngComponentOutlet, {\n index: viewContainerRef.length,\n injector,\n ngModuleRef: this._moduleRef,\n projectableNodes: this.ngComponentOutletContent,\n });\n }\n }\n /** @nodoc */\n ngOnDestroy() {\n if (this._moduleRef)\n this._moduleRef.destroy();\n }\n}\nNgComponentOutlet.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NgComponentOutlet, deps: [{ token: i0.ViewContainerRef }], target: i0.ɵɵFactoryTarget.Directive });\nNgComponentOutlet.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"14.2.0\", type: NgComponentOutlet, isStandalone: true, selector: \"[ngComponentOutlet]\", inputs: { ngComponentOutlet: \"ngComponentOutlet\", ngComponentOutletInjector: \"ngComponentOutletInjector\", ngComponentOutletContent: \"ngComponentOutletContent\", ngComponentOutletNgModule: \"ngComponentOutletNgModule\", ngComponentOutletNgModuleFactory: \"ngComponentOutletNgModuleFactory\" }, usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NgComponentOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngComponentOutlet]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }]; }, propDecorators: { ngComponentOutlet: [{\n type: Input\n }], ngComponentOutletInjector: [{\n type: Input\n }], ngComponentOutletContent: [{\n type: Input\n }], ngComponentOutletNgModule: [{\n type: Input\n }], ngComponentOutletNgModuleFactory: [{\n type: Input\n }] } });\n// Helper function that returns an Injector instance of a parent NgModule.\nfunction getParentInjector(injector) {\n const parentNgModule = injector.get(NgModuleRef);\n return parentNgModule.injector;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst NG_DEV_MODE = typeof ngDevMode === 'undefined' || !!ngDevMode;\n/**\n * @publicApi\n */\nclass NgForOfContext {\n constructor($implicit, ngForOf, index, count) {\n this.$implicit = $implicit;\n this.ngForOf = ngForOf;\n this.index = index;\n this.count = count;\n }\n get first() {\n return this.index === 0;\n }\n get last() {\n return this.index === this.count - 1;\n }\n get even() {\n return this.index % 2 === 0;\n }\n get odd() {\n return !this.even;\n }\n}\n/**\n * A [structural directive](guide/structural-directives) that renders\n * a template for each item in a collection.\n * The directive is placed on an element, which becomes the parent\n * of the cloned templates.\n *\n * The `ngForOf` directive is generally used in the\n * [shorthand form](guide/structural-directives#asterisk) `*ngFor`.\n * In this form, the template to be rendered for each iteration is the content\n * of an anchor element containing the directive.\n *\n * The following example shows the shorthand syntax with some options,\n * contained in an `` element.\n *\n * ```\n * ... \n * ```\n *\n * The shorthand form expands into a long form that uses the `ngForOf` selector\n * on an `` element.\n * The content of the `` element is the `` element that held the\n * short-form directive.\n *\n * Here is the expanded version of the short-form example.\n *\n * ```\n * \n * ... \n * \n * ```\n *\n * Angular automatically expands the shorthand syntax as it compiles the template.\n * The context for each embedded view is logically merged to the current component\n * context according to its lexical position.\n *\n * When using the shorthand syntax, Angular allows only [one structural directive\n * on an element](guide/structural-directives#one-per-element).\n * If you want to iterate conditionally, for example,\n * put the `*ngIf` on a container element that wraps the `*ngFor` element.\n * For further discussion, see\n * [Structural Directives](guide/structural-directives#one-per-element).\n *\n * @usageNotes\n *\n * ### Local variables\n *\n * `NgForOf` provides exported values that can be aliased to local variables.\n * For example:\n *\n * ```\n * \n * {{i}}/{{users.length}}. {{user}} default \n * \n * ```\n *\n * The following exported values can be aliased to local variables:\n *\n * - `$implicit: T`: The value of the individual items in the iterable (`ngForOf`).\n * - `ngForOf: NgIterable`: The value of the iterable expression. Useful when the expression is\n * more complex then a property access, for example when using the async pipe (`userStreams |\n * async`).\n * - `index: number`: The index of the current item in the iterable.\n * - `count: number`: The length of the iterable.\n * - `first: boolean`: True when the item is the first item in the iterable.\n * - `last: boolean`: True when the item is the last item in the iterable.\n * - `even: boolean`: True when the item has an even index in the iterable.\n * - `odd: boolean`: True when the item has an odd index in the iterable.\n *\n * ### Change propagation\n *\n * When the contents of the iterator changes, `NgForOf` makes the corresponding changes to the DOM:\n *\n * * When an item is added, a new instance of the template is added to the DOM.\n * * When an item is removed, its template instance is removed from the DOM.\n * * When items are reordered, their respective templates are reordered in the DOM.\n *\n * Angular uses object identity to track insertions and deletions within the iterator and reproduce\n * those changes in the DOM. This has important implications for animations and any stateful\n * controls that are present, such as ` ` elements that accept user input. Inserted rows can\n * be animated in, deleted rows can be animated out, and unchanged rows retain any unsaved state\n * such as user input.\n * For more on animations, see [Transitions and Triggers](guide/transition-and-triggers).\n *\n * The identities of elements in the iterator can change while the data does not.\n * This can happen, for example, if the iterator is produced from an RPC to the server, and that\n * RPC is re-run. Even if the data hasn't changed, the second response produces objects with\n * different identities, and Angular must tear down the entire DOM and rebuild it (as if all old\n * elements were deleted and all new elements inserted).\n *\n * To avoid this expensive operation, you can customize the default tracking algorithm.\n * by supplying the `trackBy` option to `NgForOf`.\n * `trackBy` takes a function that has two arguments: `index` and `item`.\n * If `trackBy` is given, Angular tracks changes by the return value of the function.\n *\n * @see [Structural Directives](guide/structural-directives)\n * @ngModule CommonModule\n * @publicApi\n */\nclass NgForOf {\n constructor(_viewContainer, _template, _differs) {\n this._viewContainer = _viewContainer;\n this._template = _template;\n this._differs = _differs;\n this._ngForOf = null;\n this._ngForOfDirty = true;\n this._differ = null;\n }\n /**\n * The value of the iterable expression, which can be used as a\n * [template input variable](guide/structural-directives#shorthand).\n */\n set ngForOf(ngForOf) {\n this._ngForOf = ngForOf;\n this._ngForOfDirty = true;\n }\n /**\n * Specifies a custom `TrackByFunction` to compute the identity of items in an iterable.\n *\n * If a custom `TrackByFunction` is not provided, `NgForOf` will use the item's [object\n * identity](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Object/is)\n * as the key.\n *\n * `NgForOf` uses the computed key to associate items in an iterable with DOM elements\n * it produces for these items.\n *\n * A custom `TrackByFunction` is useful to provide good user experience in cases when items in an\n * iterable rendered using `NgForOf` have a natural identifier (for example, custom ID or a\n * primary key), and this iterable could be updated with new object instances that still\n * represent the same underlying entity (for example, when data is re-fetched from the server,\n * and the iterable is recreated and re-rendered, but most of the data is still the same).\n *\n * @see `TrackByFunction`\n */\n set ngForTrackBy(fn) {\n if (NG_DEV_MODE && fn != null && typeof fn !== 'function') {\n // TODO(vicb): use a log service once there is a public one available\n if (console && console.warn) {\n console.warn(`trackBy must be a function, but received ${JSON.stringify(fn)}. ` +\n `See https://angular.io/api/common/NgForOf#change-propagation for more information.`);\n }\n }\n this._trackByFn = fn;\n }\n get ngForTrackBy() {\n return this._trackByFn;\n }\n /**\n * A reference to the template that is stamped out for each item in the iterable.\n * @see [template reference variable](guide/template-reference-variables)\n */\n set ngForTemplate(value) {\n // TODO(TS2.1): make TemplateRef>> once we move to TS v2.1\n // The current type is too restrictive; a template that just uses index, for example,\n // should be acceptable.\n if (value) {\n this._template = value;\n }\n }\n /**\n * Applies the changes when needed.\n * @nodoc\n */\n ngDoCheck() {\n if (this._ngForOfDirty) {\n this._ngForOfDirty = false;\n // React on ngForOf changes only once all inputs have been initialized\n const value = this._ngForOf;\n if (!this._differ && value) {\n if (NG_DEV_MODE) {\n try {\n // CAUTION: this logic is duplicated for production mode below, as the try-catch\n // is only present in development builds.\n this._differ = this._differs.find(value).create(this.ngForTrackBy);\n }\n catch (_a) {\n let errorMessage = `Cannot find a differ supporting object '${value}' of type '` +\n `${getTypeName(value)}'. NgFor only supports binding to Iterables, such as Arrays.`;\n if (typeof value === 'object') {\n errorMessage += ' Did you mean to use the keyvalue pipe?';\n }\n throw new ɵRuntimeError(-2200 /* RuntimeErrorCode.NG_FOR_MISSING_DIFFER */, errorMessage);\n }\n }\n else {\n // CAUTION: this logic is duplicated for development mode above, as the try-catch\n // is only present in development builds.\n this._differ = this._differs.find(value).create(this.ngForTrackBy);\n }\n }\n }\n if (this._differ) {\n const changes = this._differ.diff(this._ngForOf);\n if (changes)\n this._applyChanges(changes);\n }\n }\n _applyChanges(changes) {\n const viewContainer = this._viewContainer;\n changes.forEachOperation((item, adjustedPreviousIndex, currentIndex) => {\n if (item.previousIndex == null) {\n // NgForOf is never \"null\" or \"undefined\" here because the differ detected\n // that a new item needs to be inserted from the iterable. This implies that\n // there is an iterable value for \"_ngForOf\".\n viewContainer.createEmbeddedView(this._template, new NgForOfContext(item.item, this._ngForOf, -1, -1), currentIndex === null ? undefined : currentIndex);\n }\n else if (currentIndex == null) {\n viewContainer.remove(adjustedPreviousIndex === null ? undefined : adjustedPreviousIndex);\n }\n else if (adjustedPreviousIndex !== null) {\n const view = viewContainer.get(adjustedPreviousIndex);\n viewContainer.move(view, currentIndex);\n applyViewChange(view, item);\n }\n });\n for (let i = 0, ilen = viewContainer.length; i < ilen; i++) {\n const viewRef = viewContainer.get(i);\n const context = viewRef.context;\n context.index = i;\n context.count = ilen;\n context.ngForOf = this._ngForOf;\n }\n changes.forEachIdentityChange((record) => {\n const viewRef = viewContainer.get(record.currentIndex);\n applyViewChange(viewRef, record);\n });\n }\n /**\n * Asserts the correct type of the context for the template that `NgForOf` will render.\n *\n * The presence of this method is a signal to the Ivy template type-check compiler that the\n * `NgForOf` structural directive renders its template with a specific context type.\n */\n static ngTemplateContextGuard(dir, ctx) {\n return true;\n }\n}\nNgForOf.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NgForOf, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: i0.IterableDiffers }], target: i0.ɵɵFactoryTarget.Directive });\nNgForOf.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"14.2.0\", type: NgForOf, isStandalone: true, selector: \"[ngFor][ngForOf]\", inputs: { ngForOf: \"ngForOf\", ngForTrackBy: \"ngForTrackBy\", ngForTemplate: \"ngForTemplate\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NgForOf, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngFor][ngForOf]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: i0.IterableDiffers }]; }, propDecorators: { ngForOf: [{\n type: Input\n }], ngForTrackBy: [{\n type: Input\n }], ngForTemplate: [{\n type: Input\n }] } });\nfunction applyViewChange(view, record) {\n view.context.$implicit = record.item;\n}\nfunction getTypeName(type) {\n return type['name'] || typeof type;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A structural directive that conditionally includes a template based on the value of\n * an expression coerced to Boolean.\n * When the expression evaluates to true, Angular renders the template\n * provided in a `then` clause, and when false or null,\n * Angular renders the template provided in an optional `else` clause. The default\n * template for the `else` clause is blank.\n *\n * A [shorthand form](guide/structural-directives#asterisk) of the directive,\n * `*ngIf=\"condition\"`, is generally used, provided\n * as an attribute of the anchor element for the inserted template.\n * Angular expands this into a more explicit version, in which the anchor element\n * is contained in an `` element.\n *\n * Simple form with shorthand syntax:\n *\n * ```\n * Content to render when condition is true.
\n * ```\n *\n * Simple form with expanded syntax:\n *\n * ```\n * Content to render when condition is\n * true.
\n * ```\n *\n * Form with an \"else\" block:\n *\n * ```\n * Content to render when condition is true.
\n * Content to render when condition is false. \n * ```\n *\n * Shorthand form with \"then\" and \"else\" blocks:\n *\n * ```\n *
\n * Content to render when condition is true. \n * Content to render when condition is false. \n * ```\n *\n * Form with storing the value locally:\n *\n * ```\n * {{value}}
\n * Content to render when value is null. \n * ```\n *\n * @usageNotes\n *\n * The `*ngIf` directive is most commonly used to conditionally show an inline template,\n * as seen in the following example.\n * The default `else` template is blank.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfSimple'}\n *\n * ### Showing an alternative template using `else`\n *\n * To display a template when `expression` evaluates to false, use an `else` template\n * binding as shown in the following example.\n * The `else` binding points to an `` element labeled `#elseBlock`.\n * The template can be defined anywhere in the component view, but is typically placed right after\n * `ngIf` for readability.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfElse'}\n *\n * ### Using an external `then` template\n *\n * In the previous example, the then-clause template is specified inline, as the content of the\n * tag that contains the `ngIf` directive. You can also specify a template that is defined\n * externally, by referencing a labeled `` element. When you do this, you can\n * change which template to use at runtime, as shown in the following example.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfThenElse'}\n *\n * ### Storing a conditional result in a variable\n *\n * You might want to show a set of properties from the same object. If you are waiting\n * for asynchronous data, the object can be undefined.\n * In this case, you can use `ngIf` and store the result of the condition in a local\n * variable as shown in the following example.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfAs'}\n *\n * This code uses only one `AsyncPipe`, so only one subscription is created.\n * The conditional statement stores the result of `userStream|async` in the local variable `user`.\n * You can then bind the local `user` repeatedly.\n *\n * The conditional displays the data only if `userStream` returns a value,\n * so you don't need to use the\n * safe-navigation-operator (`?.`)\n * to guard against null values when accessing properties.\n * You can display an alternative template while waiting for the data.\n *\n * ### Shorthand syntax\n *\n * The shorthand syntax `*ngIf` expands into two separate template specifications\n * for the \"then\" and \"else\" clauses. For example, consider the following shorthand statement,\n * that is meant to show a loading page while waiting for data to be loaded.\n *\n * ```\n * \n * ...\n *
\n *\n * \n * Loading...
\n * \n * ```\n *\n * You can see that the \"else\" clause references the ``\n * with the `#loading` label, and the template for the \"then\" clause\n * is provided as the content of the anchor element.\n *\n * However, when Angular expands the shorthand syntax, it creates\n * another `` tag, with `ngIf` and `ngIfElse` directives.\n * The anchor element containing the template for the \"then\" clause becomes\n * the content of this unlabeled `` tag.\n *\n * ```\n * \n * \n * ...\n *
\n * \n *\n * \n * Loading...
\n * \n * ```\n *\n * The presence of the implicit template object has implications for the nesting of\n * structural directives. For more on this subject, see\n * [Structural Directives](guide/structural-directives#one-per-element).\n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass NgIf {\n constructor(_viewContainer, templateRef) {\n this._viewContainer = _viewContainer;\n this._context = new NgIfContext();\n this._thenTemplateRef = null;\n this._elseTemplateRef = null;\n this._thenViewRef = null;\n this._elseViewRef = null;\n this._thenTemplateRef = templateRef;\n }\n /**\n * The Boolean expression to evaluate as the condition for showing a template.\n */\n set ngIf(condition) {\n this._context.$implicit = this._context.ngIf = condition;\n this._updateView();\n }\n /**\n * A template to show if the condition expression evaluates to true.\n */\n set ngIfThen(templateRef) {\n assertTemplate('ngIfThen', templateRef);\n this._thenTemplateRef = templateRef;\n this._thenViewRef = null; // clear previous view if any.\n this._updateView();\n }\n /**\n * A template to show if the condition expression evaluates to false.\n */\n set ngIfElse(templateRef) {\n assertTemplate('ngIfElse', templateRef);\n this._elseTemplateRef = templateRef;\n this._elseViewRef = null; // clear previous view if any.\n this._updateView();\n }\n _updateView() {\n if (this._context.$implicit) {\n if (!this._thenViewRef) {\n this._viewContainer.clear();\n this._elseViewRef = null;\n if (this._thenTemplateRef) {\n this._thenViewRef =\n this._viewContainer.createEmbeddedView(this._thenTemplateRef, this._context);\n }\n }\n }\n else {\n if (!this._elseViewRef) {\n this._viewContainer.clear();\n this._thenViewRef = null;\n if (this._elseTemplateRef) {\n this._elseViewRef =\n this._viewContainer.createEmbeddedView(this._elseTemplateRef, this._context);\n }\n }\n }\n }\n /**\n * Asserts the correct type of the context for the template that `NgIf` will render.\n *\n * The presence of this method is a signal to the Ivy template type-check compiler that the\n * `NgIf` structural directive renders its template with a specific context type.\n */\n static ngTemplateContextGuard(dir, ctx) {\n return true;\n }\n}\nNgIf.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NgIf, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }], target: i0.ɵɵFactoryTarget.Directive });\nNgIf.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"14.2.0\", type: NgIf, isStandalone: true, selector: \"[ngIf]\", inputs: { ngIf: \"ngIf\", ngIfThen: \"ngIfThen\", ngIfElse: \"ngIfElse\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NgIf, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngIf]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }]; }, propDecorators: { ngIf: [{\n type: Input\n }], ngIfThen: [{\n type: Input\n }], ngIfElse: [{\n type: Input\n }] } });\n/**\n * @publicApi\n */\nclass NgIfContext {\n constructor() {\n this.$implicit = null;\n this.ngIf = null;\n }\n}\nfunction assertTemplate(property, templateRef) {\n const isTemplateRefOrNull = !!(!templateRef || templateRef.createEmbeddedView);\n if (!isTemplateRefOrNull) {\n throw new Error(`${property} must be a TemplateRef, but received '${ɵstringify(templateRef)}'.`);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass SwitchView {\n constructor(_viewContainerRef, _templateRef) {\n this._viewContainerRef = _viewContainerRef;\n this._templateRef = _templateRef;\n this._created = false;\n }\n create() {\n this._created = true;\n this._viewContainerRef.createEmbeddedView(this._templateRef);\n }\n destroy() {\n this._created = false;\n this._viewContainerRef.clear();\n }\n enforceState(created) {\n if (created && !this._created) {\n this.create();\n }\n else if (!created && this._created) {\n this.destroy();\n }\n }\n}\n/**\n * @ngModule CommonModule\n *\n * @description\n * The `[ngSwitch]` directive on a container specifies an expression to match against.\n * The expressions to match are provided by `ngSwitchCase` directives on views within the container.\n * - Every view that matches is rendered.\n * - If there are no matches, a view with the `ngSwitchDefault` directive is rendered.\n * - Elements within the `[NgSwitch]` statement but outside of any `NgSwitchCase`\n * or `ngSwitchDefault` directive are preserved at the location.\n *\n * @usageNotes\n * Define a container element for the directive, and specify the switch expression\n * to match against as an attribute:\n *\n * ```\n * \n * ```\n *\n * Within the container, `*ngSwitchCase` statements specify the match expressions\n * as attributes. Include `*ngSwitchDefault` as the final case.\n *\n * ```\n * \n * ... \n * ...\n * ... \n * \n * ```\n *\n * ### Usage Examples\n *\n * The following example shows how to use more than one case to display the same view:\n *\n * ```\n * \n * \n * ... \n * ... \n * ... \n * \n * ... \n * \n * ```\n *\n * The following example shows how cases can be nested:\n * ```\n * \n * ... \n * ... \n * ... \n * \n * \n * \n * \n * \n * ... \n * \n * ```\n *\n * @publicApi\n * @see `NgSwitchCase`\n * @see `NgSwitchDefault`\n * @see [Structural Directives](guide/structural-directives)\n *\n */\nclass NgSwitch {\n constructor() {\n this._defaultUsed = false;\n this._caseCount = 0;\n this._lastCaseCheckIndex = 0;\n this._lastCasesMatched = false;\n }\n set ngSwitch(newValue) {\n this._ngSwitch = newValue;\n if (this._caseCount === 0) {\n this._updateDefaultCases(true);\n }\n }\n /** @internal */\n _addCase() {\n return this._caseCount++;\n }\n /** @internal */\n _addDefault(view) {\n if (!this._defaultViews) {\n this._defaultViews = [];\n }\n this._defaultViews.push(view);\n }\n /** @internal */\n _matchCase(value) {\n const matched = value == this._ngSwitch;\n this._lastCasesMatched = this._lastCasesMatched || matched;\n this._lastCaseCheckIndex++;\n if (this._lastCaseCheckIndex === this._caseCount) {\n this._updateDefaultCases(!this._lastCasesMatched);\n this._lastCaseCheckIndex = 0;\n this._lastCasesMatched = false;\n }\n return matched;\n }\n _updateDefaultCases(useDefault) {\n if (this._defaultViews && useDefault !== this._defaultUsed) {\n this._defaultUsed = useDefault;\n for (let i = 0; i < this._defaultViews.length; i++) {\n const defaultView = this._defaultViews[i];\n defaultView.enforceState(useDefault);\n }\n }\n }\n}\nNgSwitch.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NgSwitch, deps: [], target: i0.ɵɵFactoryTarget.Directive });\nNgSwitch.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"14.2.0\", type: NgSwitch, isStandalone: true, selector: \"[ngSwitch]\", inputs: { ngSwitch: \"ngSwitch\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NgSwitch, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngSwitch]',\n standalone: true,\n }]\n }], propDecorators: { ngSwitch: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n * Provides a switch case expression to match against an enclosing `ngSwitch` expression.\n * When the expressions match, the given `NgSwitchCase` template is rendered.\n * If multiple match expressions match the switch expression value, all of them are displayed.\n *\n * @usageNotes\n *\n * Within a switch container, `*ngSwitchCase` statements specify the match expressions\n * as attributes. Include `*ngSwitchDefault` as the final case.\n *\n * ```\n * \n * ... \n * ...\n * ... \n * \n * ```\n *\n * Each switch-case statement contains an in-line HTML template or template reference\n * that defines the subtree to be selected if the value of the match expression\n * matches the value of the switch expression.\n *\n * Unlike JavaScript, which uses strict equality, Angular uses loose equality.\n * This means that the empty string, `\"\"` matches 0.\n *\n * @publicApi\n * @see `NgSwitch`\n * @see `NgSwitchDefault`\n *\n */\nclass NgSwitchCase {\n constructor(viewContainer, templateRef, ngSwitch) {\n this.ngSwitch = ngSwitch;\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !ngSwitch) {\n throwNgSwitchProviderNotFoundError('ngSwitchCase', 'NgSwitchCase');\n }\n ngSwitch._addCase();\n this._view = new SwitchView(viewContainer, templateRef);\n }\n /**\n * Performs case matching. For internal use only.\n * @nodoc\n */\n ngDoCheck() {\n this._view.enforceState(this.ngSwitch._matchCase(this.ngSwitchCase));\n }\n}\nNgSwitchCase.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NgSwitchCase, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: NgSwitch, host: true, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\nNgSwitchCase.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"14.2.0\", type: NgSwitchCase, isStandalone: true, selector: \"[ngSwitchCase]\", inputs: { ngSwitchCase: \"ngSwitchCase\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NgSwitchCase, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngSwitchCase]',\n standalone: true,\n }]\n }], ctorParameters: function () {\n return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: NgSwitch, decorators: [{\n type: Optional\n }, {\n type: Host\n }] }];\n }, propDecorators: { ngSwitchCase: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Creates a view that is rendered when no `NgSwitchCase` expressions\n * match the `NgSwitch` expression.\n * This statement should be the final case in an `NgSwitch`.\n *\n * @publicApi\n * @see `NgSwitch`\n * @see `NgSwitchCase`\n *\n */\nclass NgSwitchDefault {\n constructor(viewContainer, templateRef, ngSwitch) {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !ngSwitch) {\n throwNgSwitchProviderNotFoundError('ngSwitchDefault', 'NgSwitchDefault');\n }\n ngSwitch._addDefault(new SwitchView(viewContainer, templateRef));\n }\n}\nNgSwitchDefault.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NgSwitchDefault, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: NgSwitch, host: true, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\nNgSwitchDefault.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"14.2.0\", type: NgSwitchDefault, isStandalone: true, selector: \"[ngSwitchDefault]\", ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NgSwitchDefault, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngSwitchDefault]',\n standalone: true,\n }]\n }], ctorParameters: function () {\n return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: NgSwitch, decorators: [{\n type: Optional\n }, {\n type: Host\n }] }];\n } });\nfunction throwNgSwitchProviderNotFoundError(attrName, directiveName) {\n throw new ɵRuntimeError(2000 /* RuntimeErrorCode.PARENT_NG_SWITCH_NOT_FOUND */, `An element with the \"${attrName}\" attribute ` +\n `(matching the \"${directiveName}\" directive) must be located inside an element with the \"ngSwitch\" attribute ` +\n `(matching \"NgSwitch\" directive)`);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n * ```\n * \n * there is nothing \n * there is one \n * there are a few \n * \n * ```\n *\n * @description\n *\n * Adds / removes DOM sub-trees based on a numeric value. Tailored for pluralization.\n *\n * Displays DOM sub-trees that match the switch expression value, or failing that, DOM sub-trees\n * that match the switch expression's pluralization category.\n *\n * To use this directive you must provide a container element that sets the `[ngPlural]` attribute\n * to a switch expression. Inner elements with a `[ngPluralCase]` will display based on their\n * expression:\n * - if `[ngPluralCase]` is set to a value starting with `=`, it will only display if the value\n * matches the switch expression exactly,\n * - otherwise, the view will be treated as a \"category match\", and will only display if exact\n * value matches aren't found and the value maps to its category for the defined locale.\n *\n * See http://cldr.unicode.org/index/cldr-spec/plural-rules\n *\n * @publicApi\n */\nclass NgPlural {\n constructor(_localization) {\n this._localization = _localization;\n this._caseViews = {};\n }\n set ngPlural(value) {\n this._switchValue = value;\n this._updateView();\n }\n addCase(value, switchView) {\n this._caseViews[value] = switchView;\n }\n _updateView() {\n this._clearViews();\n const cases = Object.keys(this._caseViews);\n const key = getPluralCategory(this._switchValue, cases, this._localization);\n this._activateView(this._caseViews[key]);\n }\n _clearViews() {\n if (this._activeView)\n this._activeView.destroy();\n }\n _activateView(view) {\n if (view) {\n this._activeView = view;\n this._activeView.create();\n }\n }\n}\nNgPlural.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NgPlural, deps: [{ token: NgLocalization }], target: i0.ɵɵFactoryTarget.Directive });\nNgPlural.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"14.2.0\", type: NgPlural, isStandalone: true, selector: \"[ngPlural]\", inputs: { ngPlural: \"ngPlural\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NgPlural, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngPlural]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: NgLocalization }]; }, propDecorators: { ngPlural: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Creates a view that will be added/removed from the parent {@link NgPlural} when the\n * given expression matches the plural expression according to CLDR rules.\n *\n * @usageNotes\n * ```\n * \n * ... \n * ... \n * \n *```\n *\n * See {@link NgPlural} for more details and example.\n *\n * @publicApi\n */\nclass NgPluralCase {\n constructor(value, template, viewContainer, ngPlural) {\n this.value = value;\n const isANumber = !isNaN(Number(value));\n ngPlural.addCase(isANumber ? `=${value}` : value, new SwitchView(viewContainer, template));\n }\n}\nNgPluralCase.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NgPluralCase, deps: [{ token: 'ngPluralCase', attribute: true }, { token: i0.TemplateRef }, { token: i0.ViewContainerRef }, { token: NgPlural, host: true }], target: i0.ɵɵFactoryTarget.Directive });\nNgPluralCase.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"14.2.0\", type: NgPluralCase, isStandalone: true, selector: \"[ngPluralCase]\", ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NgPluralCase, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngPluralCase]',\n standalone: true,\n }]\n }], ctorParameters: function () {\n return [{ type: undefined, decorators: [{\n type: Attribute,\n args: ['ngPluralCase']\n }] }, { type: i0.TemplateRef }, { type: i0.ViewContainerRef }, { type: NgPlural, decorators: [{\n type: Host\n }] }];\n } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n *\n * Set the font of the containing element to the result of an expression.\n *\n * ```\n * ... \n * ```\n *\n * Set the width of the containing element to a pixel value returned by an expression.\n *\n * ```\n * ... \n * ```\n *\n * Set a collection of style values using an expression that returns key-value pairs.\n *\n * ```\n * ... \n * ```\n *\n * @description\n *\n * An attribute directive that updates styles for the containing HTML element.\n * Sets one or more style properties, specified as colon-separated key-value pairs.\n * The key is a style name, with an optional `.` suffix\n * (such as 'top.px', 'font-style.em').\n * The value is an expression to be evaluated.\n * The resulting non-null value, expressed in the given unit,\n * is assigned to the given style property.\n * If the result of evaluation is null, the corresponding style is removed.\n *\n * @publicApi\n */\nclass NgStyle {\n constructor(_ngEl, _differs, _renderer) {\n this._ngEl = _ngEl;\n this._differs = _differs;\n this._renderer = _renderer;\n this._ngStyle = null;\n this._differ = null;\n }\n set ngStyle(values) {\n this._ngStyle = values;\n if (!this._differ && values) {\n this._differ = this._differs.find(values).create();\n }\n }\n ngDoCheck() {\n if (this._differ) {\n const changes = this._differ.diff(this._ngStyle);\n if (changes) {\n this._applyChanges(changes);\n }\n }\n }\n _setStyle(nameAndUnit, value) {\n const [name, unit] = nameAndUnit.split('.');\n const flags = name.indexOf('-') === -1 ? undefined : RendererStyleFlags2.DashCase;\n if (value != null) {\n this._renderer.setStyle(this._ngEl.nativeElement, name, unit ? `${value}${unit}` : value, flags);\n }\n else {\n this._renderer.removeStyle(this._ngEl.nativeElement, name, flags);\n }\n }\n _applyChanges(changes) {\n changes.forEachRemovedItem((record) => this._setStyle(record.key, null));\n changes.forEachAddedItem((record) => this._setStyle(record.key, record.currentValue));\n changes.forEachChangedItem((record) => this._setStyle(record.key, record.currentValue));\n }\n}\nNgStyle.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NgStyle, deps: [{ token: i0.ElementRef }, { token: i0.KeyValueDiffers }, { token: i0.Renderer2 }], target: i0.ɵɵFactoryTarget.Directive });\nNgStyle.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"14.2.0\", type: NgStyle, isStandalone: true, selector: \"[ngStyle]\", inputs: { ngStyle: \"ngStyle\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NgStyle, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngStyle]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: i0.KeyValueDiffers }, { type: i0.Renderer2 }]; }, propDecorators: { ngStyle: [{\n type: Input,\n args: ['ngStyle']\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Inserts an embedded view from a prepared `TemplateRef`.\n *\n * You can attach a context object to the `EmbeddedViewRef` by setting `[ngTemplateOutletContext]`.\n * `[ngTemplateOutletContext]` should be an object, the object's keys will be available for binding\n * by the local template `let` declarations.\n *\n * @usageNotes\n * ```\n * \n * ```\n *\n * Using the key `$implicit` in the context object will set its value as default.\n *\n * ### Example\n *\n * {@example common/ngTemplateOutlet/ts/module.ts region='NgTemplateOutlet'}\n *\n * @publicApi\n */\nclass NgTemplateOutlet {\n constructor(_viewContainerRef) {\n this._viewContainerRef = _viewContainerRef;\n this._viewRef = null;\n /**\n * A context object to attach to the {@link EmbeddedViewRef}. This should be an\n * object, the object's keys will be available for binding by the local template `let`\n * declarations.\n * Using the key `$implicit` in the context object will set its value as default.\n */\n this.ngTemplateOutletContext = null;\n /**\n * A string defining the template reference and optionally the context object for the template.\n */\n this.ngTemplateOutlet = null;\n /** Injector to be used within the embedded view. */\n this.ngTemplateOutletInjector = null;\n }\n /** @nodoc */\n ngOnChanges(changes) {\n if (changes['ngTemplateOutlet'] || changes['ngTemplateOutletInjector']) {\n const viewContainerRef = this._viewContainerRef;\n if (this._viewRef) {\n viewContainerRef.remove(viewContainerRef.indexOf(this._viewRef));\n }\n if (this.ngTemplateOutlet) {\n const { ngTemplateOutlet: template, ngTemplateOutletContext: context, ngTemplateOutletInjector: injector } = this;\n this._viewRef = viewContainerRef.createEmbeddedView(template, context, injector ? { injector } : undefined);\n }\n else {\n this._viewRef = null;\n }\n }\n else if (this._viewRef && changes['ngTemplateOutletContext'] && this.ngTemplateOutletContext) {\n this._viewRef.context = this.ngTemplateOutletContext;\n }\n }\n}\nNgTemplateOutlet.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NgTemplateOutlet, deps: [{ token: i0.ViewContainerRef }], target: i0.ɵɵFactoryTarget.Directive });\nNgTemplateOutlet.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"14.2.0\", type: NgTemplateOutlet, isStandalone: true, selector: \"[ngTemplateOutlet]\", inputs: { ngTemplateOutletContext: \"ngTemplateOutletContext\", ngTemplateOutlet: \"ngTemplateOutlet\", ngTemplateOutletInjector: \"ngTemplateOutletInjector\" }, usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NgTemplateOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngTemplateOutlet]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }]; }, propDecorators: { ngTemplateOutletContext: [{\n type: Input\n }], ngTemplateOutlet: [{\n type: Input\n }], ngTemplateOutletInjector: [{\n type: Input\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A collection of Angular directives that are likely to be used in each and every Angular\n * application.\n */\nconst COMMON_DIRECTIVES = [\n NgClass,\n NgComponentOutlet,\n NgForOf,\n NgIf,\n NgTemplateOutlet,\n NgStyle,\n NgSwitch,\n NgSwitchCase,\n NgSwitchDefault,\n NgPlural,\n NgPluralCase,\n];\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction invalidPipeArgumentError(type, value) {\n return new ɵRuntimeError(2100 /* RuntimeErrorCode.INVALID_PIPE_ARGUMENT */, ngDevMode && `InvalidPipeArgument: '${value}' for pipe '${ɵstringify(type)}'`);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass SubscribableStrategy {\n createSubscription(async, updateLatestValue) {\n return async.subscribe({\n next: updateLatestValue,\n error: (e) => {\n throw e;\n }\n });\n }\n dispose(subscription) {\n subscription.unsubscribe();\n }\n}\nclass PromiseStrategy {\n createSubscription(async, updateLatestValue) {\n return async.then(updateLatestValue, e => {\n throw e;\n });\n }\n dispose(subscription) { }\n}\nconst _promiseStrategy = new PromiseStrategy();\nconst _subscribableStrategy = new SubscribableStrategy();\n/**\n * @ngModule CommonModule\n * @description\n *\n * Unwraps a value from an asynchronous primitive.\n *\n * The `async` pipe subscribes to an `Observable` or `Promise` and returns the latest value it has\n * emitted. When a new value is emitted, the `async` pipe marks the component to be checked for\n * changes. When the component gets destroyed, the `async` pipe unsubscribes automatically to avoid\n * potential memory leaks. When the reference of the expression changes, the `async` pipe\n * automatically unsubscribes from the old `Observable` or `Promise` and subscribes to the new one.\n *\n * @usageNotes\n *\n * ### Examples\n *\n * This example binds a `Promise` to the view. Clicking the `Resolve` button resolves the\n * promise.\n *\n * {@example common/pipes/ts/async_pipe.ts region='AsyncPipePromise'}\n *\n * It's also possible to use `async` with Observables. The example below binds the `time` Observable\n * to the view. The Observable continuously updates the view with the current time.\n *\n * {@example common/pipes/ts/async_pipe.ts region='AsyncPipeObservable'}\n *\n * @publicApi\n */\nclass AsyncPipe {\n constructor(ref) {\n this._latestValue = null;\n this._subscription = null;\n this._obj = null;\n this._strategy = null;\n // Assign `ref` into `this._ref` manually instead of declaring `_ref` in the constructor\n // parameter list, as the type of `this._ref` includes `null` unlike the type of `ref`.\n this._ref = ref;\n }\n ngOnDestroy() {\n if (this._subscription) {\n this._dispose();\n }\n // Clear the `ChangeDetectorRef` and its association with the view data, to mitigate\n // potential memory leaks in Observables that could otherwise cause the view data to\n // be retained.\n // https://github.com/angular/angular/issues/17624\n this._ref = null;\n }\n transform(obj) {\n if (!this._obj) {\n if (obj) {\n this._subscribe(obj);\n }\n return this._latestValue;\n }\n if (obj !== this._obj) {\n this._dispose();\n return this.transform(obj);\n }\n return this._latestValue;\n }\n _subscribe(obj) {\n this._obj = obj;\n this._strategy = this._selectStrategy(obj);\n this._subscription = this._strategy.createSubscription(obj, (value) => this._updateLatestValue(obj, value));\n }\n _selectStrategy(obj) {\n if (ɵisPromise(obj)) {\n return _promiseStrategy;\n }\n if (ɵisSubscribable(obj)) {\n return _subscribableStrategy;\n }\n throw invalidPipeArgumentError(AsyncPipe, obj);\n }\n _dispose() {\n // Note: `dispose` is only called if a subscription has been initialized before, indicating\n // that `this._strategy` is also available.\n this._strategy.dispose(this._subscription);\n this._latestValue = null;\n this._subscription = null;\n this._obj = null;\n }\n _updateLatestValue(async, value) {\n if (async === this._obj) {\n this._latestValue = value;\n // Note: `this._ref` is only cleared in `ngOnDestroy` so is known to be available when a\n // value is being updated.\n this._ref.markForCheck();\n }\n }\n}\nAsyncPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: AsyncPipe, deps: [{ token: i0.ChangeDetectorRef }], target: i0.ɵɵFactoryTarget.Pipe });\nAsyncPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"14.2.0\", ngImport: i0, type: AsyncPipe, isStandalone: true, name: \"async\", pure: false });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: AsyncPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'async',\n pure: false,\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Transforms text to all lower case.\n *\n * @see `UpperCasePipe`\n * @see `TitleCasePipe`\n * @usageNotes\n *\n * The following example defines a view that allows the user to enter\n * text, and then uses the pipe to convert the input text to all lower case.\n *\n * \n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass LowerCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(LowerCasePipe, value);\n }\n return value.toLowerCase();\n }\n}\nLowerCasePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: LowerCasePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nLowerCasePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"14.2.0\", ngImport: i0, type: LowerCasePipe, isStandalone: true, name: \"lowercase\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: LowerCasePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'lowercase',\n standalone: true,\n }]\n }] });\n//\n// Regex below matches any Unicode word and number compatible with ES5. In ES2018 the same result\n// can be achieved by using /[0-9\\p{L}]\\S*/gu and also known as Unicode Property Escapes\n// (https://2ality.com/2017/07/regexp-unicode-property-escapes.html). Since there is no\n// transpilation of this functionality down to ES5 without external tool, the only solution is\n// to use already transpiled form. Example can be found here -\n// https://mothereff.in/regexpu#input=var+regex+%3D+%2F%5B0-9%5Cp%7BL%7D%5D%5CS*%2Fgu%3B%0A%0A&unicodePropertyEscape=1\n//\nconst unicodeWordMatch = /(?:[0-9A-Za-z\\xAA\\xB5\\xBA\\xC0-\\xD6\\xD8-\\xF6\\xF8-\\u02C1\\u02C6-\\u02D1\\u02E0-\\u02E4\\u02EC\\u02EE\\u0370-\\u0374\\u0376\\u0377\\u037A-\\u037D\\u037F\\u0386\\u0388-\\u038A\\u038C\\u038E-\\u03A1\\u03A3-\\u03F5\\u03F7-\\u0481\\u048A-\\u052F\\u0531-\\u0556\\u0559\\u0560-\\u0588\\u05D0-\\u05EA\\u05EF-\\u05F2\\u0620-\\u064A\\u066E\\u066F\\u0671-\\u06D3\\u06D5\\u06E5\\u06E6\\u06EE\\u06EF\\u06FA-\\u06FC\\u06FF\\u0710\\u0712-\\u072F\\u074D-\\u07A5\\u07B1\\u07CA-\\u07EA\\u07F4\\u07F5\\u07FA\\u0800-\\u0815\\u081A\\u0824\\u0828\\u0840-\\u0858\\u0860-\\u086A\\u0870-\\u0887\\u0889-\\u088E\\u08A0-\\u08C9\\u0904-\\u0939\\u093D\\u0950\\u0958-\\u0961\\u0971-\\u0980\\u0985-\\u098C\\u098F\\u0990\\u0993-\\u09A8\\u09AA-\\u09B0\\u09B2\\u09B6-\\u09B9\\u09BD\\u09CE\\u09DC\\u09DD\\u09DF-\\u09E1\\u09F0\\u09F1\\u09FC\\u0A05-\\u0A0A\\u0A0F\\u0A10\\u0A13-\\u0A28\\u0A2A-\\u0A30\\u0A32\\u0A33\\u0A35\\u0A36\\u0A38\\u0A39\\u0A59-\\u0A5C\\u0A5E\\u0A72-\\u0A74\\u0A85-\\u0A8D\\u0A8F-\\u0A91\\u0A93-\\u0AA8\\u0AAA-\\u0AB0\\u0AB2\\u0AB3\\u0AB5-\\u0AB9\\u0ABD\\u0AD0\\u0AE0\\u0AE1\\u0AF9\\u0B05-\\u0B0C\\u0B0F\\u0B10\\u0B13-\\u0B28\\u0B2A-\\u0B30\\u0B32\\u0B33\\u0B35-\\u0B39\\u0B3D\\u0B5C\\u0B5D\\u0B5F-\\u0B61\\u0B71\\u0B83\\u0B85-\\u0B8A\\u0B8E-\\u0B90\\u0B92-\\u0B95\\u0B99\\u0B9A\\u0B9C\\u0B9E\\u0B9F\\u0BA3\\u0BA4\\u0BA8-\\u0BAA\\u0BAE-\\u0BB9\\u0BD0\\u0C05-\\u0C0C\\u0C0E-\\u0C10\\u0C12-\\u0C28\\u0C2A-\\u0C39\\u0C3D\\u0C58-\\u0C5A\\u0C5D\\u0C60\\u0C61\\u0C80\\u0C85-\\u0C8C\\u0C8E-\\u0C90\\u0C92-\\u0CA8\\u0CAA-\\u0CB3\\u0CB5-\\u0CB9\\u0CBD\\u0CDD\\u0CDE\\u0CE0\\u0CE1\\u0CF1\\u0CF2\\u0D04-\\u0D0C\\u0D0E-\\u0D10\\u0D12-\\u0D3A\\u0D3D\\u0D4E\\u0D54-\\u0D56\\u0D5F-\\u0D61\\u0D7A-\\u0D7F\\u0D85-\\u0D96\\u0D9A-\\u0DB1\\u0DB3-\\u0DBB\\u0DBD\\u0DC0-\\u0DC6\\u0E01-\\u0E30\\u0E32\\u0E33\\u0E40-\\u0E46\\u0E81\\u0E82\\u0E84\\u0E86-\\u0E8A\\u0E8C-\\u0EA3\\u0EA5\\u0EA7-\\u0EB0\\u0EB2\\u0EB3\\u0EBD\\u0EC0-\\u0EC4\\u0EC6\\u0EDC-\\u0EDF\\u0F00\\u0F40-\\u0F47\\u0F49-\\u0F6C\\u0F88-\\u0F8C\\u1000-\\u102A\\u103F\\u1050-\\u1055\\u105A-\\u105D\\u1061\\u1065\\u1066\\u106E-\\u1070\\u1075-\\u1081\\u108E\\u10A0-\\u10C5\\u10C7\\u10CD\\u10D0-\\u10FA\\u10FC-\\u1248\\u124A-\\u124D\\u1250-\\u1256\\u1258\\u125A-\\u125D\\u1260-\\u1288\\u128A-\\u128D\\u1290-\\u12B0\\u12B2-\\u12B5\\u12B8-\\u12BE\\u12C0\\u12C2-\\u12C5\\u12C8-\\u12D6\\u12D8-\\u1310\\u1312-\\u1315\\u1318-\\u135A\\u1380-\\u138F\\u13A0-\\u13F5\\u13F8-\\u13FD\\u1401-\\u166C\\u166F-\\u167F\\u1681-\\u169A\\u16A0-\\u16EA\\u16F1-\\u16F8\\u1700-\\u1711\\u171F-\\u1731\\u1740-\\u1751\\u1760-\\u176C\\u176E-\\u1770\\u1780-\\u17B3\\u17D7\\u17DC\\u1820-\\u1878\\u1880-\\u1884\\u1887-\\u18A8\\u18AA\\u18B0-\\u18F5\\u1900-\\u191E\\u1950-\\u196D\\u1970-\\u1974\\u1980-\\u19AB\\u19B0-\\u19C9\\u1A00-\\u1A16\\u1A20-\\u1A54\\u1AA7\\u1B05-\\u1B33\\u1B45-\\u1B4C\\u1B83-\\u1BA0\\u1BAE\\u1BAF\\u1BBA-\\u1BE5\\u1C00-\\u1C23\\u1C4D-\\u1C4F\\u1C5A-\\u1C7D\\u1C80-\\u1C88\\u1C90-\\u1CBA\\u1CBD-\\u1CBF\\u1CE9-\\u1CEC\\u1CEE-\\u1CF3\\u1CF5\\u1CF6\\u1CFA\\u1D00-\\u1DBF\\u1E00-\\u1F15\\u1F18-\\u1F1D\\u1F20-\\u1F45\\u1F48-\\u1F4D\\u1F50-\\u1F57\\u1F59\\u1F5B\\u1F5D\\u1F5F-\\u1F7D\\u1F80-\\u1FB4\\u1FB6-\\u1FBC\\u1FBE\\u1FC2-\\u1FC4\\u1FC6-\\u1FCC\\u1FD0-\\u1FD3\\u1FD6-\\u1FDB\\u1FE0-\\u1FEC\\u1FF2-\\u1FF4\\u1FF6-\\u1FFC\\u2071\\u207F\\u2090-\\u209C\\u2102\\u2107\\u210A-\\u2113\\u2115\\u2119-\\u211D\\u2124\\u2126\\u2128\\u212A-\\u212D\\u212F-\\u2139\\u213C-\\u213F\\u2145-\\u2149\\u214E\\u2183\\u2184\\u2C00-\\u2CE4\\u2CEB-\\u2CEE\\u2CF2\\u2CF3\\u2D00-\\u2D25\\u2D27\\u2D2D\\u2D30-\\u2D67\\u2D6F\\u2D80-\\u2D96\\u2DA0-\\u2DA6\\u2DA8-\\u2DAE\\u2DB0-\\u2DB6\\u2DB8-\\u2DBE\\u2DC0-\\u2DC6\\u2DC8-\\u2DCE\\u2DD0-\\u2DD6\\u2DD8-\\u2DDE\\u2E2F\\u3005\\u3006\\u3031-\\u3035\\u303B\\u303C\\u3041-\\u3096\\u309D-\\u309F\\u30A1-\\u30FA\\u30FC-\\u30FF\\u3105-\\u312F\\u3131-\\u318E\\u31A0-\\u31BF\\u31F0-\\u31FF\\u3400-\\u4DBF\\u4E00-\\uA48C\\uA4D0-\\uA4FD\\uA500-\\uA60C\\uA610-\\uA61F\\uA62A\\uA62B\\uA640-\\uA66E\\uA67F-\\uA69D\\uA6A0-\\uA6E5\\uA717-\\uA71F\\uA722-\\uA788\\uA78B-\\uA7CA\\uA7D0\\uA7D1\\uA7D3\\uA7D5-\\uA7D9\\uA7F2-\\uA801\\uA803-\\uA805\\uA807-\\uA80A\\uA80C-\\uA822\\uA840-\\uA873\\uA882-\\uA8B3\\uA8F2-\\uA8F7\\uA8FB\\uA8FD\\uA8FE\\uA90A-\\uA925\\uA930-\\uA946\\uA960-\\uA97C\\uA984-\\uA9B2\\uA9CF\\uA9E0-\\uA9E4\\uA9E6-\\uA9EF\\uA9FA-\\uA9FE\\uAA00-\\uAA28\\uAA40-\\uAA42\\uAA44-\\uAA4B\\uAA60-\\uAA76\\uAA7A\\uAA7E-\\uAAAF\\uAAB1\\uAAB5\\uAAB6\\uAAB9-\\uAABD\\uAAC0\\uAAC2\\uAADB-\\uAADD\\uAAE0-\\uAAEA\\uAAF2-\\uAAF4\\uAB01-\\uAB06\\uAB09-\\uAB0E\\uAB11-\\uAB16\\uAB20-\\uAB26\\uAB28-\\uAB2E\\uAB30-\\uAB5A\\uAB5C-\\uAB69\\uAB70-\\uABE2\\uAC00-\\uD7A3\\uD7B0-\\uD7C6\\uD7CB-\\uD7FB\\uF900-\\uFA6D\\uFA70-\\uFAD9\\uFB00-\\uFB06\\uFB13-\\uFB17\\uFB1D\\uFB1F-\\uFB28\\uFB2A-\\uFB36\\uFB38-\\uFB3C\\uFB3E\\uFB40\\uFB41\\uFB43\\uFB44\\uFB46-\\uFBB1\\uFBD3-\\uFD3D\\uFD50-\\uFD8F\\uFD92-\\uFDC7\\uFDF0-\\uFDFB\\uFE70-\\uFE74\\uFE76-\\uFEFC\\uFF21-\\uFF3A\\uFF41-\\uFF5A\\uFF66-\\uFFBE\\uFFC2-\\uFFC7\\uFFCA-\\uFFCF\\uFFD2-\\uFFD7\\uFFDA-\\uFFDC]|\\uD800[\\uDC00-\\uDC0B\\uDC0D-\\uDC26\\uDC28-\\uDC3A\\uDC3C\\uDC3D\\uDC3F-\\uDC4D\\uDC50-\\uDC5D\\uDC80-\\uDCFA\\uDE80-\\uDE9C\\uDEA0-\\uDED0\\uDF00-\\uDF1F\\uDF2D-\\uDF40\\uDF42-\\uDF49\\uDF50-\\uDF75\\uDF80-\\uDF9D\\uDFA0-\\uDFC3\\uDFC8-\\uDFCF]|\\uD801[\\uDC00-\\uDC9D\\uDCB0-\\uDCD3\\uDCD8-\\uDCFB\\uDD00-\\uDD27\\uDD30-\\uDD63\\uDD70-\\uDD7A\\uDD7C-\\uDD8A\\uDD8C-\\uDD92\\uDD94\\uDD95\\uDD97-\\uDDA1\\uDDA3-\\uDDB1\\uDDB3-\\uDDB9\\uDDBB\\uDDBC\\uDE00-\\uDF36\\uDF40-\\uDF55\\uDF60-\\uDF67\\uDF80-\\uDF85\\uDF87-\\uDFB0\\uDFB2-\\uDFBA]|\\uD802[\\uDC00-\\uDC05\\uDC08\\uDC0A-\\uDC35\\uDC37\\uDC38\\uDC3C\\uDC3F-\\uDC55\\uDC60-\\uDC76\\uDC80-\\uDC9E\\uDCE0-\\uDCF2\\uDCF4\\uDCF5\\uDD00-\\uDD15\\uDD20-\\uDD39\\uDD80-\\uDDB7\\uDDBE\\uDDBF\\uDE00\\uDE10-\\uDE13\\uDE15-\\uDE17\\uDE19-\\uDE35\\uDE60-\\uDE7C\\uDE80-\\uDE9C\\uDEC0-\\uDEC7\\uDEC9-\\uDEE4\\uDF00-\\uDF35\\uDF40-\\uDF55\\uDF60-\\uDF72\\uDF80-\\uDF91]|\\uD803[\\uDC00-\\uDC48\\uDC80-\\uDCB2\\uDCC0-\\uDCF2\\uDD00-\\uDD23\\uDE80-\\uDEA9\\uDEB0\\uDEB1\\uDF00-\\uDF1C\\uDF27\\uDF30-\\uDF45\\uDF70-\\uDF81\\uDFB0-\\uDFC4\\uDFE0-\\uDFF6]|\\uD804[\\uDC03-\\uDC37\\uDC71\\uDC72\\uDC75\\uDC83-\\uDCAF\\uDCD0-\\uDCE8\\uDD03-\\uDD26\\uDD44\\uDD47\\uDD50-\\uDD72\\uDD76\\uDD83-\\uDDB2\\uDDC1-\\uDDC4\\uDDDA\\uDDDC\\uDE00-\\uDE11\\uDE13-\\uDE2B\\uDE80-\\uDE86\\uDE88\\uDE8A-\\uDE8D\\uDE8F-\\uDE9D\\uDE9F-\\uDEA8\\uDEB0-\\uDEDE\\uDF05-\\uDF0C\\uDF0F\\uDF10\\uDF13-\\uDF28\\uDF2A-\\uDF30\\uDF32\\uDF33\\uDF35-\\uDF39\\uDF3D\\uDF50\\uDF5D-\\uDF61]|\\uD805[\\uDC00-\\uDC34\\uDC47-\\uDC4A\\uDC5F-\\uDC61\\uDC80-\\uDCAF\\uDCC4\\uDCC5\\uDCC7\\uDD80-\\uDDAE\\uDDD8-\\uDDDB\\uDE00-\\uDE2F\\uDE44\\uDE80-\\uDEAA\\uDEB8\\uDF00-\\uDF1A\\uDF40-\\uDF46]|\\uD806[\\uDC00-\\uDC2B\\uDCA0-\\uDCDF\\uDCFF-\\uDD06\\uDD09\\uDD0C-\\uDD13\\uDD15\\uDD16\\uDD18-\\uDD2F\\uDD3F\\uDD41\\uDDA0-\\uDDA7\\uDDAA-\\uDDD0\\uDDE1\\uDDE3\\uDE00\\uDE0B-\\uDE32\\uDE3A\\uDE50\\uDE5C-\\uDE89\\uDE9D\\uDEB0-\\uDEF8]|\\uD807[\\uDC00-\\uDC08\\uDC0A-\\uDC2E\\uDC40\\uDC72-\\uDC8F\\uDD00-\\uDD06\\uDD08\\uDD09\\uDD0B-\\uDD30\\uDD46\\uDD60-\\uDD65\\uDD67\\uDD68\\uDD6A-\\uDD89\\uDD98\\uDEE0-\\uDEF2\\uDFB0]|\\uD808[\\uDC00-\\uDF99]|\\uD809[\\uDC80-\\uDD43]|\\uD80B[\\uDF90-\\uDFF0]|[\\uD80C\\uD81C-\\uD820\\uD822\\uD840-\\uD868\\uD86A-\\uD86C\\uD86F-\\uD872\\uD874-\\uD879\\uD880-\\uD883][\\uDC00-\\uDFFF]|\\uD80D[\\uDC00-\\uDC2E]|\\uD811[\\uDC00-\\uDE46]|\\uD81A[\\uDC00-\\uDE38\\uDE40-\\uDE5E\\uDE70-\\uDEBE\\uDED0-\\uDEED\\uDF00-\\uDF2F\\uDF40-\\uDF43\\uDF63-\\uDF77\\uDF7D-\\uDF8F]|\\uD81B[\\uDE40-\\uDE7F\\uDF00-\\uDF4A\\uDF50\\uDF93-\\uDF9F\\uDFE0\\uDFE1\\uDFE3]|\\uD821[\\uDC00-\\uDFF7]|\\uD823[\\uDC00-\\uDCD5\\uDD00-\\uDD08]|\\uD82B[\\uDFF0-\\uDFF3\\uDFF5-\\uDFFB\\uDFFD\\uDFFE]|\\uD82C[\\uDC00-\\uDD22\\uDD50-\\uDD52\\uDD64-\\uDD67\\uDD70-\\uDEFB]|\\uD82F[\\uDC00-\\uDC6A\\uDC70-\\uDC7C\\uDC80-\\uDC88\\uDC90-\\uDC99]|\\uD835[\\uDC00-\\uDC54\\uDC56-\\uDC9C\\uDC9E\\uDC9F\\uDCA2\\uDCA5\\uDCA6\\uDCA9-\\uDCAC\\uDCAE-\\uDCB9\\uDCBB\\uDCBD-\\uDCC3\\uDCC5-\\uDD05\\uDD07-\\uDD0A\\uDD0D-\\uDD14\\uDD16-\\uDD1C\\uDD1E-\\uDD39\\uDD3B-\\uDD3E\\uDD40-\\uDD44\\uDD46\\uDD4A-\\uDD50\\uDD52-\\uDEA5\\uDEA8-\\uDEC0\\uDEC2-\\uDEDA\\uDEDC-\\uDEFA\\uDEFC-\\uDF14\\uDF16-\\uDF34\\uDF36-\\uDF4E\\uDF50-\\uDF6E\\uDF70-\\uDF88\\uDF8A-\\uDFA8\\uDFAA-\\uDFC2\\uDFC4-\\uDFCB]|\\uD837[\\uDF00-\\uDF1E]|\\uD838[\\uDD00-\\uDD2C\\uDD37-\\uDD3D\\uDD4E\\uDE90-\\uDEAD\\uDEC0-\\uDEEB]|\\uD839[\\uDFE0-\\uDFE6\\uDFE8-\\uDFEB\\uDFED\\uDFEE\\uDFF0-\\uDFFE]|\\uD83A[\\uDC00-\\uDCC4\\uDD00-\\uDD43\\uDD4B]|\\uD83B[\\uDE00-\\uDE03\\uDE05-\\uDE1F\\uDE21\\uDE22\\uDE24\\uDE27\\uDE29-\\uDE32\\uDE34-\\uDE37\\uDE39\\uDE3B\\uDE42\\uDE47\\uDE49\\uDE4B\\uDE4D-\\uDE4F\\uDE51\\uDE52\\uDE54\\uDE57\\uDE59\\uDE5B\\uDE5D\\uDE5F\\uDE61\\uDE62\\uDE64\\uDE67-\\uDE6A\\uDE6C-\\uDE72\\uDE74-\\uDE77\\uDE79-\\uDE7C\\uDE7E\\uDE80-\\uDE89\\uDE8B-\\uDE9B\\uDEA1-\\uDEA3\\uDEA5-\\uDEA9\\uDEAB-\\uDEBB]|\\uD869[\\uDC00-\\uDEDF\\uDF00-\\uDFFF]|\\uD86D[\\uDC00-\\uDF38\\uDF40-\\uDFFF]|\\uD86E[\\uDC00-\\uDC1D\\uDC20-\\uDFFF]|\\uD873[\\uDC00-\\uDEA1\\uDEB0-\\uDFFF]|\\uD87A[\\uDC00-\\uDFE0]|\\uD87E[\\uDC00-\\uDE1D]|\\uD884[\\uDC00-\\uDF4A])\\S*/g;\n/**\n * Transforms text to title case.\n * Capitalizes the first letter of each word and transforms the\n * rest of the word to lower case.\n * Words are delimited by any whitespace character, such as a space, tab, or line-feed character.\n *\n * @see `LowerCasePipe`\n * @see `UpperCasePipe`\n *\n * @usageNotes\n * The following example shows the result of transforming various strings into title case.\n *\n * \n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass TitleCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(TitleCasePipe, value);\n }\n return value.replace(unicodeWordMatch, (txt => txt[0].toUpperCase() + txt.slice(1).toLowerCase()));\n }\n}\nTitleCasePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: TitleCasePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nTitleCasePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"14.2.0\", ngImport: i0, type: TitleCasePipe, isStandalone: true, name: \"titlecase\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: TitleCasePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'titlecase',\n standalone: true,\n }]\n }] });\n/**\n * Transforms text to all upper case.\n * @see `LowerCasePipe`\n * @see `TitleCasePipe`\n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass UpperCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(UpperCasePipe, value);\n }\n return value.toUpperCase();\n }\n}\nUpperCasePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: UpperCasePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nUpperCasePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"14.2.0\", ngImport: i0, type: UpperCasePipe, isStandalone: true, name: \"uppercase\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: UpperCasePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'uppercase',\n standalone: true,\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Optionally-provided default timezone to use for all instances of `DatePipe` (such as `'+0430'`).\n * If the value isn't provided, the `DatePipe` will use the end-user's local system timezone.\n */\nconst DATE_PIPE_DEFAULT_TIMEZONE = new InjectionToken('DATE_PIPE_DEFAULT_TIMEZONE');\n// clang-format off\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a date value according to locale rules.\n *\n * `DatePipe` is executed only when it detects a pure change to the input value.\n * A pure change is either a change to a primitive input value\n * (such as `String`, `Number`, `Boolean`, or `Symbol`),\n * or a changed object reference (such as `Date`, `Array`, `Function`, or `Object`).\n *\n * Note that mutating a `Date` object does not cause the pipe to be rendered again.\n * To ensure that the pipe is executed, you must create a new `Date` object.\n *\n * Only the `en-US` locale data comes with Angular. To localize dates\n * in another language, you must import the corresponding locale data.\n * See the [I18n guide](guide/i18n-common-format-data-locale) for more information.\n *\n * The time zone of the formatted value can be specified either by passing it in as the second\n * parameter of the pipe, or by setting the default through the `DATE_PIPE_DEFAULT_TIMEZONE`\n * injection token. The value that is passed in as the second parameter takes precedence over\n * the one defined using the injection token.\n *\n * @see `formatDate()`\n *\n *\n * @usageNotes\n *\n * The result of this pipe is not reevaluated when the input is mutated. To avoid the need to\n * reformat the date on every change-detection cycle, treat the date as an immutable object\n * and change the reference when the pipe needs to run again.\n *\n * ### Pre-defined format options\n *\n * | Option | Equivalent to | Examples (given in `en-US` locale) |\n * |---------------|-------------------------------------|-------------------------------------------------|\n * | `'short'` | `'M/d/yy, h:mm a'` | `6/15/15, 9:03 AM` |\n * | `'medium'` | `'MMM d, y, h:mm:ss a'` | `Jun 15, 2015, 9:03:01 AM` |\n * | `'long'` | `'MMMM d, y, h:mm:ss a z'` | `June 15, 2015 at 9:03:01 AM GMT+1` |\n * | `'full'` | `'EEEE, MMMM d, y, h:mm:ss a zzzz'` | `Monday, June 15, 2015 at 9:03:01 AM GMT+01:00` |\n * | `'shortDate'` | `'M/d/yy'` | `6/15/15` |\n * | `'mediumDate'`| `'MMM d, y'` | `Jun 15, 2015` |\n * | `'longDate'` | `'MMMM d, y'` | `June 15, 2015` |\n * | `'fullDate'` | `'EEEE, MMMM d, y'` | `Monday, June 15, 2015` |\n * | `'shortTime'` | `'h:mm a'` | `9:03 AM` |\n * | `'mediumTime'`| `'h:mm:ss a'` | `9:03:01 AM` |\n * | `'longTime'` | `'h:mm:ss a z'` | `9:03:01 AM GMT+1` |\n * | `'fullTime'` | `'h:mm:ss a zzzz'` | `9:03:01 AM GMT+01:00` |\n *\n * ### Custom format options\n *\n * You can construct a format string using symbols to specify the components\n * of a date-time value, as described in the following table.\n * Format details depend on the locale.\n * Fields marked with (*) are only available in the extra data set for the given locale.\n *\n * | Field type | Format | Description | Example Value |\n * |-------------------- |-------------|---------------------------------------------------------------|------------------------------------------------------------|\n * | Era | G, GG & GGG | Abbreviated | AD |\n * | | GGGG | Wide | Anno Domini |\n * | | GGGGG | Narrow | A |\n * | Year | y | Numeric: minimum digits | 2, 20, 201, 2017, 20173 |\n * | | yy | Numeric: 2 digits + zero padded | 02, 20, 01, 17, 73 |\n * | | yyy | Numeric: 3 digits + zero padded | 002, 020, 201, 2017, 20173 |\n * | | yyyy | Numeric: 4 digits or more + zero padded | 0002, 0020, 0201, 2017, 20173 |\n * | Week-numbering year | Y | Numeric: minimum digits | 2, 20, 201, 2017, 20173 |\n * | | YY | Numeric: 2 digits + zero padded | 02, 20, 01, 17, 73 |\n * | | YYY | Numeric: 3 digits + zero padded | 002, 020, 201, 2017, 20173 |\n * | | YYYY | Numeric: 4 digits or more + zero padded | 0002, 0020, 0201, 2017, 20173 |\n * | Month | M | Numeric: 1 digit | 9, 12 |\n * | | MM | Numeric: 2 digits + zero padded | 09, 12 |\n * | | MMM | Abbreviated | Sep |\n * | | MMMM | Wide | September |\n * | | MMMMM | Narrow | S |\n * | Month standalone | L | Numeric: 1 digit | 9, 12 |\n * | | LL | Numeric: 2 digits + zero padded | 09, 12 |\n * | | LLL | Abbreviated | Sep |\n * | | LLLL | Wide | September |\n * | | LLLLL | Narrow | S |\n * | Week of year | w | Numeric: minimum digits | 1... 53 |\n * | | ww | Numeric: 2 digits + zero padded | 01... 53 |\n * | Week of month | W | Numeric: 1 digit | 1... 5 |\n * | Day of month | d | Numeric: minimum digits | 1 |\n * | | dd | Numeric: 2 digits + zero padded | 01 |\n * | Week day | E, EE & EEE | Abbreviated | Tue |\n * | | EEEE | Wide | Tuesday |\n * | | EEEEE | Narrow | T |\n * | | EEEEEE | Short | Tu |\n * | Week day standalone | c, cc | Numeric: 1 digit | 2 |\n * | | ccc | Abbreviated | Tue |\n * | | cccc | Wide | Tuesday |\n * | | ccccc | Narrow | T |\n * | | cccccc | Short | Tu |\n * | Period | a, aa & aaa | Abbreviated | am/pm or AM/PM |\n * | | aaaa | Wide (fallback to `a` when missing) | ante meridiem/post meridiem |\n * | | aaaaa | Narrow | a/p |\n * | Period* | B, BB & BBB | Abbreviated | mid. |\n * | | BBBB | Wide | am, pm, midnight, noon, morning, afternoon, evening, night |\n * | | BBBBB | Narrow | md |\n * | Period standalone* | b, bb & bbb | Abbreviated | mid. |\n * | | bbbb | Wide | am, pm, midnight, noon, morning, afternoon, evening, night |\n * | | bbbbb | Narrow | md |\n * | Hour 1-12 | h | Numeric: minimum digits | 1, 12 |\n * | | hh | Numeric: 2 digits + zero padded | 01, 12 |\n * | Hour 0-23 | H | Numeric: minimum digits | 0, 23 |\n * | | HH | Numeric: 2 digits + zero padded | 00, 23 |\n * | Minute | m | Numeric: minimum digits | 8, 59 |\n * | | mm | Numeric: 2 digits + zero padded | 08, 59 |\n * | Second | s | Numeric: minimum digits | 0... 59 |\n * | | ss | Numeric: 2 digits + zero padded | 00... 59 |\n * | Fractional seconds | S | Numeric: 1 digit | 0... 9 |\n * | | SS | Numeric: 2 digits + zero padded | 00... 99 |\n * | | SSS | Numeric: 3 digits + zero padded (= milliseconds) | 000... 999 |\n * | Zone | z, zz & zzz | Short specific non location format (fallback to O) | GMT-8 |\n * | | zzzz | Long specific non location format (fallback to OOOO) | GMT-08:00 |\n * | | Z, ZZ & ZZZ | ISO8601 basic format | -0800 |\n * | | ZZZZ | Long localized GMT format | GMT-8:00 |\n * | | ZZZZZ | ISO8601 extended format + Z indicator for offset 0 (= XXXXX) | -08:00 |\n * | | O, OO & OOO | Short localized GMT format | GMT-8 |\n * | | OOOO | Long localized GMT format | GMT-08:00 |\n *\n *\n * ### Format examples\n *\n * These examples transform a date into various formats,\n * assuming that `dateObj` is a JavaScript `Date` object for\n * year: 2015, month: 6, day: 15, hour: 21, minute: 43, second: 11,\n * given in the local time for the `en-US` locale.\n *\n * ```\n * {{ dateObj | date }} // output is 'Jun 15, 2015'\n * {{ dateObj | date:'medium' }} // output is 'Jun 15, 2015, 9:43:11 PM'\n * {{ dateObj | date:'shortTime' }} // output is '9:43 PM'\n * {{ dateObj | date:'mm:ss' }} // output is '43:11'\n * ```\n *\n * ### Usage example\n *\n * The following component uses a date pipe to display the current date in different formats.\n *\n * ```\n * @Component({\n * selector: 'date-pipe',\n * template: `\n *
Today is {{today | date}}
\n *
Or if you prefer, {{today | date:'fullDate'}}
\n *
The time is {{today | date:'h:mm a z'}}
\n *
`\n * })\n * // Get the current date and time as a date-time value.\n * export class DatePipeComponent {\n * today: number = Date.now();\n * }\n * ```\n *\n * @publicApi\n */\n// clang-format on\nclass DatePipe {\n constructor(locale, defaultTimezone) {\n this.locale = locale;\n this.defaultTimezone = defaultTimezone;\n }\n transform(value, format = 'mediumDate', timezone, locale) {\n var _a;\n if (value == null || value === '' || value !== value)\n return null;\n try {\n return formatDate(value, format, locale || this.locale, (_a = timezone !== null && timezone !== void 0 ? timezone : this.defaultTimezone) !== null && _a !== void 0 ? _a : undefined);\n }\n catch (error) {\n throw invalidPipeArgumentError(DatePipe, error.message);\n }\n }\n}\nDatePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: DatePipe, deps: [{ token: LOCALE_ID }, { token: DATE_PIPE_DEFAULT_TIMEZONE, optional: true }], target: i0.ɵɵFactoryTarget.Pipe });\nDatePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"14.2.0\", ngImport: i0, type: DatePipe, isStandalone: true, name: \"date\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: DatePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'date',\n pure: true,\n standalone: true,\n }]\n }], ctorParameters: function () {\n return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [DATE_PIPE_DEFAULT_TIMEZONE]\n }, {\n type: Optional\n }] }];\n } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst _INTERPOLATION_REGEXP = /#/g;\n/**\n * @ngModule CommonModule\n * @description\n *\n * Maps a value to a string that pluralizes the value according to locale rules.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/pipes/ts/i18n_pipe.ts region='I18nPluralPipeComponent'}\n *\n * @publicApi\n */\nclass I18nPluralPipe {\n constructor(_localization) {\n this._localization = _localization;\n }\n /**\n * @param value the number to be formatted\n * @param pluralMap an object that mimics the ICU format, see\n * http://userguide.icu-project.org/formatparse/messages.\n * @param locale a `string` defining the locale to use (uses the current {@link LOCALE_ID} by\n * default).\n */\n transform(value, pluralMap, locale) {\n if (value == null)\n return '';\n if (typeof pluralMap !== 'object' || pluralMap === null) {\n throw invalidPipeArgumentError(I18nPluralPipe, pluralMap);\n }\n const key = getPluralCategory(value, Object.keys(pluralMap), this._localization, locale);\n return pluralMap[key].replace(_INTERPOLATION_REGEXP, value.toString());\n }\n}\nI18nPluralPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: I18nPluralPipe, deps: [{ token: NgLocalization }], target: i0.ɵɵFactoryTarget.Pipe });\nI18nPluralPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"14.2.0\", ngImport: i0, type: I18nPluralPipe, isStandalone: true, name: \"i18nPlural\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: I18nPluralPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'i18nPlural',\n pure: true,\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: NgLocalization }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n * @description\n *\n * Generic selector that displays the string that matches the current value.\n *\n * If none of the keys of the `mapping` match the `value`, then the content\n * of the `other` key is returned when present, otherwise an empty string is returned.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/pipes/ts/i18n_pipe.ts region='I18nSelectPipeComponent'}\n *\n * @publicApi\n */\nclass I18nSelectPipe {\n /**\n * @param value a string to be internationalized.\n * @param mapping an object that indicates the text that should be displayed\n * for different values of the provided `value`.\n */\n transform(value, mapping) {\n if (value == null)\n return '';\n if (typeof mapping !== 'object' || typeof value !== 'string') {\n throw invalidPipeArgumentError(I18nSelectPipe, mapping);\n }\n if (mapping.hasOwnProperty(value)) {\n return mapping[value];\n }\n if (mapping.hasOwnProperty('other')) {\n return mapping['other'];\n }\n return '';\n }\n}\nI18nSelectPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: I18nSelectPipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nI18nSelectPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"14.2.0\", ngImport: i0, type: I18nSelectPipe, isStandalone: true, name: \"i18nSelect\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: I18nSelectPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'i18nSelect',\n pure: true,\n standalone: true,\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n * @description\n *\n * Converts a value into its JSON-format representation. Useful for debugging.\n *\n * @usageNotes\n *\n * The following component uses a JSON pipe to convert an object\n * to JSON format, and displays the string in both formats for comparison.\n *\n * {@example common/pipes/ts/json_pipe.ts region='JsonPipe'}\n *\n * @publicApi\n */\nclass JsonPipe {\n /**\n * @param value A value of any type to convert into a JSON-format string.\n */\n transform(value) {\n return JSON.stringify(value, null, 2);\n }\n}\nJsonPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: JsonPipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nJsonPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"14.2.0\", ngImport: i0, type: JsonPipe, isStandalone: true, name: \"json\", pure: false });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: JsonPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'json',\n pure: false,\n standalone: true,\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction makeKeyValuePair(key, value) {\n return { key: key, value: value };\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms Object or Map into an array of key value pairs.\n *\n * The output array will be ordered by keys.\n * By default the comparator will be by Unicode point value.\n * You can optionally pass a compareFn if your keys are complex types.\n *\n * @usageNotes\n * ### Examples\n *\n * This examples show how an Object or a Map can be iterated by ngFor with the use of this\n * keyvalue pipe.\n *\n * {@example common/pipes/ts/keyvalue_pipe.ts region='KeyValuePipe'}\n *\n * @publicApi\n */\nclass KeyValuePipe {\n constructor(differs) {\n this.differs = differs;\n this.keyValues = [];\n this.compareFn = defaultComparator;\n }\n transform(input, compareFn = defaultComparator) {\n if (!input || (!(input instanceof Map) && typeof input !== 'object')) {\n return null;\n }\n if (!this.differ) {\n // make a differ for whatever type we've been passed in\n this.differ = this.differs.find(input).create();\n }\n const differChanges = this.differ.diff(input);\n const compareFnChanged = compareFn !== this.compareFn;\n if (differChanges) {\n this.keyValues = [];\n differChanges.forEachItem((r) => {\n this.keyValues.push(makeKeyValuePair(r.key, r.currentValue));\n });\n }\n if (differChanges || compareFnChanged) {\n this.keyValues.sort(compareFn);\n this.compareFn = compareFn;\n }\n return this.keyValues;\n }\n}\nKeyValuePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: KeyValuePipe, deps: [{ token: i0.KeyValueDiffers }], target: i0.ɵɵFactoryTarget.Pipe });\nKeyValuePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"14.2.0\", ngImport: i0, type: KeyValuePipe, isStandalone: true, name: \"keyvalue\", pure: false });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: KeyValuePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'keyvalue',\n pure: false,\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.KeyValueDiffers }]; } });\nfunction defaultComparator(keyValueA, keyValueB) {\n const a = keyValueA.key;\n const b = keyValueB.key;\n // if same exit with 0;\n if (a === b)\n return 0;\n // make sure that undefined are at the end of the sort.\n if (a === undefined)\n return 1;\n if (b === undefined)\n return -1;\n // make sure that nulls are at the end of the sort.\n if (a === null)\n return 1;\n if (b === null)\n return -1;\n if (typeof a == 'string' && typeof b == 'string') {\n return a < b ? -1 : 1;\n }\n if (typeof a == 'number' && typeof b == 'number') {\n return a - b;\n }\n if (typeof a == 'boolean' && typeof b == 'boolean') {\n return a < b ? -1 : 1;\n }\n // `a` and `b` are of different types. Compare their string values.\n const aString = String(a);\n const bString = String(b);\n return aString == bString ? 0 : aString < bString ? -1 : 1;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a value according to digit options and locale rules.\n * Locale determines group sizing and separator,\n * decimal point character, and other locale-specific configurations.\n *\n * @see `formatNumber()`\n *\n * @usageNotes\n *\n * ### digitsInfo\n *\n * The value's decimal representation is specified by the `digitsInfo`\n * parameter, written in the following format: \n *\n * ```\n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}\n * ```\n *\n * - `minIntegerDigits`:\n * The minimum number of integer digits before the decimal point.\n * Default is 1.\n *\n * - `minFractionDigits`:\n * The minimum number of digits after the decimal point.\n * Default is 0.\n *\n * - `maxFractionDigits`:\n * The maximum number of digits after the decimal point.\n * Default is 3.\n *\n * If the formatted value is truncated it will be rounded using the \"to-nearest\" method:\n *\n * ```\n * {{3.6 | number: '1.0-0'}}\n * \n *\n * {{-3.6 | number:'1.0-0'}}\n * \n * ```\n *\n * ### locale\n *\n * `locale` will format a value according to locale rules.\n * Locale determines group sizing and separator,\n * decimal point character, and other locale-specific configurations.\n *\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n *\n * See [Setting your app locale](guide/i18n-common-locale-id).\n *\n * ### Example\n *\n * The following code shows how the pipe transforms values\n * according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *\n * @publicApi\n */\nclass DecimalPipe {\n constructor(_locale) {\n this._locale = _locale;\n }\n /**\n * @param value The value to be formatted.\n * @param digitsInfo Sets digit and decimal representation.\n * [See more](#digitsinfo).\n * @param locale Specifies what locale format rules to use.\n * [See more](#locale).\n */\n transform(value, digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale = locale || this._locale;\n try {\n const num = strToNumber(value);\n return formatNumber(num, locale, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(DecimalPipe, error.message);\n }\n }\n}\nDecimalPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: DecimalPipe, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Pipe });\nDecimalPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"14.2.0\", ngImport: i0, type: DecimalPipe, isStandalone: true, name: \"number\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: DecimalPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'number',\n standalone: true,\n }]\n }], ctorParameters: function () {\n return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }];\n } });\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms a number to a percentage\n * string, formatted according to locale rules that determine group sizing and\n * separator, decimal-point character, and other locale-specific\n * configurations.\n *\n * @see `formatPercent()`\n *\n * @usageNotes\n * The following code shows how the pipe transforms numbers\n * into text strings, according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *\n * @publicApi\n */\nclass PercentPipe {\n constructor(_locale) {\n this._locale = _locale;\n }\n /**\n *\n * @param value The number to be formatted as a percentage.\n * @param digitsInfo Decimal representation options, specified by a string\n * in the following format: \n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}
.\n * - `minIntegerDigits`: The minimum number of integer digits before the decimal point.\n * Default is `1`.\n * - `minFractionDigits`: The minimum number of digits after the decimal point.\n * Default is `0`.\n * - `maxFractionDigits`: The maximum number of digits after the decimal point.\n * Default is `0`.\n * @param locale A locale code for the locale format rules to use.\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n * See [Setting your app locale](guide/i18n-common-locale-id).\n */\n transform(value, digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale = locale || this._locale;\n try {\n const num = strToNumber(value);\n return formatPercent(num, locale, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(PercentPipe, error.message);\n }\n }\n}\nPercentPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: PercentPipe, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Pipe });\nPercentPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"14.2.0\", ngImport: i0, type: PercentPipe, isStandalone: true, name: \"percent\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: PercentPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'percent',\n standalone: true,\n }]\n }], ctorParameters: function () {\n return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }];\n } });\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms a number to a currency string, formatted according to locale rules\n * that determine group sizing and separator, decimal-point character,\n * and other locale-specific configurations.\n *\n * {@a currency-code-deprecation}\n * \n *\n * **Deprecation notice:**\n *\n * The default currency code is currently always `USD` but this is deprecated from v9.\n *\n * **In v11 the default currency code will be taken from the current locale identified by\n * the `LOCALE_ID` token. See the [i18n guide](guide/i18n-common-locale-id) for\n * more information.**\n *\n * If you need the previous behavior then set it by creating a `DEFAULT_CURRENCY_CODE` provider in\n * your application `NgModule`:\n *\n * ```ts\n * {provide: DEFAULT_CURRENCY_CODE, useValue: 'USD'}\n * ```\n *\n *
\n *\n * @see `getCurrencySymbol()`\n * @see `formatCurrency()`\n *\n * @usageNotes\n * The following code shows how the pipe transforms numbers\n * into text strings, according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *\n * @publicApi\n */\nclass CurrencyPipe {\n constructor(_locale, _defaultCurrencyCode = 'USD') {\n this._locale = _locale;\n this._defaultCurrencyCode = _defaultCurrencyCode;\n }\n /**\n *\n * @param value The number to be formatted as currency.\n * @param currencyCode The [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217) currency code,\n * such as `USD` for the US dollar and `EUR` for the euro. The default currency code can be\n * configured using the `DEFAULT_CURRENCY_CODE` injection token.\n * @param display The format for the currency indicator. One of the following:\n * - `code`: Show the code (such as `USD`).\n * - `symbol`(default): Show the symbol (such as `$`).\n * - `symbol-narrow`: Use the narrow symbol for locales that have two symbols for their\n * currency.\n * For example, the Canadian dollar CAD has the symbol `CA$` and the symbol-narrow `$`. If the\n * locale has no narrow symbol, uses the standard symbol for the locale.\n * - String: Use the given string value instead of a code or a symbol.\n * For example, an empty string will suppress the currency & symbol.\n * - Boolean (marked deprecated in v5): `true` for symbol and false for `code`.\n *\n * @param digitsInfo Decimal representation options, specified by a string\n * in the following format: \n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}
.\n * - `minIntegerDigits`: The minimum number of integer digits before the decimal point.\n * Default is `1`.\n * - `minFractionDigits`: The minimum number of digits after the decimal point.\n * Default is `2`.\n * - `maxFractionDigits`: The maximum number of digits after the decimal point.\n * Default is `2`.\n * If not provided, the number will be formatted with the proper amount of digits,\n * depending on what the [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217) specifies.\n * For example, the Canadian dollar has 2 digits, whereas the Chilean peso has none.\n * @param locale A locale code for the locale format rules to use.\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n * See [Setting your app locale](guide/i18n-common-locale-id).\n */\n transform(value, currencyCode = this._defaultCurrencyCode, display = 'symbol', digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale = locale || this._locale;\n if (typeof display === 'boolean') {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && console && console.warn) {\n console.warn(`Warning: the currency pipe has been changed in Angular v5. The symbolDisplay option (third parameter) is now a string instead of a boolean. The accepted values are \"code\", \"symbol\" or \"symbol-narrow\".`);\n }\n display = display ? 'symbol' : 'code';\n }\n let currency = currencyCode || this._defaultCurrencyCode;\n if (display !== 'code') {\n if (display === 'symbol' || display === 'symbol-narrow') {\n currency = getCurrencySymbol(currency, display === 'symbol' ? 'wide' : 'narrow', locale);\n }\n else {\n currency = display;\n }\n }\n try {\n const num = strToNumber(value);\n return formatCurrency(num, locale, currency, currencyCode, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(CurrencyPipe, error.message);\n }\n }\n}\nCurrencyPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: CurrencyPipe, deps: [{ token: LOCALE_ID }, { token: DEFAULT_CURRENCY_CODE }], target: i0.ɵɵFactoryTarget.Pipe });\nCurrencyPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"14.2.0\", ngImport: i0, type: CurrencyPipe, isStandalone: true, name: \"currency\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: CurrencyPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'currency',\n standalone: true,\n }]\n }], ctorParameters: function () {\n return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [DEFAULT_CURRENCY_CODE]\n }] }];\n } });\nfunction isValue(value) {\n return !(value == null || value === '' || value !== value);\n}\n/**\n * Transforms a string into a number (if needed).\n */\nfunction strToNumber(value) {\n // Convert strings to numbers\n if (typeof value === 'string' && !isNaN(Number(value) - parseFloat(value))) {\n return Number(value);\n }\n if (typeof value !== 'number') {\n throw new Error(`${value} is not a number`);\n }\n return value;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n * @description\n *\n * Creates a new `Array` or `String` containing a subset (slice) of the elements.\n *\n * @usageNotes\n *\n * All behavior is based on the expected behavior of the JavaScript API `Array.prototype.slice()`\n * and `String.prototype.slice()`.\n *\n * When operating on an `Array`, the returned `Array` is always a copy even when all\n * the elements are being returned.\n *\n * When operating on a blank value, the pipe returns the blank value.\n *\n * ### List Example\n *\n * This `ngFor` example:\n *\n * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_list'}\n *\n * produces the following:\n *\n * ```html\n * b \n * c \n * ```\n *\n * ### String Examples\n *\n * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_string'}\n *\n * @publicApi\n */\nclass SlicePipe {\n transform(value, start, end) {\n if (value == null)\n return null;\n if (!this.supports(value)) {\n throw invalidPipeArgumentError(SlicePipe, value);\n }\n return value.slice(start, end);\n }\n supports(obj) {\n return typeof obj === 'string' || Array.isArray(obj);\n }\n}\nSlicePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: SlicePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nSlicePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"14.2.0\", ngImport: i0, type: SlicePipe, isStandalone: true, name: \"slice\", pure: false });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: SlicePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'slice',\n pure: false,\n standalone: true,\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A collection of Angular pipes that are likely to be used in each and every application.\n */\nconst COMMON_PIPES = [\n AsyncPipe,\n UpperCasePipe,\n LowerCasePipe,\n JsonPipe,\n SlicePipe,\n DecimalPipe,\n PercentPipe,\n TitleCasePipe,\n CurrencyPipe,\n DatePipe,\n I18nPluralPipe,\n I18nSelectPipe,\n KeyValuePipe,\n];\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Note: This does not contain the location providers,\n// as they need some platform specific implementations to work.\n/**\n * Exports all the basic Angular directives and pipes,\n * such as `NgIf`, `NgForOf`, `DecimalPipe`, and so on.\n * Re-exported by `BrowserModule`, which is included automatically in the root\n * `AppModule` when you create a new app with the CLI `new` command.\n *\n * @publicApi\n */\nclass CommonModule {\n}\nCommonModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: CommonModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nCommonModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"14.2.0\", ngImport: i0, type: CommonModule, imports: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe], exports: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe] });\nCommonModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: CommonModule });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: CommonModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [COMMON_DIRECTIVES, COMMON_PIPES],\n exports: [COMMON_DIRECTIVES, COMMON_PIPES],\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst PLATFORM_BROWSER_ID = 'browser';\nconst PLATFORM_SERVER_ID = 'server';\nconst PLATFORM_WORKER_APP_ID = 'browserWorkerApp';\nconst PLATFORM_WORKER_UI_ID = 'browserWorkerUi';\n/**\n * Returns whether a platform id represents a browser platform.\n * @publicApi\n */\nfunction isPlatformBrowser(platformId) {\n return platformId === PLATFORM_BROWSER_ID;\n}\n/**\n * Returns whether a platform id represents a server platform.\n * @publicApi\n */\nfunction isPlatformServer(platformId) {\n return platformId === PLATFORM_SERVER_ID;\n}\n/**\n * Returns whether a platform id represents a web worker app platform.\n * @publicApi\n */\nfunction isPlatformWorkerApp(platformId) {\n return platformId === PLATFORM_WORKER_APP_ID;\n}\n/**\n * Returns whether a platform id represents a web worker UI platform.\n * @publicApi\n */\nfunction isPlatformWorkerUi(platformId) {\n return platformId === PLATFORM_WORKER_UI_ID;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @publicApi\n */\nconst VERSION = new Version('14.2.0');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Defines a scroll position manager. Implemented by `BrowserViewportScroller`.\n *\n * @publicApi\n */\nclass ViewportScroller {\n}\n// De-sugared tree-shakable injection\n// See #23917\n/** @nocollapse */\nViewportScroller.ɵprov = ɵɵdefineInjectable({\n token: ViewportScroller,\n providedIn: 'root',\n factory: () => new BrowserViewportScroller(ɵɵinject(DOCUMENT), window)\n});\n/**\n * Manages the scroll position for a browser window.\n */\nclass BrowserViewportScroller {\n constructor(document, window) {\n this.document = document;\n this.window = window;\n this.offset = () => [0, 0];\n }\n /**\n * Configures the top offset used when scrolling to an anchor.\n * @param offset A position in screen coordinates (a tuple with x and y values)\n * or a function that returns the top offset position.\n *\n */\n setOffset(offset) {\n if (Array.isArray(offset)) {\n this.offset = () => offset;\n }\n else {\n this.offset = offset;\n }\n }\n /**\n * Retrieves the current scroll position.\n * @returns The position in screen coordinates.\n */\n getScrollPosition() {\n if (this.supportsScrolling()) {\n return [this.window.pageXOffset, this.window.pageYOffset];\n }\n else {\n return [0, 0];\n }\n }\n /**\n * Sets the scroll position.\n * @param position The new position in screen coordinates.\n */\n scrollToPosition(position) {\n if (this.supportsScrolling()) {\n this.window.scrollTo(position[0], position[1]);\n }\n }\n /**\n * Scrolls to an element and attempts to focus the element.\n *\n * Note that the function name here is misleading in that the target string may be an ID for a\n * non-anchor element.\n *\n * @param target The ID of an element or name of the anchor.\n *\n * @see https://html.spec.whatwg.org/#the-indicated-part-of-the-document\n * @see https://html.spec.whatwg.org/#scroll-to-fragid\n */\n scrollToAnchor(target) {\n if (!this.supportsScrolling()) {\n return;\n }\n const elSelected = findAnchorFromDocument(this.document, target);\n if (elSelected) {\n this.scrollToElement(elSelected);\n // After scrolling to the element, the spec dictates that we follow the focus steps for the\n // target. Rather than following the robust steps, simply attempt focus.\n //\n // @see https://html.spec.whatwg.org/#get-the-focusable-area\n // @see https://developer.mozilla.org/en-US/docs/Web/API/HTMLOrForeignElement/focus\n // @see https://html.spec.whatwg.org/#focusable-area\n elSelected.focus();\n }\n }\n /**\n * Disables automatic scroll restoration provided by the browser.\n */\n setHistoryScrollRestoration(scrollRestoration) {\n if (this.supportScrollRestoration()) {\n const history = this.window.history;\n if (history && history.scrollRestoration) {\n history.scrollRestoration = scrollRestoration;\n }\n }\n }\n /**\n * Scrolls to an element using the native offset and the specified offset set on this scroller.\n *\n * The offset can be used when we know that there is a floating header and scrolling naively to an\n * element (ex: `scrollIntoView`) leaves the element hidden behind the floating header.\n */\n scrollToElement(el) {\n const rect = el.getBoundingClientRect();\n const left = rect.left + this.window.pageXOffset;\n const top = rect.top + this.window.pageYOffset;\n const offset = this.offset();\n this.window.scrollTo(left - offset[0], top - offset[1]);\n }\n /**\n * We only support scroll restoration when we can get a hold of window.\n * This means that we do not support this behavior when running in a web worker.\n *\n * Lifting this restriction right now would require more changes in the dom adapter.\n * Since webworkers aren't widely used, we will lift it once RouterScroller is\n * battle-tested.\n */\n supportScrollRestoration() {\n try {\n if (!this.supportsScrolling()) {\n return false;\n }\n // The `scrollRestoration` property could be on the `history` instance or its prototype.\n const scrollRestorationDescriptor = getScrollRestorationProperty(this.window.history) ||\n getScrollRestorationProperty(Object.getPrototypeOf(this.window.history));\n // We can write to the `scrollRestoration` property if it is a writable data field or it has a\n // setter function.\n return !!scrollRestorationDescriptor &&\n !!(scrollRestorationDescriptor.writable || scrollRestorationDescriptor.set);\n }\n catch (_a) {\n return false;\n }\n }\n supportsScrolling() {\n try {\n return !!this.window && !!this.window.scrollTo && 'pageXOffset' in this.window;\n }\n catch (_a) {\n return false;\n }\n }\n}\nfunction getScrollRestorationProperty(obj) {\n return Object.getOwnPropertyDescriptor(obj, 'scrollRestoration');\n}\nfunction findAnchorFromDocument(document, target) {\n const documentResult = document.getElementById(target) || document.getElementsByName(target)[0];\n if (documentResult) {\n return documentResult;\n }\n // `getElementById` and `getElementsByName` won't pierce through the shadow DOM so we\n // have to traverse the DOM manually and do the lookup through the shadow roots.\n if (typeof document.createTreeWalker === 'function' && document.body &&\n (document.body.createShadowRoot || document.body.attachShadow)) {\n const treeWalker = document.createTreeWalker(document.body, NodeFilter.SHOW_ELEMENT);\n let currentNode = treeWalker.currentNode;\n while (currentNode) {\n const shadowRoot = currentNode.shadowRoot;\n if (shadowRoot) {\n // Note that `ShadowRoot` doesn't support `getElementsByName`\n // so we have to fall back to `querySelector`.\n const result = shadowRoot.getElementById(target) || shadowRoot.querySelector(`[name=\"${target}\"]`);\n if (result) {\n return result;\n }\n }\n currentNode = treeWalker.nextNode();\n }\n }\n return null;\n}\n/**\n * Provides an empty implementation of the viewport scroller.\n */\nclass NullViewportScroller {\n /**\n * Empty implementation\n */\n setOffset(offset) { }\n /**\n * Empty implementation\n */\n getScrollPosition() {\n return [0, 0];\n }\n /**\n * Empty implementation\n */\n scrollToPosition(position) { }\n /**\n * Empty implementation\n */\n scrollToAnchor(anchor) { }\n /**\n * Empty implementation\n */\n setHistoryScrollRestoration(scrollRestoration) { }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A wrapper around the `XMLHttpRequest` constructor.\n *\n * @publicApi\n */\nclass XhrFactory {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Asserts that the application is in development mode. Throws an error if the application is in\n * production mode. This assert can be used to make sure that there is no dev-mode code invoked in\n * the prod mode accidentally.\n */\nfunction assertDevMode(checkName) {\n if (!ngDevMode) {\n throw new ɵRuntimeError(2958 /* RuntimeErrorCode.UNEXPECTED_DEV_MODE_CHECK_IN_PROD_MODE */, `Unexpected invocation of the ${checkName} in the prod mode. ` +\n `Please make sure that the prod mode is enabled for production builds.`);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Assembles directive details string, useful for error messages.\nfunction imgDirectiveDetails(rawSrc, includeRawSrc = true) {\n const rawSrcInfo = includeRawSrc ? `(activated on an element with the \\`rawSrc=\"${rawSrc}\"\\`) ` : '';\n return `The NgOptimizedImage directive ${rawSrcInfo}has detected that`;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Converts a string that represents a URL into a URL class instance.\nfunction getUrl(src, win) {\n // Don't use a base URL is the URL is absolute.\n return isAbsoluteUrl(src) ? new URL(src) : new URL(src, win.location.href);\n}\n// Checks whether a URL is absolute (i.e. starts with `http://` or `https://`).\nfunction isAbsoluteUrl(src) {\n return /^https?:\\/\\//.test(src);\n}\n// Given a URL, extract the hostname part.\n// If a URL is a relative one - the URL is returned as is.\nfunction extractHostname(url) {\n return isAbsoluteUrl(url) ? (new URL(url)).hostname : url;\n}\nfunction isValidPath(path) {\n const isString = typeof path === 'string';\n if (!isString || path.trim() === '') {\n return false;\n }\n // Calling new URL() will throw if the path string is malformed\n try {\n const url = new URL(path);\n return true;\n }\n catch (_a) {\n return false;\n }\n}\nfunction normalizePath(path) {\n return path.endsWith('/') ? path.slice(0, -1) : path;\n}\nfunction normalizeSrc(src) {\n return src.startsWith('/') ? src.slice(1) : src;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Set of origins that are always excluded from the preconnect checks.\nconst INTERNAL_PRECONNECT_CHECK_BLOCKLIST = new Set(['localhost', '127.0.0.1', '0.0.0.0']);\n/**\n * Multi-provider injection token to configure which origins should be excluded\n * from the preconnect checks. It can either be a single string or an array of strings\n * to represent a group of origins, for example:\n *\n * ```typescript\n * {provide: PRECONNECT_CHECK_BLOCKLIST, multi: true, useValue: 'https://your-domain.com'}\n * ```\n *\n * or:\n *\n * ```typescript\n * {provide: PRECONNECT_CHECK_BLOCKLIST, multi: true,\n * useValue: ['https://your-domain-1.com', 'https://your-domain-2.com']}\n * ```\n *\n * @publicApi\n * @developerPreview\n */\nconst PRECONNECT_CHECK_BLOCKLIST = new InjectionToken('PRECONNECT_CHECK_BLOCKLIST');\n/**\n * Contains the logic to detect whether an image, marked with the \"priority\" attribute\n * has a corresponding ` ` tag in the `document.head`.\n *\n * Note: this is a dev-mode only class, which should not appear in prod bundles,\n * thus there is no `ngDevMode` use in the code.\n */\nclass PreconnectLinkChecker {\n constructor() {\n /**\n * Set of tags found on this page.\n * The `null` value indicates that there was no DOM query operation performed.\n */\n this.preconnectLinks = null;\n /*\n * Keep track of all already seen origin URLs to avoid repeating the same check.\n */\n this.alreadySeen = new Set();\n this.window = null;\n this.blocklist = new Set(INTERNAL_PRECONNECT_CHECK_BLOCKLIST);\n assertDevMode('preconnect link checker');\n const win = inject(DOCUMENT).defaultView;\n if (typeof win !== 'undefined') {\n this.window = win;\n }\n const blocklist = inject(PRECONNECT_CHECK_BLOCKLIST, { optional: true });\n if (blocklist) {\n this.populateBlocklist(blocklist);\n }\n }\n populateBlocklist(origins) {\n if (Array.isArray(origins)) {\n deepForEach(origins, origin => {\n this.blocklist.add(extractHostname(origin));\n });\n }\n else {\n throw new ɵRuntimeError(2957 /* RuntimeErrorCode.INVALID_PRECONNECT_CHECK_BLOCKLIST */, `The blocklist for the preconnect check was not provided as an array. ` +\n `Check that the \\`PRECONNECT_CHECK_BLOCKLIST\\` token is configured as a \\`multi: true\\` provider.`);\n }\n }\n /**\n * Checks that a preconnect resource hint exists in the head fo rthe\n * given src.\n *\n * @param rewrittenSrc src formatted with loader\n * @param rawSrc rawSrc value\n */\n assertPreconnect(rewrittenSrc, rawSrc) {\n if (!this.window)\n return;\n const imgUrl = getUrl(rewrittenSrc, this.window);\n if (this.blocklist.has(imgUrl.hostname) || this.alreadySeen.has(imgUrl.origin))\n return;\n // Register this origin as seen, so we don't check it again later.\n this.alreadySeen.add(imgUrl.origin);\n if (!this.preconnectLinks) {\n // Note: we query for preconnect links only *once* and cache the results\n // for the entire lifespan of an application, since it's unlikely that the\n // list would change frequently. This allows to make sure there are no\n // performance implications of making extra DOM lookups for each image.\n this.preconnectLinks = this.queryPreconnectLinks();\n }\n if (!this.preconnectLinks.has(imgUrl.origin)) {\n console.warn(ɵformatRuntimeError(2956 /* RuntimeErrorCode.PRIORITY_IMG_MISSING_PRECONNECT_TAG */, `${imgDirectiveDetails(rawSrc)} there is no preconnect tag present for this image. ` +\n `Preconnecting to the origin(s) that serve priority images ensures that these ` +\n `images are delivered as soon as possible. To fix this, please add the following ` +\n `element into the of the document:\\n` +\n ` `));\n }\n }\n queryPreconnectLinks() {\n const preconnectUrls = new Set();\n const selector = 'link[rel=preconnect]';\n const links = Array.from(document.querySelectorAll(selector));\n for (let link of links) {\n const url = getUrl(link.href, this.window);\n preconnectUrls.add(url.origin);\n }\n return preconnectUrls;\n }\n ngOnDestroy() {\n var _a;\n (_a = this.preconnectLinks) === null || _a === void 0 ? void 0 : _a.clear();\n this.alreadySeen.clear();\n }\n}\nPreconnectLinkChecker.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: PreconnectLinkChecker, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nPreconnectLinkChecker.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: PreconnectLinkChecker, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: PreconnectLinkChecker, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return []; } });\n/**\n * Invokes a callback for each element in the array. Also invokes a callback\n * recursively for each nested array.\n */\nfunction deepForEach(input, fn) {\n for (let value of input) {\n Array.isArray(value) ? deepForEach(value, fn) : fn(value);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Noop image loader that does no transformation to the original src and just returns it as is.\n * This loader is used as a default one if more specific logic is not provided in an app config.\n *\n * @see `ImageLoader`\n * @see `NgOptimizedImage`\n */\nconst noopImageLoader = (config) => config.src;\n/**\n * Injection token that configures the image loader function.\n *\n * @see `ImageLoader`\n * @see `NgOptimizedImage`\n * @publicApi\n * @developerPreview\n */\nconst IMAGE_LOADER = new InjectionToken('ImageLoader', {\n providedIn: 'root',\n factory: () => noopImageLoader,\n});\n/**\n * Internal helper function that makes it easier to introduce custom image loaders for the\n * `NgOptimizedImage` directive. It is enough to specify a URL builder function to obtain full DI\n * configuration for a given loader: a DI token corresponding to the actual loader function, plus DI\n * tokens managing preconnect check functionality.\n * @param buildUrlFn a function returning a full URL based on loader's configuration\n * @param exampleUrls example of full URLs for a given loader (used in error messages)\n * @returns a set of DI providers corresponding to the configured image loader\n */\nfunction createImageLoader(buildUrlFn, exampleUrls) {\n return function provideImageLoader(path, options = { ensurePreconnect: true }) {\n if (!isValidPath(path)) {\n throwInvalidPathError(path, exampleUrls || []);\n }\n // The trailing / is stripped (if provided) to make URL construction (concatenation) easier in\n // the individual loader functions.\n path = normalizePath(path);\n const loaderFn = (config) => {\n if (isAbsoluteUrl(config.src)) {\n // Image loader functions expect an image file name (e.g. `my-image.png`)\n // or a relative path + a file name (e.g. `/a/b/c/my-image.png`) as an input,\n // so the final absolute URL can be constructed.\n // When an absolute URL is provided instead - the loader can not\n // build a final URL, thus the error is thrown to indicate that.\n throwUnexpectedAbsoluteUrlError(path, config.src);\n }\n return buildUrlFn(path, Object.assign(Object.assign({}, config), { src: normalizeSrc(config.src) }));\n };\n const providers = [{ provide: IMAGE_LOADER, useValue: loaderFn }];\n if (ngDevMode && options.ensurePreconnect === false) {\n providers.push({ provide: PRECONNECT_CHECK_BLOCKLIST, useValue: [path], multi: true });\n }\n return providers;\n };\n}\nfunction throwInvalidPathError(path, exampleUrls) {\n throw new ɵRuntimeError(2959 /* RuntimeErrorCode.INVALID_LOADER_ARGUMENTS */, ngDevMode &&\n `Image loader has detected an invalid path (\\`${path}\\`). ` +\n `To fix this, supply a path using one of the following formats: ${exampleUrls.join(' or ')}`);\n}\nfunction throwUnexpectedAbsoluteUrlError(path, url) {\n throw new ɵRuntimeError(2959 /* RuntimeErrorCode.INVALID_LOADER_ARGUMENTS */, ngDevMode &&\n `Image loader has detected a \\` \\` tag with an invalid \\`rawSrc\\` attribute: ${url}. ` +\n `This image loader expects \\`rawSrc\\` to be a relative URL - ` +\n `however the provided value is an absolute URL. ` +\n `To fix this, provide \\`rawSrc\\` as a path relative to the base URL ` +\n `configured for this loader (\\`${path}\\`).`);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Function that generates an ImageLoader for [Cloudflare Image\n * Resizing](https://developers.cloudflare.com/images/image-resizing/) and turns it into an Angular\n * provider. Note: Cloudflare has multiple image products - this provider is specifically for\n * Cloudflare Image Resizing; it will not work with Cloudflare Images or Cloudflare Polish.\n *\n * @param path Your domain name, e.g. https://mysite.com\n * @param options An object with extra configuration:\n * - `ensurePreconnect`: boolean flag indicating whether the NgOptimizedImage directive\n * should verify that there is a corresponding ` `\n * present in the document's ``.\n * @returns Provider that provides an ImageLoader function\n *\n * @publicApi\n * @developerPreview\n */\nconst provideCloudflareLoader = createImageLoader(createCloudflareUrl, ngDevMode ? ['https:///cdn-cgi/image//'] : undefined);\nfunction createCloudflareUrl(path, config) {\n let params = `format=auto`;\n if (config.width) {\n params += `,width=${config.width}`;\n }\n // Cloudflare image URLs format:\n // https://developers.cloudflare.com/images/image-resizing/url-format/\n return `${path}/cdn-cgi/image/${params}/${config.src}`;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Function that generates an ImageLoader for Cloudinary and turns it into an Angular provider.\n *\n * @param path Base URL of your Cloudinary images\n * This URL should match one of the following formats:\n * https://res.cloudinary.com/mysite\n * https://mysite.cloudinary.com\n * https://subdomain.mysite.com\n * @param options An object with extra configuration:\n * - `ensurePreconnect`: boolean flag indicating whether the NgOptimizedImage directive\n * should verify that there is a corresponding ` `\n * present in the document's ``.\n * @returns Set of providers to configure the Cloudinary loader.\n *\n * @publicApi\n * @developerPreview\n */\nconst provideCloudinaryLoader = createImageLoader(createCloudinaryUrl, ngDevMode ?\n [\n 'https://res.cloudinary.com/mysite', 'https://mysite.cloudinary.com',\n 'https://subdomain.mysite.com'\n ] :\n undefined);\nfunction createCloudinaryUrl(path, config) {\n // Cloudinary image URLformat:\n // https://cloudinary.com/documentation/image_transformations#transformation_url_structure\n // Example of a Cloudinary image URL:\n // https://res.cloudinary.com/mysite/image/upload/c_scale,f_auto,q_auto,w_600/marketing/tile-topics-m.png\n let params = `f_auto,q_auto`; // sets image format and quality to \"auto\"\n if (config.width) {\n params += `,w_${config.width}`;\n }\n return `${path}/image/upload/${params}/${config.src}`;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Function that generates an ImageLoader for ImageKit and turns it into an Angular provider.\n *\n * @param path Base URL of your ImageKit images\n * This URL should match one of the following formats:\n * https://ik.imagekit.io/myaccount\n * https://subdomain.mysite.com\n * @param options An object with extra configuration:\n * - `ensurePreconnect`: boolean flag indicating whether the NgOptimizedImage directive\n * should verify that there is a corresponding ` `\n * present in the document's ``.\n * @returns Set of providers to configure the ImageKit loader.\n *\n * @publicApi\n * @developerPreview\n */\nconst provideImageKitLoader = createImageLoader(createImagekitUrl, ngDevMode ? ['https://ik.imagekit.io/mysite', 'https://subdomain.mysite.com'] : undefined);\nfunction createImagekitUrl(path, config) {\n // Example of an ImageKit image URL:\n // https://ik.imagekit.io/demo/tr:w-300,h-300/medium_cafe_B1iTdD0C.jpg\n let params = `tr:q-auto`; // applies the \"auto quality\" transformation\n if (config.width) {\n params += `,w-${config.width}`;\n }\n return `${path}/${params}/${config.src}`;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Function that generates an ImageLoader for Imgix and turns it into an Angular provider.\n *\n * @param path path to the desired Imgix origin,\n * e.g. https://somepath.imgix.net or https://images.mysite.com\n * @param options An object with extra configuration:\n * - `ensurePreconnect`: boolean flag indicating whether the NgOptimizedImage directive\n * should verify that there is a corresponding ` `\n * present in the document's ``.\n * @returns Set of providers to configure the Imgix loader.\n *\n * @publicApi\n * @developerPreview\n */\nconst provideImgixLoader = createImageLoader(createImgixUrl, ngDevMode ? ['https://somepath.imgix.net/'] : undefined);\nfunction createImgixUrl(path, config) {\n const url = new URL(`${path}/${config.src}`);\n // This setting ensures the smallest allowable format is set.\n url.searchParams.set('auto', 'format');\n if (config.width) {\n url.searchParams.set('w', config.width.toString());\n }\n return url.href;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Observer that detects whether an image with `NgOptimizedImage`\n * is treated as a Largest Contentful Paint (LCP) element. If so,\n * asserts that the image has the `priority` attribute.\n *\n * Note: this is a dev-mode only class and it does not appear in prod bundles,\n * thus there is no `ngDevMode` use in the code.\n *\n * Based on https://web.dev/lcp/#measure-lcp-in-javascript.\n */\nclass LCPImageObserver {\n constructor() {\n // Map of full image URLs -> original `rawSrc` values.\n this.images = new Map();\n // Keep track of images for which `console.warn` was produced.\n this.alreadyWarned = new Set();\n this.window = null;\n this.observer = null;\n assertDevMode('LCP checker');\n const win = inject(DOCUMENT).defaultView;\n if (typeof win !== 'undefined' && typeof PerformanceObserver !== 'undefined') {\n this.window = win;\n this.observer = this.initPerformanceObserver();\n }\n }\n /**\n * Inits PerformanceObserver and subscribes to LCP events.\n * Based on https://web.dev/lcp/#measure-lcp-in-javascript\n */\n initPerformanceObserver() {\n const observer = new PerformanceObserver((entryList) => {\n var _a, _b;\n const entries = entryList.getEntries();\n if (entries.length === 0)\n return;\n // We use the latest entry produced by the `PerformanceObserver` as the best\n // signal on which element is actually an LCP one. As an example, the first image to load on\n // a page, by virtue of being the only thing on the page so far, is often a LCP candidate\n // and gets reported by PerformanceObserver, but isn't necessarily the LCP element.\n const lcpElement = entries[entries.length - 1];\n // Cast to `any` due to missing `element` on the `LargestContentfulPaint` type of entry.\n // See https://developer.mozilla.org/en-US/docs/Web/API/LargestContentfulPaint\n const imgSrc = (_b = (_a = lcpElement.element) === null || _a === void 0 ? void 0 : _a.src) !== null && _b !== void 0 ? _b : '';\n // Exclude `data:` and `blob:` URLs, since they are not supported by the directive.\n if (imgSrc.startsWith('data:') || imgSrc.startsWith('blob:'))\n return;\n const imgRawSrc = this.images.get(imgSrc);\n if (imgRawSrc && !this.alreadyWarned.has(imgSrc)) {\n this.alreadyWarned.add(imgSrc);\n logMissingPriorityWarning(imgSrc);\n }\n });\n observer.observe({ type: 'largest-contentful-paint', buffered: true });\n return observer;\n }\n registerImage(rewrittenSrc, rawSrc) {\n if (!this.observer)\n return;\n this.images.set(getUrl(rewrittenSrc, this.window).href, rawSrc);\n }\n unregisterImage(rewrittenSrc) {\n if (!this.observer)\n return;\n this.images.delete(getUrl(rewrittenSrc, this.window).href);\n }\n ngOnDestroy() {\n if (!this.observer)\n return;\n this.observer.disconnect();\n this.images.clear();\n this.alreadyWarned.clear();\n }\n}\nLCPImageObserver.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: LCPImageObserver, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nLCPImageObserver.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: LCPImageObserver, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: LCPImageObserver, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return []; } });\nfunction logMissingPriorityWarning(rawSrc) {\n const directiveDetails = imgDirectiveDetails(rawSrc);\n console.warn(ɵformatRuntimeError(2955 /* RuntimeErrorCode.LCP_IMG_MISSING_PRIORITY */, `${directiveDetails} this image is the Largest Contentful Paint (LCP) ` +\n `element but was not marked \"priority\". This image should be marked ` +\n `\"priority\" in order to prioritize its loading. ` +\n `To fix this, add the \"priority\" attribute.`));\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * When a Base64-encoded image is passed as an input to the `NgOptimizedImage` directive,\n * an error is thrown. The image content (as a string) might be very long, thus making\n * it hard to read an error message if the entire string is included. This const defines\n * the number of characters that should be included into the error message. The rest\n * of the content is truncated.\n */\nconst BASE64_IMG_MAX_LENGTH_IN_ERROR = 50;\n/**\n * RegExpr to determine whether a src in a srcset is using width descriptors.\n * Should match something like: \"100w, 200w\".\n */\nconst VALID_WIDTH_DESCRIPTOR_SRCSET = /^((\\s*\\d+w\\s*(,|$)){1,})$/;\n/**\n * RegExpr to determine whether a src in a srcset is using density descriptors.\n * Should match something like: \"1x, 2x, 50x\". Also supports decimals like \"1.5x, 1.50x\".\n */\nconst VALID_DENSITY_DESCRIPTOR_SRCSET = /^((\\s*\\d+(\\.\\d+)?x\\s*(,|$)){1,})$/;\n/**\n * Srcset values with a density descriptor higher than this value will actively\n * throw an error. Such densities are not permitted as they cause image sizes\n * to be unreasonably large and slow down LCP.\n */\nconst ABSOLUTE_SRCSET_DENSITY_CAP = 3;\n/**\n * Used only in error message text to communicate best practices, as we will\n * only throw based on the slightly more conservative ABSOLUTE_SRCSET_DENSITY_CAP.\n */\nconst RECOMMENDED_SRCSET_DENSITY_CAP = 2;\n/**\n * Used to determine whether two aspect ratios are similar in value.\n */\nconst ASPECT_RATIO_TOLERANCE = .1;\n/**\n * Used to determine whether the image has been requested at an overly\n * large size compared to the actual rendered image size (after taking\n * into account a typical device pixel ratio). In pixels.\n */\nconst OVERSIZED_IMAGE_TOLERANCE = 1000;\n/**\n * Directive that improves image loading performance by enforcing best practices.\n *\n * `NgOptimizedImage` ensures that the loading of the Largest Contentful Paint (LCP) image is\n * prioritized by:\n * - Automatically setting the `fetchpriority` attribute on the ` ` tag\n * - Lazy loading non-priority images by default\n * - Asserting that there is a corresponding preconnect link tag in the document head\n *\n * In addition, the directive:\n * - Generates appropriate asset URLs if a corresponding `ImageLoader` function is provided\n * - Requires that `width` and `height` are set\n * - Warns if `width` or `height` have been set incorrectly\n * - Warns if the image will be visually distorted when rendered\n *\n * @usageNotes\n * The `NgOptimizedImage` directive is marked as [standalone](guide/standalone-components) and can\n * be imported directly.\n *\n * Follow the steps below to enable and use the directive:\n * 1. Import it into the necessary NgModule or a standalone Component.\n * 2. Optionally provide an `ImageLoader` if you use an image hosting service.\n * 3. Update the necessary ` ` tags in templates and replace `src` attributes with `rawSrc`.\n * Using a `rawSrc` allows the directive to control when the `src` gets set, which triggers an image\n * download.\n *\n * Step 1: import the `NgOptimizedImage` directive.\n *\n * ```typescript\n * import { NgOptimizedImage } from '@angular/common';\n *\n * // Include it into the necessary NgModule\n * @NgModule({\n * imports: [NgOptimizedImage],\n * })\n * class AppModule {}\n *\n * // ... or a standalone Component\n * @Component({\n * standalone: true\n * imports: [NgOptimizedImage],\n * })\n * class MyStandaloneComponent {}\n * ```\n *\n * Step 2: configure a loader.\n *\n * To use the **default loader**: no additional code changes are necessary. The URL returned by the\n * generic loader will always match the value of \"src\". In other words, this loader applies no\n * transformations to the resource URL and the value of the `rawSrc` attribute will be used as is.\n *\n * To use an existing loader for a **third-party image service**: add the provider factory for your\n * chosen service to the `providers` array. In the example below, the Imgix loader is used:\n *\n * ```typescript\n * import {provideImgixLoader} from '@angular/common';\n *\n * // Call the function and add the result to the `providers` array:\n * providers: [\n * provideImgixLoader(\"https://my.base.url/\"),\n * ],\n * ```\n *\n * The `NgOptimizedImage` directive provides the following functions:\n * - `provideCloudflareLoader`\n * - `provideCloudinaryLoader`\n * - `provideImageKitLoader`\n * - `provideImgixLoader`\n *\n * If you use a different image provider, you can create a custom loader function as described\n * below.\n *\n * To use a **custom loader**: provide your loader function as a value for the `IMAGE_LOADER` DI\n * token.\n *\n * ```typescript\n * import {IMAGE_LOADER, ImageLoaderConfig} from '@angular/common';\n *\n * // Configure the loader using the `IMAGE_LOADER` token.\n * providers: [\n * {\n * provide: IMAGE_LOADER,\n * useValue: (config: ImageLoaderConfig) => {\n * return `https://example.com/${config.src}-${config.width}.jpg}`;\n * }\n * },\n * ],\n * ```\n *\n * Step 3: update ` ` tags in templates to use `rawSrc` instead of `src`.\n *\n * ```\n * \n * ```\n *\n * @publicApi\n * @developerPreview\n */\nclass NgOptimizedImage {\n constructor() {\n this.imageLoader = inject(IMAGE_LOADER);\n this.renderer = inject(Renderer2);\n this.imgElement = inject(ElementRef).nativeElement;\n this.injector = inject(Injector);\n // a LCP image observer - should be injected only in the dev mode\n this.lcpObserver = ngDevMode ? this.injector.get(LCPImageObserver) : null;\n /**\n * Calculate the rewritten `src` once and store it.\n * This is needed to avoid repetitive calculations and make sure the directive cleanup in the\n * `ngOnDestroy` does not rely on the `IMAGE_LOADER` logic (which in turn can rely on some other\n * instance that might be already destroyed).\n */\n this._renderedSrc = null;\n this._priority = false;\n }\n /**\n * The intrinsic width of the image in pixels.\n */\n set width(value) {\n ngDevMode && assertGreaterThanZero(this, value, 'width');\n this._width = inputToInteger(value);\n }\n get width() {\n return this._width;\n }\n /**\n * The intrinsic height of the image in pixels.\n */\n set height(value) {\n ngDevMode && assertGreaterThanZero(this, value, 'height');\n this._height = inputToInteger(value);\n }\n get height() {\n return this._height;\n }\n /**\n * Indicates whether this image should have a high priority.\n */\n set priority(value) {\n this._priority = inputToBoolean(value);\n }\n get priority() {\n return this._priority;\n }\n ngOnInit() {\n if (ngDevMode) {\n assertNonEmptyInput(this, 'rawSrc', this.rawSrc);\n assertValidRawSrcset(this, this.rawSrcset);\n assertNoConflictingSrc(this);\n assertNoConflictingSrcset(this);\n assertNotBase64Image(this);\n assertNotBlobUrl(this);\n assertNonEmptyWidthAndHeight(this);\n assertValidLoadingInput(this);\n assertNoImageDistortion(this, this.imgElement, this.renderer);\n if (this.priority) {\n const checker = this.injector.get(PreconnectLinkChecker);\n checker.assertPreconnect(this.getRewrittenSrc(), this.rawSrc);\n }\n else {\n // Monitor whether an image is an LCP element only in case\n // the `priority` attribute is missing. Otherwise, an image\n // has the necessary settings and no extra checks are required.\n if (this.lcpObserver !== null) {\n const ngZone = this.injector.get(NgZone);\n ngZone.runOutsideAngular(() => {\n this.lcpObserver.registerImage(this.getRewrittenSrc(), this.rawSrc);\n });\n }\n }\n }\n this.setHostAttributes();\n }\n setHostAttributes() {\n // Must set width/height explicitly in case they are bound (in which case they will\n // only be reflected and not found by the browser)\n this.setHostAttribute('width', this.width.toString());\n this.setHostAttribute('height', this.height.toString());\n this.setHostAttribute('loading', this.getLoadingBehavior());\n this.setHostAttribute('fetchpriority', this.getFetchPriority());\n // The `src` and `srcset` attributes should be set last since other attributes\n // could affect the image's loading behavior.\n this.setHostAttribute('src', this.getRewrittenSrc());\n if (this.rawSrcset) {\n this.setHostAttribute('srcset', this.getRewrittenSrcset());\n }\n }\n ngOnChanges(changes) {\n if (ngDevMode) {\n assertNoPostInitInputChange(this, changes, ['rawSrc', 'rawSrcset', 'width', 'height', 'priority']);\n }\n }\n getLoadingBehavior() {\n if (!this.priority && this.loading !== undefined) {\n return this.loading;\n }\n return this.priority ? 'eager' : 'lazy';\n }\n getFetchPriority() {\n return this.priority ? 'high' : 'auto';\n }\n getRewrittenSrc() {\n // ImageLoaderConfig supports setting a width property. However, we're not setting width here\n // because if the developer uses rendered width instead of intrinsic width in the HTML width\n // attribute, the image requested may be too small for 2x+ screens.\n if (!this._renderedSrc) {\n const imgConfig = { src: this.rawSrc };\n // Cache calculated image src to reuse it later in the code.\n this._renderedSrc = this.imageLoader(imgConfig);\n }\n return this._renderedSrc;\n }\n getRewrittenSrcset() {\n const widthSrcSet = VALID_WIDTH_DESCRIPTOR_SRCSET.test(this.rawSrcset);\n const finalSrcs = this.rawSrcset.split(',').filter(src => src !== '').map(srcStr => {\n srcStr = srcStr.trim();\n const width = widthSrcSet ? parseFloat(srcStr) : parseFloat(srcStr) * this.width;\n return `${this.imageLoader({ src: this.rawSrc, width })} ${srcStr}`;\n });\n return finalSrcs.join(', ');\n }\n ngOnDestroy() {\n if (ngDevMode) {\n if (!this.priority && this._renderedSrc !== null && this.lcpObserver !== null) {\n this.lcpObserver.unregisterImage(this._renderedSrc);\n }\n }\n }\n setHostAttribute(name, value) {\n this.renderer.setAttribute(this.imgElement, name, value);\n }\n}\nNgOptimizedImage.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NgOptimizedImage, deps: [], target: i0.ɵɵFactoryTarget.Directive });\nNgOptimizedImage.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"14.2.0\", type: NgOptimizedImage, isStandalone: true, selector: \"img[rawSrc]\", inputs: { rawSrc: \"rawSrc\", rawSrcset: \"rawSrcset\", width: \"width\", height: \"height\", loading: \"loading\", priority: \"priority\", src: \"src\", srcset: \"srcset\" }, usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NgOptimizedImage, decorators: [{\n type: Directive,\n args: [{\n standalone: true,\n selector: 'img[rawSrc]',\n }]\n }], propDecorators: { rawSrc: [{\n type: Input\n }], rawSrcset: [{\n type: Input\n }], width: [{\n type: Input\n }], height: [{\n type: Input\n }], loading: [{\n type: Input\n }], priority: [{\n type: Input\n }], src: [{\n type: Input\n }], srcset: [{\n type: Input\n }] } });\n/***** Helpers *****/\n/**\n * Convert input value to integer.\n */\nfunction inputToInteger(value) {\n return typeof value === 'string' ? parseInt(value, 10) : value;\n}\n/**\n * Convert input value to boolean.\n */\nfunction inputToBoolean(value) {\n return value != null && `${value}` !== 'false';\n}\n/***** Assert functions *****/\n/**\n * Verifies that there is no `src` set on a host element.\n */\nfunction assertNoConflictingSrc(dir) {\n if (dir.src) {\n throw new ɵRuntimeError(2950 /* RuntimeErrorCode.UNEXPECTED_SRC_ATTR */, `${imgDirectiveDetails(dir.rawSrc)} both \\`src\\` and \\`rawSrc\\` have been set. ` +\n `Supplying both of these attributes breaks lazy loading. ` +\n `The NgOptimizedImage directive sets \\`src\\` itself based on the value of \\`rawSrc\\`. ` +\n `To fix this, please remove the \\`src\\` attribute.`);\n }\n}\n/**\n * Verifies that there is no `srcset` set on a host element.\n */\nfunction assertNoConflictingSrcset(dir) {\n if (dir.srcset) {\n throw new ɵRuntimeError(2951 /* RuntimeErrorCode.UNEXPECTED_SRCSET_ATTR */, `${imgDirectiveDetails(dir.rawSrc)} both \\`srcset\\` and \\`rawSrcset\\` have been set. ` +\n `Supplying both of these attributes breaks lazy loading. ` +\n `The NgOptimizedImage directive sets \\`srcset\\` itself based on the value of ` +\n `\\`rawSrcset\\`. To fix this, please remove the \\`srcset\\` attribute.`);\n }\n}\n/**\n * Verifies that the `rawSrc` is not a Base64-encoded image.\n */\nfunction assertNotBase64Image(dir) {\n let rawSrc = dir.rawSrc.trim();\n if (rawSrc.startsWith('data:')) {\n if (rawSrc.length > BASE64_IMG_MAX_LENGTH_IN_ERROR) {\n rawSrc = rawSrc.substring(0, BASE64_IMG_MAX_LENGTH_IN_ERROR) + '...';\n }\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.rawSrc, false)} \\`rawSrc\\` is a Base64-encoded string ` +\n `(${rawSrc}). NgOptimizedImage does not support Base64-encoded strings. ` +\n `To fix this, disable the NgOptimizedImage directive for this element ` +\n `by removing \\`rawSrc\\` and using a standard \\`src\\` attribute instead.`);\n }\n}\n/**\n * Verifies that the `rawSrc` is not a Blob URL.\n */\nfunction assertNotBlobUrl(dir) {\n const rawSrc = dir.rawSrc.trim();\n if (rawSrc.startsWith('blob:')) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.rawSrc)} \\`rawSrc\\` was set to a blob URL (${rawSrc}). ` +\n `Blob URLs are not supported by the NgOptimizedImage directive. ` +\n `To fix this, disable the NgOptimizedImage directive for this element ` +\n `by removing \\`rawSrc\\` and using a regular \\`src\\` attribute instead.`);\n }\n}\n/**\n * Verifies that the input is set to a non-empty string.\n */\nfunction assertNonEmptyInput(dir, name, value) {\n const isString = typeof value === 'string';\n const isEmptyString = isString && value.trim() === '';\n if (!isString || isEmptyString) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.rawSrc)} \\`${name}\\` has an invalid value ` +\n `(\\`${value}\\`). To fix this, change the value to a non-empty string.`);\n }\n}\n/**\n * Verifies that the `rawSrcset` is in a valid format, e.g. \"100w, 200w\" or \"1x, 2x\".\n */\nfunction assertValidRawSrcset(dir, value) {\n if (value == null)\n return;\n assertNonEmptyInput(dir, 'rawSrcset', value);\n const stringVal = value;\n const isValidWidthDescriptor = VALID_WIDTH_DESCRIPTOR_SRCSET.test(stringVal);\n const isValidDensityDescriptor = VALID_DENSITY_DESCRIPTOR_SRCSET.test(stringVal);\n if (isValidDensityDescriptor) {\n assertUnderDensityCap(dir, stringVal);\n }\n const isValidSrcset = isValidWidthDescriptor || isValidDensityDescriptor;\n if (!isValidSrcset) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.rawSrc)} \\`rawSrcset\\` has an invalid value (\\`${value}\\`). ` +\n `To fix this, supply \\`rawSrcset\\` using a comma-separated list of one or more width ` +\n `descriptors (e.g. \"100w, 200w\") or density descriptors (e.g. \"1x, 2x\").`);\n }\n}\nfunction assertUnderDensityCap(dir, value) {\n const underDensityCap = value.split(',').every(num => num === '' || parseFloat(num) <= ABSOLUTE_SRCSET_DENSITY_CAP);\n if (!underDensityCap) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.rawSrc)} the \\`rawSrcset\\` contains an unsupported image density:` +\n `\\`${value}\\`. NgOptimizedImage generally recommends a max image density of ` +\n `${RECOMMENDED_SRCSET_DENSITY_CAP}x but supports image densities up to ` +\n `${ABSOLUTE_SRCSET_DENSITY_CAP}x. The human eye cannot distinguish between image densities ` +\n `greater than ${RECOMMENDED_SRCSET_DENSITY_CAP}x - which makes them unnecessary for ` +\n `most use cases. Images that will be pinch-zoomed are typically the primary use case for ` +\n `${ABSOLUTE_SRCSET_DENSITY_CAP}x images. Please remove the high density descriptor and try again.`);\n }\n}\n/**\n * Creates a `RuntimeError` instance to represent a situation when an input is set after\n * the directive has initialized.\n */\nfunction postInitInputChangeError(dir, inputName) {\n return new ɵRuntimeError(2953 /* RuntimeErrorCode.UNEXPECTED_INPUT_CHANGE */, `${imgDirectiveDetails(dir.rawSrc)} \\`${inputName}\\` was updated after initialization. ` +\n `The NgOptimizedImage directive will not react to this input change. ` +\n `To fix this, switch \\`${inputName}\\` a static value or wrap the image element ` +\n `in an *ngIf that is gated on the necessary value.`);\n}\n/**\n * Verify that none of the listed inputs has changed.\n */\nfunction assertNoPostInitInputChange(dir, changes, inputs) {\n inputs.forEach(input => {\n const isUpdated = changes.hasOwnProperty(input);\n if (isUpdated && !changes[input].isFirstChange()) {\n if (input === 'rawSrc') {\n // When the `rawSrc` input changes, we detect that only in the\n // `ngOnChanges` hook, thus the `rawSrc` is already set. We use\n // `rawSrc` in the error message, so we use a previous value, but\n // not the updated one in it.\n dir = { rawSrc: changes[input].previousValue };\n }\n throw postInitInputChangeError(dir, input);\n }\n });\n}\n/**\n * Verifies that a specified input is a number greater than 0.\n */\nfunction assertGreaterThanZero(dir, inputValue, inputName) {\n const validNumber = typeof inputValue === 'number' && inputValue > 0;\n const validString = typeof inputValue === 'string' && /^\\d+$/.test(inputValue.trim()) && parseInt(inputValue) > 0;\n if (!validNumber && !validString) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.rawSrc)} \\`${inputName}\\` has an invalid value ` +\n `(\\`${inputValue}\\`). To fix this, provide \\`${inputName}\\` ` +\n `as a number greater than 0.`);\n }\n}\n/**\n * Verifies that the rendered image is not visually distorted. Effectively this is checking:\n * - Whether the \"width\" and \"height\" attributes reflect the actual dimensions of the image.\n * - Whether image styling is \"correct\" (see below for a longer explanation).\n */\nfunction assertNoImageDistortion(dir, img, renderer) {\n const removeListenerFn = renderer.listen(img, 'load', () => {\n removeListenerFn();\n // TODO: `clientWidth`, `clientHeight`, `naturalWidth` and `naturalHeight`\n // are typed as number, but we run `parseFloat` (which accepts strings only).\n // Verify whether `parseFloat` is needed in the cases below.\n const renderedWidth = parseFloat(img.clientWidth);\n const renderedHeight = parseFloat(img.clientHeight);\n const renderedAspectRatio = renderedWidth / renderedHeight;\n const nonZeroRenderedDimensions = renderedWidth !== 0 && renderedHeight !== 0;\n const intrinsicWidth = parseFloat(img.naturalWidth);\n const intrinsicHeight = parseFloat(img.naturalHeight);\n const intrinsicAspectRatio = intrinsicWidth / intrinsicHeight;\n const suppliedWidth = dir.width;\n const suppliedHeight = dir.height;\n const suppliedAspectRatio = suppliedWidth / suppliedHeight;\n // Tolerance is used to account for the impact of subpixel rendering.\n // Due to subpixel rendering, the rendered, intrinsic, and supplied\n // aspect ratios of a correctly configured image may not exactly match.\n // For example, a `width=4030 height=3020` image might have a rendered\n // size of \"1062w, 796.48h\". (An aspect ratio of 1.334... vs. 1.333...)\n const inaccurateDimensions = Math.abs(suppliedAspectRatio - intrinsicAspectRatio) > ASPECT_RATIO_TOLERANCE;\n const stylingDistortion = nonZeroRenderedDimensions &&\n Math.abs(intrinsicAspectRatio - renderedAspectRatio) > ASPECT_RATIO_TOLERANCE;\n if (inaccurateDimensions) {\n console.warn(ɵformatRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.rawSrc)} the aspect ratio of the image does not match ` +\n `the aspect ratio indicated by the width and height attributes. ` +\n `Intrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h ` +\n `(aspect-ratio: ${intrinsicAspectRatio}). Supplied width and height attributes: ` +\n `${suppliedWidth}w x ${suppliedHeight}h (aspect-ratio: ${suppliedAspectRatio}). ` +\n `To fix this, update the width and height attributes.`));\n }\n else if (stylingDistortion) {\n console.warn(ɵformatRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.rawSrc)} the aspect ratio of the rendered image ` +\n `does not match the image's intrinsic aspect ratio. ` +\n `Intrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h ` +\n `(aspect-ratio: ${intrinsicAspectRatio}). Rendered image size: ` +\n `${renderedWidth}w x ${renderedHeight}h (aspect-ratio: ` +\n `${renderedAspectRatio}). This issue can occur if \"width\" and \"height\" ` +\n `attributes are added to an image without updating the corresponding ` +\n `image styling. To fix this, adjust image styling. In most cases, ` +\n `adding \"height: auto\" or \"width: auto\" to the image styling will fix ` +\n `this issue.`));\n }\n else if (!dir.rawSrcset && nonZeroRenderedDimensions) {\n // If `rawSrcset` hasn't been set, sanity check the intrinsic size.\n const recommendedWidth = RECOMMENDED_SRCSET_DENSITY_CAP * renderedWidth;\n const recommendedHeight = RECOMMENDED_SRCSET_DENSITY_CAP * renderedHeight;\n const oversizedWidth = (intrinsicWidth - recommendedWidth) >= OVERSIZED_IMAGE_TOLERANCE;\n const oversizedHeight = (intrinsicHeight - recommendedHeight) >= OVERSIZED_IMAGE_TOLERANCE;\n if (oversizedWidth || oversizedHeight) {\n console.warn(ɵformatRuntimeError(2960 /* RuntimeErrorCode.OVERSIZED_IMAGE */, `${imgDirectiveDetails(dir.rawSrc)} the intrinsic image is significantly ` +\n `larger than necessary. ` +\n `\\nRendered image size: ${renderedWidth}w x ${renderedHeight}h. ` +\n `\\nIntrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h. ` +\n `\\nRecommended intrinsic image size: ${recommendedWidth}w x ${recommendedHeight}h. ` +\n `\\nNote: Recommended intrinsic image size is calculated assuming a maximum DPR of ` +\n `${RECOMMENDED_SRCSET_DENSITY_CAP}. To improve loading time, resize the image ` +\n `or consider using the \"rawSrcset\" and \"sizes\" attributes.`));\n }\n }\n });\n}\n/**\n * Verifies that a specified input is set.\n */\nfunction assertNonEmptyWidthAndHeight(dir) {\n let missingAttributes = [];\n if (dir.width === undefined)\n missingAttributes.push('width');\n if (dir.height === undefined)\n missingAttributes.push('height');\n if (missingAttributes.length > 0) {\n throw new ɵRuntimeError(2954 /* RuntimeErrorCode.REQUIRED_INPUT_MISSING */, `${imgDirectiveDetails(dir.rawSrc)} these required attributes ` +\n `are missing: ${missingAttributes.map(attr => `\"${attr}\"`).join(', ')}. ` +\n `Including \"width\" and \"height\" attributes will prevent image-related layout shifts. ` +\n `To fix this, include \"width\" and \"height\" attributes on the image tag.`);\n }\n}\n/**\n * Verifies that the `loading` attribute is set to a valid input &\n * is not used on priority images.\n */\nfunction assertValidLoadingInput(dir) {\n if (dir.loading && dir.priority) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.rawSrc)} the \\`loading\\` attribute ` +\n `was used on an image that was marked \"priority\". ` +\n `Setting \\`loading\\` on priority images is not allowed ` +\n `because these images will always be eagerly loaded. ` +\n `To fix this, remove the “loading” attribute from the priority image.`);\n }\n const validInputs = ['auto', 'eager', 'lazy'];\n if (typeof dir.loading === 'string' && !validInputs.includes(dir.loading)) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.rawSrc)} the \\`loading\\` attribute ` +\n `has an invalid value (\\`${dir.loading}\\`). ` +\n `To fix this, provide a valid value (\"lazy\", \"eager\", or \"auto\").`);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// This file only reexports content of the `src` folder. Keep it that way.\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { APP_BASE_HREF, AsyncPipe, CommonModule, CurrencyPipe, DATE_PIPE_DEFAULT_TIMEZONE, DOCUMENT, DatePipe, DecimalPipe, FormStyle, FormatWidth, HashLocationStrategy, I18nPluralPipe, I18nSelectPipe, IMAGE_LOADER, JsonPipe, KeyValuePipe, LOCATION_INITIALIZED, Location, LocationStrategy, LowerCasePipe, NgClass, NgComponentOutlet, NgForOf, NgForOfContext, NgIf, NgIfContext, NgLocaleLocalization, NgLocalization, NgOptimizedImage, NgPlural, NgPluralCase, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgTemplateOutlet, NumberFormatStyle, NumberSymbol, PRECONNECT_CHECK_BLOCKLIST, PathLocationStrategy, PercentPipe, PlatformLocation, Plural, SlicePipe, TitleCasePipe, TranslationWidth, UpperCasePipe, VERSION, ViewportScroller, WeekDay, XhrFactory, formatCurrency, formatDate, formatNumber, formatPercent, getCurrencySymbol, getLocaleCurrencyCode, getLocaleCurrencyName, getLocaleCurrencySymbol, getLocaleDateFormat, getLocaleDateTimeFormat, getLocaleDayNames, getLocaleDayPeriods, getLocaleDirection, getLocaleEraNames, getLocaleExtraDayPeriodRules, getLocaleExtraDayPeriods, getLocaleFirstDayOfWeek, getLocaleId, getLocaleMonthNames, getLocaleNumberFormat, getLocaleNumberSymbol, getLocalePluralCase, getLocaleTimeFormat, getLocaleWeekEndRange, getNumberOfCurrencyDigits, isPlatformBrowser, isPlatformServer, isPlatformWorkerApp, isPlatformWorkerUi, provideCloudflareLoader, provideCloudinaryLoader, provideImageKitLoader, provideImgixLoader, registerLocaleData, BrowserPlatformLocation as ɵBrowserPlatformLocation, DomAdapter as ɵDomAdapter, NullViewportScroller as ɵNullViewportScroller, PLATFORM_BROWSER_ID as ɵPLATFORM_BROWSER_ID, PLATFORM_SERVER_ID as ɵPLATFORM_SERVER_ID, PLATFORM_WORKER_APP_ID as ɵPLATFORM_WORKER_APP_ID, PLATFORM_WORKER_UI_ID as ɵPLATFORM_WORKER_UI_ID, getDOM as ɵgetDOM, parseCookieValue as ɵparseCookieValue, setRootDomAdapter as ɵsetRootDomAdapter };\n","/**\n * @license Angular v14.2.0\n * (c) 2010-2022 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport * as i1 from '@angular/common';\nimport { DOCUMENT, ɵparseCookieValue, XhrFactory as XhrFactory$1 } from '@angular/common';\nimport * as i0 from '@angular/core';\nimport { Injectable, InjectionToken, Inject, PLATFORM_ID, NgModule } from '@angular/core';\nimport { of, Observable } from 'rxjs';\nimport { concatMap, filter, map } from 'rxjs/operators';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Transforms an `HttpRequest` into a stream of `HttpEvent`s, one of which will likely be a\n * `HttpResponse`.\n *\n * `HttpHandler` is injectable. When injected, the handler instance dispatches requests to the\n * first interceptor in the chain, which dispatches to the second, etc, eventually reaching the\n * `HttpBackend`.\n *\n * In an `HttpInterceptor`, the `HttpHandler` parameter is the next interceptor in the chain.\n *\n * @publicApi\n */\nclass HttpHandler {\n}\n/**\n * A final `HttpHandler` which will dispatch the request via browser HTTP APIs to a backend.\n *\n * Interceptors sit between the `HttpClient` interface and the `HttpBackend`.\n *\n * When injected, `HttpBackend` dispatches requests directly to the backend, without going\n * through the interceptor chain.\n *\n * @publicApi\n */\nclass HttpBackend {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Represents the header configuration options for an HTTP request.\n * Instances are immutable. Modifying methods return a cloned\n * instance with the change. The original object is never changed.\n *\n * @publicApi\n */\nclass HttpHeaders {\n /** Constructs a new HTTP header object with the given values.*/\n constructor(headers) {\n /**\n * Internal map of lowercased header names to the normalized\n * form of the name (the form seen first).\n */\n this.normalizedNames = new Map();\n /**\n * Queued updates to be materialized the next initialization.\n */\n this.lazyUpdate = null;\n if (!headers) {\n this.headers = new Map();\n }\n else if (typeof headers === 'string') {\n this.lazyInit = () => {\n this.headers = new Map();\n headers.split('\\n').forEach(line => {\n const index = line.indexOf(':');\n if (index > 0) {\n const name = line.slice(0, index);\n const key = name.toLowerCase();\n const value = line.slice(index + 1).trim();\n this.maybeSetNormalizedName(name, key);\n if (this.headers.has(key)) {\n this.headers.get(key).push(value);\n }\n else {\n this.headers.set(key, [value]);\n }\n }\n });\n };\n }\n else {\n this.lazyInit = () => {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n assertValidHeaders(headers);\n }\n this.headers = new Map();\n Object.keys(headers).forEach(name => {\n let values = headers[name];\n const key = name.toLowerCase();\n if (typeof values === 'string') {\n values = [values];\n }\n if (values.length > 0) {\n this.headers.set(key, values);\n this.maybeSetNormalizedName(name, key);\n }\n });\n };\n }\n }\n /**\n * Checks for existence of a given header.\n *\n * @param name The header name to check for existence.\n *\n * @returns True if the header exists, false otherwise.\n */\n has(name) {\n this.init();\n return this.headers.has(name.toLowerCase());\n }\n /**\n * Retrieves the first value of a given header.\n *\n * @param name The header name.\n *\n * @returns The value string if the header exists, null otherwise\n */\n get(name) {\n this.init();\n const values = this.headers.get(name.toLowerCase());\n return values && values.length > 0 ? values[0] : null;\n }\n /**\n * Retrieves the names of the headers.\n *\n * @returns A list of header names.\n */\n keys() {\n this.init();\n return Array.from(this.normalizedNames.values());\n }\n /**\n * Retrieves a list of values for a given header.\n *\n * @param name The header name from which to retrieve values.\n *\n * @returns A string of values if the header exists, null otherwise.\n */\n getAll(name) {\n this.init();\n return this.headers.get(name.toLowerCase()) || null;\n }\n /**\n * Appends a new value to the existing set of values for a header\n * and returns them in a clone of the original instance.\n *\n * @param name The header name for which to append the values.\n * @param value The value to append.\n *\n * @returns A clone of the HTTP headers object with the value appended to the given header.\n */\n append(name, value) {\n return this.clone({ name, value, op: 'a' });\n }\n /**\n * Sets or modifies a value for a given header in a clone of the original instance.\n * If the header already exists, its value is replaced with the given value\n * in the returned object.\n *\n * @param name The header name.\n * @param value The value or values to set or override for the given header.\n *\n * @returns A clone of the HTTP headers object with the newly set header value.\n */\n set(name, value) {\n return this.clone({ name, value, op: 's' });\n }\n /**\n * Deletes values for a given header in a clone of the original instance.\n *\n * @param name The header name.\n * @param value The value or values to delete for the given header.\n *\n * @returns A clone of the HTTP headers object with the given value deleted.\n */\n delete(name, value) {\n return this.clone({ name, value, op: 'd' });\n }\n maybeSetNormalizedName(name, lcName) {\n if (!this.normalizedNames.has(lcName)) {\n this.normalizedNames.set(lcName, name);\n }\n }\n init() {\n if (!!this.lazyInit) {\n if (this.lazyInit instanceof HttpHeaders) {\n this.copyFrom(this.lazyInit);\n }\n else {\n this.lazyInit();\n }\n this.lazyInit = null;\n if (!!this.lazyUpdate) {\n this.lazyUpdate.forEach(update => this.applyUpdate(update));\n this.lazyUpdate = null;\n }\n }\n }\n copyFrom(other) {\n other.init();\n Array.from(other.headers.keys()).forEach(key => {\n this.headers.set(key, other.headers.get(key));\n this.normalizedNames.set(key, other.normalizedNames.get(key));\n });\n }\n clone(update) {\n const clone = new HttpHeaders();\n clone.lazyInit =\n (!!this.lazyInit && this.lazyInit instanceof HttpHeaders) ? this.lazyInit : this;\n clone.lazyUpdate = (this.lazyUpdate || []).concat([update]);\n return clone;\n }\n applyUpdate(update) {\n const key = update.name.toLowerCase();\n switch (update.op) {\n case 'a':\n case 's':\n let value = update.value;\n if (typeof value === 'string') {\n value = [value];\n }\n if (value.length === 0) {\n return;\n }\n this.maybeSetNormalizedName(update.name, key);\n const base = (update.op === 'a' ? this.headers.get(key) : undefined) || [];\n base.push(...value);\n this.headers.set(key, base);\n break;\n case 'd':\n const toDelete = update.value;\n if (!toDelete) {\n this.headers.delete(key);\n this.normalizedNames.delete(key);\n }\n else {\n let existing = this.headers.get(key);\n if (!existing) {\n return;\n }\n existing = existing.filter(value => toDelete.indexOf(value) === -1);\n if (existing.length === 0) {\n this.headers.delete(key);\n this.normalizedNames.delete(key);\n }\n else {\n this.headers.set(key, existing);\n }\n }\n break;\n }\n }\n /**\n * @internal\n */\n forEach(fn) {\n this.init();\n Array.from(this.normalizedNames.keys())\n .forEach(key => fn(this.normalizedNames.get(key), this.headers.get(key)));\n }\n}\n/**\n * Verifies that the headers object has the right shape: the values\n * must be either strings or arrays. Throws an error if an invalid\n * header value is present.\n */\nfunction assertValidHeaders(headers) {\n for (const [key, value] of Object.entries(headers)) {\n if (typeof value !== 'string' && !Array.isArray(value)) {\n throw new Error(`Unexpected value of the \\`${key}\\` header provided. ` +\n `Expecting either a string or an array, but got: \\`${value}\\`.`);\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Provides encoding and decoding of URL parameter and query-string values.\n *\n * Serializes and parses URL parameter keys and values to encode and decode them.\n * If you pass URL query parameters without encoding,\n * the query parameters can be misinterpreted at the receiving end.\n *\n *\n * @publicApi\n */\nclass HttpUrlEncodingCodec {\n /**\n * Encodes a key name for a URL parameter or query-string.\n * @param key The key name.\n * @returns The encoded key name.\n */\n encodeKey(key) {\n return standardEncoding(key);\n }\n /**\n * Encodes the value of a URL parameter or query-string.\n * @param value The value.\n * @returns The encoded value.\n */\n encodeValue(value) {\n return standardEncoding(value);\n }\n /**\n * Decodes an encoded URL parameter or query-string key.\n * @param key The encoded key name.\n * @returns The decoded key name.\n */\n decodeKey(key) {\n return decodeURIComponent(key);\n }\n /**\n * Decodes an encoded URL parameter or query-string value.\n * @param value The encoded value.\n * @returns The decoded value.\n */\n decodeValue(value) {\n return decodeURIComponent(value);\n }\n}\nfunction paramParser(rawParams, codec) {\n const map = new Map();\n if (rawParams.length > 0) {\n // The `window.location.search` can be used while creating an instance of the `HttpParams` class\n // (e.g. `new HttpParams({ fromString: window.location.search })`). The `window.location.search`\n // may start with the `?` char, so we strip it if it's present.\n const params = rawParams.replace(/^\\?/, '').split('&');\n params.forEach((param) => {\n const eqIdx = param.indexOf('=');\n const [key, val] = eqIdx == -1 ?\n [codec.decodeKey(param), ''] :\n [codec.decodeKey(param.slice(0, eqIdx)), codec.decodeValue(param.slice(eqIdx + 1))];\n const list = map.get(key) || [];\n list.push(val);\n map.set(key, list);\n });\n }\n return map;\n}\n/**\n * Encode input string with standard encodeURIComponent and then un-encode specific characters.\n */\nconst STANDARD_ENCODING_REGEX = /%(\\d[a-f0-9])/gi;\nconst STANDARD_ENCODING_REPLACEMENTS = {\n '40': '@',\n '3A': ':',\n '24': '$',\n '2C': ',',\n '3B': ';',\n '3D': '=',\n '3F': '?',\n '2F': '/',\n};\nfunction standardEncoding(v) {\n return encodeURIComponent(v).replace(STANDARD_ENCODING_REGEX, (s, t) => { var _a; return (_a = STANDARD_ENCODING_REPLACEMENTS[t]) !== null && _a !== void 0 ? _a : s; });\n}\nfunction valueToString(value) {\n return `${value}`;\n}\n/**\n * An HTTP request/response body that represents serialized parameters,\n * per the MIME type `application/x-www-form-urlencoded`.\n *\n * This class is immutable; all mutation operations return a new instance.\n *\n * @publicApi\n */\nclass HttpParams {\n constructor(options = {}) {\n this.updates = null;\n this.cloneFrom = null;\n this.encoder = options.encoder || new HttpUrlEncodingCodec();\n if (!!options.fromString) {\n if (!!options.fromObject) {\n throw new Error(`Cannot specify both fromString and fromObject.`);\n }\n this.map = paramParser(options.fromString, this.encoder);\n }\n else if (!!options.fromObject) {\n this.map = new Map();\n Object.keys(options.fromObject).forEach(key => {\n const value = options.fromObject[key];\n // convert the values to strings\n const values = Array.isArray(value) ? value.map(valueToString) : [valueToString(value)];\n this.map.set(key, values);\n });\n }\n else {\n this.map = null;\n }\n }\n /**\n * Reports whether the body includes one or more values for a given parameter.\n * @param param The parameter name.\n * @returns True if the parameter has one or more values,\n * false if it has no value or is not present.\n */\n has(param) {\n this.init();\n return this.map.has(param);\n }\n /**\n * Retrieves the first value for a parameter.\n * @param param The parameter name.\n * @returns The first value of the given parameter,\n * or `null` if the parameter is not present.\n */\n get(param) {\n this.init();\n const res = this.map.get(param);\n return !!res ? res[0] : null;\n }\n /**\n * Retrieves all values for a parameter.\n * @param param The parameter name.\n * @returns All values in a string array,\n * or `null` if the parameter not present.\n */\n getAll(param) {\n this.init();\n return this.map.get(param) || null;\n }\n /**\n * Retrieves all the parameters for this body.\n * @returns The parameter names in a string array.\n */\n keys() {\n this.init();\n return Array.from(this.map.keys());\n }\n /**\n * Appends a new value to existing values for a parameter.\n * @param param The parameter name.\n * @param value The new value to add.\n * @return A new body with the appended value.\n */\n append(param, value) {\n return this.clone({ param, value, op: 'a' });\n }\n /**\n * Constructs a new body with appended values for the given parameter name.\n * @param params parameters and values\n * @return A new body with the new value.\n */\n appendAll(params) {\n const updates = [];\n Object.keys(params).forEach(param => {\n const value = params[param];\n if (Array.isArray(value)) {\n value.forEach(_value => {\n updates.push({ param, value: _value, op: 'a' });\n });\n }\n else {\n updates.push({ param, value: value, op: 'a' });\n }\n });\n return this.clone(updates);\n }\n /**\n * Replaces the value for a parameter.\n * @param param The parameter name.\n * @param value The new value.\n * @return A new body with the new value.\n */\n set(param, value) {\n return this.clone({ param, value, op: 's' });\n }\n /**\n * Removes a given value or all values from a parameter.\n * @param param The parameter name.\n * @param value The value to remove, if provided.\n * @return A new body with the given value removed, or with all values\n * removed if no value is specified.\n */\n delete(param, value) {\n return this.clone({ param, value, op: 'd' });\n }\n /**\n * Serializes the body to an encoded string, where key-value pairs (separated by `=`) are\n * separated by `&`s.\n */\n toString() {\n this.init();\n return this.keys()\n .map(key => {\n const eKey = this.encoder.encodeKey(key);\n // `a: ['1']` produces `'a=1'`\n // `b: []` produces `''`\n // `c: ['1', '2']` produces `'c=1&c=2'`\n return this.map.get(key).map(value => eKey + '=' + this.encoder.encodeValue(value))\n .join('&');\n })\n // filter out empty values because `b: []` produces `''`\n // which results in `a=1&&c=1&c=2` instead of `a=1&c=1&c=2` if we don't\n .filter(param => param !== '')\n .join('&');\n }\n clone(update) {\n const clone = new HttpParams({ encoder: this.encoder });\n clone.cloneFrom = this.cloneFrom || this;\n clone.updates = (this.updates || []).concat(update);\n return clone;\n }\n init() {\n if (this.map === null) {\n this.map = new Map();\n }\n if (this.cloneFrom !== null) {\n this.cloneFrom.init();\n this.cloneFrom.keys().forEach(key => this.map.set(key, this.cloneFrom.map.get(key)));\n this.updates.forEach(update => {\n switch (update.op) {\n case 'a':\n case 's':\n const base = (update.op === 'a' ? this.map.get(update.param) : undefined) || [];\n base.push(valueToString(update.value));\n this.map.set(update.param, base);\n break;\n case 'd':\n if (update.value !== undefined) {\n let base = this.map.get(update.param) || [];\n const idx = base.indexOf(valueToString(update.value));\n if (idx !== -1) {\n base.splice(idx, 1);\n }\n if (base.length > 0) {\n this.map.set(update.param, base);\n }\n else {\n this.map.delete(update.param);\n }\n }\n else {\n this.map.delete(update.param);\n break;\n }\n }\n });\n this.cloneFrom = this.updates = null;\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A token used to manipulate and access values stored in `HttpContext`.\n *\n * @publicApi\n */\nclass HttpContextToken {\n constructor(defaultValue) {\n this.defaultValue = defaultValue;\n }\n}\n/**\n * Http context stores arbitrary user defined values and ensures type safety without\n * actually knowing the types. It is backed by a `Map` and guarantees that keys do not clash.\n *\n * This context is mutable and is shared between cloned requests unless explicitly specified.\n *\n * @usageNotes\n *\n * ### Usage Example\n *\n * ```typescript\n * // inside cache.interceptors.ts\n * export const IS_CACHE_ENABLED = new HttpContextToken(() => false);\n *\n * export class CacheInterceptor implements HttpInterceptor {\n *\n * intercept(req: HttpRequest, delegate: HttpHandler): Observable> {\n * if (req.context.get(IS_CACHE_ENABLED) === true) {\n * return ...;\n * }\n * return delegate.handle(req);\n * }\n * }\n *\n * // inside a service\n *\n * this.httpClient.get('/api/weather', {\n * context: new HttpContext().set(IS_CACHE_ENABLED, true)\n * }).subscribe(...);\n * ```\n *\n * @publicApi\n */\nclass HttpContext {\n constructor() {\n this.map = new Map();\n }\n /**\n * Store a value in the context. If a value is already present it will be overwritten.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n * @param value The value to store.\n *\n * @returns A reference to itself for easy chaining.\n */\n set(token, value) {\n this.map.set(token, value);\n return this;\n }\n /**\n * Retrieve the value associated with the given token.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n *\n * @returns The stored value or default if one is defined.\n */\n get(token) {\n if (!this.map.has(token)) {\n this.map.set(token, token.defaultValue());\n }\n return this.map.get(token);\n }\n /**\n * Delete the value associated with the given token.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n *\n * @returns A reference to itself for easy chaining.\n */\n delete(token) {\n this.map.delete(token);\n return this;\n }\n /**\n * Checks for existence of a given token.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n *\n * @returns True if the token exists, false otherwise.\n */\n has(token) {\n return this.map.has(token);\n }\n /**\n * @returns a list of tokens currently stored in the context.\n */\n keys() {\n return this.map.keys();\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Determine whether the given HTTP method may include a body.\n */\nfunction mightHaveBody(method) {\n switch (method) {\n case 'DELETE':\n case 'GET':\n case 'HEAD':\n case 'OPTIONS':\n case 'JSONP':\n return false;\n default:\n return true;\n }\n}\n/**\n * Safely assert whether the given value is an ArrayBuffer.\n *\n * In some execution environments ArrayBuffer is not defined.\n */\nfunction isArrayBuffer(value) {\n return typeof ArrayBuffer !== 'undefined' && value instanceof ArrayBuffer;\n}\n/**\n * Safely assert whether the given value is a Blob.\n *\n * In some execution environments Blob is not defined.\n */\nfunction isBlob(value) {\n return typeof Blob !== 'undefined' && value instanceof Blob;\n}\n/**\n * Safely assert whether the given value is a FormData instance.\n *\n * In some execution environments FormData is not defined.\n */\nfunction isFormData(value) {\n return typeof FormData !== 'undefined' && value instanceof FormData;\n}\n/**\n * Safely assert whether the given value is a URLSearchParams instance.\n *\n * In some execution environments URLSearchParams is not defined.\n */\nfunction isUrlSearchParams(value) {\n return typeof URLSearchParams !== 'undefined' && value instanceof URLSearchParams;\n}\n/**\n * An outgoing HTTP request with an optional typed body.\n *\n * `HttpRequest` represents an outgoing request, including URL, method,\n * headers, body, and other request configuration options. Instances should be\n * assumed to be immutable. To modify a `HttpRequest`, the `clone`\n * method should be used.\n *\n * @publicApi\n */\nclass HttpRequest {\n constructor(method, url, third, fourth) {\n this.url = url;\n /**\n * The request body, or `null` if one isn't set.\n *\n * Bodies are not enforced to be immutable, as they can include a reference to any\n * user-defined data type. However, interceptors should take care to preserve\n * idempotence by treating them as such.\n */\n this.body = null;\n /**\n * Whether this request should be made in a way that exposes progress events.\n *\n * Progress events are expensive (change detection runs on each event) and so\n * they should only be requested if the consumer intends to monitor them.\n */\n this.reportProgress = false;\n /**\n * Whether this request should be sent with outgoing credentials (cookies).\n */\n this.withCredentials = false;\n /**\n * The expected response type of the server.\n *\n * This is used to parse the response appropriately before returning it to\n * the requestee.\n */\n this.responseType = 'json';\n this.method = method.toUpperCase();\n // Next, need to figure out which argument holds the HttpRequestInit\n // options, if any.\n let options;\n // Check whether a body argument is expected. The only valid way to omit\n // the body argument is to use a known no-body method like GET.\n if (mightHaveBody(this.method) || !!fourth) {\n // Body is the third argument, options are the fourth.\n this.body = (third !== undefined) ? third : null;\n options = fourth;\n }\n else {\n // No body required, options are the third argument. The body stays null.\n options = third;\n }\n // If options have been passed, interpret them.\n if (options) {\n // Normalize reportProgress and withCredentials.\n this.reportProgress = !!options.reportProgress;\n this.withCredentials = !!options.withCredentials;\n // Override default response type of 'json' if one is provided.\n if (!!options.responseType) {\n this.responseType = options.responseType;\n }\n // Override headers if they're provided.\n if (!!options.headers) {\n this.headers = options.headers;\n }\n if (!!options.context) {\n this.context = options.context;\n }\n if (!!options.params) {\n this.params = options.params;\n }\n }\n // If no headers have been passed in, construct a new HttpHeaders instance.\n if (!this.headers) {\n this.headers = new HttpHeaders();\n }\n // If no context have been passed in, construct a new HttpContext instance.\n if (!this.context) {\n this.context = new HttpContext();\n }\n // If no parameters have been passed in, construct a new HttpUrlEncodedParams instance.\n if (!this.params) {\n this.params = new HttpParams();\n this.urlWithParams = url;\n }\n else {\n // Encode the parameters to a string in preparation for inclusion in the URL.\n const params = this.params.toString();\n if (params.length === 0) {\n // No parameters, the visible URL is just the URL given at creation time.\n this.urlWithParams = url;\n }\n else {\n // Does the URL already have query parameters? Look for '?'.\n const qIdx = url.indexOf('?');\n // There are 3 cases to handle:\n // 1) No existing parameters -> append '?' followed by params.\n // 2) '?' exists and is followed by existing query string ->\n // append '&' followed by params.\n // 3) '?' exists at the end of the url -> append params directly.\n // This basically amounts to determining the character, if any, with\n // which to join the URL and parameters.\n const sep = qIdx === -1 ? '?' : (qIdx < url.length - 1 ? '&' : '');\n this.urlWithParams = url + sep + params;\n }\n }\n }\n /**\n * Transform the free-form body into a serialized format suitable for\n * transmission to the server.\n */\n serializeBody() {\n // If no body is present, no need to serialize it.\n if (this.body === null) {\n return null;\n }\n // Check whether the body is already in a serialized form. If so,\n // it can just be returned directly.\n if (isArrayBuffer(this.body) || isBlob(this.body) || isFormData(this.body) ||\n isUrlSearchParams(this.body) || typeof this.body === 'string') {\n return this.body;\n }\n // Check whether the body is an instance of HttpUrlEncodedParams.\n if (this.body instanceof HttpParams) {\n return this.body.toString();\n }\n // Check whether the body is an object or array, and serialize with JSON if so.\n if (typeof this.body === 'object' || typeof this.body === 'boolean' ||\n Array.isArray(this.body)) {\n return JSON.stringify(this.body);\n }\n // Fall back on toString() for everything else.\n return this.body.toString();\n }\n /**\n * Examine the body and attempt to infer an appropriate MIME type\n * for it.\n *\n * If no such type can be inferred, this method will return `null`.\n */\n detectContentTypeHeader() {\n // An empty body has no content type.\n if (this.body === null) {\n return null;\n }\n // FormData bodies rely on the browser's content type assignment.\n if (isFormData(this.body)) {\n return null;\n }\n // Blobs usually have their own content type. If it doesn't, then\n // no type can be inferred.\n if (isBlob(this.body)) {\n return this.body.type || null;\n }\n // Array buffers have unknown contents and thus no type can be inferred.\n if (isArrayBuffer(this.body)) {\n return null;\n }\n // Technically, strings could be a form of JSON data, but it's safe enough\n // to assume they're plain strings.\n if (typeof this.body === 'string') {\n return 'text/plain';\n }\n // `HttpUrlEncodedParams` has its own content-type.\n if (this.body instanceof HttpParams) {\n return 'application/x-www-form-urlencoded;charset=UTF-8';\n }\n // Arrays, objects, boolean and numbers will be encoded as JSON.\n if (typeof this.body === 'object' || typeof this.body === 'number' ||\n typeof this.body === 'boolean') {\n return 'application/json';\n }\n // No type could be inferred.\n return null;\n }\n clone(update = {}) {\n var _a;\n // For method, url, and responseType, take the current value unless\n // it is overridden in the update hash.\n const method = update.method || this.method;\n const url = update.url || this.url;\n const responseType = update.responseType || this.responseType;\n // The body is somewhat special - a `null` value in update.body means\n // whatever current body is present is being overridden with an empty\n // body, whereas an `undefined` value in update.body implies no\n // override.\n const body = (update.body !== undefined) ? update.body : this.body;\n // Carefully handle the boolean options to differentiate between\n // `false` and `undefined` in the update args.\n const withCredentials = (update.withCredentials !== undefined) ? update.withCredentials : this.withCredentials;\n const reportProgress = (update.reportProgress !== undefined) ? update.reportProgress : this.reportProgress;\n // Headers and params may be appended to if `setHeaders` or\n // `setParams` are used.\n let headers = update.headers || this.headers;\n let params = update.params || this.params;\n // Pass on context if needed\n const context = (_a = update.context) !== null && _a !== void 0 ? _a : this.context;\n // Check whether the caller has asked to add headers.\n if (update.setHeaders !== undefined) {\n // Set every requested header.\n headers =\n Object.keys(update.setHeaders)\n .reduce((headers, name) => headers.set(name, update.setHeaders[name]), headers);\n }\n // Check whether the caller has asked to set params.\n if (update.setParams) {\n // Set every requested param.\n params = Object.keys(update.setParams)\n .reduce((params, param) => params.set(param, update.setParams[param]), params);\n }\n // Finally, construct the new HttpRequest using the pieces from above.\n return new HttpRequest(method, url, body, {\n params,\n headers,\n context,\n reportProgress,\n responseType,\n withCredentials,\n });\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Type enumeration for the different kinds of `HttpEvent`.\n *\n * @publicApi\n */\nvar HttpEventType;\n(function (HttpEventType) {\n /**\n * The request was sent out over the wire.\n */\n HttpEventType[HttpEventType[\"Sent\"] = 0] = \"Sent\";\n /**\n * An upload progress event was received.\n */\n HttpEventType[HttpEventType[\"UploadProgress\"] = 1] = \"UploadProgress\";\n /**\n * The response status code and headers were received.\n */\n HttpEventType[HttpEventType[\"ResponseHeader\"] = 2] = \"ResponseHeader\";\n /**\n * A download progress event was received.\n */\n HttpEventType[HttpEventType[\"DownloadProgress\"] = 3] = \"DownloadProgress\";\n /**\n * The full response including the body was received.\n */\n HttpEventType[HttpEventType[\"Response\"] = 4] = \"Response\";\n /**\n * A custom event from an interceptor or a backend.\n */\n HttpEventType[HttpEventType[\"User\"] = 5] = \"User\";\n})(HttpEventType || (HttpEventType = {}));\n/**\n * Base class for both `HttpResponse` and `HttpHeaderResponse`.\n *\n * @publicApi\n */\nclass HttpResponseBase {\n /**\n * Super-constructor for all responses.\n *\n * The single parameter accepted is an initialization hash. Any properties\n * of the response passed there will override the default values.\n */\n constructor(init, defaultStatus = 200 /* HttpStatusCode.Ok */, defaultStatusText = 'OK') {\n // If the hash has values passed, use them to initialize the response.\n // Otherwise use the default values.\n this.headers = init.headers || new HttpHeaders();\n this.status = init.status !== undefined ? init.status : defaultStatus;\n this.statusText = init.statusText || defaultStatusText;\n this.url = init.url || null;\n // Cache the ok value to avoid defining a getter.\n this.ok = this.status >= 200 && this.status < 300;\n }\n}\n/**\n * A partial HTTP response which only includes the status and header data,\n * but no response body.\n *\n * `HttpHeaderResponse` is a `HttpEvent` available on the response\n * event stream, only when progress events are requested.\n *\n * @publicApi\n */\nclass HttpHeaderResponse extends HttpResponseBase {\n /**\n * Create a new `HttpHeaderResponse` with the given parameters.\n */\n constructor(init = {}) {\n super(init);\n this.type = HttpEventType.ResponseHeader;\n }\n /**\n * Copy this `HttpHeaderResponse`, overriding its contents with the\n * given parameter hash.\n */\n clone(update = {}) {\n // Perform a straightforward initialization of the new HttpHeaderResponse,\n // overriding the current parameters with new ones if given.\n return new HttpHeaderResponse({\n headers: update.headers || this.headers,\n status: update.status !== undefined ? update.status : this.status,\n statusText: update.statusText || this.statusText,\n url: update.url || this.url || undefined,\n });\n }\n}\n/**\n * A full HTTP response, including a typed response body (which may be `null`\n * if one was not returned).\n *\n * `HttpResponse` is a `HttpEvent` available on the response event\n * stream.\n *\n * @publicApi\n */\nclass HttpResponse extends HttpResponseBase {\n /**\n * Construct a new `HttpResponse`.\n */\n constructor(init = {}) {\n super(init);\n this.type = HttpEventType.Response;\n this.body = init.body !== undefined ? init.body : null;\n }\n clone(update = {}) {\n return new HttpResponse({\n body: (update.body !== undefined) ? update.body : this.body,\n headers: update.headers || this.headers,\n status: (update.status !== undefined) ? update.status : this.status,\n statusText: update.statusText || this.statusText,\n url: update.url || this.url || undefined,\n });\n }\n}\n/**\n * A response that represents an error or failure, either from a\n * non-successful HTTP status, an error while executing the request,\n * or some other failure which occurred during the parsing of the response.\n *\n * Any error returned on the `Observable` response stream will be\n * wrapped in an `HttpErrorResponse` to provide additional context about\n * the state of the HTTP layer when the error occurred. The error property\n * will contain either a wrapped Error object or the error response returned\n * from the server.\n *\n * @publicApi\n */\nclass HttpErrorResponse extends HttpResponseBase {\n constructor(init) {\n // Initialize with a default status of 0 / Unknown Error.\n super(init, 0, 'Unknown Error');\n this.name = 'HttpErrorResponse';\n /**\n * Errors are never okay, even when the status code is in the 2xx success range.\n */\n this.ok = false;\n // If the response was successful, then this was a parse error. Otherwise, it was\n // a protocol-level failure of some sort. Either the request failed in transit\n // or the server returned an unsuccessful status code.\n if (this.status >= 200 && this.status < 300) {\n this.message = `Http failure during parsing for ${init.url || '(unknown url)'}`;\n }\n else {\n this.message = `Http failure response for ${init.url || '(unknown url)'}: ${init.status} ${init.statusText}`;\n }\n this.error = init.error || null;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Constructs an instance of `HttpRequestOptions` from a source `HttpMethodOptions` and\n * the given `body`. This function clones the object and adds the body.\n *\n * Note that the `responseType` *options* value is a String that identifies the\n * single data type of the response.\n * A single overload version of the method handles each response type.\n * The value of `responseType` cannot be a union, as the combined signature could imply.\n *\n */\nfunction addBody(options, body) {\n return {\n body,\n headers: options.headers,\n context: options.context,\n observe: options.observe,\n params: options.params,\n reportProgress: options.reportProgress,\n responseType: options.responseType,\n withCredentials: options.withCredentials,\n };\n}\n/**\n * Performs HTTP requests.\n * This service is available as an injectable class, with methods to perform HTTP requests.\n * Each request method has multiple signatures, and the return type varies based on\n * the signature that is called (mainly the values of `observe` and `responseType`).\n *\n * Note that the `responseType` *options* value is a String that identifies the\n * single data type of the response.\n * A single overload version of the method handles each response type.\n * The value of `responseType` cannot be a union, as the combined signature could imply.\n\n *\n * @usageNotes\n * Sample HTTP requests for the [Tour of Heroes](/tutorial/toh-pt0) application.\n *\n * ### HTTP Request Example\n *\n * ```\n * // GET heroes whose name contains search term\n * searchHeroes(term: string): observable{\n *\n * const params = new HttpParams({fromString: 'name=term'});\n * return this.httpClient.request('GET', this.heroesUrl, {responseType:'json', params});\n * }\n * ```\n *\n * Alternatively, the parameter string can be used without invoking HttpParams\n * by directly joining to the URL.\n * ```\n * this.httpClient.request('GET', this.heroesUrl + '?' + 'name=term', {responseType:'json'});\n * ```\n *\n *\n * ### JSONP Example\n * ```\n * requestJsonp(url, callback = 'callback') {\n * return this.httpClient.jsonp(this.heroesURL, callback);\n * }\n * ```\n *\n * ### PATCH Example\n * ```\n * // PATCH one of the heroes' name\n * patchHero (id: number, heroName: string): Observable<{}> {\n * const url = `${this.heroesUrl}/${id}`; // PATCH api/heroes/42\n * return this.httpClient.patch(url, {name: heroName}, httpOptions)\n * .pipe(catchError(this.handleError('patchHero')));\n * }\n * ```\n *\n * @see [HTTP Guide](guide/http)\n * @see [HTTP Request](api/common/http/HttpRequest)\n *\n * @publicApi\n */\nclass HttpClient {\n constructor(handler) {\n this.handler = handler;\n }\n /**\n * Constructs an observable for a generic HTTP request that, when subscribed,\n * fires the request through the chain of registered interceptors and on to the\n * server.\n *\n * You can pass an `HttpRequest` directly as the only parameter. In this case,\n * the call returns an observable of the raw `HttpEvent` stream.\n *\n * Alternatively you can pass an HTTP method as the first parameter,\n * a URL string as the second, and an options hash containing the request body as the third.\n * See `addBody()`. In this case, the specified `responseType` and `observe` options determine the\n * type of returned observable.\n * * The `responseType` value determines how a successful response body is parsed.\n * * If `responseType` is the default `json`, you can pass a type interface for the resulting\n * object as a type parameter to the call.\n *\n * The `observe` value determines the return type, according to what you are interested in\n * observing.\n * * An `observe` value of events returns an observable of the raw `HttpEvent` stream, including\n * progress events by default.\n * * An `observe` value of response returns an observable of `HttpResponse`,\n * where the `T` parameter depends on the `responseType` and any optionally provided type\n * parameter.\n * * An `observe` value of body returns an observable of `` with the same `T` body type.\n *\n */\n request(first, url, options = {}) {\n let req;\n // First, check whether the primary argument is an instance of `HttpRequest`.\n if (first instanceof HttpRequest) {\n // It is. The other arguments must be undefined (per the signatures) and can be\n // ignored.\n req = first;\n }\n else {\n // It's a string, so it represents a URL. Construct a request based on it,\n // and incorporate the remaining arguments (assuming `GET` unless a method is\n // provided.\n // Figure out the headers.\n let headers = undefined;\n if (options.headers instanceof HttpHeaders) {\n headers = options.headers;\n }\n else {\n headers = new HttpHeaders(options.headers);\n }\n // Sort out parameters.\n let params = undefined;\n if (!!options.params) {\n if (options.params instanceof HttpParams) {\n params = options.params;\n }\n else {\n params = new HttpParams({ fromObject: options.params });\n }\n }\n // Construct the request.\n req = new HttpRequest(first, url, (options.body !== undefined ? options.body : null), {\n headers,\n context: options.context,\n params,\n reportProgress: options.reportProgress,\n // By default, JSON is assumed to be returned for all calls.\n responseType: options.responseType || 'json',\n withCredentials: options.withCredentials,\n });\n }\n // Start with an Observable.of() the initial request, and run the handler (which\n // includes all interceptors) inside a concatMap(). This way, the handler runs\n // inside an Observable chain, which causes interceptors to be re-run on every\n // subscription (this also makes retries re-run the handler, including interceptors).\n const events$ = of(req).pipe(concatMap((req) => this.handler.handle(req)));\n // If coming via the API signature which accepts a previously constructed HttpRequest,\n // the only option is to get the event stream. Otherwise, return the event stream if\n // that is what was requested.\n if (first instanceof HttpRequest || options.observe === 'events') {\n return events$;\n }\n // The requested stream contains either the full response or the body. In either\n // case, the first step is to filter the event stream to extract a stream of\n // responses(s).\n const res$ = events$.pipe(filter((event) => event instanceof HttpResponse));\n // Decide which stream to return.\n switch (options.observe || 'body') {\n case 'body':\n // The requested stream is the body. Map the response stream to the response\n // body. This could be done more simply, but a misbehaving interceptor might\n // transform the response body into a different format and ignore the requested\n // responseType. Guard against this by validating that the response is of the\n // requested type.\n switch (req.responseType) {\n case 'arraybuffer':\n return res$.pipe(map((res) => {\n // Validate that the body is an ArrayBuffer.\n if (res.body !== null && !(res.body instanceof ArrayBuffer)) {\n throw new Error('Response is not an ArrayBuffer.');\n }\n return res.body;\n }));\n case 'blob':\n return res$.pipe(map((res) => {\n // Validate that the body is a Blob.\n if (res.body !== null && !(res.body instanceof Blob)) {\n throw new Error('Response is not a Blob.');\n }\n return res.body;\n }));\n case 'text':\n return res$.pipe(map((res) => {\n // Validate that the body is a string.\n if (res.body !== null && typeof res.body !== 'string') {\n throw new Error('Response is not a string.');\n }\n return res.body;\n }));\n case 'json':\n default:\n // No validation needed for JSON responses, as they can be of any type.\n return res$.pipe(map((res) => res.body));\n }\n case 'response':\n // The response stream was requested directly, so return it.\n return res$;\n default:\n // Guard against new future observe types being added.\n throw new Error(`Unreachable: unhandled observe type ${options.observe}}`);\n }\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `DELETE` request to execute on the server. See the individual overloads for\n * details on the return type.\n *\n * @param url The endpoint URL.\n * @param options The HTTP options to send with the request.\n *\n */\n delete(url, options = {}) {\n return this.request('DELETE', url, options);\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `GET` request to execute on the server. See the individual overloads for\n * details on the return type.\n */\n get(url, options = {}) {\n return this.request('GET', url, options);\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `HEAD` request to execute on the server. The `HEAD` method returns\n * meta information about the resource without transferring the\n * resource itself. See the individual overloads for\n * details on the return type.\n */\n head(url, options = {}) {\n return this.request('HEAD', url, options);\n }\n /**\n * Constructs an `Observable` that, when subscribed, causes a request with the special method\n * `JSONP` to be dispatched via the interceptor pipeline.\n * The [JSONP pattern](https://en.wikipedia.org/wiki/JSONP) works around limitations of certain\n * API endpoints that don't support newer,\n * and preferable [CORS](https://developer.mozilla.org/en-US/docs/Web/HTTP/CORS) protocol.\n * JSONP treats the endpoint API as a JavaScript file and tricks the browser to process the\n * requests even if the API endpoint is not located on the same domain (origin) as the client-side\n * application making the request.\n * The endpoint API must support JSONP callback for JSONP requests to work.\n * The resource API returns the JSON response wrapped in a callback function.\n * You can pass the callback function name as one of the query parameters.\n * Note that JSONP requests can only be used with `GET` requests.\n *\n * @param url The resource URL.\n * @param callbackParam The callback function name.\n *\n */\n jsonp(url, callbackParam) {\n return this.request('JSONP', url, {\n params: new HttpParams().append(callbackParam, 'JSONP_CALLBACK'),\n observe: 'body',\n responseType: 'json',\n });\n }\n /**\n * Constructs an `Observable` that, when subscribed, causes the configured\n * `OPTIONS` request to execute on the server. This method allows the client\n * to determine the supported HTTP methods and other capabilities of an endpoint,\n * without implying a resource action. See the individual overloads for\n * details on the return type.\n */\n options(url, options = {}) {\n return this.request('OPTIONS', url, options);\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `PATCH` request to execute on the server. See the individual overloads for\n * details on the return type.\n */\n patch(url, body, options = {}) {\n return this.request('PATCH', url, addBody(options, body));\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `POST` request to execute on the server. The server responds with the location of\n * the replaced resource. See the individual overloads for\n * details on the return type.\n */\n post(url, body, options = {}) {\n return this.request('POST', url, addBody(options, body));\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `PUT` request to execute on the server. The `PUT` method replaces an existing resource\n * with a new set of values.\n * See the individual overloads for details on the return type.\n */\n put(url, body, options = {}) {\n return this.request('PUT', url, addBody(options, body));\n }\n}\nHttpClient.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: HttpClient, deps: [{ token: HttpHandler }], target: i0.ɵɵFactoryTarget.Injectable });\nHttpClient.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: HttpClient });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: HttpClient, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: HttpHandler }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * `HttpHandler` which applies an `HttpInterceptor` to an `HttpRequest`.\n *\n *\n */\nclass HttpInterceptorHandler {\n constructor(next, interceptor) {\n this.next = next;\n this.interceptor = interceptor;\n }\n handle(req) {\n return this.interceptor.intercept(req, this.next);\n }\n}\n/**\n * A multi-provider token that represents the array of registered\n * `HttpInterceptor` objects.\n *\n * @publicApi\n */\nconst HTTP_INTERCEPTORS = new InjectionToken('HTTP_INTERCEPTORS');\nclass NoopInterceptor {\n intercept(req, next) {\n return next.handle(req);\n }\n}\nNoopInterceptor.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NoopInterceptor, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nNoopInterceptor.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NoopInterceptor });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.0\", ngImport: i0, type: NoopInterceptor, decorators: [{\n type: Injectable\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Every request made through JSONP needs a callback name that's unique across the\n// whole page. Each request is assigned an id and the callback name is constructed\n// from that. The next id to be assigned is tracked in a global variable here that\n// is shared among all applications on the page.\nlet nextRequestId = 0;\n/**\n * When a pending